SE181240C1 - - Google Patents
Info
- Publication number
- SE181240C1 SE181240C1 SE181240DA SE181240C1 SE 181240 C1 SE181240 C1 SE 181240C1 SE 181240D A SE181240D A SE 181240DA SE 181240 C1 SE181240 C1 SE 181240C1
- Authority
- SE
- Sweden
- Prior art keywords
- disulfide
- dicyclic
- mixture
- disulfides
- materials according
- Prior art date
Links
- -1 ethylene, propylene Chemical group 0.000 claims description 47
- 229920000642 polymer Polymers 0.000 claims description 36
- 239000000463 material Substances 0.000 claims description 31
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 20
- 239000002245 particle Substances 0.000 claims description 10
- GUUVPOWQJOLRAS-UHFFFAOYSA-N Diphenyl disulfide Chemical compound C=1C=CC=CC=1SSC1=CC=CC=C1 GUUVPOWQJOLRAS-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 230000015556 catabolic process Effects 0.000 claims description 7
- 238000006731 degradation reaction Methods 0.000 claims description 7
- HLBZWYXLQJQBKU-UHFFFAOYSA-N 4-(morpholin-4-yldisulfanyl)morpholine Chemical group C1COCCN1SSN1CCOCC1 HLBZWYXLQJQBKU-UHFFFAOYSA-N 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- AFZSMODLJJCVPP-UHFFFAOYSA-N dibenzothiazol-2-yl disulfide Chemical group C1=CC=C2SC(SSC=3SC4=CC=CC=C4N=3)=NC2=C1 AFZSMODLJJCVPP-UHFFFAOYSA-N 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 3
- 229920001577 copolymer Polymers 0.000 claims description 3
- 239000000178 monomer Substances 0.000 claims description 3
- LDTAOIUHUHHCMU-UHFFFAOYSA-N 3-methylpent-1-ene Chemical compound CCC(C)C=C LDTAOIUHUHHCMU-UHFFFAOYSA-N 0.000 claims description 2
- WYLQRHZSKIDFEP-UHFFFAOYSA-N benzene-1,4-dithiol Chemical compound SC1=CC=C(S)C=C1 WYLQRHZSKIDFEP-UHFFFAOYSA-N 0.000 claims description 2
- 238000006116 polymerization reaction Methods 0.000 claims description 2
- 125000002619 bicyclic group Chemical group 0.000 claims 9
- KBDYPDHUODKDRK-UHFFFAOYSA-N n-acetyl-n-phenylacetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=CC=C1 KBDYPDHUODKDRK-UHFFFAOYSA-N 0.000 claims 1
- 239000004698 Polyethylene Substances 0.000 description 33
- 229920000573 polyethylene Polymers 0.000 description 33
- 239000003112 inhibitor Substances 0.000 description 31
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 24
- 239000000523 sample Substances 0.000 description 24
- 229910052760 oxygen Inorganic materials 0.000 description 23
- 239000001301 oxygen Substances 0.000 description 23
- 239000006229 carbon black Substances 0.000 description 22
- 239000003963 antioxidant agent Substances 0.000 description 17
- 235000006708 antioxidants Nutrition 0.000 description 17
- 230000003647 oxidation Effects 0.000 description 14
- 238000007254 oxidation reaction Methods 0.000 description 14
- 230000003078 antioxidant effect Effects 0.000 description 13
- 150000002019 disulfides Chemical class 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- 229960001413 acetanilide Drugs 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 239000000654 additive Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 4
- 239000004743 Polypropylene Substances 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 239000012496 blank sample Substances 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- 229920001155 polypropylene Polymers 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- BZBKGGMMHPADHK-UHFFFAOYSA-N C(CCC)C=1C(=C(C=CC=1)SSC1=C(C(=CC=C1)CCCC)C1=CC=CC=C1)C1=CC=CC=C1 Chemical class C(CCC)C=1C(=C(C=CC=1)SSC1=C(C(=CC=C1)CCCC)C1=CC=CC=C1)C1=CC=CC=C1 BZBKGGMMHPADHK-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 238000009413 insulation Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 238000010525 oxidative degradation reaction Methods 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 239000002861 polymer material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- 238000012549 training Methods 0.000 description 2
