SE202134C1 - - Google Patents
Info
- Publication number
- SE202134C1 SE202134C1 SE202134DA SE202134C1 SE 202134 C1 SE202134 C1 SE 202134C1 SE 202134D A SE202134D A SE 202134DA SE 202134 C1 SE202134 C1 SE 202134C1
- Authority
- SE
- Sweden
- Prior art keywords
- methyl
- halide
- iodide
- reacted
- bromine
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- -1 methyl halide Chemical class 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 150000003512 tertiary amines Chemical class 0.000 claims description 5
- 150000001450 anions Chemical class 0.000 claims description 4
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 4
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- 210000004400 mucous membrane Anatomy 0.000 claims description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims 2
- 241000237518 Arion Species 0.000 claims 1
- 241000630665 Hada Species 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- MROWHKRJXTVSGQ-UHFFFAOYSA-N n-(2-phenoxyethyl)-2-phenylethanamine Chemical compound C=1C=CC=CC=1CCNCCOC1=CC=CC=C1 MROWHKRJXTVSGQ-UHFFFAOYSA-N 0.000 claims 1
- XTNXLNGNJZRBRW-UHFFFAOYSA-N n-benzyl-2-phenoxyethanamine Chemical compound C=1C=CC=CC=1CNCCOC1=CC=CC=C1 XTNXLNGNJZRBRW-UHFFFAOYSA-N 0.000 claims 1
- 229920006395 saturated elastomer Polymers 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- CJAAPVQEZPAQNI-UHFFFAOYSA-N (2-methylphenyl)methanamine Chemical compound CC1=CC=CC=C1CN CJAAPVQEZPAQNI-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- PURSZYWBIQIANP-UHFFFAOYSA-N 1-(bromomethyl)-2-chlorobenzene Chemical compound ClC1=CC=CC=C1CBr PURSZYWBIQIANP-UHFFFAOYSA-N 0.000 description 2
- XZXYQEHISUMZAT-UHFFFAOYSA-N 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=CC=C(C)C=2)O)=C1 XZXYQEHISUMZAT-UHFFFAOYSA-N 0.000 description 2
- JJFOBACUIRKUPN-UHFFFAOYSA-N 2-bromoethoxybenzene Chemical compound BrCCOC1=CC=CC=C1 JJFOBACUIRKUPN-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 241000244206 Nematoda Species 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229940107816 ammonium iodide Drugs 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000012022 methylating agents Substances 0.000 description 2
- RUHVDRGWCIAFLG-UHFFFAOYSA-N n,n-dimethyl-2-phenoxyethanamine Chemical compound CN(C)CCOC1=CC=CC=C1 RUHVDRGWCIAFLG-UHFFFAOYSA-N 0.000 description 2
- 244000045947 parasite Species 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000005956 quaternization reaction Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- ZDEJJQHQIOWTPC-UHFFFAOYSA-N 1-(2-bromoethoxy)-2-chlorobenzene Chemical compound ClC1=CC=CC=C1OCCBr ZDEJJQHQIOWTPC-UHFFFAOYSA-N 0.000 description 1
- ABXRTJHEVCZIAG-UHFFFAOYSA-N 1-(2-bromoethoxy)-2-methylbenzene Chemical compound CC1=CC=CC=C1OCCBr ABXRTJHEVCZIAG-UHFFFAOYSA-N 0.000 description 1
- AHOFWSHLRKOJBS-UHFFFAOYSA-N 1-(2-bromoethoxy)-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1OCCBr AHOFWSHLRKOJBS-UHFFFAOYSA-N 0.000 description 1
- FFWQLZFIMNTUCZ-UHFFFAOYSA-N 1-(bromomethyl)-2-fluorobenzene Chemical compound FC1=CC=CC=C1CBr FFWQLZFIMNTUCZ-UHFFFAOYSA-N 0.000 description 1
- LZSYGJNFCREHMD-UHFFFAOYSA-N 1-bromo-2-(bromomethyl)benzene Chemical compound BrCC1=CC=CC=C1Br LZSYGJNFCREHMD-UHFFFAOYSA-N 0.000 description 1
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 1
- YKLDYAJWXJLMRX-UHFFFAOYSA-N 2-(2-methylphenoxy)ethanamine;hydrochloride Chemical compound Cl.CC1=CC=CC=C1OCCN YKLDYAJWXJLMRX-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000760149 Aspiculuris Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- OQMZQCZLFHARNO-UHFFFAOYSA-N Cl.CN(CCOC1=C(C=CC=C1)[N+](=O)[O-])C Chemical compound Cl.CN(CCOC1=C(C=CC=C1)[N+](=O)[O-])C OQMZQCZLFHARNO-UHFFFAOYSA-N 0.000 description 1
- 241000876447 Cooperia curticei Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000243780 Heligmosomoides polygyrus Species 0.000 description 1
