SU655308A3 - Способ получени производных 11-дезоксипростагландина - Google Patents
Способ получени производных 11-дезоксипростагландинаInfo
- Publication number
- SU655308A3 SU655308A3 SU731900137A SU1900137A SU655308A3 SU 655308 A3 SU655308 A3 SU 655308A3 SU 731900137 A SU731900137 A SU 731900137A SU 1900137 A SU1900137 A SU 1900137A SU 655308 A3 SU655308 A3 SU 655308A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- trans
- acid
- formula
- ester
- compound
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 16
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 74
- 150000001875 compounds Chemical class 0.000 claims description 53
- -1 3-hydroxy-1-heptenyl Chemical group 0.000 claims description 44
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 39
- 239000002253 acid Substances 0.000 claims description 31
- 239000000243 solution Substances 0.000 claims description 31
- 239000000203 mixture Substances 0.000 claims description 28
- 150000002148 esters Chemical class 0.000 claims description 25
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 21
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 16
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 10
- 150000004702 methyl esters Chemical class 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 6
- 125000004187 tetrahydropyran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 5
- 239000003153 chemical reaction reagent Substances 0.000 claims description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 239000012312 sodium hydride Substances 0.000 claims description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 3
- 235000011152 sodium sulphate Nutrition 0.000 claims description 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 claims description 2
- 235000019341 magnesium sulphate Nutrition 0.000 claims description 2
- 230000007935 neutral effect Effects 0.000 claims description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 2
- 239000012429 reaction media Substances 0.000 claims description 2
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims 6
- 150000008064 anhydrides Chemical class 0.000 claims 2
- 125000004494 ethyl ester group Chemical group 0.000 claims 2
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 claims 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims 2
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 claims 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 claims 1
- 125000002252 acyl group Chemical group 0.000 claims 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 claims 1
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 claims 1
- 229910010277 boron hydride Inorganic materials 0.000 claims 1
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical group CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 claims 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- 239000005457 ice water Substances 0.000 claims 1
- 230000001681 protective effect Effects 0.000 claims 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 26
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 12
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 238000005481 NMR spectroscopy Methods 0.000 description 9
- 238000010992 reflux Methods 0.000 description 8
- 238000004587 chromatography analysis Methods 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000012259 ether extract Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical class OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000012047 saturated solution Substances 0.000 description 3
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical class O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 2
- MBDOYVRWFFCFHM-UHFFFAOYSA-N 2-hexenal Chemical compound CCCC=CC=O MBDOYVRWFFCFHM-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- QXKAIJAYHKCRRA-JJYYJPOSSA-N D-arabinonic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)C(O)=O QXKAIJAYHKCRRA-JJYYJPOSSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 101710178747 Phosphatidate cytidylyltransferase 1 Proteins 0.000 description 2
