SE7409654L - - Google Patents
Info
- Publication number
- SE7409654L SE7409654L SE7409654A SE7409654A SE7409654L SE 7409654 L SE7409654 L SE 7409654L SE 7409654 A SE7409654 A SE 7409654A SE 7409654 A SE7409654 A SE 7409654A SE 7409654 L SE7409654 L SE 7409654L
- Authority
- SE
- Sweden
- Prior art keywords
- hydrogen
- herbicidal
- cyclopropyl
- alkenyl
- halogen
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 abstract 2
- 229910052739 hydrogen Inorganic materials 0.000 abstract 2
- 239000001257 hydrogen Substances 0.000 abstract 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 2
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 abstract 1
- 229910052736 halogen Chemical group 0.000 abstract 1
- 150000002367 halogens Chemical group 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/20—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP48085339A JPS5031039A (enExample) | 1973-07-27 | 1973-07-27 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7409654L true SE7409654L (enExample) | 1975-01-28 |
| SE424864B SE424864B (sv) | 1982-08-16 |
Family
ID=13855874
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7409654A SE424864B (sv) | 1973-07-27 | 1974-07-25 | Isoxanolderivat for anvendning som herbicid |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4293328A (enExample) |
| JP (1) | JPS5031039A (enExample) |
| AR (1) | AR214854A1 (enExample) |
| BE (1) | BE818161A (enExample) |
| CA (1) | CA1034950A (enExample) |
| CH (1) | CH588810A5 (enExample) |
| DE (1) | DE2436179C2 (enExample) |
| DK (1) | DK140511B (enExample) |
| FR (1) | FR2245645B1 (enExample) |
| GB (1) | GB1471743A (enExample) |
| IT (1) | IT1050528B (enExample) |
| NL (1) | NL175415C (enExample) |
| PH (1) | PH10998A (enExample) |
| SE (1) | SE424864B (enExample) |
| ZA (1) | ZA744786B (enExample) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53127797A (en) * | 1977-04-14 | 1978-11-08 | Fuji Electric Co Ltd | Coin counting circuit |
| JPS6033109B2 (ja) * | 1977-04-28 | 1985-08-01 | 塩野義製薬株式会社 | 尿素誘導体の合成法 |
| JPS544013A (en) * | 1977-06-10 | 1979-01-12 | Yaesu Musen Kk | Carry forth and back composite frequency indicator |
| EP0002881A1 (en) * | 1977-11-02 | 1979-07-11 | FISONS plc | 5-Isoxazolylurea derivatives, their preparation, their use and compositions containing them |
| US4259501A (en) | 1978-02-22 | 1981-03-31 | Eli Lilly And Company | Method for preparing 3-amino-5-(t-butyl)isoxazole |
| FR2429209A2 (fr) * | 1978-06-20 | 1980-01-18 | Shionogi & Co | Derives de n-(5-t-butyl-3-isoxazolyl)alcanamide et compositions herbicides les renfermant |
| US4336264A (en) * | 1980-06-19 | 1982-06-22 | Eli Lilly And Company | 1-Benzoyl-3-(isoxazolyl or benzisoxazolyl)-ureas and insecticidal use thereof |
| US5086184A (en) * | 1980-09-16 | 1992-02-04 | Dowelanco | N-heterocyclic benzamides |
| MA19269A1 (fr) * | 1980-09-16 | 1982-04-01 | Lilly Co Eli | Perfectionnement relatif a des derives de n-arylbenzamides . |
| US4943634A (en) * | 1980-09-16 | 1990-07-24 | Eli Lilly And Company | N-heterocyclic benzamides |
| US4636243A (en) * | 1980-09-16 | 1987-01-13 | Eli Lilly And Company | Benzamides, compositions and agricultural method |
| CH655312A5 (de) * | 1982-02-09 | 1986-04-15 | Sandoz Ag | Chloracetamide. |
| IT1176635B (it) * | 1984-08-29 | 1987-08-18 | Enichimica Secondaria | Composti eterociclici ad attivita' erbicida |
| DE3501723A1 (de) * | 1985-01-19 | 1986-07-24 | Bayer Ag, 5090 Leverkusen | Substituierte furazane |
| DE3940261A1 (de) * | 1989-12-06 | 1991-06-13 | Agrolinz Agrarchemikalien Muen | Verfahren zur herstellung reiner, unsymmetrisch disubstituierter harnstoffe |
| AU2006201959B2 (en) * | 1997-12-22 | 2008-09-04 | Bayer Healthcare Llc | Inhibition of Raf Kinase using Substituted Heterocyclic Ureas |
