SU489336A3 - Способ получени фосфорорганических производных изотиазола - Google Patents
Способ получени фосфорорганических производных изотиазолаInfo
- Publication number
- SU489336A3 SU489336A3 SU1913402A SU1913402A SU489336A3 SU 489336 A3 SU489336 A3 SU 489336A3 SU 1913402 A SU1913402 A SU 1913402A SU 1913402 A SU1913402 A SU 1913402A SU 489336 A3 SU489336 A3 SU 489336A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carbon atoms
- isothiazole
- hydroxy
- mixture
- evaporated
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 5
- 150000003854 isothiazoles Chemical class 0.000 title description 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 125000004432 carbon atom Chemical group C* 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- -1 alkylthio radical Chemical class 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 239000002480 mineral oil Substances 0.000 description 4
- 235000010446 mineral oil Nutrition 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- CIVRVDZNKIRSJO-UHFFFAOYSA-N 5-methyl-3-oxo-1,2-thiazole-4-carbonitrile Chemical compound CC=1SN=C(O)C=1C#N CIVRVDZNKIRSJO-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- MGIYRDNGCNKGJU-UHFFFAOYSA-N isothiazolinone Chemical group O=C1C=CSN1 MGIYRDNGCNKGJU-UHFFFAOYSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N methyl pentane Natural products CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- HBNHMPUHGSRIIN-UHFFFAOYSA-N 5-methyl-3-oxo-1,2-thiazole-4-carboxamide Chemical compound CC=1SN=C(O)C=1C(N)=O HBNHMPUHGSRIIN-UHFFFAOYSA-N 0.000 description 1
- GCJTZGLHWFXNSS-UHFFFAOYSA-N 5-phenyl-1,2-thiazole Chemical compound S1N=CC=C1C1=CC=CC=C1 GCJTZGLHWFXNSS-UHFFFAOYSA-N 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 101100208721 Mus musculus Usp5 gene Proteins 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- NGFFLHMFSINFGB-UHFFFAOYSA-N [chloro(methoxy)phosphoryl]oxymethane Chemical compound COP(Cl)(=O)OC NGFFLHMFSINFGB-UHFFFAOYSA-N 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LJSQFQKUNVCTIA-UHFFFAOYSA-N diethyl sulfide Chemical group CCSCC LJSQFQKUNVCTIA-UHFFFAOYSA-N 0.000 description 1
- PWWSSIYVTQUJQQ-UHFFFAOYSA-N distearyl thiodipropionate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCCCCCCCC PWWSSIYVTQUJQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- KONIYTHNVWYBMP-UHFFFAOYSA-N ethylcyclohexane Chemical compound [CH2-]C[C+]1CCCCC1 KONIYTHNVWYBMP-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- IBIRZFNPWYRWOG-UHFFFAOYSA-N phosphane;phosphoric acid Chemical class P.OP(O)(O)=O IBIRZFNPWYRWOG-UHFFFAOYSA-N 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7217578A FR2184438B1 (enExample) | 1972-05-17 | 1972-05-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU489336A3 true SU489336A3 (ru) | 1975-10-25 |
Family
ID=9098637
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1913402A SU489336A3 (ru) | 1972-05-17 | 1973-05-16 | Способ получени фосфорорганических производных изотиазола |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS4941371A (enExample) |
| BE (1) | BE799614A (enExample) |
| BG (1) | BG26799A3 (enExample) |
| BR (1) | BR7303538D0 (enExample) |
| CH (1) | CH571820A5 (enExample) |
| DD (1) | DD108195A5 (enExample) |
| DE (1) | DE2325043A1 (enExample) |
| EG (1) | EG10879A (enExample) |
| ES (1) | ES414789A1 (enExample) |
| FR (1) | FR2184438B1 (enExample) |
| GB (1) | GB1397882A (enExample) |
| HU (1) | HU168973B (enExample) |
| IL (1) | IL42161A (enExample) |
| IT (1) | IT986086B (enExample) |
| NL (1) | NL7306802A (enExample) |
| OA (1) | OA04374A (enExample) |
| SU (1) | SU489336A3 (enExample) |
-
1972
- 1972-05-17 FR FR7217578A patent/FR2184438B1/fr not_active Expired
-
1973
- 1973-04-27 OA OA54890A patent/OA04374A/xx unknown
- 1973-05-01 IL IL42161A patent/IL42161A/en unknown
- 1973-05-04 CH CH637873A patent/CH571820A5/xx not_active IP Right Cessation
- 1973-05-15 DD DD17084973A patent/DD108195A5/xx unknown
- 1973-05-15 BR BR353873A patent/BR7303538D0/pt unknown
- 1973-05-15 BG BG023612A patent/BG26799A3/xx unknown
- 1973-05-16 BE BE131183A patent/BE799614A/xx unknown
- 1973-05-16 SU SU1913402A patent/SU489336A3/ru active
- 1973-05-16 ES ES414789A patent/ES414789A1/es not_active Expired
- 1973-05-16 NL NL7306802A patent/NL7306802A/xx not_active Application Discontinuation
- 1973-05-16 EG EG18373A patent/EG10879A/xx active
- 1973-05-17 GB GB2351073A patent/GB1397882A/en not_active Expired
- 1973-05-17 DE DE19732325043 patent/DE2325043A1/de active Pending
- 1973-05-17 IT IT5005373A patent/IT986086B/it active
- 1973-05-17 HU HURO000729 patent/HU168973B/hu unknown
- 1973-05-17 JP JP5421373A patent/JPS4941371A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4941371A (enExample) | 1974-04-18 |
| IT986086B (it) | 1975-01-10 |
| EG10879A (en) | 1976-10-31 |
| FR2184438B1 (enExample) | 1974-07-26 |
| IL42161A0 (en) | 1973-07-30 |
| NL7306802A (enExample) | 1973-11-20 |
| OA04374A (fr) | 1980-02-15 |
| DE2325043A1 (de) | 1973-12-06 |
| HU168973B (enExample) | 1976-08-28 |
| GB1397882A (en) | 1975-06-18 |
| BG26799A3 (bg) | 1979-06-12 |
| BE799614A (fr) | 1973-11-16 |
| CH571820A5 (enExample) | 1976-01-30 |
| ES414789A1 (es) | 1976-01-16 |
| DD108195A5 (enExample) | 1974-09-12 |
| FR2184438A1 (enExample) | 1973-12-28 |
| IL42161A (en) | 1976-06-30 |
| BR7303538D0 (pt) | 1974-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3364229A (en) | 1, 4 dithiin-2, 3, 5, 6-tetracarboximides and process for their preparation | |
| US4329479A (en) | Process for producing 1,3-dithiol-2-ylidene malonic acid dialkyl esters | |
| JPS5834474B2 (ja) | チアゾリジン誘導体の製造法 | |
| US4230873A (en) | Thiophene derivatives | |
| SU489336A3 (ru) | Способ получени фосфорорганических производных изотиазола | |
| US3481948A (en) | 2,2 - disubstituted - 3 - acyl - 5alpha - azidothiazolidine-4-carboxylic acids and derivatives | |
| US2984669A (en) | N-methyl-benzoxazolone esters of thiophosphoric and dithiophosphoric acids | |
| KR910004673B1 (ko) | 2,3-디아미노아크릴로니트릴 유도체 | |
| US4046774A (en) | Process for N-phosphorylation of heterocyclic amines | |
| SU730309A3 (ru) | Способ получени 3-алкил-5-изохинолилиминотиазоло-(3,4-б) изохинолинов, или их оптических изомеров, или смесей их оптических изомеров или их солей | |
| US4888429A (en) | Process for producing allyl aminothiazole acetate intermediates | |
| US4258194A (en) | Process for producing 2,3,5-trichloropyridine | |
| US4259495A (en) | Process for producing 2,3,5,6-tetrachloropyridine | |
| US4786747A (en) | Substituted benzamides | |
| US2912467A (en) | Phosphoranes and method for the preparation thereof | |
| TW202434114A (zh) | 草銨膦或其衍生物的製備方法 | |
| US4457873A (en) | Process for preparing phosphonomethylated amino acids | |
| SU797579A3 (ru) | Способ получени амидов кислот или ихСОлЕй C щЕлОчНыМи МЕТАллАМи или ТРиАл-КилАМиНАМи | |
| US3725422A (en) | New organic sulfur compounds and methods for their production | |
| US4628109A (en) | 2-ketosulfonamides and process for their preparation | |
| US4191823A (en) | Process for the preparation of oxaprostaglandin intermediates | |
| US3364245A (en) | Phosphonium salts | |
| US4347373A (en) | Derivatives of 4-methyl-5-[(2-aminoethyl)-thiomethyl]-imidazole | |
| SU730303A3 (ru) | Способ получени производных тиазолидинкарбоновых кислот или их кислотно-аддитивных солей | |
| HU203071B (en) | Process for producing cyclohexane-1,3,5-triones |