PL99087B1 - Smar - Google Patents
Smar Download PDFInfo
- Publication number
- PL99087B1 PL99087B1 PL18795176A PL18795176A PL99087B1 PL 99087 B1 PL99087 B1 PL 99087B1 PL 18795176 A PL18795176 A PL 18795176A PL 18795176 A PL18795176 A PL 18795176A PL 99087 B1 PL99087 B1 PL 99087B1
- Authority
- PL
- Poland
- Prior art keywords
- dmm
- penetration
- grease according
- double strokes
- polyglycol
- Prior art date
Links
- 239000004519 grease Substances 0.000 title claims description 20
- 238000000034 method Methods 0.000 claims description 28
- 239000002480 mineral oil Substances 0.000 claims description 28
- 235000010446 mineral oil Nutrition 0.000 claims description 28
- 239000000314 lubricant Substances 0.000 claims description 17
- 239000004711 α-olefin Substances 0.000 claims description 17
- 150000003871 sulfonates Chemical class 0.000 claims description 12
- 239000002199 base oil Substances 0.000 claims description 11
- 229910052751 metal Inorganic materials 0.000 claims description 10
- 239000002184 metal Substances 0.000 claims description 10
- 239000010695 polyglycol Substances 0.000 claims description 10
- 229920000151 polyglycol Polymers 0.000 claims description 10
- -1 polyoxypropylene Polymers 0.000 claims description 10
- 239000010687 lubricating oil Substances 0.000 claims description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 5
- 229910052782 aluminium Inorganic materials 0.000 claims description 5
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 5
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 4
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 claims description 4
- 229920002545 silicone oil Polymers 0.000 claims description 4
- 229910052725 zinc Inorganic materials 0.000 claims description 4
- 239000011701 zinc Substances 0.000 claims description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 3
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 claims description 3
- 239000004205 dimethyl polysiloxane Substances 0.000 claims description 3
- 235000013870 dimethyl polysiloxane Nutrition 0.000 claims description 3
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 claims description 3
- RDOFJDLLWVCMRU-UHFFFAOYSA-N Diisobutyl adipate Chemical group CC(C)COC(=O)CCCCC(=O)OCC(C)C RDOFJDLLWVCMRU-UHFFFAOYSA-N 0.000 claims description 2
- 239000002202 Polyethylene glycol Substances 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 229940031769 diisobutyl adipate Drugs 0.000 claims description 2
- MIMDHDXOBDPUQW-UHFFFAOYSA-N dioctyl decanedioate Chemical compound CCCCCCCCOC(=O)CCCCCCCCC(=O)OCCCCCCCC MIMDHDXOBDPUQW-UHFFFAOYSA-N 0.000 claims description 2
- 229920001223 polyethylene glycol Polymers 0.000 claims description 2
- 229920001451 polypropylene glycol Polymers 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 230000035515 penetration Effects 0.000 description 71
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 42
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- 239000000203 mixture Substances 0.000 description 29
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 20
- 229910052791 calcium Inorganic materials 0.000 description 19
- 239000011575 calcium Substances 0.000 description 19
- 239000002904 solvent Substances 0.000 description 19
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 17
- 239000006185 dispersion Substances 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 229910002092 carbon dioxide Inorganic materials 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- 239000000292 calcium oxide Substances 0.000 description 7
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 230000000737 periodic effect Effects 0.000 description 5
- 239000002562 thickening agent Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 159000000007 calcium salts Chemical class 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 229920001296 polysiloxane Chemical class 0.000 description 3
