SU495824A3 - Способ получени незамещенных или замещенных пара-или мета-фенилендиаминов - Google Patents
Способ получени незамещенных или замещенных пара-или мета-фенилендиаминовInfo
- Publication number
- SU495824A3 SU495824A3 SU1899019A SU1899019A SU495824A3 SU 495824 A3 SU495824 A3 SU 495824A3 SU 1899019 A SU1899019 A SU 1899019A SU 1899019 A SU1899019 A SU 1899019A SU 495824 A3 SU495824 A3 SU 495824A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- meta
- unsubstituted
- phenylenediamine
- obtaining
- substituted para
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 3
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical class NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 title 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical class NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 title 1
- 238000006243 chemical reaction Methods 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- 229910000410 antimony oxide Inorganic materials 0.000 description 6
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 6
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical class OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- HZLCGUXUOFWCCN-UHFFFAOYSA-N 2-hydroxynonadecane-1,2,3-tricarboxylic acid Chemical compound CCCCCCCCCCCCCCCCC(C(O)=O)C(O)(C(O)=O)CC(O)=O HZLCGUXUOFWCCN-UHFFFAOYSA-N 0.000 description 1
- UFMBOFGKHIXOTA-UHFFFAOYSA-N 2-methylterephthalic acid Chemical compound CC1=CC(C(O)=O)=CC=C1C(O)=O UFMBOFGKHIXOTA-UHFFFAOYSA-N 0.000 description 1
- YTLWDDZIUHEODJ-UHFFFAOYSA-N 4-methylcyclohexa-1,5-diene-1,4-dicarboxylic acid Chemical compound OC(=O)C1(C)CC=C(C(O)=O)C=C1 YTLWDDZIUHEODJ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 239000008896 Opium Substances 0.000 description 1
- 235000001484 Trigonella foenum graecum Nutrition 0.000 description 1
- 244000250129 Trigonella foenum graecum Species 0.000 description 1
- 101100184148 Xenopus laevis mix-a gene Proteins 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 229940040563 agaric acid Drugs 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 238000010009 beating Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- ZJQHPWUVQPJPQT-UHFFFAOYSA-N muscimol Chemical compound NCC1=CC(=O)NO1 ZJQHPWUVQPJPQT-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229960001027 opium Drugs 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- MHSKRLJMQQNJNC-UHFFFAOYSA-N terephthalamide Chemical compound NC(=O)C1=CC=C(C(N)=O)C=C1 MHSKRLJMQQNJNC-UHFFFAOYSA-N 0.000 description 1
- 150000003503 terephthalic acid derivatives Chemical class 0.000 description 1
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical compound OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polyamides (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722216028 DE2216028C3 (de) | 1972-04-01 | 1972-04-01 | Verfahren zur Herstellung von unsubstituierten und substituierten p- und m-Phenylendiaminen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU495824A3 true SU495824A3 (ru) | 1975-12-15 |
Family
ID=5840878
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1899019A SU495824A3 (ru) | 1972-04-01 | 1973-03-30 | Способ получени незамещенных или замещенных пара-или мета-фенилендиаминов |
Country Status (13)
| Country | Link |
|---|---|
| JP (1) | JPS5754500B2 (enExample) |
| AT (1) | AT321887B (enExample) |
| BE (1) | BE797562A (enExample) |
| CA (1) | CA1010896A (enExample) |
| CH (1) | CH590203A5 (enExample) |
| DD (1) | DD107437A5 (enExample) |
| DE (1) | DE2216028C3 (enExample) |
| ES (1) | ES413229A1 (enExample) |
| FR (1) | FR2178975B1 (enExample) |
| GB (1) | GB1399407A (enExample) |
| IT (1) | IT988135B (enExample) |
| NL (1) | NL7304532A (enExample) |
| SU (1) | SU495824A3 (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4254272A (en) * | 1979-02-21 | 1981-03-03 | The Goodyear Tire & Rubber Company | Aromatic diamines and polyurethanes cured thereby |
| DE3126435A1 (de) * | 1981-07-04 | 1983-01-20 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von gegebenenfalls zelligen polyurethan-polyharnstoff-formkoerpern und alkylsubstituierte phenylendiamine hierzu |
