SU576893A3 - Способ борьбы с сорн ками - Google Patents
Способ борьбы с сорн камиInfo
- Publication number
- SU576893A3 SU576893A3 SU7502115822A SU2115822A SU576893A3 SU 576893 A3 SU576893 A3 SU 576893A3 SU 7502115822 A SU7502115822 A SU 7502115822A SU 2115822 A SU2115822 A SU 2115822A SU 576893 A3 SU576893 A3 SU 576893A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- zero
- weed
- fighting
- fighting weed
- weight
- Prior art date
Links
- 241000196324 Embryophyta Species 0.000 title claims 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 230000002363 herbicidal effect Effects 0.000 claims description 2
- 239000004009 herbicide Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 1
- 239000013543 active substance Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- UJNBRWHYYUWQMC-UHFFFAOYSA-N [4-(4-chlorophenoxy)phenyl]urea Chemical compound C1=CC(NC(=O)N)=CC=C1OC1=CC=C(Cl)C=C1 UJNBRWHYYUWQMC-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- IVUXTESCPZUGJC-UHFFFAOYSA-N chloroxuron Chemical compound C1=CC(NC(=O)N(C)C)=CC=C1OC1=CC=C(Cl)C=C1 IVUXTESCPZUGJC-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 230000008654 plant damage Effects 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/32—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C275/34—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C275/36—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with at least one of the oxygen atoms further bound to a carbon atom of a six-membered aromatic ring, e.g. N-aryloxyphenylureas
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2411320A DE2411320A1 (de) | 1974-03-09 | 1974-03-09 | (trifluormethylphenoxy)-phenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU576893A3 true SU576893A3 (ru) | 1977-10-15 |
Family
ID=5909556
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU7502115822A SU576893A3 (ru) | 1974-03-09 | 1975-03-05 | Способ борьбы с сорн ками |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4080193A (enExample) |
| JP (1) | JPS50121249A (enExample) |
| AT (1) | AT345608B (enExample) |
| BE (1) | BE826412A (enExample) |
| BR (1) | BR7501373A (enExample) |
| CA (1) | CA1051925A (enExample) |
| DD (1) | DD118791A5 (enExample) |
| DE (1) | DE2411320A1 (enExample) |
| DK (1) | DK93675A (enExample) |
| ES (1) | ES435413A1 (enExample) |
| FR (1) | FR2272985A1 (enExample) |
| GB (1) | GB1447345A (enExample) |
| IE (1) | IE40762B1 (enExample) |
| IL (1) | IL46757A0 (enExample) |
| LU (1) | LU72004A1 (enExample) |
| NL (1) | NL7502682A (enExample) |
| SU (1) | SU576893A3 (enExample) |
| TR (1) | TR18157A (enExample) |
| ZA (1) | ZA751403B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2538178A1 (de) * | 1975-08-27 | 1977-03-10 | Bayer Ag | Trifluormethylphenoxy-phenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| US4336062A (en) * | 1977-09-19 | 1982-06-22 | Stauffer Chemical Company | Herbicidal cyclohexenone derivatives |
| US4221816A (en) * | 1979-04-16 | 1980-09-09 | American Cyanamid Company | Method for the control of phytopathogenic fungi using p-(alkoxyalkyl)urea compounds |
| DE3064249D1 (en) * | 1979-07-03 | 1983-08-25 | Ciba Geigy Ag | Thio-urea derivatives and isothio-urea derivatives, process for their preparation, compositions containing these compounds and their use in combating pests |
| US4376646A (en) * | 1980-03-18 | 1983-03-15 | Ciba-Geigy Corporation | Herbicidal N-[4-(3'-alkoxyphenoxy)-phenyl]-N'-methylureas |
| AU6118898A (en) * | 1997-03-03 | 1998-09-22 | Nissan Chemical Industries Ltd. | Urea derivatives, and industrial antibacterial and antifungal agents, algaecidesand antiperiphytic agents containing the same |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE593743A (enExample) * | 1959-08-05 | |||
| NL255528A (enExample) * | 1959-08-21 | |||