- NYDCHVIMHHJJHD-UHFFFAOYSA-N 1-(phenyldisulfanyl)naphthalene Chemical compound C=1C=CC2=CC=CC=C2C=1SSC1=CC=CC=C1 NYDCHVIMHHJJHD-UHFFFAOYSA-N 0.000 description 1
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical group [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 229920001342 Bakelite® Polymers 0.000 description 1
- BYPSKWUZDHHIMX-UHFFFAOYSA-N C(C(C)C)C=1C(=C(C=CC=1)SSC1=C(C(=CC=C1)CC(C)C)C1=CC=CC=C1)C1=CC=CC=C1 Chemical class C(C(C)C)C=1C(=C(C=CC=1)SSC1=C(C(=CC=C1)CC(C)C)C1=CC=CC=C1)C1=CC=CC=C1 BYPSKWUZDHHIMX-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000004637 bakelite Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 230000000593 degrading effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 150000004662 dithiols Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000006864 oxidative decomposition reaction Methods 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 238000012956 testing procedure Methods 0.000 description 1
Landscapes
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE181240T |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE181240C1 true SE181240C1 (cg-RX-API-DMAC7.html) | 1962-01-01 |
Family
ID=41969431
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE181240D SE181240C1 (cg-RX-API-DMAC7.html) |
Country Status (1)
| Country | Link |
|---|---|
| SE (1) | SE181240C1 (cg-RX-API-DMAC7.html) |
-
0
- SE SE181240D patent/SE181240C1/sv unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CN107286636B (zh) | 一种低烟阻燃可陶瓷化热塑性聚氨酯弹性体复合材料及其制备方法和应用 | |
| US2967850A (en) | Compositions of stabilized straight chain hydrocarbons containing carbon black and a compound having r-s-s-r structure | |
| US2889306A (en) | Stabilized straight chain hydrocarbons | |
| NO138868B (no) | Apparat til lagring og utlevering av beholdere som inneholder bestanddeler for drikker | |
| US4440671A (en) | Compositions of hydrocarbon-substituted diphenyl amines and high molecular weight polyethylene glycols; and the use thereof as water-tree retardants for polymers | |
| US2967847A (en) | Alpha olefin hydrocarbons stabilized with carbon black and a compound having r-s-s-rstructure | |
| US3859247A (en) | Pressureless cure system for chemically cross-linking ethylene containing polymers | |
| US2967845A (en) | Alpha olefin hydrocarbons stabilized with carbon black and a carbocyclic thioether | |
| SE181158C1 (cg-RX-API-DMAC7.html) | ||
| SU578896A3 (ru) | Полимерна композици на основе полиолефина | |
| US4283505A (en) | Method for cross-linking and stabilizing polymers which can be cross-linked radically | |
| US2967848A (en) | Alpha-olefin hydrocarbons stabilized with carbon black and a compound having r(sh)x structure | |
| US2967849A (en) | Stabilized straight chain hydrocarbons | |
| SE181240C1 (cg-RX-API-DMAC7.html) | ||
| EP0090427B1 (en) | Compositions of hydrocarbon-substituted diphenyl amines and high molecular weight polyethylene glycols; and the use thereof as water-tree retardants for polymers | |
| US4036719A (en) | Irradiatable polymer composition with improved oxidation resistance | |
| US3679777A (en) | Photodegradable polyolefins | |
| US3072603A (en) | Poly-alpha-olefin compositions containing dialkyl-3, 3'-thiodipropionates and a nitrogen containing compound | |
| JPS627933B2 (cg-RX-API-DMAC7.html) | ||
| CA1218778A (en) | Stabilization system for impact polystyrene | |
| US3072604A (en) | Poly-alpha-olefin compositions containing dialkyl-3, 3'-thiodipropionates and a nitrogen containing compound | |
| US3042649A (en) | Composition including a saturated hydrocarbon polymer stabilized with oxygenated or sulfurized carbon black | |
| CN107778525B (zh) | 一种聚乙烯电线电缆专用料的稳定剂组合物 | |
| Nakagawa et al. | Radiation protection of poly (vinyl chloride) by N‐methyl dithiocarbamate substitution | |
| SE181239C1 (cg-RX-API-DMAC7.html) |