RU2162080C2 - Улучшенный способ получения 2,4-диамино-6-алкилтио- s -триазинов - Google Patents
Улучшенный способ получения 2,4-диамино-6-алкилтио- s -триазинов Download PDFInfo
- Publication number
- RU2162080C2 RU2162080C2 RU94038305/04A RU94038305A RU2162080C2 RU 2162080 C2 RU2162080 C2 RU 2162080C2 RU 94038305/04 A RU94038305/04 A RU 94038305/04A RU 94038305 A RU94038305 A RU 94038305A RU 2162080 C2 RU2162080 C2 RU 2162080C2
- Authority
- RU
- Russia
- Prior art keywords
- alkyl
- cycloalkyl
- water
- triazine
- methylthio
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 31
- 238000006243 chemical reaction Methods 0.000 claims abstract description 31
- 150000001875 compounds Chemical class 0.000 claims abstract description 15
- 239000003960 organic solvent Substances 0.000 claims abstract description 13
- 239000002253 acid Substances 0.000 claims abstract description 12
- 239000003153 chemical reaction reagent Substances 0.000 claims abstract description 10
- 239000011230 binding agent Substances 0.000 claims abstract description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 9
- 239000003444 phase transfer catalyst Substances 0.000 claims abstract description 9
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 5
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims abstract description 3
- 125000003118 aryl group Chemical group 0.000 claims abstract description 3
- 229930195733 hydrocarbon Natural products 0.000 claims abstract description 3
- 150000002430 hydrocarbons Chemical class 0.000 claims abstract description 3
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims abstract description 3
- 150000003573 thiols Chemical class 0.000 claims abstract description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 21
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 claims description 18
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 claims description 10
- HDHLIWCXDDZUFH-UHFFFAOYSA-N irgarol 1051 Chemical compound CC(C)(C)NC1=NC(SC)=NC(NC2CC2)=N1 HDHLIWCXDDZUFH-UHFFFAOYSA-N 0.000 claims description 9
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 claims description 8
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 claims description 7
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 239000008096 xylene Substances 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 5
- MWWBDLRPMWTLRX-UHFFFAOYSA-N GS26575 Chemical compound CSC1=NC(N)=NC(NC(C)(C)C)=N1 MWWBDLRPMWTLRX-UHFFFAOYSA-N 0.000 claims description 4
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 4
- VONUTDHPPXOPTC-UHFFFAOYSA-N M3 Chemical compound CSC1=NC(NC(C)(C)C)=NC(NC(C)(C)C)=N1 VONUTDHPPXOPTC-UHFFFAOYSA-N 0.000 claims description 3
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 claims description 3
- IPILPUZVTYHGIL-UHFFFAOYSA-M tributyl(methyl)azanium;chloride Chemical compound [Cl-].CCCC[N+](C)(CCCC)CCCC IPILPUZVTYHGIL-UHFFFAOYSA-M 0.000 claims description 3
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 claims description 3
- CJSBPHMYXLHWIQ-UHFFFAOYSA-N 2-n,4-n-dicyclopropyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound N=1C(NC2CC2)=NC(SC)=NC=1NC1CC1 CJSBPHMYXLHWIQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- ZXUCBXRTRRIBSO-UHFFFAOYSA-L tetrabutylazanium;sulfate Chemical compound [O-]S([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC ZXUCBXRTRRIBSO-UHFFFAOYSA-L 0.000 claims 1
- 239000002904 solvent Substances 0.000 abstract description 16
- 239000000126 substance Substances 0.000 abstract description 9
- 239000013535 sea water Substances 0.000 abstract description 5
- 244000005700 microbiome Species 0.000 abstract description 4
