SU295246A1 - - Google Patents
Info
- Publication number
- SU295246A1 SU295246A1 SU1235629A SU1235629A SU295246A1 SU 295246 A1 SU295246 A1 SU 295246A1 SU 1235629 A SU1235629 A SU 1235629A SU 1235629 A SU1235629 A SU 1235629A SU 295246 A1 SU295246 A1 SU 295246A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- phosphoric acid
- phosphate
- soda
- mixture
- na2o
- Prior art date
Links
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 18
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 9
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 7
- 229910021529 ammonia Inorganic materials 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 claims description 4
- 229910019142 PO4 Inorganic materials 0.000 claims description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 4
- 239000000047 product Substances 0.000 claims description 4
- 235000019832 sodium triphosphate Nutrition 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 3
- 238000006386 neutralization reaction Methods 0.000 claims description 3
- 239000010452 phosphate Substances 0.000 claims description 3
- 238000000926 separation method Methods 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 230000003472 neutralizing effect Effects 0.000 claims description 2
- 239000002244 precipitate Substances 0.000 claims description 2
- 235000021317 phosphate Nutrition 0.000 claims 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims 2
- 238000002360 preparation method Methods 0.000 claims 2
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 239000013067 intermediate product Substances 0.000 claims 1
- -1 monosubstituted phosphate Chemical class 0.000 claims 1
- 238000007669 thermal treatment Methods 0.000 claims 1
- 238000000605 extraction Methods 0.000 description 4
- 239000012452 mother liquor Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 3
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- 229910000397 disodium phosphate Inorganic materials 0.000 description 2
- 235000019800 disodium phosphate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- CUXQLKLUPGTTKL-UHFFFAOYSA-M microcosmic salt Chemical compound [NH4+].[Na+].OP([O-])([O-])=O CUXQLKLUPGTTKL-UHFFFAOYSA-M 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU295246A1 true SU295246A1 (cs) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3764655A (en) | Process for purifying phosphoric acids by neutralization with an alkali metal hydroxide and/or carbonate | |
| RU2368567C1 (ru) | Способ получения пищевых фосфатов аммония | |
| SU295246A1 (cs) | ||
| US2191206A (en) | Process of purifying gelatin and casein | |
| US2948588A (en) | Method of manufacturing alkali metal tripolyphosphates | |
| US3586495A (en) | Production of nitrogenous and phosphate fertilizers | |
| US4721519A (en) | Stable ammonium polyphosphate liquid fertilizer from merchant grade phosphoric acid | |
| RU2318724C1 (ru) | Способ получения фосфатов щелочных металлов | |
| US4146575A (en) | Preparation of sodium tripolyphosphate | |
| US3574535A (en) | Process for manufacturing sodium tripolyphosphate | |
| US2165948A (en) | Preparation of soluble phosphates | |
| US2888321A (en) | Manufacture of alkali metal polyphosphates | |
| SU1101406A1 (ru) | Способ получени триполифосфата натри | |
| SU1477678A1 (ru) | Способ получени тетрагидрата фосфата цинка | |
| RU2378191C1 (ru) | Способ получения триполифосфата натрия из экстракционной фосфорной кислоты | |
| NO123938B (cs) | ||
| US598182A (en) | Heem an-poole | |
| US3458279A (en) | Process for preparing sodium metaphosphate | |
| SU1468855A1 (ru) | Способ получени дигидрофосфата кали | |
| US2022050A (en) | Preparation of phosphoric acids | |
| US1945914A (en) | Production of water-soluble phosphate compounds | |
| RU2008257C1 (ru) | Способ получения триполифосфата натрия | |
| SU906976A1 (ru) | Способ получени диаммонийфосфата | |
| SU1261902A1 (ru) | Способ получени триполифосфата натри | |
| NO170972B (no) | Surfaktant, samt anvendelse derav med kjemisk floemming aven oljebroenn med sjoevann |