SU515451A3 - Способ получени производных аминофенилкетона или их солей - Google Patents
Способ получени производных аминофенилкетона или их солейInfo
- Publication number
- SU515451A3 SU515451A3 SU1773176A SU1773176A SU515451A3 SU 515451 A3 SU515451 A3 SU 515451A3 SU 1773176 A SU1773176 A SU 1773176A SU 1773176 A SU1773176 A SU 1773176A SU 515451 A3 SU515451 A3 SU 515451A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- propyl
- fluorobenzoyl
- phenyl
- triazaspiro
- oxo
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 6
- GSEZYWGNEACOIW-UHFFFAOYSA-N bis(2-aminophenyl)methanone Chemical class NC1=CC=CC=C1C(=O)C1=CC=CC=C1N GSEZYWGNEACOIW-UHFFFAOYSA-N 0.000 title description 5
- 150000003839 salts Chemical class 0.000 title description 5
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 79
- -1 JTOKCH Chemical group 0.000 description 28
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000007800 oxidant agent Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 5
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Chemical class O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 3
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 235000010650 Hyssopus officinalis Nutrition 0.000 description 1
- 240000001812 Hyssopus officinalis Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000006332 fluoro benzoyl group Chemical group 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229940086735 succinate Drugs 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/56—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups bound to carbon atoms of six-membered aromatic rings and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/18—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP46024376A JPS5136752B1 (enExample) | 1971-04-15 | 1971-04-15 | |
| JP2437371 | 1971-04-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU515451A3 true SU515451A3 (ru) | 1976-05-25 |
Family
ID=26361874
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1773176A SU515451A3 (ru) | 1971-04-15 | 1972-04-14 | Способ получени производных аминофенилкетона или их солей |
Country Status (19)
| Country | Link |
|---|---|
| AR (1) | AR199993A1 (enExample) |
| AU (1) | AU442844B2 (enExample) |
| BE (1) | BE782098A (enExample) |
| CA (1) | CA976168A (enExample) |
| CH (1) | CH568321A5 (enExample) |
| CS (1) | CS179967B2 (enExample) |
| DD (1) | DD98682A5 (enExample) |
| DE (1) | DE2218190B2 (enExample) |
| DK (1) | DK139300B (enExample) |
| ES (1) | ES401724A1 (enExample) |
| FI (1) | FI53820C (enExample) |
| FR (1) | FR2133610B1 (enExample) |
| GB (1) | GB1364354A (enExample) |
| IL (1) | IL39204A (enExample) |
| NL (1) | NL7205038A (enExample) |
| NO (1) | NO134744C (enExample) |
| PL (1) | PL88960B1 (enExample) |
| SE (1) | SE379355B (enExample) |
| SU (1) | SU515451A3 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2720406C2 (ru) * | 2014-06-02 | 2020-04-29 | Эстеве Фармасьютикалз, С.А. | Алкильные производные 1-окса-4,9-диазаспироундекановых соединений, обладающих мультимодальной активностью, направленной против боли |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2416397C1 (ru) * | 2009-11-09 | 2011-04-20 | Общество с ограниченной ответственностью "Лечебно-реабилитационный научный центр "Феникс" | Способ лечения депрессии, резистентной к психофармакотерапии |
-
1972
- 1972-04-07 FR FR7212253A patent/FR2133610B1/fr not_active Expired
- 1972-04-11 CH CH532672A patent/CH568321A5/xx not_active IP Right Cessation
- 1972-04-11 NO NO1232/72A patent/NO134744C/no unknown
- 1972-04-12 AU AU41063/72A patent/AU442844B2/en not_active Expired
- 1972-04-12 IL IL39204A patent/IL39204A/xx unknown
- 1972-04-12 CA CA139,521A patent/CA976168A/en not_active Expired
- 1972-04-13 FI FI1050/72A patent/FI53820C/fi active
