SE321431B - - Google Patents
Info
- Publication number
- SE321431B SE321431B SE5219/63A SE521963A SE321431B SE 321431 B SE321431 B SE 321431B SE 5219/63 A SE5219/63 A SE 5219/63A SE 521963 A SE521963 A SE 521963A SE 321431 B SE321431 B SE 321431B
- Authority
- SE
- Sweden
- Prior art keywords
- bridgewire
- cyclotrimethylenetrinitramine
- squib
- explosive
- bound
- Prior art date
Links
- XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 abstract 1
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 abstract 1
- 239000000026 Pentaerythritol tetranitrate Substances 0.000 abstract 1
- 239000002360 explosive Substances 0.000 abstract 1
- 229910052909 inorganic silicate Inorganic materials 0.000 abstract 1
- 229960004321 pentaerithrityl tetranitrate Drugs 0.000 abstract 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B3/00—Blasting cartridges, i.e. case and explosive
- F42B3/10—Initiators therefor
- F42B3/103—Mounting initiator heads in initiators; Sealing-plugs
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B3/00—Blasting cartridges, i.e. case and explosive
- F42B3/10—Initiators therefor
- F42B3/12—Bridge initiators
- F42B3/124—Bridge initiators characterised by the configuration or material of the bridge
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B3/00—Blasting cartridges, i.e. case and explosive
- F42B3/10—Initiators therefor
- F42B3/12—Bridge initiators
- F42B3/125—Bridge initiators characterised by the configuration of the bridge initiator case
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Silicates, Zeolites, And Molecular Sieves (AREA)
- Paints Or Removers (AREA)
- Air Bags (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US193729A US3134329A (en) | 1962-05-10 | 1962-05-10 | Exploding bridgewire coating |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE321431B true SE321431B (enExample) | 1970-03-02 |
Family
ID=22714790
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE5219/63A SE321431B (enExample) | 1962-05-10 | 1963-05-10 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3134329A (enExample) |
| BE (1) | BE632157A (enExample) |
| CH (1) | CH439051A (enExample) |
| DE (1) | DE1235205B (enExample) |
| GB (1) | GB972664A (enExample) |
| NL (2) | NL133269C (enExample) |
| SE (1) | SE321431B (enExample) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3272127A (en) * | 1963-08-05 | 1966-09-13 | Robert E Betts | Igniter squib |
| DE1258771B (de) * | 1965-03-09 | 1968-01-11 | Montage Technik Anstalt F | Verfahren zum Zuenden von Treibladungen fuer pulverkraftbetriebene Bolzensetzwerkzeuge und Treibladung hierfuer |
| US3831523A (en) * | 1967-01-04 | 1974-08-27 | Us Army | Electroexplosive device |
| FR2130783A5 (enExample) * | 1971-01-18 | 1972-11-10 | France Etat | |
| FR2307248A1 (fr) * | 1973-07-12 | 1976-11-05 | Poudres & Explosifs Ste Nale | Dispositif allumeur directif |
| CH663089A5 (de) * | 1984-05-21 | 1987-11-13 | Inventa Ag | Polkoerper fuer eine elektrische zuendvorrichtung, verfahren zu seiner herstellung und dessen verwendung. |
| ZA852777B (en) * | 1984-05-24 | 1985-11-27 | Inventa Ag | Pole body for an electric fuze,method of manufacturing and method of using the pole body |
| US4831932A (en) * | 1987-08-17 | 1989-05-23 | Honeywell Inc. | Detonator |
| DE3735405C2 (de) * | 1987-10-20 | 1998-07-30 | Dynamit Nobel Ag | Anzündpille |
| US4938137A (en) * | 1989-06-05 | 1990-07-03 | Guay Roland H | Exploding bridgewire driven multiple flyer detonator |
