SE421071B - Forfarande for framstellning av 3-trihalogenmetyl-5-legre alkoxi-1,2,4-tiadiazoler - Google Patents
Forfarande for framstellning av 3-trihalogenmetyl-5-legre alkoxi-1,2,4-tiadiazolerInfo
- Publication number
- SE421071B SE421071B SE7901832A SE7901832A SE421071B SE 421071 B SE421071 B SE 421071B SE 7901832 A SE7901832 A SE 7901832A SE 7901832 A SE7901832 A SE 7901832A SE 421071 B SE421071 B SE 421071B
- Authority
- SE
- Sweden
- Prior art keywords
- process according
- reaction
- lower alkoxy
- trihalomethyl
- alkali metal
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 17
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 6
- 239000000376 reactant Substances 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- -1 alkyl xanthate salt Chemical class 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000000417 fungicide Substances 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 125000004953 trihalomethyl group Chemical group 0.000 claims 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 2
- 239000003513 alkali Substances 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 239000002689 soil Substances 0.000 claims 1
- 239000000047 product Substances 0.000 description 7
- 230000000855 fungicidal effect Effects 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- KUECWKYCHVOFEE-UHFFFAOYSA-N n',2,2,2-tetrachloroethanimidamide Chemical compound ClN=C(N)C(Cl)(Cl)Cl KUECWKYCHVOFEE-UHFFFAOYSA-N 0.000 description 2
- XFLKNHORUXYCFK-UHFFFAOYSA-N n'-bromo-2,2,2-trichloroethanimidamide Chemical compound ClC(Cl)(Cl)C(=N)NBr XFLKNHORUXYCFK-UHFFFAOYSA-N 0.000 description 2
- JCBJVAJGLKENNC-UHFFFAOYSA-M potassium ethyl xanthate Chemical compound [K+].CCOC([S-])=S JCBJVAJGLKENNC-UHFFFAOYSA-M 0.000 description 2
- PEEXCRJDFUVJRT-UHFFFAOYSA-M potassium;methoxymethanedithioate Chemical compound [K+].COC([S-])=S PEEXCRJDFUVJRT-UHFFFAOYSA-M 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical class CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 description 1
- KQTVWCSONPJJPE-UHFFFAOYSA-N etridiazole Chemical compound CCOC1=NC(C(Cl)(Cl)Cl)=NS1 KQTVWCSONPJJPE-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- YCHTWXVSQOOMGL-UHFFFAOYSA-N n'-bromo-2,2,2-trifluoroethanimidamide Chemical compound FC(F)(F)C(=N)NBr YCHTWXVSQOOMGL-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/08—1,2,4-Thiadiazoles; Hydrogenated 1,2,4-thiadiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/893,550 US4143044A (en) | 1978-04-05 | 1978-04-05 | Process for making selected 3-trihalomethyl-5-lower alkoxy-1,2,4-thiadiazoles |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7901832L SE7901832L (sv) | 1979-10-06 |
| SE421071B true SE421071B (sv) | 1981-11-23 |
Family
ID=25401742
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7901832A SE421071B (sv) | 1978-04-05 | 1979-02-28 | Forfarande for framstellning av 3-trihalogenmetyl-5-legre alkoxi-1,2,4-tiadiazoler |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4143044A (de) |
| JP (1) | JPS5812276B2 (de) |
| CA (1) | CA1116608A (de) |
| DE (1) | DE2908037A1 (de) |
| FR (1) | FR2421890A1 (de) |
| GB (1) | GB2018242B (de) |
| NL (1) | NL7901705A (de) |
| SE (1) | SE421071B (de) |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3260725A (en) * | 1961-03-15 | 1966-07-12 | Olin Mathieson | 3-trichloromethyl-5-substituted-1, 2, 4-thiadiazole |
| US3260588A (en) * | 1961-03-15 | 1966-07-12 | Olin Mathieson | Method for controlling pests |
| IL26100A (en) * | 1965-07-28 | 1970-03-22 | Olin Mathieson | Process for the production of 3 - trihalomethyl - 5 - alkoxy-1, 2, 4 - thiadium - azoles and intermediates for them |
