SU283092A1 - - Google Patents
Info
- Publication number
- SU283092A1 SU283092A1 SU1273523A SU1273523A SU283092A1 SU 283092 A1 SU283092 A1 SU 283092A1 SU 1273523 A SU1273523 A SU 1273523A SU 1273523 A SU1273523 A SU 1273523A SU 283092 A1 SU283092 A1 SU 283092A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- methylcarbamate
- acid
- methyl
- interaction
- compounds
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 241000209094 Oryza Species 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- XWCQTFGYDJCXOD-UHFFFAOYSA-N CCC1=CC(N(C)C(O)=O)=C(C)C=C1 Chemical compound CCC1=CC(N(C)C(O)=O)=C(C)C=C1 XWCQTFGYDJCXOD-UHFFFAOYSA-N 0.000 description 1
- 241001470016 Laodelphax Species 0.000 description 1
- 239000005949 Malathion Substances 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- -1 chloroacetic acid ester Chemical class 0.000 description 1
- JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229960000453 malathion Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SU285640A1 SU285640A1 (https=) | |
| SU283092A1 true SU283092A1 (https=) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4980346A (en) | Synergistic fungicidal and acaricidal and compositions containing two or three active ingredients | |
| HU201519B (en) | Process for producing n-(2,6-difluorobenzoyl)-n-l3-chloro-4-brackets open 1,1,2-trifluoro-2-(trifluoromethoxy)-ethoxy brackets closed-phenylurea | |
| IL28893A (en) | N-carbamoyloxy-iminocyanoacetic acid derivatives,their manufacture and pesticidal compositions containing them | |
| SU283092A1 (https=) | ||
| US4080468A (en) | Method of combating insect pests in plant cultures employing dimethyltin-diacetate | |
| SU876055A3 (ru) | Способ получени производных N-фенил-1,3-оксазолидин-2,4-диона | |
| HU181859B (en) | Fungicide compositions containing 3-bracket-n-acyl-n-aryl-amino-bracket closed-gamma-butirolaktone- or 3-bracket-n-acyl-n-aryl-amino-bracket closed-gamma-butirolactone derivatives as active agents, and process for producing the active agents | |
| US4401675A (en) | Fungicidal carbazates | |
| SU519109A3 (ru) | Фунгицидное средство | |
| US4066781A (en) | Miticidal method | |
| RU2855792C1 (ru) | Применение 4,6-диметил-2-{ [2-оксо-2-(10H-фенотиазин-10-ил)этил]тио} никотинонитрила в качестве антидота 2,4-Д на подсолнечнике | |
| SU843696A3 (ru) | Гербицидный состав | |
| US4073932A (en) | Method of controlling insects using 1,3-dioxin-4-ones | |
| RU2798595C1 (ru) | 5-(3-Амино-3-оксо-2-тиокарбамоил-1-(2-хлорфенил)пропил)-2,2-диметил-4-оксо-4H-1,3-диоксин-6-олат триэтиламмония в качестве антидота 2,4-Д на подсолнечнике | |
| SU1766236A3 (ru) | Инсектицидное средство | |
| RU2798592C1 (ru) | 5-(3-Амино-3-оксо-2-тиокарбамоил-1-(фуран-2-ил)пропил)-2,2-диметил-4-оксо-4H-1,3-диоксин-6-олат триэтиламмония в качестве антидота 2,4-Д на подсолнечнике | |
| SU454722A3 (ru) | Инсектицид и акарицид | |
| KR840000765B1 (ko) | 설피닐아미드류의 제조방법 | |
| RU2287273C1 (ru) | Применение n-замещенных 3-циано-4,6-диметил-5-хлорпиридил-2-сульфониламидов в качестве антидотов гербицида 2,4-дихлорфеноксиуксусной кислоты на подсолнечнике | |
| SU280366A1 (https=) | ||
| US3960917A (en) | Bis-cycloalkylthiocarbamates | |
| CN121040468A (zh) | 一种吡嗪类化合物在制备植物寄生线虫引诱剂上的应用 | |
| SU454760A1 (ru) | Репеллент | |
| SU578935A1 (ru) | Синергист пиретринов | |
| US4038394A (en) | Substituted pyrimido-[4,5-d]-pyrimidine compounds useful for repelling insects, rodents or animals from substrates |