SU507236A3 - Способ получени производных 1он-тиено-/3,2-с//1/бензазепина или их солей - Google Patents
Способ получени производных 1он-тиено-/3,2-с//1/бензазепина или их солейInfo
- Publication number
- SU507236A3 SU507236A3 SU1849433A SU1849433A SU507236A3 SU 507236 A3 SU507236 A3 SU 507236A3 SU 1849433 A SU1849433 A SU 1849433A SU 1849433 A SU1849433 A SU 1849433A SU 507236 A3 SU507236 A3 SU 507236A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- thieno
- compounds
- chloro
- solution
- formula
- Prior art date
Links
- DQFQCHIDRBIESA-UHFFFAOYSA-N 1-benzazepine Chemical compound N1C=CC=CC2=CC=CC=C12 DQFQCHIDRBIESA-UHFFFAOYSA-N 0.000 title description 19
- 238000000034 method Methods 0.000 title description 11
- 150000003839 salts Chemical class 0.000 title description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 40
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- 150000001875 compounds Chemical class 0.000 description 27
- 239000000243 solution Substances 0.000 description 23
- -1 p-nitrobenzylthio group Chemical group 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 11
- 238000010992 reflux Methods 0.000 description 10
- 229910052739 hydrogen Inorganic materials 0.000 description 9
- 239000001257 hydrogen Substances 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 150000002431 hydrogen Chemical class 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 239000003208 petroleum Substances 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- BZZKABPYTXDJQF-UHFFFAOYSA-N 1-benzazepin-4-one Chemical compound O=C1C=CN=C2C=CC=CC2=C1 BZZKABPYTXDJQF-UHFFFAOYSA-N 0.000 description 5
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 5
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- 230000029936 alkylation Effects 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- 125000005429 oxyalkyl group Chemical group 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000003245 coal Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 235000019439 ethyl acetate Nutrition 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000005932 reductive alkylation reaction Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- RYPVUNGPPCYIDC-UHFFFAOYSA-N 1,4-dioxane;propan-2-one Chemical compound CC(C)=O.C1COCCO1 RYPVUNGPPCYIDC-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- AQTKMJINQRNWEF-UHFFFAOYSA-N 2-[(2-isocyanatophenyl)methyl]thiophene Chemical compound O=C=NC1=CC=CC=C1CC1=CC=CS1 AQTKMJINQRNWEF-UHFFFAOYSA-N 0.000 description 1
- IIBJYECIXWQIBU-UHFFFAOYSA-N 2-[(4-chloro-2-isocyanatophenyl)methyl]thiophene Chemical compound O=C=NC1=CC(Cl)=CC=C1CC1=CC=CS1 IIBJYECIXWQIBU-UHFFFAOYSA-N 0.000 description 1
- HMDGYCQXXNBFNM-UHFFFAOYSA-N 2-[(5-chloro-2-isocyanophenyl)methyl]thiophene Chemical compound ClC1=CC=C([N+]#[C-])C(CC=2SC=CC=2)=C1 HMDGYCQXXNBFNM-UHFFFAOYSA-N 0.000 description 1
- JYYLQSCZISREGY-UHFFFAOYSA-N 2-amino-4-chlorobenzoic acid Chemical compound NC1=CC(Cl)=CC=C1C(O)=O JYYLQSCZISREGY-UHFFFAOYSA-N 0.000 description 1
- KESSXSWKJHRGHT-UHFFFAOYSA-N 3H-1-benzazocin-4-one Chemical compound C1=CC(=O)CC=NC2=CC=CC=C21 KESSXSWKJHRGHT-UHFFFAOYSA-N 0.000 description 1
- MZNMGOJKHAOFSZ-UHFFFAOYSA-N 4-chloro-2-(1-oxothiophen-2-yl)aniline Chemical compound NC1=CC=C(Cl)C=C1C1=CC=CS1=O MZNMGOJKHAOFSZ-UHFFFAOYSA-N 0.000 description 1