- 102100031075 Serine/threonine-protein kinase Chk2 Human genes 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- FNJVDWXUKLTFFL-UHFFFAOYSA-N diethyl 2-bromopropanedioate Chemical compound CCOC(=O)C(Br)C(=O)OCC FNJVDWXUKLTFFL-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- NUKZAGXMHTUAFE-UHFFFAOYSA-N methyl hexanoate Chemical compound CCCCCC(=O)OC NUKZAGXMHTUAFE-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- YLTBAANDCZGTCR-VOTSOKGWSA-N (e)-1-chlorooct-1-en-3-one Chemical compound CCCCCC(=O)\C=C\Cl YLTBAANDCZGTCR-VOTSOKGWSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RLYFKZHIZBASMB-UHFFFAOYSA-N 1-(dimethylamino)hept-1-en-3-one Chemical compound CCCCC(=O)C=CN(C)C RLYFKZHIZBASMB-UHFFFAOYSA-N 0.000 description 1
- CHJVYZKLDXMEPT-UHFFFAOYSA-N 1-(dimethylamino)non-1-en-3-one Chemical compound CCCCCCC(=O)C=CN(C)C CHJVYZKLDXMEPT-UHFFFAOYSA-N 0.000 description 1
- ZRXCTNFXIOYGLK-UHFFFAOYSA-N 1-(dimethylamino)oct-1-en-3-one Chemical compound CCCCCC(=O)C=CN(C)C ZRXCTNFXIOYGLK-UHFFFAOYSA-N 0.000 description 1
- HPBKASIYSDDWNK-UHFFFAOYSA-N 1-(dimethylamino)pent-1-en-3-one Chemical compound CCC(=O)C=CN(C)C HPBKASIYSDDWNK-UHFFFAOYSA-N 0.000 description 1
- BEBLXWVFJRCWCM-UHFFFAOYSA-N 1-chlorodec-1-en-3-one Chemical compound CCCCCCCC(=O)C=CCl BEBLXWVFJRCWCM-UHFFFAOYSA-N 0.000 description 1
- MBDOYVRWFFCFHM-SNAWJCMRSA-N 2-Hexenal Natural products CCC\C=C\C=O MBDOYVRWFFCFHM-SNAWJCMRSA-N 0.000 description 1
- VBZOUUJVGADJBK-UHFFFAOYSA-N 2-bromopropanedioic acid Chemical compound OC(=O)C(Br)C(O)=O VBZOUUJVGADJBK-UHFFFAOYSA-N 0.000 description 1
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229930188012 Bromoether Natural products 0.000 description 1
- NTZRDKVFLPLTPU-UHFFFAOYSA-N CC[Na] Chemical compound CC[Na] NTZRDKVFLPLTPU-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 1
- 101150042033 Copg1 gene Proteins 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 101100114422 Drosophila melanogaster gammaCOP gene Proteins 0.000 description 1
- 101150060598 GPI1 gene Proteins 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 240000001812 Hyssopus officinalis Species 0.000 description 1
- 235000010650 Hyssopus officinalis Nutrition 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZTHYODDOHIVTJV-UHFFFAOYSA-N Propyl gallate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- VUBFDPHDHBTRIR-UHFFFAOYSA-N [Br].CCO Chemical compound [Br].CCO VUBFDPHDHBTRIR-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- HJCMMOODWZOXML-UHFFFAOYSA-N bromo hypobromite Chemical compound BrOBr HJCMMOODWZOXML-UHFFFAOYSA-N 0.000 description 1
- RRTWEEAEXPZMPY-UHFFFAOYSA-N bromo nitrate Chemical class [O-][N+](=O)OBr RRTWEEAEXPZMPY-UHFFFAOYSA-N 0.000 description 1
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical compound BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- QVQUOSCLJISGOB-UHFFFAOYSA-N deca-1,3-dien-5-one Chemical compound CCCCCC(=O)C=CC=C QVQUOSCLJISGOB-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- COYGTUCJQDTEEG-UHFFFAOYSA-N dimethyl 2-formylcyclopropane-1,1-dicarboxylate Chemical compound COC(=O)C1(C(=O)OC)CC1C=O COYGTUCJQDTEEG-UHFFFAOYSA-N 0.000 description 1
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- XYOWUMRGJNUYBC-UHFFFAOYSA-N dodeca-1,3-dien-5-one Chemical compound CCCCCCCC(=O)C=CC=C XYOWUMRGJNUYBC-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- DLLJVQNYBYOKGS-UHFFFAOYSA-N ethoxyethane;pentane Chemical compound CCCCC.CCOCC DLLJVQNYBYOKGS-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- AFVYWKMVEGBLGD-UHFFFAOYSA-N hectane Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC AFVYWKMVEGBLGD-UHFFFAOYSA-N 0.000 description 1
- CCAACSOXHPRBDG-UHFFFAOYSA-N hepta-4,6-dien-3-one Chemical compound CCC(=O)C=CC=C CCAACSOXHPRBDG-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- ARNWQMJQALNBBV-UHFFFAOYSA-N lithium carbide Chemical compound [Li+].[Li+].[C-]#[C-] ARNWQMJQALNBBV-UHFFFAOYSA-N 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- KYLVAMSNNZMHSX-UHFFFAOYSA-N methyl 6-bromohexanoate Chemical compound COC(=O)CCCCCBr KYLVAMSNNZMHSX-UHFFFAOYSA-N 0.000 description 1