| US7329670B1 (en) | 1997-12-22 | 2008-02-12 | Bayer Pharmaceuticals Corporation | Inhibition of RAF kinase using aryl and heteroaryl substituted heterocyclic ureas |
| US7517880B2 (en) | 1997-12-22 | 2009-04-14 | Bayer Pharmaceuticals Corporation | Inhibition of p38 kinase using symmetrical and unsymmetrical diphenyl ureas |
| PL205321B1 (pl) * | 1997-12-22 | 2010-04-30 | Bayer Corp | Zastosowanie podstawionych heterocyklicznych moczników do wytwarzania leku do hamowania kinazy raf, podstawione heterocykliczne moczniki oraz kompozycja farmaceutyczna je zawierająca |
| ATE556713T1 (de) | 1999-01-13 | 2012-05-15 | Bayer Healthcare Llc | Omega-carboxyarylsubstituierte-diphenyl- harnstoffe als p38-kinasehemmer |
| EP1140840B1 (en) | 1999-01-13 | 2006-03-22 | Bayer Pharmaceuticals Corp. | -g(v)-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| US7928239B2 (en) | 1999-01-13 | 2011-04-19 | Bayer Healthcare Llc | Inhibition of RAF kinase using quinolyl, isoquinolyl or pyridyl ureas |
| ME00275B (me) | 1999-01-13 | 2011-02-10 | Bayer Corp | ω-KARBOKSIARIL SUPSTITUISANI DIFENIL KARBAMIDI KAO INHIBITORI RAF KINAZE |
| US8124630B2 (en) | 1999-01-13 | 2012-02-28 | Bayer Healthcare Llc | ω-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| US7235576B1 (en) | 2001-01-12 | 2007-06-26 | Bayer Pharmaceuticals Corporation | Omega-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| US7371763B2 (en) | 2001-04-20 | 2008-05-13 | Bayer Pharmaceuticals Corporation | Inhibition of raf kinase using quinolyl, isoquinolyl or pyridyl ureas |
| SI1580188T1 (sl) | 2002-02-11 | 2012-02-29 | Bayer Healthcare Llc | Aril sečnine kot kinazni inhibitorji |
| AU2003209116A1 (en) | 2002-02-11 | 2003-09-04 | Bayer Pharmaceuticals Corporation | Aryl ureas with angiogenesis inhibiting activity |
| WO2003068229A1 (en) | 2002-02-11 | 2003-08-21 | Bayer Pharmaceuticals Corporation | Pyridine, quinoline, and isoquinoline n-oxides as kinase inhibitors |
| US20030236287A1 (en) * | 2002-05-03 | 2003-12-25 | Piotrowski David W. | Positive allosteric modulators of the nicotinic acetylcholine receptor |
| US7557129B2 (en) | 2003-02-28 | 2009-07-07 | Bayer Healthcare Llc | Cyanopyridine derivatives useful in the treatment of cancer and other disorders |
| PT1636585E (pt) | 2003-05-20 | 2008-03-27 | Bayer Pharmaceuticals Corp | Diarilureias com actividade inibidora de cinase |
| PL1663978T3 (pl) | 2003-07-23 | 2008-04-30 | Bayer Healthcare Llc | Fluoropodstawiony omega-karboksyarylodifenylomocznik do leczenia i profilaktyki chorób i stanów |
| US20050192314A1 (en) | 2003-11-13 | 2005-09-01 | Ambit Biosciences Corporation | Urea derivatives as C-kit modulators |
| DE102006060598A1 (de) * | 2006-12-21 | 2008-06-26 | Merck Patent Gmbh | Tetrahydrobenzoisoxazole |
| EP2052615A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037628A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Crop Science Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1015437B (de) * | 1954-12-23 | 1957-09-12 | Merck & Co Inc | Verfahren zur Herstellung von 4-Acylamino-isoxazolidon-(3)-verbindungen |
| NL130992C (enExample) * | 1964-09-14 | |||
| US3743498A (en) * | 1967-10-31 | 1973-07-03 | Du Pont | Method of selectively controlling undesirable vegetation |
| US3547940A (en) * | 1967-10-31 | 1970-12-15 | Du Pont | Substituted ureido isoxazoles |
| JPS4830383B1 (enExample) * | 1970-11-27 | 1973-09-19 | ||
| US4062861A (en) * | 1973-07-27 | 1977-12-13 | Shionogi & Co., Ltd. | 3-Isoxazolylurea derivatives |
| US4111680A (en) * | 1973-07-27 | 1978-09-05 | Shionogi & Co., Ltd. | Herbicidal compositions containing 3-isoxazolylurea derivatives |
| JPS50133256A (enExample) * | 1974-04-10 | 1975-10-22 | ||
| JPS5810361B2 (ja) * | 1974-10-04 | 1983-02-25 | 塩野義製薬株式会社 | 3−アルチルイソオキサゾ−ル系除草剤 |
| JPS5163170A (en) * | 1974-11-27 | 1976-06-01 | Shionogi Seiyaku Kk | 33 isookisazorirunyosoruino seizoho |