| US4989515A (en) * | 1989-08-08 | 1991-02-05 | The United States Of America As Represented By The United States Department Of Energy | Ignitor with stable low-energy thermite igniting system |
| US5140906A (en) * | 1991-11-05 | 1992-08-25 | Ici Americas, Inc. | Airbag igniter having double glass seal |
| US5404263A (en) * | 1992-08-27 | 1995-04-04 | Oea, Inc. | All-glass header assembly used in an inflator system |
| US6274252B1 (en) * | 1994-08-04 | 2001-08-14 | Coors Ceramics Company | Hermetic glass-to-metal seal useful in headers for airbags |
| US5709724A (en) * | 1994-08-04 | 1998-01-20 | Coors Ceramics Company | Process for fabricating a hermetic glass-to-metal seal |
| US5691499A (en) * | 1996-08-07 | 1997-11-25 | Morton International, Inc. | Bridgewire ladder initiator |
| US5988069A (en) * | 1996-11-12 | 1999-11-23 | Universal Propulsion Company, Inc. | Electric initiator having a sealing material forming a ceramic to metal seal |
| US5939660A (en) * | 1997-03-12 | 1999-08-17 | Trw Inc. | Inflator for an inflatable vehicle occupant protection device |
| AUPP021697A0 (en) | 1997-11-06 | 1997-11-27 | Rocktek Limited | Radio detonation system |
| FR2781878B1 (fr) * | 1998-07-31 | 2001-02-16 | Giat Ind Sa | Procede de mise en oeuvre d'une substance pyrotechnique et initiateur pyrotechnique obtenu avec un tel procede |
| US6230624B1 (en) | 1999-08-13 | 2001-05-15 | Trw Inc. | Igniter having a hot melt ignition droplet |
| AUPQ591000A0 (en) | 2000-02-29 | 2000-03-23 | Rockmin Pty Ltd | Cartridge shell and cartridge for blast holes and method of use |
| DE10116189A1 (de) * | 2001-03-31 | 2002-10-10 | Bosch Gmbh Robert | Brückenzünder |
| US6679175B2 (en) | 2001-07-19 | 2004-01-20 | Rocktek Limited | Cartridge and method for small charge breaking |
| AU2003200490B2 (en) * | 2002-02-20 | 2008-05-08 | Rocktek Ltd. | Apparatus and method for fracturing a hard material |
| DE20314580U1 (de) * | 2003-03-03 | 2004-08-05 | Schott Glas | Metall-Fixiermaterial-Durchführung |
| DE102006004036A1 (de) * | 2006-01-27 | 2007-08-09 | Schott Ag | Metall-Fixiermaterial-Durchführung und Verwendung einer derartigen Durchführung sowie Airbag und Gurtspanner mit einer Zündeinrichtung |
| US8327765B2 (en) * | 2003-03-03 | 2012-12-11 | Schott Ag | Metal fixing material bushing and method for producing a base plate of a metal fixing material bushing |
| ATE396375T1 (de) * | 2003-03-03 | 2008-06-15 | Schott Ag | Metall-fixiermaterial-durchführung und verfahren zur fertigung eines grundkörpers einer metall- fixiermaterial-durchführung |
| DE102004004748A1 (de) * | 2003-03-08 | 2004-09-23 | Dynamit Nobel Ais Gmbh Automotive Ignition Systems | Glasdurchführung für einen pyroelektrischen Anzünder |
| US8733250B2 (en) | 2006-01-27 | 2014-05-27 | Schott Ag | Metal-sealing material-feedthrough and utilization of the metal-sealing material feedthrough with an airbag, a belt tensioning device, and an ignition device |
| DE102006056077A1 (de) * | 2006-11-28 | 2008-05-29 | Schott Ag | Zündvorrichtung für eine pyrotechnische Schutzvorrichtung |
| US10684102B2 (en) | 2010-09-17 | 2020-06-16 | Schott Ag | Method for producing a ring-shaped or plate-like element |
| DE102010045641A1 (de) | 2010-09-17 | 2012-03-22 | Schott Ag | Verfahren zur Herstellung eines ring- oder plattenförmigen Elementes |
| DE102012004966B3 (de) * | 2012-03-14 | 2013-01-03 | A&O Technologie GmbH | Zündsockel für pyroelektrische Zündvorrichtungen |
| EP2743632A1 (en) * | 2012-12-11 | 2014-06-18 | Nederlandse Organisatie voor toegepast -natuurwetenschappelijk onderzoek TNO | Miniature electro-pyrotechnic igniter, and ignition head for the same |
