GB1447345A - Substituted phenylureas their preparation and their use as herbicides - Google Patents
Substituted phenylureas their preparation and their use as herbicidesInfo
- Publication number
- GB1447345A GB1447345A GB960375A GB960375A GB1447345A GB 1447345 A GB1447345 A GB 1447345A GB 960375 A GB960375 A GB 960375A GB 960375 A GB960375 A GB 960375A GB 1447345 A GB1447345 A GB 1447345A
- Authority
- GB
- United Kingdom
- Prior art keywords
- formula
- optionally
- trifluoromethylphenoxy
- reacting
- solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004009 herbicide Substances 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 4
- 239000002904 solvent Substances 0.000 abstract 3
- 229910052739 hydrogen Inorganic materials 0.000 abstract 2
- 239000001257 hydrogen Substances 0.000 abstract 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 2
- 238000000034 method Methods 0.000 abstract 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 2
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 abstract 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 239000012948 isocyanate Substances 0.000 abstract 1
- 150000002513 isocyanates Chemical class 0.000 abstract 1
- 238000002955 isolation Methods 0.000 abstract 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 abstract 1
- GMCPBHQGHYWPEC-UHFFFAOYSA-N n-phenoxy-n-(trifluoromethyl)aniline Chemical compound C=1C=CC=CC=1N(C(F)(F)F)OC1=CC=CC=C1 GMCPBHQGHYWPEC-UHFFFAOYSA-N 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
- -1 trifluoromethylphenoxy Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/32—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C275/34—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C275/36—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with at least one of the oxygen atoms further bound to a carbon atom of a six-membered aromatic ring, e.g. N-aryloxyphenylureas
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2411320A DE2411320A1 (de) | 1974-03-09 | 1974-03-09 | (trifluormethylphenoxy)-phenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1447345A true GB1447345A (en) | 1976-08-25 |
Family
ID=5909556
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB960375A Expired GB1447345A (en) | 1974-03-09 | 1975-03-07 | Substituted phenylureas their preparation and their use as herbicides |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4080193A (enExample) |
| JP (1) | JPS50121249A (enExample) |
| AT (1) | AT345608B (enExample) |
| BE (1) | BE826412A (enExample) |
| BR (1) | BR7501373A (enExample) |
| CA (1) | CA1051925A (enExample) |
| DD (1) | DD118791A5 (enExample) |
| DE (1) | DE2411320A1 (enExample) |
| DK (1) | DK93675A (enExample) |
| ES (1) | ES435413A1 (enExample) |
| FR (1) | FR2272985A1 (enExample) |
| GB (1) | GB1447345A (enExample) |
| IE (1) | IE40762B1 (enExample) |
| IL (1) | IL46757A0 (enExample) |
| LU (1) | LU72004A1 (enExample) |
| NL (1) | NL7502682A (enExample) |
| SU (1) | SU576893A3 (enExample) |
| TR (1) | TR18157A (enExample) |
| ZA (1) | ZA751403B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2538178A1 (de) * | 1975-08-27 | 1977-03-10 | Bayer Ag | Trifluormethylphenoxy-phenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| US4336062A (en) * | 1977-09-19 | 1982-06-22 | Stauffer Chemical Company | Herbicidal cyclohexenone derivatives |
| US4221816A (en) * | 1979-04-16 | 1980-09-09 | American Cyanamid Company | Method for the control of phytopathogenic fungi using p-(alkoxyalkyl)urea compounds |
| DE3064249D1 (en) * | 1979-07-03 | 1983-08-25 | Ciba Geigy Ag | Thio-urea derivatives and isothio-urea derivatives, process for their preparation, compositions containing these compounds and their use in combating pests |
| US4376646A (en) * | 1980-03-18 | 1983-03-15 | Ciba-Geigy Corporation | Herbicidal N-[4-(3'-alkoxyphenoxy)-phenyl]-N'-methylureas |
| AU6118898A (en) * | 1997-03-03 | 1998-09-22 | Nissan Chemical Industries Ltd. | Urea derivatives, and industrial antibacterial and antifungal agents, algaecidesand antiperiphytic agents containing the same |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE593743A (enExample) * | 1959-08-05 | |||
| NL255528A (enExample) * | 1959-08-21 | |||
| NL134755C (enExample) * | 1961-01-19 | |||
| US3901687A (en) * | 1973-08-31 | 1975-08-26 | Scott & Sons Co O M | Process for the selective control of weeds in kentucky bluegrass |
-
1974
