UA75874C2 - Grain lifter for a combine harvester - Google Patents
Grain lifter for a combine harvester Download PDFInfo
- Publication number
- UA75874C2 UA75874C2 UA2002053838A UA2002053838A UA75874C2 UA 75874 C2 UA75874 C2 UA 75874C2 UA 2002053838 A UA2002053838 A UA 2002053838A UA 2002053838 A UA2002053838 A UA 2002053838A UA 75874 C2 UA75874 C2 UA 75874C2
- Authority
- UA
- Ukraine
- Prior art keywords
- rail
- lifter
- mowing
- holder
- zone
- Prior art date
Links
- 239000000463 material Substances 0.000 abstract description 3
- 241001124569 Lycaenidae Species 0.000 abstract 1
- 238000005452 bending Methods 0.000 description 3
- 239000010902 straw Substances 0.000 description 3
- 239000002689 soil Substances 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 101100182248 Caenorhabditis elegans lat-2 gene Proteins 0.000 description 1
- 241001063191 Elops affinis Species 0.000 description 1
- 235000002756 Erythrina berteroana Nutrition 0.000 description 1
- 206010051602 Laziness Diseases 0.000 description 1
- 241000221535 Pucciniales Species 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- HKPHPIREJKHECO-UHFFFAOYSA-N butachlor Chemical compound CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000005489 elastic deformation Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01D—HARVESTING; MOWING
- A01D65/00—Grain-crop lifters
- A01D65/02—Lifting fingers
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Environmental Sciences (AREA)
- Harvester Elements (AREA)
- Outside Dividers And Delivering Mechanisms For Harvesters (AREA)
- Combines (AREA)
- Harvesting Machines For Root Crops (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10123248A DE10123248C1 (de) | 2001-05-12 | 2001-05-12 | Ährenheber für Erntemaschinenmähsysteme |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| UA75874C2 true UA75874C2 (en) | 2006-06-15 |
Family
ID=7684626
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| UA2002053838A UA75874C2 (en) | 2001-05-12 | 2002-05-10 | Grain lifter for a combine harvester |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US6708477B2 (OSRAM) |
| EP (1) | EP1256271B1 (OSRAM) |
| AT (1) | ATE310378T1 (OSRAM) |
| BR (1) | BR0201710A (OSRAM) |
| CA (1) | CA2385988C (OSRAM) |
| DE (2) | DE10123248C1 (OSRAM) |
| DK (1) | DK1256271T3 (OSRAM) |
| HU (1) | HU228241B1 (OSRAM) |
| RU (1) | RU2277321C2 (OSRAM) |
| UA (1) | UA75874C2 (OSRAM) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10113107B4 (de) * | 2001-03-15 | 2010-01-21 | Gebr. Schumacher Gerätebaugesellschaft mbH | Ährenheber für Erntemaschinenmähsysteme |
| US8539744B2 (en) | 2005-01-06 | 2013-09-24 | Dave Dietrich | Crop lifter and crop accessory attachment |
| WO2006072158A1 (en) * | 2005-01-06 | 2006-07-13 | Dave Dietrich | Crop lifter and crop accessory attachment |
| US20090183483A1 (en) * | 2006-10-02 | 2009-07-23 | Dave Dietrich | Crop lifter pans |
| CA2579398A1 (en) * | 2007-02-21 | 2008-08-21 | Ralph Mckay Industries Inc. | Crop lifting apparatus |
| US8196381B2 (en) * | 2008-02-04 | 2012-06-12 | Dave Dietrich | Crop lifter pans |