- 239000003795 chemical substances by application Substances 0.000 abstract description 3
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 abstract 2
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 abstract 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- 239000000047 product Substances 0.000 description 21
- 239000000243 solution Substances 0.000 description 21
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 20
- 239000012044 organic layer Substances 0.000 description 18
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- 238000010533 azeotropic distillation Methods 0.000 description 10
- 238000004817 gas chromatography Methods 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- 150000001412 amines Chemical class 0.000 description 9
- 229940078552 o-xylene Drugs 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 239000012467 final product Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 238000007405 data analysis Methods 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 229910001220 stainless steel Inorganic materials 0.000 description 5
- 239000010935 stainless steel Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000010183 spectrum analysis Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 4
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 3
- 150000003973 alkyl amines Chemical class 0.000 description 3
- -1 alkyl mercaptan Chemical compound 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 238000003912 environmental pollution Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 230000002353 algacidal effect Effects 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- NVVZQXQBYZPMLJ-UHFFFAOYSA-N formaldehyde;naphthalene-1-sulfonic acid Chemical compound O=C.C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 NVVZQXQBYZPMLJ-UHFFFAOYSA-N 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical class C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- HTSVYUUXJSMGQC-UHFFFAOYSA-N 2-chloro-1,3,5-triazine Chemical class ClC1=NC=NC=N1 HTSVYUUXJSMGQC-UHFFFAOYSA-N 0.000 description 1
- YQSPKCXHYIXZTK-UHFFFAOYSA-N 2-n,4-n-didodecyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCCCCCCCNC1=NC(NCCCCCCCCCCCC)=NC(SC)=N1 YQSPKCXHYIXZTK-UHFFFAOYSA-N 0.000 description 1
- BRHDTRXHZFORCW-UHFFFAOYSA-N 2-n,4-n-dioctyl-6-propylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCCCNC1=NC(NCCCCCCCC)=NC(SCCC)=N1 BRHDTRXHZFORCW-UHFFFAOYSA-N 0.000 description 1
- SNYDXUHKCJUBOK-UHFFFAOYSA-N 2-n,4-n-ditert-butyl-6-ethylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound CCSC1=NC(NC(C)(C)C)=NC(NC(C)(C)C)=N1 SNYDXUHKCJUBOK-UHFFFAOYSA-N 0.000 description 1
- PJYRDZVUMJAYDN-UHFFFAOYSA-N 2-n-cyclobutyl-4-n-octyl-6-pentylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCSC1=NC(NCCCCCCCC)=NC(NC2CCC2)=N1 PJYRDZVUMJAYDN-UHFFFAOYSA-N 0.000 description 1
- UEMXCXNVACFPDQ-UHFFFAOYSA-N 2-n-cyclohexyl-6-hexylsulfanyl-4-n-pentyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCSC1=NC(NCCCCC)=NC(NC2CCCCC2)=N1 UEMXCXNVACFPDQ-UHFFFAOYSA-N 0.000 description 1
- NMRKVCUCYVTVIJ-UHFFFAOYSA-N 2-n-cyclopropyl-6-hexylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCSC1=NC(N)=NC(NC2CC2)=N1 NMRKVCUCYVTVIJ-UHFFFAOYSA-N 0.000 description 1
- SGNIUDRKEPUBDN-UHFFFAOYSA-N 2-n-dodecyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCCCCCCCNC1=NC(N)=NC(SC)=N1 SGNIUDRKEPUBDN-UHFFFAOYSA-N 0.000 description 1
- HYHDEZMKZPHEQS-UHFFFAOYSA-N 2-n-methyl-6-nonylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCCCCSC1=NC(N)=NC(NC)=N1 HYHDEZMKZPHEQS-UHFFFAOYSA-N 0.000 description 1