| CH477467A (de) * | 1966-04-09 | 1969-08-31 | Basf Ag | Verfahren zur Herstellung von 5-Mercapto-1,2,4-thiodiazolderivaten |
| US3428681A (en) * | 1966-09-01 | 1969-02-18 | Ansul Co | N-halotrichloroacetamidines |
| AT261605B (de) * | 1966-12-09 | 1968-05-10 | Olin Mathieson | Verfahren zur Herstellung von 3-Trihalogenmethyl-5-alkoxy-1,2,4-thiadiazolen |
| US3822280A (en) * | 1971-03-11 | 1974-07-02 | Ciba Geigy Corp | Certain diazolyl ureas |
| US3890338A (en) * | 1974-05-02 | 1975-06-17 | Olin Corp | Ethanolysis of 3-trichloromethyl-5-chloro-1,2,4-thiadizole employing aqueous base |
| US3890339A (en) * | 1974-05-28 | 1975-06-17 | Olin Corp | Process for preparing 3-trichloromethyl-5-ethoxy-1,2,4-thiadiazole from trichloroacetonitrile in ethanol |
-
1978
- 1978-04-05 US US05/893,550 patent/US4143044A/en not_active Expired - Lifetime
-
1979
- 1979-02-21 CA CA000322019A patent/CA1116608A/en not_active Expired
- 1979-02-26 GB GB7906699A patent/GB2018242B/en not_active Expired
- 1979-02-28 SE SE7901832A patent/SE421071B/sv not_active IP Right Cessation
- 1979-03-01 DE DE19792908037 patent/DE2908037A1/de active Granted
- 1979-03-02 NL NL7901705A patent/NL7901705A/xx not_active Application Discontinuation
- 1979-03-05 FR FR7905666A patent/FR2421890A1/fr active Granted
- 1979-03-05 JP JP54025458A patent/JPS5812276B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2908037A1 (de) | 1979-10-25 |
| SE7901832L (sv) | 1979-10-06 |
| FR2421890B1 (de) | 1983-06-17 |
| US4143044A (en) | 1979-03-06 |
| GB2018242B (en) | 1982-06-23 |
| JPS54154768A (en) | 1979-12-06 |
| NL7901705A (nl) | 1979-10-09 |
| DE2908037C2 (de) | 1989-03-02 |
| CA1116608A (en) | 1982-01-19 |
| JPS5812276B2 (ja) | 1983-03-07 |
| FR2421890A1 (fr) | 1979-11-02 |
| GB2018242A (en) | 1979-10-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6155514B2 (de) | ||
| US2863899A (en) | Substituted thiolcarbanilic esters | |
| US4296034A (en) | Polyfluorinated sulfonamides | |
| US4978768A (en) | Process for the preparation of alkyl esters of tetrachloro-2-cyano-benzoic acid | |
| CA1077045A (en) | Process for the manufacture of 5-amino-1,2,3-thiadiazole | |
| US4385189A (en) | Diphenyl ethers | |
| CA1249601A (en) | Process for the preparation of substituted phenylhydrazines | |
| CH642614A5 (fr) | Procede de preparation d'acides trichlorophenoxyalcanoiques et de leurs derives exempts de dibenzo-p-dioxines chlorees. | |
| US3082239A (en) | Thiophosphoric acid esters and process for their production | |
| SE421071B (sv) | Forfarande for framstellning av 3-trihalogenmetyl-5-legre alkoxi-1,2,4-tiadiazoler | |
| US2880238A (en) | 3, 3-dichloro-2-methylallyl oxime ethers | |
| US2964538A (en) | Nu-(3-chloro-methylallyl)-benzene-sulfonanilides | |
| US2960532A (en) | Alkylphenyl 3, 4-dichlorobenzoates | |
| US2944080A (en) | Pentachlorobenzenesulfenyl halides | |
| US3462472A (en) | 1,4- and 1,2-bis(substituted sulfonylthiomethyl)cyclohexane | |
| JPH06508110A (ja) | N−ホスホノメチルグリシンの有機塩の製造方法 | |
| US2906778A (en) | 2-allyloxy-5-chlorobenzophenone | |
| US2971028A (en) | 2-fluoro oximes | |
| US2967186A (en) | Substituted benzophenones | |
| US2488499A (en) | 1, 4-di(halophenoxy)-2-butenes | |
| US4492793A (en) | Process for the production of 2-amino-5-mercapto-1,3,4-thiadiazole | |
| US3284515A (en) | Tribromopropenol | |
| FI94244C (fi) | Menetelmä 2-tiosyaanimetyylitiobentsotiatsolin valmistamiseksi ja menetelmä 2-tiosyaanimetyylitiobentsotiatsolin valmistamiseksi glykolieetteriliuoksena | |
| CA1225650A (en) | Insecticidal carbamates | |
| US2567839A (en) | 4 methoxyphenyl ester of 4-chloro-benzene sulfonic acid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7901832-1 Effective date: 19911009 Format of ref document f/p: F |