SE373360B - 4-tert.-butyl-n-(sek.-butyl)-2,6-dinitroanilin sasom herbidalt aktiv substans - Google Patents
4-tert.-butyl-n-(sek.-butyl)-2,6-dinitroanilin sasom herbidalt aktiv substansInfo
- Publication number
- SE373360B SE373360B SE7015774A SE1577470A SE373360B SE 373360 B SE373360 B SE 373360B SE 7015774 A SE7015774 A SE 7015774A SE 1577470 A SE1577470 A SE 1577470A SE 373360 B SE373360 B SE 373360B
- Authority
- SE
- Sweden
- Prior art keywords
- butyl
- herbidal
- sasom
- dinitroaniline
- tert
- Prior art date
Links
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 title 1
- 239000013543 active substance Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/11—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings
- C07C205/12—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings the six-membered aromatic ring or a condensed ring system containing that ring being substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/13—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups
- C07C205/20—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups and hydroxy groups bound to carbon atoms of six-membered aromatic rings
- C07C205/21—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups and hydroxy groups bound to carbon atoms of six-membered aromatic rings having nitro groups and hydroxy groups bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C205/23—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups and hydroxy groups bound to carbon atoms of six-membered aromatic rings having nitro groups and hydroxy groups bound to carbon atoms of the same non-condensed six-membered aromatic ring having two nitro groups bound to the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US87858369A | 1969-11-20 | 1969-11-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE373360B true SE373360B (sv) | 1975-02-03 |
Family
ID=25372327
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7015774A SE373360B (sv) | 1969-11-20 | 1970-11-20 | 4-tert.-butyl-n-(sek.-butyl)-2,6-dinitroanilin sasom herbidalt aktiv substans |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS5114571B1 (ja) |
| BR (1) | BR7024045D0 (ja) |
| CA (1) | CA976567A (ja) |
| CH (1) | CH553538A (ja) |
| ES (1) | ES389679A1 (ja) |
| FR (1) | FR2069755A5 (ja) |
| GB (1) | GB1319306A (ja) |
| IL (1) | IL35623A (ja) |
| NL (1) | NL152847B (ja) |
| SE (1) | SE373360B (ja) |
| ZA (1) | ZA707617B (ja) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1336863C (en) * | 1988-05-25 | 1995-09-05 | Gottfried Lichti | Controlled release composition |
| FR2765576B1 (fr) * | 1997-07-02 | 1999-12-31 | Francais Prod Ind Cfpi | Procede de preparation des dinitroanilines 4-substituees |
| FR2761685B1 (fr) * | 1997-04-07 | 1999-06-11 | Francais Prod Ind Cfpi | Procede de preparation des dinitroanilines 4-substituees |
| EP0870755A1 (fr) * | 1997-04-07 | 1998-10-14 | Cfpi Agro | Procédé de préparation des dinitroanilines 4-substituées |
-
1970
- 1970-11-10 ZA ZA707617A patent/ZA707617B/xx unknown
- 1970-11-11 IL IL35623A patent/IL35623A/xx unknown
- 1970-11-17 GB GB5465970A patent/GB1319306A/en not_active Expired
- 1970-11-17 CA CA098,356A patent/CA976567A/en not_active Expired
- 1970-11-19 NL NL707016949A patent/NL152847B/xx not_active IP Right Cessation
- 1970-11-20 CH CH1724170A patent/CH553538A/xx not_active IP Right Cessation
- 1970-11-20 SE SE7015774A patent/SE373360B/xx unknown
- 1970-11-20 BR BR224045/70A patent/BR7024045D0/pt unknown
- 1970-11-20 JP JP45102625A patent/JPS5114571B1/ja active Pending
- 1970-11-20 FR FR7041719A patent/FR2069755A5/fr not_active Expired
-
1971
- 1971-03-29 ES ES389679A patent/ES389679A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL7016949A (ja) | 1971-05-24 |
| IL35623A (en) | 1973-11-28 |
| ES389679A1 (es) | 1974-03-01 |
| CH553538A (de) | 1974-09-13 |
| GB1319306A (en) | 1973-06-06 |
| NL152847B (nl) | 1977-04-15 |
| ZA707617B (en) | 1971-08-25 |
| DE2058201A1 (de) | 1971-05-27 |
| BR7024045D0 (pt) | 1973-06-26 |
| DE2058201B2 (de) | 1976-01-22 |
| CA976567A (en) | 1975-10-21 |
| FR2069755A5 (ja) | 1971-09-03 |
| IL35623A0 (en) | 1971-01-28 |
| JPS5114571B1 (ja) | 1976-05-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH548156A (de) | Herbizides mittel. | |
| DK126498B (da) | Fungicidt aktive ureidophenylguanider. | |
| AT311724B (de) | Insektizide Mittel | |
| CH552940A (de) | Herbizides mittel. | |
| CH556137A (de) | Herbizides mittel. | |
| AT301264B (de) | Insektizides Mittel | |
| CH552335A (de) | Akarizides mittel. | |
| DK126499B (da) | Fungicidt aktive amidophenylguanidiner. | |
| CH547057A (de) | Herbizides mittel. | |
| CH540010A (de) | Insektizides Mittel | |
| AT306435B (de) | Insektizides Mittel | |
| CH558632A (de) | Herbizides mittel. | |
| CH551139A (de) | Ektoparasitizid wirksames mittel. | |
| AT311720B (de) | Insektizides Mittel | |
| AT301946B (de) | Insektizides Mittel | |
| AT301263B (de) | Insektizides Mittel | |
| CH555138A (de) | Herbizides mittel. | |
| DK131265B (da) | Insekticid. | |
| IT1043814B (it) | Procedimento per preparare 2,9,diossatriciclo,4,3,1,0,3,7,decani | |
| AT309891B (de) | Insektizides Mittel | |
| AT316201B (de) | Insektizides Mittel | |
| CH555636A (de) | Herbizides mittel. | |
| ES147735Y (es) | Paridera perfeccionada para cerdas. | |
| NL7412951A (nl) | Coccidiostatische actieve stofcombinatie. | |
| AT309890B (de) | Insektizides Mittel |