GB1422318A - Cyclopentanone triesters - Google Patents
Cyclopentanone triestersInfo
- Publication number
- GB1422318A GB1422318A GB1748175A GB1748175A GB1422318A GB 1422318 A GB1422318 A GB 1422318A GB 1748175 A GB1748175 A GB 1748175A GB 1748175 A GB1748175 A GB 1748175A GB 1422318 A GB1422318 A GB 1422318A
- Authority
- GB
- United Kingdom
- Prior art keywords
- prepared
- bromo
- cis
- reacting
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 Cyclopentanone triesters Chemical class 0.000 title 1
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclo-pentanone Natural products O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 abstract 1
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical compound O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 abstract 1
- RSZRMRUFASZUMS-UHFFFAOYSA-N 6-chlorohex-2-yn-1-ol Chemical compound OCC#CCCCCl RSZRMRUFASZUMS-UHFFFAOYSA-N 0.000 abstract 1
- MEPYEDWQGLFULE-UHFFFAOYSA-N 7-bromohept-5-ynoic acid Chemical compound OC(=O)CCCC#CCBr MEPYEDWQGLFULE-UHFFFAOYSA-N 0.000 abstract 1
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 abstract 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 230000005494 condensation Effects 0.000 abstract 1
- 238000009833 condensation Methods 0.000 abstract 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical class CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 abstract 1
- 238000005984 hydrogenation reaction Methods 0.000 abstract 1
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 239000000543 intermediate Substances 0.000 abstract 1
- ORMJOYKCTLOKIS-UHFFFAOYSA-N methyl 7-bromohept-5-ynoate Chemical compound COC(=O)CCCC#CCBr ORMJOYKCTLOKIS-UHFFFAOYSA-N 0.000 abstract 1
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 abstract 1
- 150000003180 prostaglandins Chemical class 0.000 abstract 1
- 125000004187 tetrahydropyran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/93—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems condensed with a ring other than six-membered
- C07D307/935—Not further condensed cyclopenta [b] furans or hydrogenated cyclopenta [b] furans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00238650A US3849474A (en) | 1972-03-27 | 1972-03-27 | 11-deoxyprostaglandin derivatives and process therefor |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1422318A true GB1422318A (en) | 1976-01-28 |
Family
ID=22898762
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB1748375A Expired GB1422319A (en) | 1972-03-27 | 1973-03-23 | Derivatives of cyclopropane-1,1-dicarboxylate |
| GB1748175A Expired GB1422318A (en) | 1972-03-27 | 1973-03-23 | Cyclopentanone triesters |
| GB1412873A Expired GB1422518A (en) | 1972-03-27 | 1973-03-23 | 11-deoxyprostaglandin derivatives and process therefor |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB1748375A Expired GB1422319A (en) | 1972-03-27 | 1973-03-23 | Derivatives of cyclopropane-1,1-dicarboxylate |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB1412873A Expired GB1422518A (en) | 1972-03-27 | 1973-03-23 | 11-deoxyprostaglandin derivatives and process therefor |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3849474A (enExample) |
| JP (1) | JPS495945A (enExample) |
| AU (2) | AU476003B2 (enExample) |
| CA (1) | CA997341A (enExample) |
| CH (1) | CH609969A5 (enExample) |
| DE (1) | DE2313868A1 (enExample) |
| FR (2) | FR2187332B1 (enExample) |
| GB (3) | GB1422319A (enExample) |
| HU (1) | HU167202B (enExample) |
| IL (3) | IL49234A (enExample) |
