SU440823A1 - - Google Patents
Info
- Publication number
- SU440823A1 SU440823A1 SU1727688A SU1727688A SU440823A1 SU 440823 A1 SU440823 A1 SU 440823A1 SU 1727688 A SU1727688 A SU 1727688A SU 1727688 A SU1727688 A SU 1727688A SU 440823 A1 SU440823 A1 SU 440823A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- aluminum
- dihydromethyl
- jasmonate
- cis
- isomer
- Prior art date
Links
- ZNJFBWYDHIGLCU-HWKXXFMVSA-N jasmonic acid Chemical compound CC\C=C/C[C@@H]1[C@@H](CC(O)=O)CCC1=O ZNJFBWYDHIGLCU-HWKXXFMVSA-N 0.000 claims description 16
- 229910052782 aluminium Inorganic materials 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 12
- -1 aluminum compound Chemical class 0.000 claims description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 4
- UAEJRRZPRZCUBE-UHFFFAOYSA-N trimethoxyalumane Chemical compound [Al+3].[O-]C.[O-]C.[O-]C UAEJRRZPRZCUBE-UHFFFAOYSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- 238000002955 isolation Methods 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 16
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- 238000005984 hydrogenation reaction Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 5
- 150000004862 dioxolanes Chemical class 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000006345 epimerization reaction Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- CEGOLXSVJUTHNZ-UHFFFAOYSA-K aluminium tristearate Chemical compound [Al+3].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CEGOLXSVJUTHNZ-UHFFFAOYSA-K 0.000 description 2
- 229940063655 aluminum stearate Drugs 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N methyl acetate Chemical compound COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- HPQURZRDYMUHJI-UHFFFAOYSA-N pentylcyclopentane Chemical compound CCCCCC1CCCC1 HPQURZRDYMUHJI-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910015900 BF3 Inorganic materials 0.000 description 1
- OXPRJQUCBLBLQJ-UHFFFAOYSA-N CC(C)C[O-].CC(C)C[O-].CC(C)C[O-].[Al+3].[Al+3] Chemical compound CC(C)C[O-].CC(C)C[O-].CC(C)C[O-].[Al+3].[Al+3] OXPRJQUCBLBLQJ-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- PKFWFAJEJALKKZ-UHFFFAOYSA-N ethane-1,2-diol;methoxymethanediol Chemical compound OCCO.COC(O)O PKFWFAJEJALKKZ-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- DEBVVCQFYJWTDA-UHFFFAOYSA-N hexadecylalumanylformic acid Chemical compound C([AlH]CCCCCCCCCCCCCCCC)(=O)O DEBVVCQFYJWTDA-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- KVWWIYGFBYDJQC-UHFFFAOYSA-N methyl dihydrojasmonate Chemical compound CCCCCC1C(CC(=O)OC)CCC1=O KVWWIYGFBYDJQC-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- NRQNMMBQPIGPTB-UHFFFAOYSA-N methylaluminum Chemical compound [CH3].[Al] NRQNMMBQPIGPTB-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- DAOVYDBYKGXFOB-UHFFFAOYSA-N tris(2-methylpropoxy)alumane Chemical compound [Al+3].CC(C)C[O-].CC(C)C[O-].CC(C)C[O-] DAOVYDBYKGXFOB-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7046407A FR2119177A5 (https=) | 1970-12-23 | 1970-12-23 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SU440823A3 SU440823A3 (https=) | 1974-08-25 |
| SU440823A1 true SU440823A1 (https=) | 1974-08-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Tsuji et al. | Palladium-catalyzed decarboxylation-allylation of allylic esters of. alpha.-substituted. beta.-keto carboxylic, malonic, cyanoacetic, and nitroacetic acids | |
| Kimel et al. | The rearrangement of allyl-type esters of β-keto acids | |
| Babler et al. | A facile method for the bishomologation of ketones to α, β-unsaturated aldehydes: application to the synthesis of the cyclohexanoid components of the boll weevil sex attractant | |
| McKeon et al. | The palladium (II) catalyzed vinyl interchange reaction—I | |
| US4128728A (en) | Production of 2,3,6-trimethylphenol | |
| Burness | β-Keto Acetals. II. Synthesis of 3-Methyl-and 3-Phenyl-furans | |
| US5371299A (en) | Process for the preparation of diethers | |
| SU440823A1 (https=) | ||
| IL159318A (en) | Method for producing 2-(alkyl) cycloalkenone | |
| US4435585A (en) | Process for the preparation of dihydrocinnamaldehyde derivatives | |
| US3823190A (en) | Process for the manufacture of cycloalkenones | |
| KR100651334B1 (ko) | 비타민 e 제조용 불포화 케톤의 제조방법 | |
| Silbert | Facile dehydrobromination ofvic‐dibromo fatty acids: A one‐vessel bromination‐dehydrobromination of oleic acid to stearolic acid | |
| JPH10147548A (ja) | γ,δ−不飽和ケトンの製法 | |
| SU578300A1 (ru) | Способ получени алициклических ненасыщенных сложных эфиров | |
| US3978135A (en) | Preparation of ethers from citronellal or homologues thereof | |
| EP0024770B1 (en) | Hydrolysis of allyl ethers and ketones thus prepared | |
| US4438286A (en) | Substituted esters and alcohols | |
| JP4464274B2 (ja) | アルキリデン置換−1,4−ジオン誘導体の製造法 | |
| CA1109486A (en) | Process for the production of di-n-propylacetic acid | |
| Shimizu et al. | Facile synthesis of. ALPHA.-keto acids and esters by palladium-catalyzed decarboxylation reactions of diallyl. ALPHA.-oxalcarboxylates. | |
| KR830002563B1 (ko) | 테트라하이드로푸란의 제조방법 | |
| JPS58203937A (ja) | 3−アシルサリチル酸誘導体の製造方法 | |
| US3173954A (en) | Preparation of hexaalkyl-1, 3, 5-cyclohexanetriones | |
| US3892814A (en) | Cyclopropane derivatives |