| NL134755C (enExample) * | 1961-01-19 | |||
| US3901687A (en) * | 1973-08-31 | 1975-08-26 | Scott & Sons Co O M | Process for the selective control of weeds in kentucky bluegrass |
-
1974
- 1974-03-09 DE DE2411320A patent/DE2411320A1/de active Pending
-
1975
- 1975-03-05 US US05/555,515 patent/US4080193A/en not_active Expired - Lifetime
- 1975-03-05 SU SU7502115822A patent/SU576893A3/ru active
- 1975-03-06 NL NL7502682A patent/NL7502682A/xx unknown
- 1975-03-06 IL IL46757A patent/IL46757A0/xx unknown
- 1975-03-06 TR TR18157A patent/TR18157A/xx unknown
- 1975-03-07 ZA ZA00751403A patent/ZA751403B/xx unknown
- 1975-03-07 BR BR1373/75A patent/BR7501373A/pt unknown
- 1975-03-07 CA CA221,529A patent/CA1051925A/en not_active Expired
- 1975-03-07 DK DK93675*#A patent/DK93675A/da unknown
- 1975-03-07 ES ES435413A patent/ES435413A1/es not_active Expired
- 1975-03-07 DD DD184638A patent/DD118791A5/xx unknown
- 1975-03-07 GB GB960375A patent/GB1447345A/en not_active Expired
- 1975-03-07 BE BE154110A patent/BE826412A/xx unknown
- 1975-03-07 FR FR7507288A patent/FR2272985A1/fr not_active Withdrawn
- 1975-03-07 LU LU72004A patent/LU72004A1/xx unknown
- 1975-03-07 IE IE497/75A patent/IE40762B1/xx unknown
- 1975-03-08 JP JP50027635A patent/JPS50121249A/ja active Pending
- 1975-03-10 AT AT183475A patent/AT345608B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ES435413A1 (es) | 1977-03-16 |
| JPS50121249A (enExample) | 1975-09-23 |
| IE40762L (en) | 1975-09-09 |
| BE826412A (fr) | 1975-09-08 |
| AT345608B (de) | 1978-09-25 |
| ZA751403B (en) | 1976-02-25 |
| NL7502682A (nl) | 1975-09-11 |
| DE2411320A1 (de) | 1975-09-18 |
| DK93675A (enExample) | 1975-09-10 |
| TR18157A (tr) | 1976-10-11 |
| CA1051925A (en) | 1979-04-03 |
| US4080193A (en) | 1978-03-21 |
| DD118791A5 (enExample) | 1976-03-20 |
| FR2272985A1 (enExample) | 1975-12-26 |
| LU72004A1 (enExample) | 1976-02-04 |
| IL46757A0 (en) | 1975-05-22 |
| BR7501373A (pt) | 1975-12-09 |
| IE40762B1 (en) | 1979-08-15 |
| AU7885675A (en) | 1976-09-09 |
| GB1447345A (en) | 1976-08-25 |
| ATA183475A (de) | 1978-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU518107A3 (ru) | Гербицидный состав | |
| EP0003313B1 (de) | Neue Pyridyloxy-phenoxy-alpha-propionsäure-aminoalkyl-ester mit herbizider Wirkung,ihre Herstellung, sie enthaltende Mittel und deren Verwendung | |
| JPS638302A (ja) | 殺生剤用効力増強剤 | |
| ES482059A1 (es) | Procedimiento para preparar derivados de pirazoleter herbi- cidas. | |
| DK162521C (da) | Quinoxalinyloxyphenylderivater til anvendelse som mellemprodukter til fremstilling af herbicide quinoxalinyloxyphenoxyalkancarboxylsyrederivater | |
| SU685130A3 (ru) | Гербицидное средство | |
| SU576893A3 (ru) | Способ борьбы с сорн ками | |
| US2863754A (en) | Method of weed control | |
| CS233739B2 (en) | Fungicide agent and processing of effective component | |
| SU673135A3 (ru) | Гербицидный состав | |
| SU550104A3 (ru) | Гербицидный состав | |
| US3468655A (en) | Method of applying herbicidal imidates | |
| SU555827A3 (ru) | Гербицидный состав | |
| SU639410A3 (ru) | Гербицидное средство | |
| SU707501A3 (ru) | Способ борьбы с сорной растительностью | |
| US4185989A (en) | 3-Phenacyl phthaldide safening agents | |
| CA1091951A (en) | Wild oat herbicide composition | |
| JPS56140983A (en) | Substituted acetanilide compound, its preparation and herbicide containing the same as active constituent | |
| EP0147683B1 (en) | A method for the control of galium aparine | |
| US3326748A (en) | Control of powdery mildew with zinc and antimony n, n-dibutyldithiocarbamates | |
| US4182625A (en) | 3-Halo-5-(lower alkoxy) phenoxy alkyl amides | |
| SU651644A3 (ru) | Гербицидное средство | |
| JPS60109508A (ja) | 除草剤組成物 | |
| EP0032832B1 (en) | Synergistic herbicidal compositions and use thereof | |
| SU591122A3 (ru) | Гербицидный состав |