-
1973
- 1973-07-27 JP JP48085339A patent/JPS5031039A/ja active Pending
-
1974
- 1974-07-18 CA CA204,990A patent/CA1034950A/en not_active Expired
- 1974-07-25 SE SE7409654A patent/SE424864B/xx not_active IP Right Cessation
- 1974-07-25 PH PH16090A patent/PH10998A/en unknown
- 1974-07-26 CH CH1034774A patent/CH588810A5/xx not_active IP Right Cessation
- 1974-07-26 BE BE147010A patent/BE818161A/xx not_active IP Right Cessation
- 1974-07-26 AR AR254912A patent/AR214854A1/es active
- 1974-07-26 FR FR7426175A patent/FR2245645B1/fr not_active Expired
- 1974-07-26 ZA ZA00744786A patent/ZA744786B/xx unknown
- 1974-07-26 DE DE2436179A patent/DE2436179C2/de not_active Expired
- 1974-07-26 DK DK403674AA patent/DK140511B/da not_active IP Right Cessation
- 1974-07-26 IT IT69389/74A patent/IT1050528B/it active
- 1974-07-29 NL NLAANVRAGE7410205,A patent/NL175415C/xx not_active IP Right Cessation
- 1974-07-29 GB GB3346974A patent/GB1471743A/en not_active Expired
-
1978
- 1978-06-07 US US05/914,749 patent/US4293328A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BE818161A (fr) | 1974-11-18 |
| CH588810A5 (enExample) | 1977-06-15 |
| FR2245645B1 (enExample) | 1978-06-09 |
| NL175415C (nl) | 1984-11-01 |
| AU7166174A (en) | 1976-01-29 |
| GB1471743A (en) | 1977-04-27 |
| FR2245645A1 (enExample) | 1975-04-25 |
| DK140511C (enExample) | 1980-03-03 |
| IT1050528B (it) | 1981-03-10 |
| SE424864B (sv) | 1982-08-16 |
| CA1034950A (en) | 1978-07-18 |
| DK140511B (da) | 1979-09-24 |
| US4293328A (en) | 1981-10-06 |
| ZA744786B (en) | 1975-08-27 |
| JPS5031039A (enExample) | 1975-03-27 |
| NL175415B (nl) | 1984-06-01 |
| DE2436179A1 (de) | 1975-02-06 |
| NL7410205A (nl) | 1975-01-29 |
| PH10998A (en) | 1977-10-20 |
| DE2436179C2 (de) | 1986-04-10 |
| AR214854A1 (es) | 1979-08-15 |
| DK403674A (enExample) | 1975-04-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE7409654L (enExample) | ||
| ES477695A1 (es) | Un procedimiento para preparar derivados de deshidrociclici-minoacidos. | |
| SE8401134D0 (sv) | Forfarande for framstellning av dihydro-cyklosporin d | |
| GB1522869A (en) | Substituted 4- halomethyl 2- pyrrolidinones and the use thereof as herbicides | |
| SE7602144L (sv) | Kvaternera imidazoliumforeningar | |
| SE7910072L (sv) | Pyrrolo- eller pyrido(2,1-c)(1,4)tiaziner eller -tiazepiner | |
| ES8105053A1 (es) | Procedimiento para la preparacion de mezclas de aclaradores opticos | |
| ES466590A1 (es) | Un procedimiento para la preparacion de derivados de oxadia-zolopirimidina. | |
| GB1471847A (en) | Dibenzofuran derivatives | |
| ES449068A1 (es) | Procedimiento para preparar derivados de isoxazol. | |
| GB1070139A (en) | Novel imidazothiazole derivatives and a process for preparation thereof | |
| GB1063891A (en) | Method for preparation of benzodiazepinones | |
| GB1123104A (en) | 3-oxime-steroids and method of preparation | |
| GB1114694A (en) | Diazaspiro[4,5]decan-1,3-dione derivatives | |
| GB1509034A (en) | Herbicides | |
| JPS52100472A (en) | 11thiazolyll55 acylimidazolidinone compound | |
| DE2961132D1 (en) | Substituted phenylpropyl halides, their preparation and use | |
| GB1467225A (en) | 7-alkoxy-4,6-dihydroxy-quinoline derivatives and pharmaceuti cal compositions thereof | |
| GB858786A (en) | Improvements in or relating to sulphonamides | |
| GB1032268A (en) | New guanyl-hydrazones and preparations containing them | |
| GB1115329A (en) | Dibenzocycloheptene derivatives | |
| GB1110056A (en) | Improvements in or relating to carotenoid compounds | |
| GB1077275A (en) | Novel isoxazoles | |
| GB1016667A (en) | Novel benzophenones and the preparation thereof | |
| GB1069938A (en) | Pyruvic acid anilides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7409654-6 Effective date: 19940810 Format of ref document f/p: F |