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- 230000005587 bubbling Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 230000008719 thickening Effects 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- MHHAKYUMPRWGJE-UHFFFAOYSA-N O=S=O.O=S=O.[Ca+2] Chemical compound O=S=O.O=S=O.[Ca+2] MHHAKYUMPRWGJE-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229910052767 actinium Inorganic materials 0.000 description 1
- QQINRWTZWGJFDB-UHFFFAOYSA-N actinium atom Chemical compound [Ac] QQINRWTZWGJFDB-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 159000000009 barium salts Chemical class 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000701 coagulant Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229910052705 radium Inorganic materials 0.000 description 1
- HCWPIIXVSYCSAN-UHFFFAOYSA-N radium atom Chemical compound [Ra] HCWPIIXVSYCSAN-UHFFFAOYSA-N 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 229910052706 scandium Inorganic materials 0.000 description 1
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical group [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Landscapes
- Lubricants (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2132175A IT1034156B (it) | 1975-03-17 | 1975-03-17 | Ispessenti per grassi |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL99087B1 true PL99087B1 (pl) | 1978-06-30 |
Family
ID=11180066
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL18795176A PL99087B1 (pl) | 1975-03-17 | 1976-03-15 | Smar |
Country Status (7)
| Country | Link |
|---|---|
| CS (1) | CS220309B2 (show.php) |
| HU (1) | HU176320B (show.php) |
| IN (1) | IN145033B (show.php) |
| IT (1) | IT1034156B (show.php) |
| MW (1) | MW676A1 (show.php) |
| PL (1) | PL99087B1 (show.php) |
| ZA (1) | ZA761455B (show.php) |
-
1975
- 1975-03-17 IT IT2132175A patent/IT1034156B/it active
-
1976
- 1976-03-09 ZA ZA761455A patent/ZA761455B/xx unknown
- 1976-03-15 PL PL18795176A patent/PL99087B1/pl unknown
- 1976-03-16 MW MW676A patent/MW676A1/xx unknown
- 1976-03-16 HU HUSA002902 patent/HU176320B/hu unknown
- 1976-03-17 IN IN464/CAL/76A patent/IN145033B/en unknown
- 1976-03-17 CS CS173476A patent/CS220309B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ZA761455B (en) | 1977-03-30 |
| IN145033B (show.php) | 1978-08-12 |
| MW676A1 (en) | 1977-07-13 |
| HU176320B (en) | 1981-01-28 |
| IT1034156B (it) | 1979-09-10 |
| CS220309B2 (en) | 1983-03-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2116369C (en) | Improved sulfonate greases | |
| US4560489A (en) | High performance calcium borate modified overbased calcium sulfonate complex greases | |
| US3661622A (en) | Method of improving resistance to corrosion of metal surfaces and resultant article | |
| EP1784411B1 (en) | Modified overbased calcium or calcium borate salicylate complex in greases | |
| US2535101A (en) | Sulfonate base lubricating grease | |
| US2628202A (en) | Soap useful for making lubricating greases | |
| US2628195A (en) | Lubricating grease | |
| CA2133393C (en) | Overbased carboxylates and gels | |
| US6429175B1 (en) | Lubricating grease composition | |
| JP3630641B2 (ja) | 改良されたレオロジ−的に動的な、液体で適用できる弾性体組成物 | |
| AU2001253212A1 (en) | Improved rheologically-dynamic, liquid-applicable elastomeric compositions | |
| US2699414A (en) | Water-resistant gypsum composition and emulsions for making the same | |
| US3396108A (en) | Extreme pressure soap and complex thickened greases | |
| PL99087B1 (pl) | Smar | |
| US4310428A (en) | Lubricants, and process for thickening organic liquids | |
| KR830004396A (ko) | 수화된 Mg(NO_3)_2/MgCl_2가역 상변화 조성물 | |
| RU2717349C2 (ru) | Смазочная композиция | |
| US2540534A (en) | Extreme pressure grease | |
| KR20180101478A (ko) | 알칼리 금속 수산화물을 사용하고 비수성 전환제의 지연된 첨가를 사용하는 설폰산칼슘 그리스의 제조 | |
| US2230556A (en) | Foam suppressor for soluble oils | |
| US3793197A (en) | Lubricating grease composition | |
| US4541965A (en) | Dispersants for aqueous slurries | |
| US2308116A (en) | Pour point depressant for lubricating oils | |
| US4605507A (en) | Processes for making a sulfur suspension and a sulfurized cutting fluid | |
| US2846393A (en) | Heavy duty soluble oil composition |