- BXRLUWIDTDLHQE-UHFFFAOYSA-N methyl 7-bromoheptanoate Chemical compound COC(=O)CCCCCCBr BXRLUWIDTDLHQE-UHFFFAOYSA-N 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- KLTVSWGXIAYTHO-UHFFFAOYSA-N n-pentyl vinyl ketone Natural products CCCCCC(=O)C=C KLTVSWGXIAYTHO-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- QHGVXILFMXYDRS-UHFFFAOYSA-N pyraclofos Chemical compound C1=C(OP(=O)(OCC)SCCC)C=NN1C1=CC=C(Cl)C=C1 QHGVXILFMXYDRS-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000004436 sodium atom Chemical group 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- SRWFBFUYENBCGF-UHFFFAOYSA-M sodium;chloride;hydrochloride Chemical compound [Na+].Cl.[Cl-] SRWFBFUYENBCGF-UHFFFAOYSA-M 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 150000005691 triesters Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/93—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems condensed with a ring other than six-membered
- C07D307/935—Not further condensed cyclopenta [b] furans or hydrogenated cyclopenta [b] furans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrane Compounds (AREA)
- Furan Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00238650A US3849474A (en) | 1972-03-27 | 1972-03-27 | 11-deoxyprostaglandin derivatives and process therefor |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU655308A3 true SU655308A3 (ru) | 1979-03-30 |
Family
ID=22898762
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU731900137A SU655308A3 (ru) | 1972-03-27 | 1973-03-26 | Способ получени производных 11-дезоксипростагландина |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3849474A (enExample) |
| JP (1) | JPS495945A (enExample) |
| AU (2) | AU476003B2 (enExample) |
| CA (1) | CA997341A (enExample) |
| CH (1) | CH609969A5 (enExample) |
| DE (1) | DE2313868A1 (enExample) |
| FR (2) | FR2187332B1 (enExample) |
| GB (3) | GB1422518A (enExample) |
| HU (1) | HU167202B (enExample) |
| IL (3) | IL41515A (enExample) |
| NL (1) | NL7304258A (enExample) |
| SE (1) | SE391520B (enExample) |
| SU (1) | SU655308A3 (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4045577A (en) * | 1971-06-17 | 1977-08-30 | Alza Corporation | Valuable medicinial prostaglandin compounds prepared from material isolated from the sea |
| JPS5146114B2 (enExample) * | 1972-09-01 | 1976-12-07 | ||
| US3987081A (en) * | 1973-04-16 | 1976-10-19 | American Home Products Corporation | Alkyl derivatives of prostanoic acids and preparation thereof |
| JPS5623984B2 (enExample) * | 1973-04-19 | 1981-06-03 | ||
| DE2331081A1 (de) * | 1973-06-19 | 1975-01-23 | Hoechst Ag | Neue cyclopentanderivate und verfahren zu ihrer herstellung |
| US4052446A (en) * | 1973-08-06 | 1977-10-04 | Hoffmann-La Roche Inc. | 11,16-substituted prostaglandins |
| US3953435A (en) * | 1974-01-10 | 1976-04-27 | Ono Pharmaceutical Company | Aldehyde derivatives of prostaglandins |
| US3931282A (en) * | 1974-02-21 | 1976-01-06 | Syntex (U.S.A.) Inc. | 11α-Hydroxymethyl prostaglandins |
| US4034003A (en) * | 1974-04-11 | 1977-07-05 | Ono Pharmaceutical Co., Ltd. | 15-Cycloalkyl-prostaglandins |
| US3959263A (en) * | 1974-06-19 | 1976-05-25 | American Home Products Corporation | Prostaglandin intermediate |
| JPS5153758U (enExample) * | 1974-10-22 | 1976-04-24 | ||
| US3996263A (en) * | 1975-05-05 | 1976-12-07 | Sankyo Company Limited | 9-Oxo-11α-methyl-15Ε-hyroxyprost-13(trans)-enoic acid derivatives and process for the preparaion thereof |
| US4086269A (en) * | 1975-07-07 | 1978-04-25 | American Home Products Corporation | 11-Deoxy-15-substituted prostaglandins |
| US4257981A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-PG2 compounds |
| US4257983A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-PG1 compounds |
| US4257982A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-13,14-dihydro-PG2 compounds |
| US4257980A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-13,14-dihydro-PG1 compounds |
| US4257979A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-19-methyl-PG compounds |
| US4251463A (en) * | 1979-05-01 | 1981-02-17 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-9-deoxy-9-methylene-5,6-didehydro-PGF1 compounds |
| US4254058A (en) * | 1979-07-05 | 1981-03-03 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-6a-carba-PGI2 compounds |
| US4256667A (en) * | 1979-07-05 | 1981-03-17 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-19-methyl-6a-carba-PGI2 compounds |
| US4251464A (en) * | 1979-07-05 | 1981-02-17 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-6-oxo-PGE1 compounds |
| US4255354A (en) * | 1979-07-05 | 1981-03-10 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-19-methyl-6-oxo-PGF1 compounds |