- HVQUWBHHJQCJQS-UHFFFAOYSA-N 6-butylsulfanyl-2-n,4-n-diethyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCSC1=NC(NCC)=NC(NCC)=N1 HVQUWBHHJQCJQS-UHFFFAOYSA-N 0.000 description 1
- XXDCPMIWWQQVMZ-UHFFFAOYSA-N 6-butylsulfanyl-2-n-(cyclopropylmethyl)-4-n-methyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCSC1=NC(NC)=NC(NCC2CC2)=N1 XXDCPMIWWQQVMZ-UHFFFAOYSA-N 0.000 description 1
- FVFVNNKYKYZTJU-UHFFFAOYSA-N 6-chloro-1,3,5-triazine-2,4-diamine Chemical compound NC1=NC(N)=NC(Cl)=N1 FVFVNNKYKYZTJU-UHFFFAOYSA-N 0.000 description 1
- WKSAVKBBBSIALV-UHFFFAOYSA-N 6-decylsulfanyl-2-n-octyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCCCCCSC1=NC(N)=NC(NCCCCCCCC)=N1 WKSAVKBBBSIALV-UHFFFAOYSA-N 0.000 description 1
- OZDBPRGJTUNDHX-UHFFFAOYSA-N 6-ethylsulfanyl-2-n-hexyl-4-n-methyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCNC1=NC(NC)=NC(SCC)=N1 OZDBPRGJTUNDHX-UHFFFAOYSA-N 0.000 description 1
- LTFYDXJSGLBVAH-UHFFFAOYSA-N 6-hexylsulfanyl-2-n,4-n-dipentyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCSC1=NC(NCCCCC)=NC(NCCCCC)=N1 LTFYDXJSGLBVAH-UHFFFAOYSA-N 0.000 description 1
- 241001474374 Blennius Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- RQVYBGPQFYCBGX-UHFFFAOYSA-N ametryn Chemical compound CCNC1=NC(NC(C)C)=NC(SC)=N1 RQVYBGPQFYCBGX-UHFFFAOYSA-N 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000003373 anti-fouling effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- WIBFFTLQMKKBLZ-SEYXRHQNSA-N n-butyl oleate Chemical class CCCCCCCC\C=C/CCCCCCCC(=O)OCCCC WIBFFTLQMKKBLZ-SEYXRHQNSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000005304 optical glass Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- AAEVYOVXGOFMJO-UHFFFAOYSA-N prometryn Chemical compound CSC1=NC(NC(C)C)=NC(NC(C)C)=N1 AAEVYOVXGOFMJO-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229940104261 taurate Drugs 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 150000007944 thiolates Chemical class 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/42—One nitrogen atom
- C07D251/46—One nitrogen atom with oxygen or sulfur atoms attached to the two other ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/48—Two nitrogen atoms
- C07D251/52—Two nitrogen atoms with an oxygen or sulfur atom attached to the third ring carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Catalysts (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/138,853 | 1993-10-18 | ||
| US08/138,858 | 1993-10-19 | ||
| US08/138,858 US5420274A (en) | 1993-10-19 | 1993-10-19 | Process for the preparation of 2,4-di(alkylamino)-6-alkylthio-s-triazines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| RU94038305A RU94038305A (ru) | 1996-05-27 |
| RU2162080C2 true RU2162080C2 (ru) | 2001-01-20 |
Family
ID=22483976
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RU94038305/04A RU2162080C2 (ru) | 1993-10-19 | 1994-10-14 | Улучшенный способ получения 2,4-диамино-6-алкилтио- s -триазинов |
Country Status (13)
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR20040002159A (ko) * | 2002-06-29 | 2004-01-07 | 삼성전자주식회사 | 세탁기 |
| CN100413851C (zh) * | 2006-03-31 | 2008-08-27 | 樊能廷 | 一种制备n－环丙基－n’－(1,1－二甲基乙基)－6－(甲硫基)－1,3,5－三嗪－2,4－二胺的方法 |
| CN101502265B (zh) * | 2009-03-06 | 2011-11-23 | 山东潍坊润丰化工有限公司 | 一种催化合成三嗪类除草剂的方法 |
| US9340725B2 (en) * | 2011-08-19 | 2016-05-17 | Baker Hughes Incorporated | Use of a BTEX-free solvent to prepare stimulation and oilfield production additives |
Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SU399136A3 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1968-07-25 | 1973-09-27 | ||
| US3830810A (en) * | 1971-12-01 | 1974-08-20 | Ciba Geigy Corp | S-triazine derivatives |