| NL (1) | NL7304258A (enExample) |
| SE (1) | SE391520B (enExample) |
| SU (1) | SU655308A3 (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4045577A (en) * | 1971-06-17 | 1977-08-30 | Alza Corporation | Valuable medicinial prostaglandin compounds prepared from material isolated from the sea |
| JPS5146114B2 (enExample) * | 1972-09-01 | 1976-12-07 | ||
| US3987081A (en) * | 1973-04-16 | 1976-10-19 | American Home Products Corporation | Alkyl derivatives of prostanoic acids and preparation thereof |
| JPS5623984B2 (enExample) * | 1973-04-19 | 1981-06-03 | ||
| DE2331081A1 (de) * | 1973-06-19 | 1975-01-23 | Hoechst Ag | Neue cyclopentanderivate und verfahren zu ihrer herstellung |
| US4052446A (en) * | 1973-08-06 | 1977-10-04 | Hoffmann-La Roche Inc. | 11,16-substituted prostaglandins |
| US3953435A (en) * | 1974-01-10 | 1976-04-27 | Ono Pharmaceutical Company | Aldehyde derivatives of prostaglandins |
| US3931282A (en) * | 1974-02-21 | 1976-01-06 | Syntex (U.S.A.) Inc. | 11α-Hydroxymethyl prostaglandins |
| US4034003A (en) * | 1974-04-11 | 1977-07-05 | Ono Pharmaceutical Co., Ltd. | 15-Cycloalkyl-prostaglandins |
| US3959263A (en) * | 1974-06-19 | 1976-05-25 | American Home Products Corporation | Prostaglandin intermediate |
| JPS5153758U (enExample) * | 1974-10-22 | 1976-04-24 | ||
| US3996263A (en) * | 1975-05-05 | 1976-12-07 | Sankyo Company Limited | 9-Oxo-11α-methyl-15Ε-hyroxyprost-13(trans)-enoic acid derivatives and process for the preparaion thereof |
| US4086269A (en) * | 1975-07-07 | 1978-04-25 | American Home Products Corporation | 11-Deoxy-15-substituted prostaglandins |
| US4257982A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-13,14-dihydro-PG2 compounds |
| US4257981A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-PG2 compounds |
| US4257979A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-19-methyl-PG compounds |
| US4257983A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-PG1 compounds |
| US4257980A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-13,14-dihydro-PG1 compounds |
| US4251463A (en) * | 1979-05-01 | 1981-02-17 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-9-deoxy-9-methylene-5,6-didehydro-PGF1 compounds |
| US4254058A (en) * | 1979-07-05 | 1981-03-03 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-6a-carba-PGI2 compounds |
| US4251464A (en) * | 1979-07-05 | 1981-02-17 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-6-oxo-PGE1 compounds |
| US4255354A (en) * | 1979-07-05 | 1981-03-10 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-19-methyl-6-oxo-PGF1 compounds |
| US4256667A (en) * | 1979-07-05 | 1981-03-17 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-19-methyl-6a-carba-PGI2 compounds |
| US4296241A (en) * | 1979-07-21 | 1981-10-20 | Bayer Aktiengesellschaft | Preparation of 3-(2,2-dichlorovinyl)-2,2-dimethyl-cyclopropane-1-carboxylic acid derivatives |
| JPH0192401A (ja) * | 1987-09-29 | 1989-04-11 | Tatsuji Nakajima | パンツの製造法 |
| WO2008092655A1 (en) * | 2007-01-30 | 2008-08-07 | Dsm Ip Assets B.V. | Process for preparing dienones |
-
1972
- 1972-03-27 US US00238650A patent/US3849474A/en not_active Expired - Lifetime
-
1973
- 1973-02-12 IL IL49234A patent/IL49234A/en unknown
- 1973-02-12 IL IL41515A patent/IL41515A/en unknown
- 1973-02-16 AU AU52255/73A patent/AU476003B2/en not_active Expired
- 1973-03-20 DE DE2313868A patent/DE2313868A1/de active Pending
- 1973-03-23 GB GB1748375A patent/GB1422319A/en not_active Expired
- 1973-03-23 GB GB1748175A patent/GB1422318A/en not_active Expired
