SU440820A1 - - Google Patents
Info
- Publication number
- SU440820A1 SU440820A1 SU1262580A SU1262580A SU440820A1 SU 440820 A1 SU440820 A1 SU 440820A1 SU 1262580 A SU1262580 A SU 1262580A SU 1262580 A SU1262580 A SU 1262580A SU 440820 A1 SU440820 A1 SU 440820A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- dichloroethanol
- reaction mixture
- isopropanol
- mixture
- chlorine
- Prior art date
Links
- 239000011541 reaction mixture Substances 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- KFZMGEQAYNKOFK-UHFFFAOYSA-N iso-propanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N methylene dichloride Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 239000000460 chlorine Substances 0.000 description 9
- 229910052801 chlorine Inorganic materials 0.000 description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 238000004821 distillation Methods 0.000 description 8
- -1 metal complex hydride Chemical class 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- KZBUYRJDOAKODT-UHFFFAOYSA-N chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- XAUFGFKZNMVWMK-UHFFFAOYSA-N 2,2-dichloro-1-(2,5-dichlorophenyl)ethanol Chemical compound ClC(Cl)C(O)C1=CC(Cl)=CC=C1Cl XAUFGFKZNMVWMK-UHFFFAOYSA-N 0.000 description 4
- XHODMTAOVMFHQJ-UHFFFAOYSA-N aluminum;propan-2-ol Chemical compound [Al].CC(C)O XHODMTAOVMFHQJ-UHFFFAOYSA-N 0.000 description 4
- 230000005587 bubbling Effects 0.000 description 4
- KWOLFJPFCHCOCG-UHFFFAOYSA-N methylphenylketone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 4
- 239000012429 reaction media Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- CTCJOMMEKYNBFZ-UHFFFAOYSA-N COC1=C(C=C(C=C1)Cl)C(C(Cl)Cl)O Chemical compound COC1=C(C=C(C=C1)Cl)C(C(Cl)Cl)O CTCJOMMEKYNBFZ-UHFFFAOYSA-N 0.000 description 3
- BVZZGLIFSCWAAM-UHFFFAOYSA-N ClC1=C(C=C(C=C1)C)C(C(Cl)Cl)O Chemical compound ClC1=C(C=C(C=C1)C)C(C(Cl)Cl)O BVZZGLIFSCWAAM-UHFFFAOYSA-N 0.000 description 3
- FXNVQNNWQXSTOH-UHFFFAOYSA-N ClC=1C=C(C=CC1Cl)C(C(Cl)Cl)O Chemical compound ClC=1C=C(C=CC1Cl)C(C(Cl)Cl)O FXNVQNNWQXSTOH-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- OAMHTTBNEJBIKA-UHFFFAOYSA-N 2,2,2-trichloro-1-phenylethanone Chemical compound ClC(Cl)(Cl)C(=O)C1=CC=CC=C1 OAMHTTBNEJBIKA-UHFFFAOYSA-N 0.000 description 2
- AYYZONLKSDKVIZ-UHFFFAOYSA-N 2,2-dichloro-1-(2-chlorophenyl)ethanol Chemical compound ClC(Cl)C(O)C1=CC=CC=C1Cl AYYZONLKSDKVIZ-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K Aluminium chloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- IMACFCSSMIZSPP-UHFFFAOYSA-N Phenacyl chloride Chemical compound ClCC(=O)C1=CC=CC=C1 IMACFCSSMIZSPP-UHFFFAOYSA-N 0.000 description 2
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 2
- 150000008062 acetophenones Chemical class 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000005712 crystallization Effects 0.000 description 2
- 238000010908 decantation Methods 0.000 description 2
- FBCCMZVIWNDFMO-UHFFFAOYSA-N dichloroacetyl chloride Chemical compound ClC(Cl)C(Cl)=O FBCCMZVIWNDFMO-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- WBPAOUHWPONFEQ-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C(Cl)=C1 WBPAOUHWPONFEQ-UHFFFAOYSA-N 0.000 description 1
- UUWJBXKHMMQDED-UHFFFAOYSA-N 1-(3-chlorophenyl)ethanone Chemical compound CC(=O)C1=CC=CC(Cl)=C1 UUWJBXKHMMQDED-UHFFFAOYSA-N 0.000 description 1
- BUZYGTVTZYSBCU-UHFFFAOYSA-N 1-(4-chlorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C=C1 BUZYGTVTZYSBCU-UHFFFAOYSA-N 0.000 description 1
- VLTJQHYMIFWMOD-UHFFFAOYSA-N 2,2,2-trichloro-1-(2-chlorophenyl)ethanone Chemical compound ClC1=CC=CC=C1C(=O)C(Cl)(Cl)Cl VLTJQHYMIFWMOD-UHFFFAOYSA-N 0.000 description 1
- NWQWQKUXRJYXFH-UHFFFAOYSA-N 2,2-Dichloroacetaldehyde Chemical compound ClC(Cl)C=O NWQWQKUXRJYXFH-UHFFFAOYSA-N 0.000 description 1
- INLMRTPMNPOFAV-UHFFFAOYSA-N 2,2-dichloro-1-(3-chlorophenyl)ethanol Chemical compound ClC(Cl)C(O)C1=CC=CC(Cl)=C1 INLMRTPMNPOFAV-UHFFFAOYSA-N 0.000 description 1
- XNSCLDYOTQWNGW-UHFFFAOYSA-N 2,2-dichloro-1-phenylethanol Chemical compound ClC(Cl)C(O)C1=CC=CC=C1 XNSCLDYOTQWNGW-UHFFFAOYSA-N 0.000 description 1
- VYWPPRLJNVHPEU-UHFFFAOYSA-N 2-chloro-1-(2,4-dichlorophenyl)ethanone Chemical compound ClCC(=O)C1=CC=C(Cl)C=C1Cl VYWPPRLJNVHPEU-UHFFFAOYSA-N 0.000 description 1
- YSXIQLPKHYUFPM-UHFFFAOYSA-N C(C)(=O)OC(C(Cl)Cl)C1=C(C=CC(=C1)Cl)Cl Chemical compound C(C)(=O)OC(C(Cl)Cl)C1=C(C=CC(=C1)Cl)Cl YSXIQLPKHYUFPM-UHFFFAOYSA-N 0.000 description 1
- JRRSPDOJKMQRDM-UHFFFAOYSA-N CC1=C(C=C(C=C1)Cl)C(C(Cl)Cl)O Chemical compound CC1=C(C=C(C=C1)Cl)C(C(Cl)Cl)O JRRSPDOJKMQRDM-UHFFFAOYSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000000875 corresponding Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N iodine atom Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000001184 potassium carbonate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- AKEBROIVCDHVSD-UHFFFAOYSA-N potassium;tetrafluoroborate Chemical compound [K+].F[B-](F)(F)F AKEBROIVCDHVSD-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000002194 synthesizing Effects 0.000 description 1
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
FR114639A FR1550129A (ja) | 1967-07-18 | 1967-07-18 |
Publications (2)
Publication Number | Publication Date |
---|---|
SU440820A1 true SU440820A1 (ja) | 1974-08-25 |
SU440820A3 SU440820A3 (ja) | 1974-08-25 |
Family
ID=8635277
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
SU1262580A SU440820A3 (ja) | 1967-07-18 | 1968-07-18 |
Country Status (2)
Country | Link |
---|---|
CS (1) | CS163725B2 (ja) |
SU (1) | SU440820A3 (ja) |
-
1968
- 1968-07-18 SU SU1262580A patent/SU440820A3/ru active
- 1968-07-18 CS CS526468A patent/CS163725B2/cs unknown
Similar Documents
Publication | Publication Date | Title |
---|---|---|
FERRIS | THE ACTION OF MINERAL ACID ON DIETHYL BIS (HYDROXYMETHYL) MALONATE1 | |
Baran | Method for the cleavage of osmate esters | |
NO155004B (no) | Nye ketaler av 2-halogen-1-(6'metoksy-2'-naftyl)-propan-1-en. | |
US4727181A (en) | Process for the preparation of α-halocinnamate esters | |
US4465862A (en) | Cyclopentendione and cyclopentenone | |
US3997577A (en) | Manufacture of lavandulol and its esters | |
EP0043479A1 (en) | Novel cyclopentenone derivatives and methods for the preparation of the novel compounds | |
SU440820A1 (ja) | ||
US3968124A (en) | Process for preparing phenyl-acetic acid esters | |
US4078008A (en) | Process for the preparation of dienes | |
US4304931A (en) | Biphenylhydroxypropionic acid derivatives | |
JPS6045631B2 (ja) | フエニルグリオキザル酸エステの製造法 | |
US4188491A (en) | Preparation of therapeutic compounds | |
US3910958A (en) | Process for preparing arylacetic acids and esters thereof | |
US4042617A (en) | Process for preparing a 2-methyl-(substituted aryl)-pyruvic acid compound | |
Cason et al. | Concerning the Mechanism of the Ester Acid Chloride Rearrangement | |
US3287372A (en) | Process and intermediates for manufacture of 2-(dialkylmethyl)-5-alkyl-2-cyclohexen-1-ones | |
JPS601292B2 (ja) | ジハイドロコエンザイムq類化合物の合成法 | |
US2451818A (en) | Vinylphenoxthines and method of preparing the same | |
US4057585A (en) | Method of preparing 2,3-dichloroanisole | |
EP1121338A1 (en) | Method for synthesizing diaryl-substituted heterocyclic compounds, including tetrahydrofurans | |
IE52041B1 (en) | Dioxolane derivatives for use as chemical intermediates | |
US1979614A (en) | Halogenated ethanol | |
AT344153B (de) | Verfahren zur herstellung neuer 2-alkyl-5-indanessigsaeure- und -alkylester-derivate | |
EP0306096B1 (en) | Process for preparing diphenyl ethers |