| US4296241A (en) * | 1979-07-21 | 1981-10-20 | Bayer Aktiengesellschaft | Preparation of 3-(2,2-dichlorovinyl)-2,2-dimethyl-cyclopropane-1-carboxylic acid derivatives |
| JPH0192401A (ja) * | 1987-09-29 | 1989-04-11 | Tatsuji Nakajima | パンツの製造法 |
| WO2008092655A1 (en) * | 2007-01-30 | 2008-08-07 | Dsm Ip Assets B.V. | Process for preparing dienones |
-
1972
- 1972-03-27 US US00238650A patent/US3849474A/en not_active Expired - Lifetime
-
1973
- 1973-02-12 IL IL41515A patent/IL41515A/en unknown
- 1973-02-12 IL IL49234A patent/IL49234A/en unknown
- 1973-02-16 AU AU52255/73A patent/AU476003B2/en not_active Expired
- 1973-03-20 DE DE2313868A patent/DE2313868A1/de active Pending
- 1973-03-23 GB GB1412873A patent/GB1422518A/en not_active Expired
- 1973-03-23 GB GB1748375A patent/GB1422319A/en not_active Expired
- 1973-03-23 GB GB1748175A patent/GB1422318A/en not_active Expired
- 1973-03-26 HU HUAE376A patent/HU167202B/hu unknown
- 1973-03-26 SE SE7304219A patent/SE391520B/xx unknown
- 1973-03-26 FR FR7310802A patent/FR2187332B1/fr not_active Expired
- 1973-03-26 SU SU731900137A patent/SU655308A3/ru active
- 1973-03-27 CA CA167,338A patent/CA997341A/en not_active Expired
- 1973-03-27 JP JP48035005A patent/JPS495945A/ja active Pending
- 1973-03-27 CH CH441873A patent/CH609969A5/xx not_active IP Right Cessation
- 1973-03-27 NL NL7304258A patent/NL7304258A/xx not_active Application Discontinuation
-
1975
- 1975-03-17 FR FR7508290A patent/FR2270234B1/fr not_active Expired
-
1976
- 1976-03-17 IL IL49234A patent/IL49234A0/xx unknown
- 1976-07-14 AU AU15895/76A patent/AU494525B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AU5225573A (en) | 1974-08-22 |
| IL49234A0 (en) | 1976-05-31 |
| AU494525B2 (en) | 1976-09-30 |
| CH609969A5 (enExample) | 1979-03-30 |
| GB1422319A (en) | 1976-01-28 |
| FR2270234A1 (enExample) | 1975-12-05 |
| NL7304258A (enExample) | 1973-10-01 |
| IL41515A0 (en) | 1973-05-31 |
| FR2270234B1 (enExample) | 1978-02-03 |
| AU1589576A (en) | 1976-09-30 |
| FR2187332A1 (enExample) | 1974-01-18 |
| US3849474A (en) | 1974-11-19 |
| GB1422518A (en) | 1976-01-28 |
| IL41515A (en) | 1976-10-31 |
| IL49234A (en) | 1976-10-31 |
| HU167202B (enExample) | 1975-09-27 |
| FR2187332B1 (enExample) | 1976-12-24 |
| CA997341A (en) | 1976-09-21 |
| DE2313868A1 (de) | 1973-10-04 |
| GB1422318A (en) | 1976-01-28 |
| SE391520B (sv) | 1977-02-21 |
| AU476003B2 (en) | 1976-09-09 |
| JPS495945A (enExample) | 1974-01-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU655308A3 (ru) | Способ получени производных 11-дезоксипростагландина | |
| US3736319A (en) | Novel cyclopentanone-2-carboxylates | |
| DE1958600A1 (de) | Neue Isoxazolderivate und deren Herstellung | |
| Voyle et al. | Quassinoids. 1. Attempted intramolecular Diels-Alder approach for assembling the ABCD rings | |
| Awl et al. | Cyclic fatty esters: Synthesis and characterization of methyl ω-(6-alkyl-3-cyclohexenyl) alkenoates | |
| US4568762A (en) | 4-Methyl-2-oxo-cyclopentylidene acetic acid and esters thereof | |
| US4094892A (en) | Process for preparing optically active esters | |
| US4016178A (en) | Synthesis of vitamin E | |
| US4959349A (en) | Indane derivative and perfumery composition comprising the same | |
| US4000169A (en) | Asymmetric synthesis of optically active compounds | |
| US4020172A (en) | Lactone aldehydes | |
| US4595783A (en) | Magnesium chloride or phosphonium halide derivatives of 3,7,11-trimethyl-dodeca-2,6(10)-diene(triene)-1-ol | |
| US4357278A (en) | Process for synthesizing estrone or estrone derivatives | |
| US4097495A (en) | Tetramethyl-benzyloxy chromans | |
| US4547586A (en) | Preparation of 2-isopropenyl-or 2-isopropylidenyl-3-hexenoates from chrysanthemic acid esters | |
| US3868402A (en) | Novel cyclopentanone-2-carboxylates | |
| US4006136A (en) | Prostaglandin intermediates | |
| US4032577A (en) | Unsaturated ketones | |
| US4165436A (en) | Trans-2,3-didehydro-9-deoxy-9-methylene-PGF compounds | |
| US4071542A (en) | Synthesis of hydroxycyclopenten-1-ones | |
| US3978093A (en) | Synthesis of hydroxycyclopenten-1-ones | |
| US4390718A (en) | Prostaglandin intermediates | |
| SU524518A3 (ru) | Способ получени 2-замещенных 5-алкил-5-аралкокси-1,3-диоксанов | |
| US4430507A (en) | 4-Methyl-2-oxo-cyclopentaneacetic acid prostaglandin intermediates | |
| US4036856A (en) | Cyclopentanone derivatives |