- MHOWVAPHXZSVJW-UHFFFAOYSA-N 4-chloro-2-(thiophen-2-ylmethyl)aniline Chemical compound NC1=CC=C(Cl)C=C1CC1=CC=CS1 MHOWVAPHXZSVJW-UHFFFAOYSA-N 0.000 description 1
- JJOCTMYAGFLYRV-UHFFFAOYSA-N 5,10-dihydrothieno[3,2-c][1]benzazepin-4-one Chemical compound O=C1NC2=CC=CC=C2CC2=C1C=CS2 JJOCTMYAGFLYRV-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- KDMINZODBKGLNW-UHFFFAOYSA-N 5-chloro-2-(1-oxothiophen-2-yl)aniline Chemical compound NC1=CC(Cl)=CC=C1C1=CC=CS1=O KDMINZODBKGLNW-UHFFFAOYSA-N 0.000 description 1
- LRIPSHYOGXWVIO-UHFFFAOYSA-N 5-chloro-2-(thiophen-2-ylmethyl)aniline Chemical compound NC1=CC(Cl)=CC=C1CC1=CC=CS1 LRIPSHYOGXWVIO-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- OKSUCCKLAIZTQH-UHFFFAOYSA-N Cl[P] Chemical compound Cl[P] OKSUCCKLAIZTQH-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- NIXKBAZVOQAHGC-UHFFFAOYSA-N phenylmethanesulfonic acid Chemical class OS(=O)(=O)CC1=CC=CC=C1 NIXKBAZVOQAHGC-UHFFFAOYSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/22—Radicals substituted by doubly bound hetero atoms, or by two hetero atoms other than halogen singly bound to the same carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1722571A CH559211A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1971-11-26 | 1971-11-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU507236A3 true SU507236A3 (ru) | 1976-03-15 |
Family
ID=4423739
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1849433A SU507236A3 (ru) | 1971-11-26 | 1972-11-24 | Способ получени производных 1он-тиено-/3,2-с//1/бензазепина или их солей |
| SU7401989491A SU576928A3 (ru) | 1971-11-26 | 1974-01-28 | Способ получени производных 1он-тиено(3,2-с) (1) бензазепина или их солей |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU7401989491A SU576928A3 (ru) | 1971-11-26 | 1974-01-28 | Способ получени производных 1он-тиено(3,2-с) (1) бензазепина или их солей |
Country Status (21)
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH592096A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1974-03-26 | 1977-10-14 | Sandoz Ag | |
| EP0001401A1 (en) * | 1977-09-29 | 1979-04-18 | Sandoz Ag | Thienobenzazepine derivatives, processes for their production and pharmaceutical compositions containing them |
| US4431589A (en) * | 1980-12-11 | 1984-02-14 | Lilly House | Benzodiazepine compounds and their use as pharmaceuticals |
| US4362727A (en) * | 1981-09-29 | 1982-12-07 | Basf Aktiengesellschaft | 5-Substituted 9-cyanomethylene-dithieno[3,4-b:4,3-e]-azepines and therapeutic agents which contain these compounds |
| US4459232A (en) * | 1981-12-07 | 1984-07-10 | Ciba-Geigy Corporation | Imidazo[1,2-c][1,3]benzodiazepines |
| EP2402309A1 (en) | 2002-05-24 | 2012-01-04 | Millennium Pharmaceuticals, Inc. | CCR9 inhibitors and methods of use thereof |
| US6939885B2 (en) * | 2002-11-18 | 2005-09-06 | Chemocentryx | Aryl sulfonamides |
| TW200808810A (en) * | 2006-02-23 | 2008-02-16 | Novartis Ag | Organic compounds |
-
0
- BE BE791902D patent/BE791902A/xx unknown
-
1971
- 1971-11-26 CH CH1722571A patent/CH559211A5/xx not_active IP Right Cessation
-
1972
- 1972-11-17 FI FI3245/72A patent/FI55202C/fi active
- 1972-11-17 SE SE7214978A patent/SE380527B/xx unknown
- 1972-11-20 US US00307924A patent/US3842082A/en not_active Expired - Lifetime
- 1972-11-21 NL NL7215726A patent/NL7215726A/xx not_active Application Discontinuation