- 1974-03-09 DE DE2411320A patent/DE2411320A1/de active Pending
-
1975
- 1975-03-05 US US05/555,515 patent/US4080193A/en not_active Expired - Lifetime
- 1975-03-05 SU SU7502115822A patent/SU576893A3/ru active
- 1975-03-06 NL NL7502682A patent/NL7502682A/xx unknown
- 1975-03-06 IL IL46757A patent/IL46757A0/xx unknown
- 1975-03-06 TR TR18157A patent/TR18157A/xx unknown
- 1975-03-07 ZA ZA00751403A patent/ZA751403B/xx unknown
- 1975-03-07 BR BR1373/75A patent/BR7501373A/pt unknown
- 1975-03-07 CA CA221,529A patent/CA1051925A/en not_active Expired
- 1975-03-07 DK DK93675*#A patent/DK93675A/da unknown
- 1975-03-07 ES ES435413A patent/ES435413A1/es not_active Expired
- 1975-03-07 DD DD184638A patent/DD118791A5/xx unknown
- 1975-03-07 GB GB960375A patent/GB1447345A/en not_active Expired
- 1975-03-07 BE BE154110A patent/BE826412A/xx unknown
- 1975-03-07 FR FR7507288A patent/FR2272985A1/fr not_active Withdrawn
- 1975-03-07 LU LU72004A patent/LU72004A1/xx unknown
- 1975-03-07 IE IE497/75A patent/IE40762B1/xx unknown
- 1975-03-08 JP JP50027635A patent/JPS50121249A/ja active Pending
- 1975-03-10 AT AT183475A patent/AT345608B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ES435413A1 (es) | 1977-03-16 |
| JPS50121249A (enExample) | 1975-09-23 |
| IE40762L (en) | 1975-09-09 |
| BE826412A (fr) | 1975-09-08 |
| AT345608B (de) | 1978-09-25 |
| ZA751403B (en) | 1976-02-25 |
| NL7502682A (nl) | 1975-09-11 |
| DE2411320A1 (de) | 1975-09-18 |
| DK93675A (enExample) | 1975-09-10 |
| TR18157A (tr) | 1976-10-11 |
| CA1051925A (en) | 1979-04-03 |
| US4080193A (en) | 1978-03-21 |
| DD118791A5 (enExample) | 1976-03-20 |
| FR2272985A1 (enExample) | 1975-12-26 |
| LU72004A1 (enExample) | 1976-02-04 |
| IL46757A0 (en) | 1975-05-22 |
| BR7501373A (pt) | 1975-12-09 |
| SU576893A3 (ru) | 1977-10-15 |
| IE40762B1 (en) | 1979-08-15 |
| AU7885675A (en) | 1976-09-09 |
| ATA183475A (de) | 1978-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1127050A (en) | Substituted phenylcarbamates and herbicidal preparations thereof | |
| GB1501607A (en) | Substituted n-phenyl-n'-benzoyl-ureas and their use as insecticides | |
| GB1353179A (en) | Hydantoin derivatives processes for producing them and compositions containing them | |
| GB916575A (en) | 4-hydroxy-2-butynyl n-(3-halophenyl) carbamates and process for preparing same | |
| GB1447345A (en) | Substituted phenylureas their preparation and their use as herbicides | |
| ZA826755B (en) | Substituted phenylsulfonylurea derivatives,a process for their preparation and their use as herbicides,and new intermediate products for their preparation | |
| GB1344642A (en) | Meta-anilide urea compositions and their utility as herbicides | |
| GB1193418A (en) | Process for the Preparation of Isocyanates | |
| MY102732A (en) | A process for the manufacture of n, n-(dibenzohexatrienylene) ureas | |
| GB1331201A (en) | Carbamates process for their preparation and their use as insecticides | |
| GB1359251A (en) | N-carbamoyl-or n-thiocarbamoyl - 4,5,6,7 - tetrahydrobenztriazoles processes for their preparation and their use as insecticides and acaricides | |
| GB1287084A (en) | Benzimidazole derivatives, process for their preparation, and their fungicidal use | |
| GB1223890A (en) | Substituted ureidophenyl carbamates and herbicides containing same | |
| GB1479126A (en) | Substituted ureas and the use thereof as herbicides | |
| GB1364140A (en) | 1-carbamoyl-benzimidazoles processes for their production and their fungicidal and bactericidal use | |
| GB1205786A (en) | Process for the manufacture of n-carbamoyloxyphenyl-carbamates | |
| ES352493A1 (es) | Procedimiento para la obtencion de composiciones herbici- das. | |
| GB1263421A (en) | New heterocyclic compounds | |
| DK517882A (da) | Fremgangsmaade til fremstilling af n-substituerede n-isocyanatocarbonyl-carbamater | |
| GB1345300A (en) | Phenylurea derivatives their preparation and use as herbicides | |
| GB1410725A (en) | Azidoformates and their application to polymeric substrates | |
| GB1488274A (en) | Butynyl carbamates | |
| GB1314864A (en) | N-arylureas a process for their production and their use as herbicid | |
| IE35500B1 (en) | Substituted phenylthiocarbamates having a herbicidal activity and processes for their manufacture | |
| GB1352464A (en) | N-alkyl-alpha-3,5-substituted phenoxy-alkyl amides and their use as herbicides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |