SU385442A1 - - Google Patents
Info
- Publication number
- SU385442A1 SU385442A1 SU24537A SU24537A SU385442A1 SU 385442 A1 SU385442 A1 SU 385442A1 SU 24537 A SU24537 A SU 24537A SU 24537 A SU24537 A SU 24537A SU 385442 A1 SU385442 A1 SU 385442A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- acid
- water
- general formula
- acetic acid
- hydrogen peroxide
- Prior art date
Links
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- MHAJPDPJQMAIIY-UHFFFAOYSA-N hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- SJSYJHLLBBSLIH-SDNWHVSQSA-N (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoic acid Chemical class COC1=CC=CC=C1\C=C(\C(O)=O)C1=CC=CC=C1 SJSYJHLLBBSLIH-SDNWHVSQSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- PDCHPGBRGBPVEZ-UHFFFAOYSA-N S1CCC(CC1)C1=C(C=C(C=C1)CC(=O)O)Cl Chemical compound S1CCC(CC1)C1=C(C=C(C=C1)CC(=O)O)Cl PDCHPGBRGBPVEZ-UHFFFAOYSA-N 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- RCCPEORTSYDPMB-UHFFFAOYSA-N hydroxy benzenecarboximidothioate Chemical compound OSC(=N)C1=CC=CC=C1 RCCPEORTSYDPMB-UHFFFAOYSA-N 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 2
- -1 alkali metal cyanide Chemical class 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 125000004435 hydrogen atoms Chemical group [H]* 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N Benzyl chloride Chemical class ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 101700072148 IAA2 Proteins 0.000 description 1
- 101710005767 POLR3C Proteins 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N Phenylacetic acid Natural products OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000004432 carbon atoms Chemical group C* 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000000875 corresponding Effects 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium(0) Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 150000004680 hydrogen peroxides Chemical class 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
Publications (5)
| Publication Number | Publication Date |
|---|---|
| SU385442A1 true SU385442A1 (fi) | |
| SU385441A1 SU385441A1 (ru) | |
| SU376940A1 SU376940A1 (ru) | |
| SU378005A1 SU378005A1 (fi) | |
| SU379083A1 SU379083A1 (fi) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0195247B1 (en) | Trisubstituted benzoic acid intermediates | |
| BR112019002192B1 (pt) | Processo para produzir cetoenóis cíclicos substituídos por espirocetal, e seus intermediários e seu processo de preparação | |
| JPH0383950A (ja) | グリセリド誘導体およびその製造法 | |
| SU385442A1 (fi) | ||
| SU786895A3 (ru) | Способ получени производных тиазолидин-,тиазан-или морфолинкарбоновых кислот или их кислотно-аддитивных солей | |
| JPS648616B2 (fi) | ||
| US5739342A (en) | Process for the preparation of nicotinic acids | |
| JPH04297461A (ja) | ２−チオヒダントイン誘導体 | |
| FI81808B (fi) | Foerfarande foer framstaellning av ursodesoxicholsyra fraon 3 ,7 ,12 -trihydroxicholansyra, samt anvaenda mellanprodukter. | |
| SU1189341A3 (ru) | Способ получени 5-(2-алкоксифенил)тиазолидиндионов или их основных солей с щелочными металлами | |
| US4284562A (en) | Process for preparing pyrrole-2-acetic acids | |
| US5081277A (en) | Process for the preparation of propionic acid derivatives | |
| JPH0489452A (ja) | 環式化合物 | |
| SU394969A1 (ru) | Способ получения бис-морфолиновых производных пиримидина | |
| KR890002253B1 (ko) | 티아졸 화합물의 제조방법 | |
| JPS644508B2 (fi) | ||
| SU376940A1 (ru) | Всесоюзная i | |
| US4385004A (en) | Esters of ortho-allylphenol useful for the preparation of arylacetic acid derivatives | |
| Rabjohn et al. | Some β, β-Dialkyl-Substituted Aliphatic Acids and Their Derivatives. | |
| SU793379A3 (ru) | Способ получени производных -нафтилпропионовой кислоты | |
| FI61878C (fi) | Foerfarande foer framstaellning av 1-etyl-2-(2'-metoxi-5'-sulfonamidobensoyl)-aminometylpyrrolidin och dess salter | |
| SU341231A1 (ru) | Способ получения гетероциклических карбоновых кислот | |
| HU201728B (en) | Process for producing 3-(2-halogenethylamino)-3-pentenedicarboxylic acid-dialkyl esters | |
| SU385441A1 (ru) | СПОСОБ ПОЛУЧЕНИЯПРОИЗВОДНЫХ ФЕНилуксусной кислоты | |
| US5648524A (en) | Method for the preparation of 3-benzylthio-2-alkylpropionic acid and its derivatives |