SU713520A3 - Гербицидна композици - Google Patents
Гербицидна композици Download PDFInfo
- Publication number
- SU713520A3 SU713520A3 SU731898369A SU1898369A SU713520A3 SU 713520 A3 SU713520 A3 SU 713520A3 SU 731898369 A SU731898369 A SU 731898369A SU 1898369 A SU1898369 A SU 1898369A SU 713520 A3 SU713520 A3 SU 713520A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carbon atoms
- atoms
- halogen
- alkyl
- group
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 3
- 229910052736 halogen Inorganic materials 0.000 claims abstract 8
- 150000002367 halogens Chemical group 0.000 claims abstract 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract 6
- 239000001257 hydrogen Substances 0.000 claims abstract 5
- 150000001875 compounds Chemical class 0.000 claims abstract 4
- 125000003545 alkoxy group Chemical group 0.000 claims abstract 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims abstract 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 230000002363 herbicidal effect Effects 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 2
- 230000000996 additive effect Effects 0.000 claims description 2
- 239000002270 dispersing agent Substances 0.000 claims description 2
- 230000000694 effects Effects 0.000 claims description 2
- 239000003995 emulsifying agent Substances 0.000 claims description 2
- 239000002689 soil Substances 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 241001276440 Irodes Species 0.000 claims 1
- 101100490437 Mus musculus Acvrl1 gene Proteins 0.000 claims 1
- 125000003158 alcohol group Chemical group 0.000 claims 1
- 150000002170 ethers Chemical class 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 235000015250 liver sausages Nutrition 0.000 claims 1
- -1 carbalkoxy Chemical group 0.000 abstract description 3
- 239000004009 herbicide Substances 0.000 abstract description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 abstract 3
- 125000004953 trihalomethyl group Chemical group 0.000 abstract 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 2
- 150000002431 hydrogen Chemical group 0.000 abstract 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 abstract 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 abstract 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 125000003277 amino group Chemical group 0.000 abstract 1
- 125000005111 carboxyalkoxy group Chemical group 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 abstract 1
- 229910052801 chlorine Inorganic materials 0.000 abstract 1
- 125000001309 chloro group Chemical group Cl* 0.000 abstract 1
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 abstract 1
- 125000005113 hydroxyalkoxy group Chemical group 0.000 abstract 1
- 150000002989 phenols Chemical class 0.000 abstract 1
- 239000011591 potassium Substances 0.000 abstract 1
- 229910052700 potassium Inorganic materials 0.000 abstract 1
- 159000000000 sodium salts Chemical class 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- XUKUURHRXDUEBC-KAYWLYCHSA-N Atorvastatin Chemical compound C=1C=CC=CC=1C1=C(C=2C=CC(F)=CC=2)N(CC[C@@H](O)C[C@@H](O)CC(O)=O)C(C(C)C)=C1C(=O)NC1=CC=CC=C1 XUKUURHRXDUEBC-KAYWLYCHSA-N 0.000 description 1
- 101100005001 Caenorhabditis elegans cah-5 gene Proteins 0.000 description 1
- 241001137251 Corvidae Species 0.000 description 1
- 241000544051 Damasonium alisma Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 101100364835 Homo sapiens SALL1 gene Proteins 0.000 description 1
- 101150049532 SAL1 gene Proteins 0.000 description 1
- 102100037204 Sal-like protein 1 Human genes 0.000 description 1
- 101100117436 Thermus aquaticus polA gene Proteins 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000035606 childbirth Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/24—Ethers with hydroxy compounds containing no oxirane rings with polyhydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/11—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings
- C07C205/12—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings the six-membered aromatic ring or a condensed ring system containing that ring being substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/38—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to a carbon atom of a six-membered aromatic ring, e.g. nitrodiphenyl ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/39—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups
