SU239149A1 - - Google Patents
Info
- Publication number
- SU239149A1 SU239149A1 SU1161369A SU1161369A SU239149A1 SU 239149 A1 SU239149 A1 SU 239149A1 SU 1161369 A SU1161369 A SU 1161369A SU 1161369 A SU1161369 A SU 1161369A SU 239149 A1 SU239149 A1 SU 239149A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carbon atoms
- hydantoin
- branched
- alkyl group
- amino
- Prior art date
Links
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- KVYKDNGUEZRPGJ-UHFFFAOYSA-N 1-Aminohydantoin Chemical compound NN1CC(=O)NC1=O KVYKDNGUEZRPGJ-UHFFFAOYSA-N 0.000 description 3
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- NXFQHRVNIOXGAQ-UHFFFAOYSA-N 1-[(5-nitro-2-furanyl)methylideneamino]imidazolidine-2,4-dione Chemical compound O1C([N+](=O)[O-])=CC=C1C=NN1C(=O)NC(=O)C1 NXFQHRVNIOXGAQ-UHFFFAOYSA-N 0.000 description 2
- -1 5 - nitrofurfurylideneamino Chemical group 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 125000001118 alkylidene group Chemical group 0.000 description 2
- 235000011167 hydrochloric acid Nutrition 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- IYYXRVUUBHBXGF-UHFFFAOYSA-N acetic acid;aminourea Chemical compound CC(O)=O.NNC(N)=O IYYXRVUUBHBXGF-UHFFFAOYSA-N 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 229940091173 hydantoin Drugs 0.000 description 1
- NXFQHRVNIOXGAQ-YCRREMRBSA-N nitrofurantoin Chemical compound O1C([N+](=O)[O-])=CC=C1\C=N\N1C(=O)NC(=O)C1 NXFQHRVNIOXGAQ-YCRREMRBSA-N 0.000 description 1
- 229960000564 nitrofurantoin Drugs 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU239149A1 true SU239149A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU509221A3 (ru) | Способ получени 1,4-дигидро-пиридинов или их солей | |
| SU451244A3 (ru) | Способ получени производных фенилимидазолилалкила | |
| SU539528A3 (ru) | Способ получени производных 2оксазолина | |
| US5349103A (en) | Preparation of aromatic nitriles | |
| SU239149A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| KR930011283B1 (ko) | 3'-아지도-3'-디옥시디미딘 및 그 유사화합물의 합성방법 | |
| EP0008831B1 (en) | Process for the preparation of 1-(3-mercapto-2-d-methyl-propionyl)-l-proline and derivatives thereof | |
| US5155257A (en) | Process for the preparation of acylaminomethanephosphonic acids | |
| US4658035A (en) | Preparation of 2-alkyl-4,5-dihydroxymethylimidazoles | |
| DE69313122T2 (de) | Optisch aktive alkylammonium 1-(3-aminophenyl) ethansulfonat-derivate, ihre herstellung sowie ihre verwendung | |
| KR870001569B1 (ko) | 피롤리딘 유도체의 제조방법 | |
| EP0042794B1 (fr) | 4-méthyl 3-formyl penten-1-oates d'alcoyle, leur préparation, leur application à la préparation de l'acide 4-méthyl 3-formyl pen-3-èn-1-oique et les nouveaux intermédiaires obtenus | |
| US2449038A (en) | Preparation of 3-substituted benzotetronic acid and salts thereof | |
| Keglevich et al. | The synthesis of hydroxymethylenebisphosphonic-(dronic-) and acyl-ethoxycarbonyl-methylphosphonate derivatives | |
| FR2512020A1 (fr) | Derives d'imidazole et procede de preparation de ceux-ci | |
| WO1986002069A1 (en) | Biotin intermediates and process therefor | |
| SU491633A1 (ru) | Способ получени производных 1-окси1,2,5,6-тетрагидропиримидин-3- -окиси | |
| EP0358484B1 (en) | Process for preparation of 1-benzylimidazole compound, and its compound | |
| CN1035672C (zh) | 3－(甲基咪唑基)－甲基－四氢－咔唑酮新的制备方法 | |
| CA1184177A (en) | N-chloro-carbonyl-amino carboxylic esters, process for producing same and its use | |
| CS196365B2 (en) | Process for preparing di-n-propylacetonitrile | |
| SU202127A1 (ru) | Способ получения 0-аминоалкил-8,8- этилентритиофосфатов | |
| CH637117A5 (de) | Verfahren zur herstellung eines carbazolderivates. | |
| EP0087656B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| KR800001634B1 (ko) | 옥사졸류의 제조방법 |