- 1972-04-13 GB GB1715772A patent/GB1364354A/en not_active Expired
- 1972-04-13 PL PL1972154697A patent/PL88960B1/xx unknown
- 1972-04-13 ES ES401724A patent/ES401724A1/es not_active Expired
- 1972-04-14 CS CS7200002535A patent/CS179967B2/cs unknown
- 1972-04-14 AR AR241470A patent/AR199993A1/es active
- 1972-04-14 NL NL7205038A patent/NL7205038A/xx not_active Application Discontinuation
- 1972-04-14 DD DD162302A patent/DD98682A5/xx unknown
- 1972-04-14 DE DE19722218190 patent/DE2218190B2/de active Granted
- 1972-04-14 DK DK183472AA patent/DK139300B/da unknown
- 1972-04-14 SU SU1773176A patent/SU515451A3/ru active
- 1972-04-14 BE BE782098A patent/BE782098A/xx unknown
- 1972-04-14 SE SE7204889A patent/SE379355B/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2720406C2 (ru) * | 2014-06-02 | 2020-04-29 | Эстеве Фармасьютикалз, С.А. | Алкильные производные 1-окса-4,9-диазаспироундекановых соединений, обладающих мультимодальной активностью, направленной против боли |
Also Published As
| Publication number | Publication date |
|---|---|
| SE379355B (enExample) | 1975-10-06 |
| DK139300B (da) | 1979-01-29 |
| AU4106372A (en) | 1973-10-18 |
| ES401724A1 (es) | 1975-11-01 |
| AR199993A1 (es) | 1974-10-15 |
| CA976168A (en) | 1975-10-14 |
| DK139300C (enExample) | 1979-07-09 |
| DE2218190B2 (de) | 1977-01-20 |
| FR2133610B1 (enExample) | 1975-10-31 |
| NL7205038A (enExample) | 1972-10-17 |
| NO134744B (enExample) | 1976-08-30 |
| FI53820C (fi) | 1978-08-10 |
| BE782098A (fr) | 1972-07-31 |
| NO134744C (enExample) | 1976-12-08 |
| DE2218190A1 (de) | 1973-01-25 |
| GB1364354A (en) | 1974-08-21 |
| DD98682A5 (enExample) | 1973-07-05 |
| FR2133610A1 (enExample) | 1972-12-01 |
| IL39204A0 (en) | 1972-06-28 |
| PL88960B1 (enExample) | 1976-10-30 |
| CS179967B2 (en) | 1977-12-30 |
| AU442844B2 (en) | 1973-12-06 |
| IL39204A (en) | 1975-10-15 |
| FI53820B (fi) | 1978-05-02 |
| CH568321A5 (enExample) | 1975-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Adams et al. | The structure of monocrotaline, the alkaloid in Crotalaria spectabilis and Crotalaria retusa. I | |
| NO760003L (enExample) | ||
| SU652894A3 (ru) | Способ получени производных хиназолона или их солей | |
| SU515451A3 (ru) | Способ получени производных аминофенилкетона или их солей | |
| SU1722228A3 (ru) | Способ получени производных хинолинкарбоновой кислоты или ее метансульфонатной соли | |
| Wasserman et al. | The oxidation of heterocyclic systems by moleculr oxygen—IV: The photosensitized autoxidation of oxazoles | |
| Eade et al. | 464. Further studies on the sydnones | |
| SU923368A3 (ru) | Способ получени производных бензимидазола или их солей | |
| Richtmyer et al. | The Ring Structure of D-Altrosan1 | |
| Berson | The Self-Condensation of Phenacyl Bromide. The Structure of the Halogen Diphenacyls | |
| Franz et al. | Ozonolysis of cyclic olefins | |
| SU1230468A3 (ru) | Способ получени производных хиноксалин-1,4-диоксида | |
| SU1584751A3 (ru) | Способ получени ангидридов 6-фтор-7-хлор-1-метиламино-4-оксо-1,4-дигидрохинолин-3-карбоновой кислоты и борных кислот | |
| JPS5833843B2 (ja) | スイサンヨウ ヤクザイ | |
| JPH0225468A (ja) | イミダゾール誘導体及びその製造方法 | |
| US3271407A (en) | Certain isothiazolylacetic acid compounds | |
| US3476743A (en) | 6-isothiazolylacetamido penicillanic acids | |
| JPS58148817A (ja) | 強心剤 | |
| JPS58148861A (ja) | カルボスチリル誘導体 | |
| SU1227633A1 (ru) | Способ получени производных имидазо [4,5- @ ] индолов | |
| Barger et al. | CCCLXXXIV.—The constitution of laurotetanine | |
| US3761493A (en) | 3-dibromomethylphthalic anhydride | |
| JPS63250378A (ja) | インド−ル誘導体 | |
| FR2172868A1 (en) | Carboxy substd benzophenone derivs - as analgesics and antiinflammatory agents | |
| SU138611A1 (ru) | Способ приготовлени фурил-альфа-и тиснил-альфа-алкилкетонов |