SU150522A1 - - Google Patents
Info
- Publication number
- SU150522A1 SU150522A1 SU757251A SU757251A SU150522A1 SU 150522 A1 SU150522 A1 SU 150522A1 SU 757251 A SU757251 A SU 757251A SU 757251 A SU757251 A SU 757251A SU 150522 A1 SU150522 A1 SU 150522A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- mixture
- alcohols
- temperature
- catalyst
- reaction
- Prior art date
Links
- 239000000203 mixture Substances 0.000 description 11
- 239000003054 catalyst Substances 0.000 description 10
- 150000001298 alcohols Chemical class 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 238000000034 method Methods 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- -1 aliphatic aldehydes Chemical class 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- ATGUVEKSASEFFO-UHFFFAOYSA-N p-aminodiphenylamine Chemical compound C1=CC(N)=CC=C1NC1=CC=CC=C1 ATGUVEKSASEFFO-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU150522A1 true SU150522A1 (https=) |
Family
ID=
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2417981C1 (ru) * | 2010-05-07 | 2011-05-10 | Семен Моисеевич Кавун | СПОСОБ ПОЛУЧЕНИЯ N-2-ЭТИЛГЕКСИЛ-N'-ФЕНИЛ-п-ФЕНИЛЕНДИАМИНА |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2417981C1 (ru) * | 2010-05-07 | 2011-05-10 | Семен Моисеевич Кавун | СПОСОБ ПОЛУЧЕНИЯ N-2-ЭТИЛГЕКСИЛ-N'-ФЕНИЛ-п-ФЕНИЛЕНДИАМИНА |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2426724C2 (ru) | Способы преобразования глицерина в аминоспирты | |
| US9988331B2 (en) | Method for producing optically active, racemic menthol | |
| US4181810A (en) | Process for the preparation of propane-1,3-diols, disubstituted in the 2-position | |
| EP0368363B1 (fr) | Nouveau monoacétal du glyoxal | |
| CN111039769A (zh) | 一种甲基丁炔醇合成甲基庚烯酮的方法 | |
| US4070399A (en) | Hydrogenation of terephthalnitrile | |
| SU150522A1 (https=) | ||
| US4719309A (en) | Preparation of imidazoles | |
| EP0010235A1 (de) | 2-Propylpent-4-en 1-al und Verfahren zu dessen Herstellung | |
| SE442991B (sv) | Sett att framstella 2,3-dimetylbuten-2 | |
| FR2463761A1 (fr) | Procede de preparation du 2-methyl-2-sec-butyl-1,3-propane-diol | |
| SU150523A1 (https=) | ||
| US2425628A (en) | Preparation of aminoacetals | |
| SU159854A1 (https=) | ||
| SU148065A1 (ru) | Способ получени NN'-ди-вторично-октил-n-фекилендиамина | |
| US2516337A (en) | Manufacture of 5-amino-1-pentanol and alkyl derivatives thereof | |
| EP3580193A1 (en) | Transfer-hydrogenation process | |
| WO1992007817A1 (en) | Process for producing imines and/or amines from alcohols | |
| US2678950A (en) | Process of producing acrolein | |
| US10570072B2 (en) | Process for the preparation of alcohols from alfa, beta-unsaturated aldehydes and ketones | |
| SU544368A3 (ru) | Способ получени гидрохлорида карнитина | |
| SU164294A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ N-ГEKCИЛ-N'-ФEHИЛ-/г-ФEHИЛEHДИАМИНА | |
| SU166036A1 (ru) | Способ получения n-алкил-р-анизидинов | |
| SU159855A1 (https=) | ||
| EP0623109A1 (de) | Verfahren zur herstellung von dibenzylamin |