- C07C205/42—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/43—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/59—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/32—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C275/34—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C275/36—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with at least one of the oxygen atoms further bound to a carbon atom of a six-membered aromatic ring, e.g. N-aryloxyphenylureas
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/62—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by introduction of halogen; by substitution of halogen atoms by other halogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US23465172A | 1972-03-14 | 1972-03-14 | |
| US234656A US3888932A (en) | 1972-03-14 | 1972-03-14 | Herbicidal 4-trifluoromethyl-4-nitrodiphenyl ethers |
| US331719A US3928416A (en) | 1972-03-14 | 1973-02-12 | Herbicidal 4-trifluoromethyl-4{40 nitrodiphenyl ethers |
| US05/331,947 US4076741A (en) | 1972-03-14 | 1973-02-12 | Herbicidal 4-trifluoromethyl-4-nitrodiphenyl ethers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU713520A3 true SU713520A3 (ru) | 1980-01-30 |
Family
ID=27499755
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU731898369A SU713520A3 (ru) | 1972-03-14 | 1973-03-13 | Гербицидна композици |
Country Status (21)
| Country | Link |
|---|---|
| JP (1) | JPS5825641B2 (OSRAM) |
| AR (1) | AR208495A1 (OSRAM) |
| AU (1) | AU467605B2 (OSRAM) |
| CH (1) | CH567359A5 (OSRAM) |
| DK (1) | DK144561C (OSRAM) |
| FR (1) | FR2175997B1 (OSRAM) |
| GB (1) | GB1423376A (OSRAM) |
| HU (1) | HU172709B (OSRAM) |
| IE (1) | IE37575B1 (OSRAM) |
| IL (1) | IL41766A (OSRAM) |
| IN (1) | IN138701B (OSRAM) |
| IT (1) | IT983545B (OSRAM) |
| KE (1) | KE2734A (OSRAM) |
| LU (1) | LU67204A1 (OSRAM) |
| NL (1) | NL174825C (OSRAM) |
| OA (1) | OA04348A (OSRAM) |
| PH (1) | PH18682A (OSRAM) |
| RO (1) | RO77037A (OSRAM) |
| SE (1) | SE416544B (OSRAM) |
| SU (1) | SU713520A3 (OSRAM) |
| TR (1) | TR18291A (OSRAM) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE32243E (en) * | 1969-04-25 | 1986-09-09 | Rhone-Poulenc Agrochimie | Esters of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| USRE32216E (en) * | 1969-04-25 | 1986-07-29 | Rhone-Poulenc Agrochimie | Salts of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| USRE32215E (en) * | 1971-02-11 | 1986-07-22 | Rhone-Poulenc Agrochimie | Substituted phenoxybenzoic acids compositions of the same and herbicidal use thereof |
| JPS5436209B2 (OSRAM) * | 1972-10-24 | 1979-11-08 | ||
| EG11593A (en) * | 1973-07-03 | 1980-07-31 | Bayer Ag | Halogenated 4-trifluiromethyl-4-cyano-diphenyl-ethers process for their preparation and their use as herbicides |
| JPS5724761B2 (OSRAM) * | 1973-12-19 | 1982-05-26 | ||
| JPS5068800U (OSRAM) * | 1973-10-22 | 1975-06-19 | ||
| JPS50123824A (OSRAM) * | 1974-03-15 | 1975-09-29 | ||
| JPS50132125A (OSRAM) * | 1974-04-12 | 1975-10-20 | ||
| JPS5173126A (ja) * | 1974-12-23 | 1976-06-24 | Mitsui Toatsu Chemicals | Satsusozai |
| JPS545033A (en) * | 1977-06-15 | 1979-01-16 | Mitsui Toatsu Chem Inc | Herbicides |
| DE2938595A1 (de) * | 1979-09-24 | 1981-04-23 | Celamerck Gmbh & Co Kg, 6507 Ingelheim | Verfahren zur herstellung von diphenylaethern |
| DE2942930A1 (de) * | 1979-10-24 | 1981-05-27 | Basf Ag, 6700 Ludwigshafen | Substituierte harnstoffe, deren herstellung und verwendung als herbizide |
| DE3045805A1 (de) | 1980-12-05 | 1982-07-08 | Basf Ag, 6700 Ludwigshafen | Diphenylether, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| GB2105715B (en) * | 1981-08-07 | 1985-09-04 | Ciba Geigy Ag | Herbicidal phenoxyphenylamino acid derivatives |
| JP2801181B2 (ja) * | 1983-01-10 | 1998-09-21 | キヤノン株式会社 | シート反転装置 |
| FR2549047B1 (fr) * | 1983-07-12 | 1986-03-21 | Rhone Poulenc Agrochimie | Nouveaux herbicides derives d'acides aryloxybenzenes carbonimides |
| EP0161529B1 (en) * | 1984-05-18 | 1989-07-12 | Asahi Kasei Kogyo Kabushiki Kaisha | 2-nitro-5-(2'-chloro-4'trifluoromethylphenoxy)phenylacetic ester, thioester and amide, process for preparation therof, herbicidal composition, and method for destruction of undesirable weeds |
| HU193466B (en) * | 1984-11-12 | 1987-10-28 | Budapesti Vegyimuevek | Fungicidal composition comprising 2-nitrobenzoic acid derivative as active substance |
