SE7700321L - Sett att framstella 2-aminoindanderivat - Google Patents
Sett att framstella 2-aminoindanderivatInfo
- Publication number
- SE7700321L SE7700321L SE7700321A SE7700321A SE7700321L SE 7700321 L SE7700321 L SE 7700321L SE 7700321 A SE7700321 A SE 7700321A SE 7700321 A SE7700321 A SE 7700321A SE 7700321 L SE7700321 L SE 7700321L
- Authority
- SE
- Sweden
- Prior art keywords
- indian
- derivatives
- amino
- produce
- way
- Prior art date
Links
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical compound NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU74197A LU74197A1 (enExample) | 1976-01-16 | 1976-01-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE7700321L true SE7700321L (sv) | 1977-07-17 |
Family
ID=19728141
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7700321A SE7700321L (sv) | 1976-01-16 | 1977-01-13 | Sett att framstella 2-aminoindanderivat |
Country Status (21)
| Country | Link |
|---|---|
| AR (1) | AR211042A1 (enExample) |
| AT (1) | AT347444B (enExample) |
| AU (1) | AU503658B2 (enExample) |
| CA (1) | CA1068289A (enExample) |
| CH (1) | CH617663A5 (enExample) |
| CS (1) | CS193538B2 (enExample) |
| DD (1) | DD123598A5 (enExample) |
| DK (1) | DK4677A (enExample) |
| ES (1) | ES454939A1 (enExample) |
| FI (1) | FI770039A7 (enExample) |
| HU (1) | HU174694B (enExample) |
| IL (1) | IL51125A (enExample) |
| LU (1) | LU74197A1 (enExample) |
| MX (1) | MX4651E (enExample) |
| NO (1) | NO143217C (enExample) |
| NZ (1) | NZ182904A (enExample) |
| PL (1) | PL104367B1 (enExample) |
| PT (1) | PT66020B (enExample) |
| SE (1) | SE7700321L (enExample) |
| SU (1) | SU640658A3 (enExample) |
| ZA (1) | ZA767468B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7718674B2 (en) | 2004-09-27 | 2010-05-18 | Bridge Pharma, Inc. | Methods of relieving neuropathic pain with the S-isomer of 2-{2[N-(2-indanyl)-N-phenylamino]ethyl}piperidine |
| WO2008011161A2 (en) | 2006-07-21 | 2008-01-24 | Bridge Pharma, Inc. | Dermal anesthetic compounds |
-
1976
- 1976-01-16 LU LU74197A patent/LU74197A1/xx unknown
- 1976-03-01 DD DD191667A patent/DD123598A5/xx unknown
- 1976-03-04 HU HU76CI1646A patent/HU174694B/hu unknown
- 1976-03-11 CS CS761606A patent/CS193538B2/cs unknown
- 1976-03-12 PL PL1976187911A patent/PL104367B1/pl unknown
- 1976-03-16 SU SU762333209A patent/SU640658A3/ru active
- 1976-12-15 ZA ZA767468A patent/ZA767468B/xx unknown
- 1976-12-15 CA CA267,951A patent/CA1068289A/en not_active Expired
- 1976-12-16 NZ NZ182904A patent/NZ182904A/xx unknown
- 1976-12-17 AU AU20677/76A patent/AU503658B2/en not_active Expired
- 1976-12-17 IL IL51125A patent/IL51125A/xx unknown
- 1976-12-27 AT AT966976A patent/AT347444B/de not_active IP Right Cessation
- 1976-12-28 PT PT66020A patent/PT66020B/pt unknown
-
1977
- 1977-01-05 MX MX775301U patent/MX4651E/es unknown
- 1977-01-05 AR AR266112A patent/AR211042A1/es active
- 1977-01-06 FI FI770039A patent/FI770039A7/fi not_active Application Discontinuation
- 1977-01-06 DK DK4677A patent/DK4677A/da unknown
- 1977-01-11 ES ES454939A patent/ES454939A1/es not_active Expired
- 1977-01-13 SE SE7700321A patent/SE7700321L/xx unknown
- 1977-01-14 CH CH49977A patent/CH617663A5/fr not_active IP Right Cessation
- 1977-01-14 NO NO770126A patent/NO143217C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO770126L (no) | 1977-07-19 |
| LU74197A1 (enExample) | 1977-07-22 |
| CS193538B2 (en) | 1979-10-31 |
| ATA966976A (de) | 1978-05-15 |
| DK4677A (da) | 1977-07-17 |
| AT347444B (de) | 1978-12-27 |
| IL51125A (en) | 1980-06-30 |
| FI770039A7 (enExample) | 1977-07-17 |
| NO143217B (no) | 1980-09-22 |
| PL104367B1 (pl) | 1979-08-31 |
| AU2067776A (en) | 1978-06-22 |
| AR211042A1 (es) | 1977-10-14 |
| HU174694B (hu) | 1980-03-28 |
| CH617663A5 (en) | 1980-06-13 |
| MX4651E (es) | 1982-07-16 |
| PT66020A (en) | 1977-01-01 |
| CA1068289A (en) | 1979-12-18 |
| IL51125A0 (en) | 1977-02-28 |
| SU640658A3 (ru) | 1978-12-30 |
| NZ182904A (en) | 1979-01-11 |
| ES454939A1 (es) | 1977-12-01 |
| NO143217C (no) | 1981-01-07 |
| PT66020B (en) | 1978-06-19 |
| ZA767468B (en) | 1977-11-30 |
| DD123598A5 (enExample) | 1977-01-05 |
| AU503658B2 (en) | 1979-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE440779B (sv) | Sett att framstella androstan-17-on-derivat | |
| SE433222B (sv) | Sett att framstella modifierad polysackarid | |
| SE7602339L (sv) | Kinolonderivat och sett att framstella desamma | |
| SE432247B (sv) | Sett att framstella dihydro-cyklosporin c | |
| SE7606280L (sv) | Sett att framstella etrar | |
| SE441042B (sv) | Sett att pavisa rheumatoida faktorer | |
| SE420728B (sv) | Sett att framstella piperazinyliminorifamyciner | |
| SE432256B (sv) | Sett att framstella cellulosaalkyletrar | |
| SE7611629L (sv) | Sett att framstella expanderad slagg | |
| SE430687B (sv) | Sett att framstella hexanitrostilben | |
| SE7708055L (sv) | Sett att framstella violett ticl3 | |
| SE7708841L (sv) | Sett att framstella rifamycinforeningar | |
| SE425321B (sv) | Sett att reducera vanadinoxider | |
| SE7608927L (sv) | Sett att framstella pyridinderivat | |
| SE420732B (sv) | Sett att framstella 4-gonen-3-oner | |
| SE434397B (sv) | Sett att framstella bens-acyl-bensimidazol-2-derivat | |
| SE7804126L (sv) | Sett att framstella vulkanisat | |
| SE410733B (sv) | Sett att framstella vissa angivna oximetrar | |
| SE7607171L (sv) | Sett att framstella indolokinoliziner | |
| SE7509513L (sv) | Sett att framstella bietamidderivat | |
| SE433213B (sv) | Sett att framstella 2 -fenyl-3-amino-benso/b/tiofenderivat | |
| SE420731B (sv) | Sett att framstella 5-androsten-17-on-derivat | |
| SE7713906L (sv) | Sett att framstella nya piperazinderivat | |
| SE7704055L (sv) | Sett att framstella nya naftalenderivat | |
| SE7709051L (sv) | Sett att framstella prostanderivat |