- 1972-11-23 DD DD167134A patent/DD100953A5/xx unknown
- 1972-11-23 GB GB5417072A patent/GB1410963A/en not_active Expired
- 1972-11-23 DE DE2257443A patent/DE2257443A1/de active Pending
- 1972-11-23 CY CY988A patent/CY988A/xx unknown
- 1972-11-23 HU HUWA266A patent/HU164860B/hu unknown
- 1972-11-24 JP JP47117255A patent/JPS4862798A/ja active Pending
- 1972-11-24 AU AU49288/72A patent/AU476056B2/en not_active Expired
- 1972-11-24 FR FR7241907A patent/FR2161079B1/fr not_active Expired
- 1972-11-24 AT AT1003072A patent/AT340427B/de not_active IP Right Cessation
- 1972-11-24 SU SU1849433A patent/SU507236A3/ru active
- 1972-11-24 PL PL1972159071A patent/PL78769B1/pl unknown
- 1972-11-24 ES ES408956A patent/ES408956A1/es not_active Expired
-
1974
- 1974-01-28 SU SU7401989491A patent/SU576928A3/ru active
-
1979
- 1979-01-23 SG SG81/79A patent/SG8179G/en unknown
- 1979-02-15 HK HK83/79A patent/HK8379A/xx unknown
- 1979-12-30 MY MY109/79A patent/MY7900109A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU507236A3 (ru) | Способ получени производных 1он-тиено-/3,2-с//1/бензазепина или их солей | |
| US4405635A (en) | 4-Aroylimidazol-2-ones and their use as pharmaceuticals | |
| IL49205A (en) | 5-chloro-4-(2-imidazolin-2-ylamino)-2,1,3-benzothiadiazole its production and pharmaceutical compositions containing it | |
| NZ207428A (en) | Optionally heterocyclyl-substituted piperidinyl alkyl carboxamides and pharmaceutical compositions | |
| DK150071B (da) | Analogifremgangsmaade til fremstilling af imidazoquinoliner eller salte deraf | |
| NZ562541A (en) | Dihydropyridine derivatives | |
| US4176190A (en) | Diuretic and saliuretic sulphamoylbenzoic acids | |
| KR860001338B1 (ko) | 4-아로일이미다졸-2-온의 제조방법 | |
| US4247555A (en) | 4,9-Dihydro-9-oxo-N-1H-tetrazol-5-yl-pyrazolo[5,1-b]-quinazoline-2-carboxamides and antiallergic compositions and methods using them | |
| US3960854A (en) | 7-Mercapto(or thio)-benzothiadiazine products | |
| GB2099419A (en) | Imidazothizole derivatives | |
| EP0015065B1 (en) | Pyrazolo (5,1-b) quinazolin-9(4h)-one derivatives, process for their preparation and pharmaceutical compositions containing them | |
| SU591150A3 (ru) | Способ получени производных нитроимидазолилтриазолопиридазина или их солей | |
| CA1173831A (en) | Process for the manufacture of novel polyazaheterocyclic compounds | |
| US2641597A (en) | Furans and method of production | |
| US4600709A (en) | Benzodioxole derivatives, processes for the manufacture thereof and corresponding pharmaceutical compositions | |
| CA1138868A (en) | Quinoxaline-di-n-oxide derivatives | |
| US3557153A (en) | N-acylated benzene-2,4-disulfonamides and process for preparing them | |
| US2740785A (en) | 4-hydroxy-5-alkyl-6-arylpyrimidine derivatives | |
| Yasuda et al. | Synthesis of novel 1, 3‐dithiolan‐2‐one derivatives | |
| CA1051892A (en) | Triazolocycloalkylhydrothiadiazine derivatives | |
| CZ252493A3 (en) | Novel heterocyclic compounds with anti-asthmatic anti-allergic antiphlogistic, positively inotropic and blood pressure reducing activity | |
| US4761474A (en) | 3-(1H-tetrazol-5-yl)thieno[2,3-d]pyrimidin-4(3H)-ones | |
| US2723978A (en) | 2-amino-5-alkenyl-6-phenyl-4-pyrimidols | |
| SU1705287A1 (ru) | Производные 2-амино-1,2,3,4-тетрагидроизохинолина, обладающие салуретическим действием |