| GB1593036A (en) * | 1977-04-14 | 1981-07-15 | Ciba Geigy Ag | Herbicidal triazine compounds |
| US4281123A (en) * | 1978-11-20 | 1981-07-28 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler | Process for introducing three substituents in cyanuric chloride |
| EP0191496A2 (en) * | 1985-02-15 | 1986-08-20 | Idemitsu Kosan Company Limited | Triazine Derivatives, a process for preparing the derivatives, and herbicides containing the derivatives as the effective component |
| EP0357556A1 (de) * | 1988-09-02 | 1990-03-07 | Ciba-Geigy Ag | Verfahren zur Herstellung von 6-Alkylthio-2,4-diamino-1,3,5-triazinen |
| SU1599370A1 (ru) * | 1984-08-14 | 1990-10-15 | Вызкумны Устав Хемицкей Технологие (Инопредприятие) | Способ получени смеси 2,4-диамино-6-алкилтио-S-триазинов с 2,4-диамино-6-хлор-S-триазинами |
| EP0398843A1 (en) * | 1989-05-17 | 1990-11-22 | Ciba-Geigy Ag | Lubricant compositions |
| SU1394675A1 (ru) * | 1986-01-06 | 1995-10-10 | Л.И. Ахметов | Способ получения 2-алкилтио-4,6-бис-(алкиламино)-1,3,5-триазинов |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH492400A (de) * | 1968-03-20 | 1970-06-30 | Agripat Sa | Selektives Herbizid und dessen Verwendung zur Bekämpfung von Unkräutern und Ungräsern |
| US3741745A (en) * | 1969-03-14 | 1973-06-26 | Ciba Geigy Corp | Herbicidal 2-alkythio-4,6-diamino-s-triazines |
| US3753986A (en) * | 1970-04-02 | 1973-08-21 | Exxon Research Engineering Co | Triazine herbicides |
| CH534477A (de) * | 1970-08-20 | 1973-03-15 | Agripat Sa | Herbizides Mittel |
| US3766182A (en) * | 1971-05-26 | 1973-10-16 | Ciba Geigy Corp | S-triazine derivatives |
| EP0003749B1 (de) * | 1978-02-03 | 1982-09-15 | Ciba-Geigy Ag | 2-Methylthio-4-cyclopropylamino-6-(Alpha,Beta-dimethylpropylamino)-s-triazin und die Verwendung von Triazinderivaten als Meerwasseralgizide |
| DE3927623A1 (de) * | 1989-08-22 | 1991-02-28 | Hoechst Ag | N,n'-bis-1,3,5-triazin-6-yl-piperazine und verfahren zu ihrer herstellung |
-
1993
- 1993-10-19 US US08/138,858 patent/US5420274A/en not_active Expired - Fee Related
-
1994
- 1994-09-24 TW TW083108882A patent/TW265339B/zh active
- 1994-10-11 EP EP94810593A patent/EP0648755B1/en not_active Expired - Lifetime
- 1994-10-11 DE DE69425405T patent/DE69425405T2/de not_active Expired - Fee Related
- 1994-10-11 ES ES94810593T patent/ES2149858T3/es not_active Expired - Lifetime
- 1994-10-14 RU RU94038305/04A patent/RU2162080C2/ru not_active IP Right Cessation
- 1994-10-17 CA CA002118282A patent/CA2118282C/en not_active Expired - Fee Related
- 1994-10-17 CZ CZ942562A patent/CZ256294A3/cs unknown
- 1994-10-17 SK SK1256-94A patent/SK282246B6/sk unknown
- 1994-10-18 CN CN94117319A patent/CN1057761C/zh not_active Expired - Fee Related
- 1994-10-18 KR KR1019940026807A patent/KR100335723B1/ko not_active Expired - Fee Related
- 1994-10-18 BR BR9404139A patent/BR9404139A/pt not_active IP Right Cessation
- 1994-10-19 JP JP28008394A patent/JP3755109B2/ja not_active Expired - Fee Related
Patent Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SU399136A3 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1968-07-25 | 1973-09-27 | ||
| US3830810A (en) * | 1971-12-01 | 1974-08-20 | Ciba Geigy Corp | S-triazine derivatives |
| GB1593036A (en) * | 1977-04-14 | 1981-07-15 | Ciba Geigy Ag | Herbicidal triazine compounds |
| US4281123A (en) * | 1978-11-20 | 1981-07-28 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler | Process for introducing three substituents in cyanuric chloride |
| SU1599370A1 (ru) * | 1984-08-14 | 1990-10-15 | Вызкумны Устав Хемицкей Технологие (Инопредприятие) | Способ получени смеси 2,4-диамино-6-алкилтио-S-триазинов с 2,4-диамино-6-хлор-S-триазинами |