- 1973-03-23 GB GB1412873A patent/GB1422518A/en not_active Expired
- 1973-03-26 SE SE7304219A patent/SE391520B/xx unknown
- 1973-03-26 FR FR7310802A patent/FR2187332B1/fr not_active Expired
- 1973-03-26 HU HUAE376A patent/HU167202B/hu unknown
- 1973-03-26 SU SU731900137A patent/SU655308A3/ru active
- 1973-03-27 JP JP48035005A patent/JPS495945A/ja active Pending
- 1973-03-27 NL NL7304258A patent/NL7304258A/xx not_active Application Discontinuation
- 1973-03-27 CH CH441873A patent/CH609969A5/xx not_active IP Right Cessation
- 1973-03-27 CA CA167,338A patent/CA997341A/en not_active Expired
-
1975
- 1975-03-17 FR FR7508290A patent/FR2270234B1/fr not_active Expired
-
1976
- 1976-03-17 IL IL49234A patent/IL49234A0/xx unknown
- 1976-07-14 AU AU15895/76A patent/AU494525B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1422518A (en) | 1976-01-28 |
| AU5225573A (en) | 1974-08-22 |
| IL49234A (en) | 1976-10-31 |
| FR2270234A1 (enExample) | 1975-12-05 |
| SU655308A3 (ru) | 1979-03-30 |
| IL41515A (en) | 1976-10-31 |
| HU167202B (enExample) | 1975-09-27 |
| NL7304258A (enExample) | 1973-10-01 |
| JPS495945A (enExample) | 1974-01-19 |
| SE391520B (sv) | 1977-02-21 |
| DE2313868A1 (de) | 1973-10-04 |
| IL41515A0 (en) | 1973-05-31 |
| FR2187332A1 (enExample) | 1974-01-18 |
| CH609969A5 (enExample) | 1979-03-30 |
| AU1589576A (en) | 1976-09-30 |
| CA997341A (en) | 1976-09-21 |
| FR2270234B1 (enExample) | 1978-02-03 |
| US3849474A (en) | 1974-11-19 |
| GB1422319A (en) | 1976-01-28 |
| FR2187332B1 (enExample) | 1976-12-24 |
| AU494525B2 (en) | 1976-09-30 |
| IL49234A0 (en) | 1976-05-31 |
| AU476003B2 (en) | 1976-09-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1422318A (en) | Cyclopentanone triesters | |
| US3900512A (en) | 2-(6-carbomethoxy-cis-2-hexenyl)-4(r)-hydroxy-2-cyclopenten-1-one and method for preparing same | |
| SU620207A3 (ru) | Способ получени оптически активных соединений р да простагландинов | |
| US2446171A (en) | Preparation of acetals | |
| GB1455468A (en) | Allenic esters | |
| US2676988A (en) | Method of making vitamin a and intermediates formed thereby | |
| GB1445956A (en) | Esters of dihydroapovincaminic acid | |
| GB1472132A (en) | Cyclopentanone triesters and process therefor | |
| US3576880A (en) | 5(2,6,6-trimethyl - 1 - hydroxy-cyclohex-2-enyl) -3 methyl-penta-2,4-dien-1-al derivatives | |
| GB1311408A (en) | Process for the preparation of butyrolactones | |
| GB1346289A (en) | Cyclopentanone derivatives | |
| GB1417174A (en) | 1-2-delta2-imidazolinyl-2,2-diarylcoclopropanes | |
| US3102133A (en) | 1-[5-(6-methoxy-2-naphthyl)-2-oxycyclopentyl]-2-propanone derivatives | |
| GB1310382A (en) | Process for the preparation of glucofuranosides | |
| US4284794A (en) | Prostaglandin derivatives | |
| GB1379874A (en) | Process for the preparation of cyclopentenes | |
| GB1422443A (en) | Process for the production of benzocycloheptathiophenone derivative | |
| US3868402A (en) | Novel cyclopentanone-2-carboxylates | |
| US4024172A (en) | Preparation of prostanoic acid derivatives | |
| GB1381207A (en) | Ketones | |
| GB1309670A (en) | Pyranosides | |
| Milas et al. | THE SYNTHESIS OF 1-[CYCLOHEXEN-1'-YL]-3-METHYL-1, 3, 5-OCTATRIEN-7-ONE (C15 KETONE) | |
| GB1297662A (enExample) | ||
| GB1457395A (en) | O-ethyl-o-n-propyl-o-1-aryl-2-cyano vinyl-thionophosphoric acid esters and their use as insecticides and acaricides | |
| IE42966L (en) | 8-azaprostaglandins and process for the preparation thereof. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |