SU469243A3 - Способ получени акриламида или метакриламида - Google Patents
Способ получени акриламида или метакриламидаInfo
- Publication number
- SU469243A3 SU469243A3 SU1724583A SU1724583A SU469243A3 SU 469243 A3 SU469243 A3 SU 469243A3 SU 1724583 A SU1724583 A SU 1724583A SU 1724583 A SU1724583 A SU 1724583A SU 469243 A3 SU469243 A3 SU 469243A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- copper
- acrylamide
- acrylonitrile
- amount
- conversion
- Prior art date
Links
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 title claims description 20
- 238000000034 method Methods 0.000 title claims description 6
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 title claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 33
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 20
- 239000010949 copper Substances 0.000 claims description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 10
- 229910052802 copper Inorganic materials 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 7
- 150000001879 copper Chemical class 0.000 claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 claims description 2
- -1 fatty acid copper salt Chemical class 0.000 claims description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims 1
- 229910002651 NO3 Inorganic materials 0.000 claims 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims 1
- 239000002253 acid Substances 0.000 claims 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 claims 1
- 235000014113 dietary fatty acids Nutrition 0.000 claims 1
- 229930195729 fatty acid Natural products 0.000 claims 1
- 239000000194 fatty acid Substances 0.000 claims 1
- 235000013310 margarine Nutrition 0.000 claims 1
- 239000003264 margarine Substances 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 claims 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 claims 1
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 10
- 239000012295 chemical reaction liquid Substances 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 7
- 238000004817 gas chromatography Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 5
- 239000006227 byproduct Substances 0.000 description 5
- 229910001431 copper ion Inorganic materials 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 229910000365 copper sulfate Inorganic materials 0.000 description 4
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 238000003969 polarography Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/02—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
- C07C233/09—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals with carbon atoms of carboxamide groups bound to carbon atoms of an acyclic unsaturated carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP45110514A JPS5012409B1 (https=) | 1970-12-14 | 1970-12-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU469243A3 true SU469243A3 (ru) | 1975-04-30 |
Family
ID=14537707
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1724583A SU469243A3 (ru) | 1970-12-14 | 1971-12-13 | Способ получени акриламида или метакриламида |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3911009A (https=) |
| JP (1) | JPS5012409B1 (https=) |
| BE (1) | BE784779A (https=) |
| CA (1) | CA930377A (https=) |
| CH (1) | CH565742A5 (https=) |
| FR (1) | FR2118517A5 (https=) |
| GB (1) | GB1347160A (https=) |
| IT (1) | IT943936B (https=) |
| NL (1) | NL150430B (https=) |
| SU (1) | SU469243A3 (https=) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5720294B2 (https=) * | 1973-06-05 | 1982-04-27 | ||
| JPS5122790A (ja) * | 1974-08-16 | 1976-02-23 | Mitsubishi Chem Ind | Akuriruamidojugotaino seizohoho |
| US4096184A (en) * | 1976-01-19 | 1978-06-20 | Sumitomo Chemical Company, Limited | Process for preparing acid amides |
| JPS52100418A (en) * | 1976-02-17 | 1977-08-23 | Mitsui Toatsu Chem Inc | Purification of acrylamide aqueous solution |
| JPS5323042U (https=) * | 1976-08-06 | 1978-02-27 | ||
| US4233240A (en) * | 1977-02-14 | 1980-11-11 | American Cyanamid Company | Stabilization of acrylamide solutions |
| US4322532A (en) | 1980-11-17 | 1982-03-30 | Nalco Chemical Company | Solvents for the catalytic production of acrylamide from acrylonitrile and water |
| DE3264935D1 (en) * | 1981-10-29 | 1985-08-29 | Allied Colloids Ltd | Hydration of nitriles |
| DE3343673A1 (de) * | 1983-12-02 | 1985-09-05 | Basf Ag, 6700 Ludwigshafen | Verfahren zur gleichzeitigen herstellung von nitrilen und acrylamid bzw. methacrylamid |
| US4820872A (en) * | 1984-07-17 | 1989-04-11 | Allied Colloids Ltd. | Process for hydrolyzing nitriles |
| DE3767365D1 (de) * | 1986-05-21 | 1991-02-21 | Allied Colloids Ltd | Katalysatoren und ihre verwendung fuer die hydrolyse von nitrilen. |
| IN170143B (https=) * | 1987-12-16 | 1992-02-15 | Mitsui Toatsu Chemicals | |
| US4861268A (en) * | 1988-06-13 | 1989-08-29 | Transpharm Group | Tooth-anchored beneficial agent delivery device |
| US5072024A (en) * | 1990-04-27 | 1991-12-10 | The Standard Oil Company | Synthesis of N-substituted amides by condensation of nitriles with certain organic hydroxyl compounds |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3381034A (en) * | 1965-06-30 | 1968-04-30 | Standard Oil Co | Process for hydrolyzing nitriles |
| US3597481A (en) * | 1969-01-16 | 1971-08-03 | Dow Chemical Co | Heterogeneous catalyst for the liquid phase hydrolysis of nitriles to amides |
| US3758578A (en) * | 1969-06-23 | 1973-09-11 | Dow Chemical Co | Hydration of nitriles to amides using cupreous catalysts |
| US3642894A (en) * | 1969-12-05 | 1972-02-15 | Dow Chemical Co | Catalysts for the hydration of nitriles to amides |
| JPS547754B1 (https=) * | 1970-12-24 | 1979-04-10 |
-
1970
- 1970-12-14 JP JP45110514A patent/JPS5012409B1/ja active Pending
-
1971
- 1971-12-06 US US205137A patent/US3911009A/en not_active Expired - Lifetime
- 1971-12-10 FR FR7144421A patent/FR2118517A5/fr not_active Expired
- 1971-12-10 NL NL717117007A patent/NL150430B/xx not_active IP Right Cessation
- 1971-12-13 SU SU1724583A patent/SU469243A3/ru active
- 1971-12-13 CA CA129949A patent/CA930377A/en not_active Expired
- 1971-12-13 GB GB5782371A patent/GB1347160A/en not_active Expired
- 1971-12-14 CH CH1822971A patent/CH565742A5/xx not_active IP Right Cessation
- 1971-12-14 IT IT32363/71A patent/IT943936B/it active
-
1972
- 1972-06-13 BE BE784779A patent/BE784779A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1347160A (en) | 1974-02-27 |
| JPS5012409B1 (https=) | 1975-05-12 |
| DE2162093B2 (de) | 1976-08-05 |
| NL150430B (nl) | 1976-08-16 |
| IT943936B (it) | 1973-04-10 |
| US3911009A (en) | 1975-10-07 |
| FR2118517A5 (https=) | 1972-07-28 |
| BE784779A (fr) | 1972-10-02 |
| CH565742A5 (https=) | 1975-08-29 |
| CA930377A (en) | 1973-07-17 |
| NL7117007A (https=) | 1972-06-16 |
| DE2162093A1 (https=) | 1972-06-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU469243A3 (ru) | Способ получени акриламида или метакриламида | |
| JPS61275241A (ja) | 重水素化アクリル酸又は重水素化メタクリル酸の製造方法 | |
| Parsons et al. | Trifluoromethyl-substituted boranes. Trifluoromethyldibutylborane and trifluoromethylboron difluoride | |
| EP0109212B1 (en) | Process for the preparation of acids | |
| Olson et al. | Coördination Chain Reactions. Exchange between Ethylenediaminetetraacetatocuprate (II) and Triethylenetetraminenickel (II) | |
| Mann et al. | Partial oxidation of methane to formaldehyde over halogen modified catalyst | |
| JPS5855444A (ja) | カルボン酸エステルの製造法 | |
| US4465635A (en) | Manufacture of palladous carboxylates | |
| Haefele et al. | Catalyzed hydration of nitriles to amides | |
| DE1163302B (de) | Verfahren zur Herstellung von Dicyan | |
| US3389963A (en) | Catalytic decomposition of hydrogen peroxide | |
| US1723442A (en) | Process of chlorination of methane | |
| US3781351A (en) | Preparation of alpha-hydroyamides | |
| US3983161A (en) | Oxidation of unsaturated amines | |
| Misumi et al. | Polarographic and Potentiometric Studies of Indium (III)-and Europium (III)-Iminodiacetate Complexes | |
| FR2397389A1 (fr) | Procede de preparation d'alcoylesters d'acides carboxyliques | |
| Bach | Oxygen and peroxide effects in the radiation chemistry of organic liquids | |
| Pickart et al. | Equilibrium Constants of Substituted Benzophenones in the Meerwein-Ponndorf Reaction1 | |
| Kimura | The Kinetics of the Ligand Substitution Reaction of Copper (II)-nitrilotriacetate and-nitrilo (diacetic) propionate Complexes with trans-1, 2-Cyclohexanediaminetetraacetate Ions | |
| EP0165503A2 (en) | Process for the removal of acid gases from a gas mixture | |
| US3776931A (en) | Copper-containing compounds | |
| US3035088A (en) | Process for producing acrylic acid esters | |
| Vona et al. | Reactions of Alkyl Halides with Silver Nitrate in Pyridine1 | |
| DE1543986B2 (de) | Verfahren zur Herstellung von Propionsäure- oder Buttersäurenitril | |
| SU423271A3 (https=) |