| CA2638565A1 (en) * | 2008-08-08 | 2010-02-08 | Dave Dietrich | Offset guard bolt attachment system |
| DE102009039670B9 (de) * | 2009-09-02 | 2011-07-14 | Gebr. Schumacher Gerätebaugesellschaft mbH, 57612 | Ährenheber |
| CA2748754C (en) * | 2011-08-11 | 2017-11-07 | Dave Dietrich | High rise crop lifter |
| DE102012100302A1 (de) * | 2012-01-13 | 2013-07-18 | Gebr. Schumacher Gerätebaugesellschaft mbH | Heber für Erntegut |
| ES2651992T3 (es) | 2015-06-12 | 2018-01-30 | Gebr. Schumacher Gerätebaugesellschaft mbH | Carril de soporte de un levantaespigas para cosechas |
| DE102016112052A1 (de) * | 2016-06-30 | 2018-01-04 | Claas Selbstfahrende Erntemaschinen Gmbh | Ährenheber |
| PL3732951T3 (pl) | 2019-04-30 | 2023-04-11 | SMF - Holding GmbH | Podbieracz do plonów |
| DE202019102446U1 (de) | 2019-04-30 | 2020-07-31 | SMF - Holding GmbH | Tragschiene eines Ährenhebers für Erntegut |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE191691C (OSRAM) * | 1906-07-20 | 1907-10-11 | ||
| US1862775A (en) * | 1928-11-28 | 1932-06-14 | Caterpillar Tractor Co | Pick-up guard adapter |
| DE1188853B (de) * | 1961-05-03 | 1965-03-11 | Reinhold Claas | AEhrenheber fuer insbesondere Maehdreschern zugeordnete Schneidwerke |
| DE1507366C3 (de) * | 1965-09-07 | 1974-03-14 | Gustav 5231 Eichelhardt Schumacher Ii | Ährenheber für Getreidemähwerke |
| US3579967A (en) * | 1968-09-18 | 1971-05-25 | Gustav Schumacher | Grain-lifter for grain-cutting assemblies |
| DE2142153C2 (de) * | 1971-03-08 | 1984-09-20 | Gustav Schumacher Ii | Gleitkufe für Mähwerke von Erntemaschinen |
| US3845832A (en) | 1971-12-06 | 1974-11-05 | Darf Corp | Power take-off connection |
| DE2232235A1 (de) * | 1972-06-30 | 1974-01-10 | Fahr Ag Maschf | Selbsttaetige maehtischverstellung fuer maehdrescher |
| DE2531435A1 (de) * | 1975-07-14 | 1977-02-03 | Schumacher | Aehrenheber fuer maehwerke von erntemaschinen |
| US4295328A (en) * | 1978-08-12 | 1981-10-20 | Schumacher Gustav | Holding means for grain lifters, support skids and the like |
| DE3300769A1 (de) * | 1983-01-12 | 1984-07-12 | Gustav Schumacher Ii | Aehrenheber fuer fingerbalkenmaehwerke von erntemaschinen |
| US4622840A (en) | 1983-06-20 | 1986-11-18 | Neapco, Inc. | Method for drawing telescoping tubes for torque transmission |
| SU1440413A1 (ru) * | 1986-12-19 | 1988-11-30 | Украинский научно-исследовательский институт механизации и электрификации сельского хозяйства | Стеблеподъемник уборочной машины |
| RU2045883C1 (ru) * | 1992-11-24 | 1995-10-20 | Всероссийский научно-исследовательский институт кормов им.В.Р.Вильямса | Стеблеподъемник |
| DE4323053C2 (de) * | 1993-07-12 | 1995-07-20 | Rasspe Soehne P | Haltevorrichtung an Ährenhebern für Mähbalken |
| DE4445634C2 (de) | 1994-12-21 | 1997-10-16 | Walterscheid Gmbh Gkn | Kupplung |
| US5681222A (en) | 1995-02-28 | 1997-10-28 | Weasler Engineering, Inc. | Torque overload clutch coupler for a torque transmitting driveline |
| AU2932399A (en) * | 1998-03-10 | 1999-09-27 | Gustav Ii Schumacher | Ear lifter |