| JPS63157065U (OSRAM) * | 1987-04-02 | 1988-10-14 | ||
| IL133454A0 (en) * | 1998-12-23 | 2001-04-30 | Rohm & Haas | Preparation of diphenylethers |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1602719A (en) * | 1968-11-22 | 1971-01-18 | Herbicidal diphenylether/pheny urea compos - ition |
-
1973
- 1973-02-27 SE SE7302765A patent/SE416544B/xx unknown
- 1973-03-13 LU LU67204A patent/LU67204A1/xx unknown
- 1973-03-13 PH PH14420A patent/PH18682A/en unknown
- 1973-03-13 FR FR7308925A patent/FR2175997B1/fr not_active Expired
- 1973-03-13 OA OA54853A patent/OA04348A/xx unknown
- 1973-03-13 IL IL41766A patent/IL41766A/en unknown
- 1973-03-13 DK DK136973A patent/DK144561C/da not_active IP Right Cessation
- 1973-03-13 AR AR247014A patent/AR208495A1/es active
- 1973-03-13 CH CH363173A patent/CH567359A5/xx not_active IP Right Cessation
- 1973-03-13 HU HU73RO00000709A patent/HU172709B/hu unknown
- 1973-03-13 GB GB1195473A patent/GB1423376A/en not_active Expired
- 1973-03-13 SU SU731898369A patent/SU713520A3/ru active
- 1973-03-14 NL NLAANVRAGE7303590,A patent/NL174825C/xx not_active IP Right Cessation
- 1973-03-14 RO RO7374159A patent/RO77037A/ro unknown
- 1973-03-14 IT IT21605/73A patent/IT983545B/it active
- 1973-03-14 JP JP48029896A patent/JPS5825641B2/ja not_active Expired
- 1973-03-14 TR TR18291A patent/TR18291A/xx unknown
- 1973-03-14 AU AU53289/73A patent/AU467605B2/en not_active Expired
- 1973-03-14 IE IE415/73A patent/IE37575B1/xx unknown
- 1973-03-16 IN IN598/CAL/73A patent/IN138701B/en unknown
-
1977
- 1977-05-11 KE KE2734A patent/KE2734A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HU172709B (hu) | 1978-11-28 |
| FR2175997A1 (OSRAM) | 1973-10-26 |
| AU5328973A (en) | 1974-09-19 |
| IL41766A (en) | 1977-04-29 |
| FR2175997B1 (OSRAM) | 1977-02-04 |
| DK144561B (da) | 1982-03-29 |
| CH567359A5 (OSRAM) | 1975-10-15 |
| JPS5825641B2 (ja) | 1983-05-28 |
| SE416544B (sv) | 1981-01-19 |
| IE37575B1 (en) | 1977-08-31 |
| IT983545B (it) | 1974-11-11 |
| LU67204A1 (OSRAM) | 1973-09-14 |
| IN138701B (OSRAM) | 1976-03-20 |
| GB1423376A (en) | 1976-02-04 |
| NL174825C (nl) | 1984-08-16 |
| IE37575L (en) | 1973-09-14 |
| TR18291A (tr) | 1976-12-28 |
| IL41766A0 (en) | 1973-05-31 |
| NL7303590A (OSRAM) | 1973-09-18 |
| RO77037A (ro) | 1981-08-30 |
| JPS49236A (OSRAM) | 1974-01-05 |
| AR208495A1 (es) | 1977-02-15 |
| PH18682A (en) | 1985-08-29 |
| KE2734A (en) | 1977-05-27 |
| OA04348A (fr) | 1980-01-31 |
| NL174825B (nl) | 1984-03-16 |
| AU467605B2 (en) | 1975-12-04 |
| DK144561C (da) | 1982-09-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU713520A3 (ru) | Гербицидна композици | |
| SU1276243A3 (ru) | Гербицидное средство | |
| US2319481A (en) | Antiseptic | |
| US3189428A (en) | Method for inhibiting plant growth | |
| SU552010A3 (ru) | Гербицидное средство | |
| PL129545B1 (en) | Pesticide | |
| SU740141A3 (ru) | Гербицидна композици | |
| HU191024B (en) | Herbicide compositions containing diphenyl-ether derivatives as active substances and process for preparing the active substances | |
| GB1253377A (en) | Improvements in or relating to 1,5-substituted indazoles and their use as biocides | |
| FR2367056A1 (fr) | Compositions biocides a base de derives aryles d'hydrazone pour lutter contre les maladies des plantes | |
| SU843695A3 (ru) | Гербицидна композици | |
| RU2236134C1 (ru) | Гербицидный состав для борьбы с нежелательной растительностью в посевах зерновых культур | |
| US4364767A (en) | N(Carboxymethyl-N-(phosphonomethyl)-5-(2-chloro-4-trifluoromethyl phenoxy)-2-nitrobenzamide and salts thereof | |
| GB1052308A (OSRAM) | ||
| JP2000290112A (ja) | 工業用抗菌剤組成物及びそれを用いた抗菌方法 | |
| SU747398A3 (ru) | Гербицидна композици | |
| SU657726A3 (ru) | Гербицидна композици | |
| US3890385A (en) | Dichlorobenzaldehyde-oxime-carbonates | |
| CN116172003B (zh) | 一种含有解毒喹的绿色除草剂及其制备工艺 | |
| US3408426A (en) | O, o-diisopropyl-ethylsulfinylmethyldithiophosphate | |
| GB1419882A (en) | Herbicides | |
| FR2437167A1 (fr) | Composition herbicide et procede pour la lutte contre les mauvaises herbes utilisant cette composition | |
| US2272525A (en) | Embalming composition | |
| US3577545A (en) | N-tetrahaloethylthio pyrazoles as bactericides and fungicides | |
| Tayal et al. | Phytotoxicity of two nematicides, oxamyl and EDB, and its interaction with GA3 on the process of germination and amylase activity in Solanum melongena L. |