| KR101778168B1 (ko) * | 2017-04-13 | 2017-09-13 | 국방과학연구소 | 로켓 모터용 착화기 |
| RU2756030C1 (ru) * | 2021-01-11 | 2021-09-24 | Российская Федерация, от имени которой выступает Государственная корпорация по атомной энергии "Росатом" (Госкорпорация "Росатом") | ИНДУКЦИОННЫЙ ДЕТОНАТОР (варианты) |
| WO2025050138A1 (en) * | 2023-08-22 | 2025-03-06 | Cobra Firing Systems | Embedded electronic firework igniter |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3040660A (en) * | 1944-11-08 | 1962-06-26 | Lawrence H Johnston | Electric initiator with exploding bridge wire |
| US2982639A (en) * | 1953-01-27 | 1961-05-02 | William A Gey | Explosive compositions |
| US2926566A (en) * | 1956-11-30 | 1960-03-01 | Walter W Atkins | Device for accelerating the ignition of the propellant for a projectile |
| US3048507A (en) * | 1956-12-31 | 1962-08-07 | Hercules Powder Co Ltd | Matchhead igniters and compositions and method for their manufacture |
| US3054258A (en) * | 1957-10-28 | 1962-09-18 | Standard Oil Co | Temperature rise retardation of surfaces exposed to heat |
| US3059576A (en) * | 1958-09-26 | 1962-10-23 | Conax Corp | Electrically fired detonator |
| US2992087A (en) * | 1959-11-03 | 1961-07-11 | Du Pont | New explosive |
-
0
- BE BE632157D patent/BE632157A/xx unknown
- NL NL292575D patent/NL292575A/xx unknown
- NL NL133269D patent/NL133269C/xx active
-
1962
- 1962-05-10 US US193729A patent/US3134329A/en not_active Expired - Lifetime
-
1963
- 1963-05-08 GB GB18174/62A patent/GB972664A/en not_active Expired
- 1963-05-10 CH CH590663A patent/CH439051A/de unknown
- 1963-05-10 SE SE5219/63A patent/SE321431B/xx unknown
- 1963-05-10 DE DET23979A patent/DE1235205B/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CH439051A (de) | 1967-06-30 |
| NL133269C (enExample) | |
| NL292575A (enExample) | |
| GB972664A (en) | 1964-10-14 |
| BE632157A (enExample) | |
| DE1235205B (de) | 1967-02-23 |
| US3134329A (en) | 1964-05-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE321431B (enExample) | ||
| FR1274682A (fr) | Fusée pour projectiles, mines ou engins analogues | |
| FR1248396A (fr) | Cartouches explosives | |
| CA663864A (en) | Detonating relatively insensitive explosive compositions | |
| CA599612A (en) | Primer for detonating fuse | |
| CA582187A (en) | Ammonium nitrate explosive | |
| CA556655A (en) | Primer for igniting explosives | |
| CA643201A (en) | Method of detonating ammonium nitrate base explosives | |
| CA574970A (en) | Percussion safety fuze for projectiles | |
| AU234402B2 (en) | Explosive primer | |
| CA630807A (en) | Blasting detonator | |
| CA616532A (en) | Blasting explosives | |
| CA617006A (en) | Blasting explosives | |
| AU5935860A (en) | Explosive primer | |
| CA646113A (en) | Explosive engine | |
| AU270759B2 (en) | Ammonium nitrate for use m explosive compositions when admixed with fuel oil | |
| CA570873A (en) | Complete detonation explosive composition | |
| CA605662A (en) | Blasting explosives | |
| FR1364664A (fr) | Détonateur déflagrant | |
| CA676017A (en) | Means for igniting an igniter primer | |
| AU259052B2 (en) | Slurry blasting explosives | |
| CA555348A (en) | Blasting detonators | |
| AU244435B2 (en) | Ammonium nitrate gas - generating explosive compositions | |
| AU243771B2 (en) | Explosive charge and detonating device suitable for use therein | |
| AU3467163A (en) | Ammonium nitrate for use m explosive compositions when admixed with fuel oil |