| DE10113107B4 (de) * | 2001-03-15 | 2010-01-21 | Gebr. Schumacher Gerätebaugesellschaft mbH | Ährenheber für Erntemaschinenmähsysteme |
| DE10128101B4 (de) * | 2001-06-11 | 2005-04-14 | Gustav Schumacher | Ährenheber |
-
2001
- 2001-05-12 DE DE10123248A patent/DE10123248C1/de not_active Expired - Fee Related
-
2002
- 2002-02-08 AT AT02002832T patent/ATE310378T1/de not_active IP Right Cessation
- 2002-02-08 EP EP02002832A patent/EP1256271B1/de not_active Expired - Lifetime
- 2002-02-08 DK DK02002832T patent/DK1256271T3/da active
- 2002-02-08 DE DE50204994T patent/DE50204994D1/de not_active Expired - Lifetime
- 2002-05-07 US US10/139,903 patent/US6708477B2/en not_active Expired - Lifetime
- 2002-05-07 RU RU2002112356/12A patent/RU2277321C2/ru active
- 2002-05-10 HU HU0201596A patent/HU228241B1/hu unknown
- 2002-05-10 UA UA2002053838A patent/UA75874C2/uk unknown
- 2002-05-10 BR BR0201710-5A patent/BR0201710A/pt not_active Application Discontinuation
- 2002-05-13 CA CA002385988A patent/CA2385988C/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CA2385988A1 (en) | 2002-11-12 |
| DK1256271T3 (da) | 2006-04-03 |
| DE50204994D1 (de) | 2005-12-29 |
| CA2385988C (en) | 2009-11-03 |
| EP1256271A1 (de) | 2002-11-13 |
| HUP0201596A2 (hu) | 2003-08-28 |
| US20020166314A1 (en) | 2002-11-14 |
| HU0201596D0 (OSRAM) | 2002-07-29 |
| RU2277321C2 (ru) | 2006-06-10 |
| US6708477B2 (en) | 2004-03-23 |
| RU2002112356A (ru) | 2004-01-20 |
| ATE310378T1 (de) | 2005-12-15 |
| HUP0201596A3 (en) | 2004-06-28 |
| BR0201710A (pt) | 2003-03-25 |
| DE10123248C1 (de) | 2002-09-19 |
| EP1256271B1 (de) | 2005-11-23 |
| HU228241B1 (en) | 2013-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| UA75874C2 (en) | Grain lifter for a combine harvester | |
| EP3360438B1 (en) | Rigid cantilevered stud | |
| CA1056162A (en) | Cutterbar for a crop harvesting machine | |
| US2478664A (en) | Sandal | |
| AR071407A1 (es) | Soporte de correa draper y zapata deslizante integrados en una maquina cosechadora agricola | |
| EA200900772A1 (ru) | Секционная направляющая транспортерной ленты для полотенного транспортера в сельскохозяйственной уборочной машине | |
| US2087945A (en) | Antislipping device to be worn upon the human foot | |
| UA74812C2 (en) | Cutting mechanism for harvesters (variants) | |
| US4120138A (en) | Grain lifter for the cutter mechanisms of harvesters | |
| KR840008266A (ko) | 발가락 부상 방지용 운동화 | |
| US6244026B1 (en) | Crop lifter mechanism | |
| RU2222886C1 (ru) | Колосоподъемник для косилочных систем уборочных машин | |
| AU2010345716B2 (en) | Horseshoe with splaying feature and flexibility | |
| US1848518A (en) | Arch support | |
| ES2931030T3 (es) | Levantador de mies para cosecha | |
| US4997045A (en) | Horseshoe liner | |
| US748172A (en) | Skate. | |
| US11310958B2 (en) | Sickle guard counter-knife insert | |
| US1333409A (en) | Running-shoe | |
| US2293272A (en) | Sweep for cultivators | |
| JP3107988U (ja) | スパイク | |
| KR100986779B1 (ko) | 하체 고정용 스파이크 | |
| US912584A (en) | Adjustable arch-support. | |
| US1945122A (en) | Footwear | |
| EA044108B1 (ru) | Несущая шина колосоподъемника для сбора урожая |