| EP0191496A2 (en) * | 1985-02-15 | 1986-08-20 | Idemitsu Kosan Company Limited | Triazine Derivatives, a process for preparing the derivatives, and herbicides containing the derivatives as the effective component |
| SU1394675A1 (ru) * | 1986-01-06 | 1995-10-10 | Л.И. Ахметов | Способ получения 2-алкилтио-4,6-бис-(алкиламино)-1,3,5-триазинов |
| EP0357556A1 (de) * | 1988-09-02 | 1990-03-07 | Ciba-Geigy Ag | Verfahren zur Herstellung von 6-Alkylthio-2,4-diamino-1,3,5-triazinen |
| EP0398843A1 (en) * | 1989-05-17 | 1990-11-22 | Ciba-Geigy Ag | Lubricant compositions |
Also Published As
| Publication number | Publication date |
|---|---|
| US5420274A (en) | 1995-05-30 |
| ES2149858T3 (es) | 2000-11-16 |
| DE69425405D1 (de) | 2000-09-07 |
| EP0648755B1 (en) | 2000-08-02 |
| DE69425405T2 (de) | 2001-02-08 |
| CN1057761C (zh) | 2000-10-25 |
| JPH07188192A (ja) | 1995-07-25 |
| RU94038305A (ru) | 1996-05-27 |
| BR9404139A (pt) | 1995-06-13 |
| JP3755109B2 (ja) | 2006-03-15 |
| KR950011423A (ko) | 1995-05-15 |
| SK125694A3 (en) | 1995-05-10 |
| KR100335723B1 (ko) | 2002-11-29 |
| CA2118282C (en) | 2005-12-06 |
| CZ256294A3 (en) | 1995-05-17 |
| CN1110276A (zh) | 1995-10-18 |
| CA2118282A1 (en) | 1995-04-20 |
| SK282246B6 (sk) | 2001-12-03 |
| EP0648755A1 (en) | 1995-04-19 |
| TW265339B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1995-12-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Bernatowicz et al. | Urethane protected derivatives of 1-guanylpyrazole for the mild and efficient preparation of guanidines | |
| US2655534A (en) | Preparation of n-aromatic-n'-aliphatic hydrocarbon ureas | |
| US5731449A (en) | Triethylendiamine synthesis with base-treated zeolites as catalysts | |
| RU2162080C2 (ru) | Улучшенный способ получения 2,4-диамино-6-алкилтио- s -триазинов | |
| US4966969A (en) | Process for the preparation of triethylenediamines | |
| US4886882A (en) | Hydroxyoxaalkylmelamines | |
| US5463138A (en) | Process for preparing difluoromethoxyarenes and difluoromethylthioarenes | |
| KR0156250B1 (ko) | 이소티오시아네이트의 제조 방법 | |
| US5043444A (en) | Process for the preparation of asymmetrically substituted ureas | |
| US4039577A (en) | Process for preparing phenylisopropylurea derivatives | |
| US3326912A (en) | Process for the production of 2-mercapto-4, 6-bis-amino-s-triazine derivatives | |
| US5565602A (en) | Production of thiolcarbamates | |
| EP0390278A1 (en) | 3-(1,3-oxazolidinyl)-s-triazine | |
| US6878824B2 (en) | Process for preparing N-methylated melamines | |
| HUT58285A (en) | Process for producing substituted ethylene derivatives | |
| CA2187217A1 (en) | Process for producing carboxy arene sulphonic acids and their carboxylic acid derivatives | |
| GB1588027A (en) | Manufacture of acetoacetamides | |
| US3883515A (en) | Adiabatic process for the production of 2,4-dichloro-6-amino-S-triazines | |
| IE58978B1 (en) | Process for preparing a substituted phenylurea | |
| US3479353A (en) | Preparation of 6-amino-2,4-bis(dimethylamino)-s-triazine | |
| US5130428A (en) | Preparation of 6-trifluoromethyl-1,3,5-triazines | |
| SU598560A3 (ru) | Способ получени замещенных 2-хлор-4-алкиламино-6цианоалкиламино-1,3,5триазинов | |
| RU2230741C1 (ru) | Способ получения простых макроэфиров сим-триазинового ряда | |
| SU1113376A1 (ru) | Способ получени @ , @ -дизамещенных нитрозогидразинов | |
| US5721364A (en) | Process for making 2-amino-4, 6-dialkoxy-1, 3, 5-triazines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | The patent is invalid due to non-payment of fees |
Effective date: 20061015 |