SU332632A1 - - Google Patents
Info
- Publication number
- SU332632A1 SU332632A1 SU1363971A SU1363971A SU332632A1 SU 332632 A1 SU332632 A1 SU 332632A1 SU 1363971 A SU1363971 A SU 1363971A SU 1363971 A SU1363971 A SU 1363971A SU 332632 A1 SU332632 A1 SU 332632A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- lower alkoxy
- contain
- carbon atoms
- halogen
- atoms
- Prior art date
Links
- 125000003545 alkoxy group Chemical group 0.000 claims description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 13
- 125000005843 halogen group Chemical group 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 5
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- IYCKMNAVTMOAKD-UHFFFAOYSA-N 1,2-thiazol-3-amine Chemical class NC=1C=CSN=1 IYCKMNAVTMOAKD-UHFFFAOYSA-N 0.000 claims description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- 239000011260 aqueous acid Substances 0.000 claims description 2
- 125000002837 carbocyclic group Chemical group 0.000 claims description 2
- 230000007062 hydrolysis Effects 0.000 claims description 2
- 238000006460 hydrolysis reaction Methods 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 235000019441 ethanol Nutrition 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000000859 sublimation Methods 0.000 description 5
- 230000008022 sublimation Effects 0.000 description 5
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- WIJQCPIRWXSWQG-UHFFFAOYSA-N 1,2-benzothiazol-3-amine Chemical compound C1=CC=C2C(N)=NSC2=C1 WIJQCPIRWXSWQG-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- AAXQROQCUYARLR-UHFFFAOYSA-N n-(1,2-benzothiazol-3-yl)acetamide Chemical compound C1=CC=C2C(NC(=O)C)=NSC2=C1 AAXQROQCUYARLR-UHFFFAOYSA-N 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- CSNIZNHTOVFARY-UHFFFAOYSA-N 1,2-benzothiazole Chemical compound C1=CC=C2C=NSC2=C1 CSNIZNHTOVFARY-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 125000002228 disulfide group Chemical group 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000004476 plant protection product Substances 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
Publications (1)
Publication Number | Publication Date |
---|---|
SU332632A1 true SU332632A1 (enrdf_load_html_response) |
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
FI64144C (fi) | Foerfarande foer framstaellning av 2-arylamino-2-imidazolinderivat | |
McKay | The Preparation of N-Substituted-N1-nitroguanidines by the Reaction of Primary Amines with N-Alkyl-N-nitroso-N1-nitroguanidines | |
FI59991B (fi) | Foerfarande foer framstaellning av 2-arylamino-2-imidazolin-derivat och deras salter | |
US4061647A (en) | Thiazolidine derivatives | |
US4791210A (en) | Process for the production of 5-methyltetrazole | |
SU332632A1 (enrdf_load_html_response) | ||
US3868418A (en) | Novel N-(ortho- and para-nitrobenzoyl)-sulfoximine intermediates and process for their production | |
US2701252A (en) | Isoindolenine compounds | |
US5382689A (en) | Process for preparation of bevantolol hydrochloride | |
IL28645A (en) | Tropine derivatives | |
HU220971B1 (hu) | Eljárás 0-(3-amino-2-hidroxi-propil)-hidroximsav-halogenidek előállítására | |
US3450709A (en) | Process for the preparation of ring-substituted 2-aminoimidazoles | |
US2525927A (en) | 2-nitramino delta 2-1, 3 diazacycloalkenes | |
SU555854A3 (ru) | Способ получени производных 1,3,4-тиадиазола или их солей | |
SU308579A1 (ru) | Всесоюзная па]1нш-у;?а;:^:^^' 5иблио -'г-^ | |
SU253685A1 (ru) | Способ получения замещенных карбоксамидотиазолов | |
KR0177151B1 (ko) | 페닐 프로피온산 유도체의 제조방법 | |
GB1570912A (en) | Aromatic sulphonamido derivatives and process for their manufacture | |
US2611770A (en) | N-(2-thiazolyl)-2-hydroxypyridine-5-sulfonamides | |
SU1261562A3 (ru) | Способ получени производных бензимидазола или их солей | |
SU346860A1 (enrdf_load_html_response) | ||
CN119095829A (zh) | 用于制备4-[5-[双(2-氯乙基)氨基]-1-甲基-1H-苯并[d]咪唑-2-基]丁酸烷基酯和甲酰化衍生物的方法 | |
EP0285655B1 (en) | Process for the preparation of quinoline-carboxylic acid derivatives | |
SU320119A1 (enrdf_load_html_response) | ||
SU249308A1 (enrdf_load_html_response) |