| DE3309913A1 (de) * | 1983-03-19 | 1984-09-27 | Henkel KGaA, 4000 Düsseldorf | Neue 2,4-diaminobenzolderivate als kuppler fuer oxidationshaarfaerbemittel |
| RU2378248C1 (ru) * | 2008-10-27 | 2010-01-10 | Открытое акционерное общество "Каустик" (ОАО "Каустик") | СПОСОБ ПОЛУЧЕНИЯ п-ФЕНИЛЕНДИАМИНА |
| CN102276376B (zh) * | 2010-06-13 | 2013-08-28 | 华东理工大学 | 轴手性二胺衍生物的制备方法 |
| WO2019070981A1 (en) | 2017-10-05 | 2019-04-11 | Novomer, Inc. | ISOCYANATES, DERIVATIVES, AND THEIR PRODUCTION PROCESSES |
| CN111018720B (zh) * | 2019-12-16 | 2021-01-22 | 上海交通大学 | 间苯二胺的制备方法 |
-
1972
- 1972-04-01 DE DE19722216028 patent/DE2216028C3/de not_active Expired
-
1973
- 1973-03-13 IT IT4877773A patent/IT988135B/it active
- 1973-03-28 CA CA167,378A patent/CA1010896A/en not_active Expired
- 1973-03-29 DD DD16981973A patent/DD107437A5/xx unknown
- 1973-03-30 AT AT282373A patent/AT321887B/de not_active IP Right Cessation
- 1973-03-30 SU SU1899019A patent/SU495824A3/ru active
- 1973-03-30 CH CH459873A patent/CH590203A5/xx not_active IP Right Cessation
- 1973-03-30 GB GB1544073A patent/GB1399407A/en not_active Expired
- 1973-03-30 BE BE129465A patent/BE797562A/xx not_active IP Right Cessation
- 1973-03-30 FR FR7311668A patent/FR2178975B1/fr not_active Expired
- 1973-03-31 ES ES413229A patent/ES413229A1/es not_active Expired
- 1973-03-31 NL NL7304532A patent/NL7304532A/xx not_active Application Discontinuation
- 1973-04-02 JP JP3772173A patent/JPS5754500B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5754500B2 (enExample) | 1982-11-18 |
| CA1010896A (en) | 1977-05-24 |
| FR2178975A1 (enExample) | 1973-11-16 |
| DE2216028C3 (de) | 1979-06-28 |
| DE2216028B2 (de) | 1978-11-02 |
| NL7304532A (enExample) | 1973-10-03 |
| ES413229A1 (es) | 1976-01-01 |
| AT321887B (de) | 1975-04-25 |
| CH590203A5 (enExample) | 1977-07-29 |
| DD107437A5 (enExample) | 1974-08-05 |
| IT988135B (it) | 1975-04-10 |
| GB1399407A (en) | 1975-07-02 |
| FR2178975B1 (enExample) | 1978-03-10 |
| BE797562A (fr) | 1973-07-16 |
| JPS4992031A (enExample) | 1974-09-03 |
| DE2216028A1 (de) | 1973-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK159878B (da) | Fremgangsmaade til fremstilling af 2-amino-3-carbethoxyamino-6-(p-fluor-benzylamino)-pyridin-maleat | |
| US3703542A (en) | Hydroxamic acid derivatives of 1-amino-cyclohexanecarboxylic acid | |
| DE69204806T2 (de) | 1-Cyanomethyl-4-carboxymethyl-3-ketopiperazine, ihre Salze und Verfahren zu ihrer Herstellung. | |
| US2066742A (en) | Antimony compounds of polyhydroxy carboxylic acids and process of making them | |
| Forsman et al. | The Reactions of Phenyl Esters of Phosphorous Acid with Iodine1 | |
| US2430874A (en) | Preparation of ethyleneurea | |
| DE69518888T2 (de) | Verfahren zur Herstellung von N-vinylverbindungen | |
| US499927A (en) | Prosper monnet | |
| Sell et al. | XCVIII.—Studies on citrazinic acid. Part V | |
| US1117352A (en) | Alkali metal salts of 3.3<1>-diamino-4.4<1>dioxyarsenobenzene combined with copper and process of making same. | |
| SU100591A1 (ru) | Способ получени бисульфитного соединени ализарин-хинолина-3 | |
| US2043547A (en) | Diamino-pyridine o-hydroxy benzoic acid salts | |
| US1485380A (en) | Therapeutic compound and process of producing the same | |
| DE2048912C3 (de) | Verfahren zur Herstellung von l-Aminoalkan-l.l-diphosphonsäuren | |
| US602646A (en) | Officex | |
| US535270A (en) | Richard auschutz | |
| US1604143A (en) | Bismuth compound of aminophenols and process of making same | |
| SU466232A1 (ru) | Споссоб получени конденсированных пиримидо- -триазиниевых соединений с мостиковыми атомами азота | |
| SU348063A1 (ru) | Способ получени комплексной соли карбамида двухзамещенного фосфата меди | |
| SU644375A3 (ru) | Способ получени 3-цианамидо4-трифторметил-2,6-динитроанилинов или их основных солей | |
| DE682256C (de) | Verfahren zur Herstellung neuer saurer quartaerer Ammoniumoxalate | |
| SU372209A1 (enExample) | ||
| US555711A (en) | Ijruno richard setfert | |
| US708511A (en) | Paramethyl-amidophenyl-glyoxylic acid and process of making same. | |
| US913940A (en) | Manufacture of homologues of para-aminophenylarsinic acids. |