- 241001137882 Nematodirus Species 0.000 description 1
- 241001126260 Nippostrongylus Species 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 241000191771 Teladorsagia circumcincta Species 0.000 description 1
- 241000122945 Trichostrongylus axei Species 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 244000000053 intestinal parasite Species 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 210000004877 mucosa Anatomy 0.000 description 1
- MAAOCTAUJRPCTL-UHFFFAOYSA-N n,n-dimethyl-2-(2-methylphenoxy)ethanamine Chemical compound CN(C)CCOC1=CC=CC=C1C MAAOCTAUJRPCTL-UHFFFAOYSA-N 0.000 description 1
- PEXRLFVEZITTKC-UHFFFAOYSA-N n,n-dimethyl-2-(2-methylphenyl)ethanamine Chemical compound CN(C)CCC1=CC=CC=C1C PEXRLFVEZITTKC-UHFFFAOYSA-N 0.000 description 1
- DUAIQRCOSYOASH-UHFFFAOYSA-N n-benzyl-2-(2-chlorophenoxy)ethanamine Chemical compound ClC1=CC=CC=C1OCCNCC1=CC=CC=C1 DUAIQRCOSYOASH-UHFFFAOYSA-N 0.000 description 1
- WBEAMCVSKNGCJJ-UHFFFAOYSA-N n-benzyl-2-(2-methylphenoxy)ethanamine Chemical compound CC1=CC=CC=C1OCCNCC1=CC=CC=C1 WBEAMCVSKNGCJJ-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229950000688 phenothiazine Drugs 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/14—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring
- C07C217/18—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE202134T |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE202134C1 true SE202134C1 (member.php) | 1965-01-01 |
Family
ID=38413310
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE202134D SE202134C1 (member.php) |
Country Status (1)
| Country | Link |
|---|---|
| SE (1) | SE202134C1 (member.php) |
-
0
- SE SE202134D patent/SE202134C1/sv unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Turner et al. | Studies on imidazole compounds. I. 4-Methylimidazole and related compounds | |
| ES2215045T3 (es) | Metodo para la produccion de tiazolidina. | |
| DK158980B (da) | Analogifremgangsmaade til fremstilling af 2,5-bis-(2,2,2-trifluorethoxy)-n-(2-piperidylmethyl)benzamid eller et farmaceutisk acceptabelt syreadditionssalt deraf | |
| IMMEDIATA et al. | β-Naphthyl derivatives of ethanolamine and n-substituted ethanolamines | |
| US3725427A (en) | Certain 2,4-dimethyl-5-carboxamido-thiazoles | |
| JPS6054302B2 (ja) | 9,10‐ジヒドロ‐9,10‐メタノアントラセン・n‐オキシド誘導体およびその製法 | |
| US2573644A (en) | beta-chloroethyl aminoindanes | |
| SE202134C1 (member.php) | ||
| AT201581B (de) | Verfahren zur Herstellung neuer quaternärer Ammoniumsalze | |
| US2876232A (en) | Therapeutic agents | |
| SE452321B (sv) | 1-substituerade n-(8alfa-ergolinyl)-n' ,n'-dietylkarbamider och sett att framstella desamma | |
| US3030371A (en) | Process for the preparation of d-and l-aryl-(2-pyridyl)-amino alkanes | |
| US2415786A (en) | Unsymmetrically substituted piperazines | |
| DE3119796A1 (de) | Substituierte tryptaminderivate von thienyloxpropanolaminen, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen sowie ihre verwendung | |
| US2679501A (en) | Amino derivatives of 2-substituted-4-tert. butylphenol ethers | |
| US3442953A (en) | Novel 7-oxo-7-desacetylaminocolchicine compounds | |
| US2574150A (en) | Acenaphthenyl amino alcohols | |
| EP0139138B1 (en) | Spiro(benzofuran-azalkanes), a method for their preparation and their use as medicaments | |
| US2820827A (en) | Process of separating l- and d-aminomethyl-(3, 4-dihydroxyphenyl)-carbinol | |
| GB2230526A (en) | Preparation of substituted ethenes | |
| US2578696A (en) | N-(2-chloroethyl)-n-piperonyl amines | |
| US2830049A (en) | Acetylenic tetrahydroisoquinoline derivatives | |
| US2763687A (en) | Fluorene derivatives | |
| US4002633A (en) | Novel compounds: N-disubstituted amino-ethyl esters of raubasine of the general formula | |
| NO123929B (member.php) |