PL94934B1 - - Google Patents
Download PDFInfo
- Publication number
- PL94934B1 PL94934B1 PL1975179229A PL17922975A PL94934B1 PL 94934 B1 PL94934 B1 PL 94934B1 PL 1975179229 A PL1975179229 A PL 1975179229A PL 17922975 A PL17922975 A PL 17922975A PL 94934 B1 PL94934 B1 PL 94934B1
- Authority
- PL
- Poland
- Prior art keywords
- methyl
- formula
- cephem
- group
- acid
- Prior art date
Links
- -1 1-methyl-1H-tetrazol-5-ylthiomethyl Chemical group 0.000 claims description 55
- 239000002253 acid Substances 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 22
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 11
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 9
- 125000005059 halophenyl group Chemical group 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 125000005042 acyloxymethyl group Chemical group 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 5
- RAGLEQCHKYDVPY-UHFFFAOYSA-N n-(4-chlorobenzoyl)-n-methylcarbamoyl chloride Chemical compound ClC(=O)N(C)C(=O)C1=CC=C(Cl)C=C1 RAGLEQCHKYDVPY-UHFFFAOYSA-N 0.000 claims description 5
- 125000005633 phthalidyl group Chemical group 0.000 claims description 5
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- VNWREJGHKGOVEE-UHFFFAOYSA-N n-methyl-n-(3-phenylprop-2-enoyl)carbamoyl chloride Chemical compound ClC(=O)N(C)C(=O)C=CC1=CC=CC=C1 VNWREJGHKGOVEE-UHFFFAOYSA-N 0.000 claims description 4
- 231100000252 nontoxic Toxicity 0.000 claims description 4
- 230000003000 nontoxic effect Effects 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 3
- 150000001782 cephems Chemical class 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- RQSCFNPNNLWQBJ-UHFFFAOYSA-N 2-methyl-1,3,4-thiadiazole Chemical compound CC1=NN=CS1 RQSCFNPNNLWQBJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 2
- IXWFNFDCGPYKRG-QFSRMBNQSA-N (6r)-4-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid Chemical compound CN1N=NN=C1SCC1C(C(O)=O)=CN2C(=O)C[C@H]2S1 IXWFNFDCGPYKRG-QFSRMBNQSA-N 0.000 claims 1
- PSDRTSQLTACMMU-NQPNHJOESA-N N1N=NN=C1SCC1S[C@H]2N(C=C1)C(C2)=O Chemical compound N1N=NN=C1SCC1S[C@H]2N(C=C1)C(C2)=O PSDRTSQLTACMMU-NQPNHJOESA-N 0.000 claims 1
- 125000002541 furyl group Chemical group 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims 1
- AFCCDDWKHLHPDF-UHFFFAOYSA-M metam-sodium Chemical compound [Na+].CNC([S-])=S AFCCDDWKHLHPDF-UHFFFAOYSA-M 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 31
- 150000001875 compounds Chemical class 0.000 description 17
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 229940124587 cephalosporin Drugs 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 229930186147 Cephalosporin Natural products 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- 150000001780 cephalosporins Chemical class 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 239000003242 anti bacterial agent Substances 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 229940088710 antibiotic agent Drugs 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 8
- 244000005700 microbiome Species 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 238000004448 titration Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 125000003541 2-chlorobenzoyl group Chemical group ClC1=C(C(=O)*)C=CC=C1 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- 241000191940 Staphylococcus Species 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 230000003115 biocidal effect Effects 0.000 description 4
- 238000002955 isolation Methods 0.000 description 4
- JQZOWMZABYXALC-UHFFFAOYSA-N n-(2-chlorobenzoyl)-n-methylcarbamoyl chloride Chemical compound ClC(=O)N(C)C(=O)C1=CC=CC=C1Cl JQZOWMZABYXALC-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- 125000001750 3-nitrocinnamoyl group Chemical group 0.000 description 3
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical class CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229930182555 Penicillin Natural products 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- OMAFFHIGWTVZOH-UHFFFAOYSA-N 1-methyltetrazole Chemical compound CN1C=NN=N1 OMAFFHIGWTVZOH-UHFFFAOYSA-N 0.000 description 2
- CLMSHAWYULIVFQ-UHFFFAOYSA-N 3-bromo-3h-2-benzofuran-1-one Chemical compound C1=CC=C2C(Br)OC(=O)C2=C1 CLMSHAWYULIVFQ-UHFFFAOYSA-N 0.000 description 2
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 2
- 125000002672 4-bromobenzoyl group Chemical group BrC1=CC=C(C(=O)*)C=C1 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 241000589516 Pseudomonas Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- SIOVKLKJSOKLIF-UHFFFAOYSA-N bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)OC(C)=N[Si](C)(C)C SIOVKLKJSOKLIF-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 229910003002 lithium salt Inorganic materials 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 229940049954 penicillin Drugs 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- FZEVMBJWXHDLDB-ZCFIWIBFSA-N (6r)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound S1CC=CN2C(=O)C[C@H]21 FZEVMBJWXHDLDB-ZCFIWIBFSA-N 0.000 description 1
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 1
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Chemical group C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 1
- DUJAUTCYDLIGAY-UHFFFAOYSA-N 2-(furan-2-ylamino)acetic acid Chemical compound OC(=O)CNC1=CC=CO1 DUJAUTCYDLIGAY-UHFFFAOYSA-N 0.000 description 1
- ITXNDDPDABTCBO-UHFFFAOYSA-N 2-chloro-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1Cl ITXNDDPDABTCBO-UHFFFAOYSA-N 0.000 description 1
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 241000588914 Enterobacter Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000588748 Klebsiella Species 0.000 description 1
- 241000588915 Klebsiella aerogenes Species 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- VATYITURZAJOJV-UHFFFAOYSA-N N-(3,4-dichlorobenzoyl)-N-methylcarbamoyl chloride Chemical compound ClC=1C=C(C(=O)N(C(=O)Cl)C)C=CC1Cl VATYITURZAJOJV-UHFFFAOYSA-N 0.000 description 1
- UNVIQEULQDZGOJ-UHFFFAOYSA-N N-[3-(2,4-dichlorophenyl)prop-2-enoyl]-N-methylcarbamoyl chloride Chemical compound ClC1=C(C=CC(=O)N(C(=O)Cl)C)C=CC(=C1)Cl UNVIQEULQDZGOJ-UHFFFAOYSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- SVGQLMJGQZUEHN-UHFFFAOYSA-N N-methyl-N-(3-nitrobenzoyl)carbamoyl chloride Chemical compound CN(C(Cl)=O)C(=O)C1=CC(=CC=C1)[N+]([O-])=O SVGQLMJGQZUEHN-UHFFFAOYSA-N 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical group CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- 241000607726 Salmonella enterica subsp. enterica serovar Heidelberg Species 0.000 description 1
- 241000607720 Serratia Species 0.000 description 1
- 241000607715 Serratia marcescens Species 0.000 description 1
- 241000607758 Shigella sp. Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000194017 Streptococcus Species 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- NHYXMAKLBXBVEO-UHFFFAOYSA-N bromomethyl acetate Chemical compound CC(=O)OCBr NHYXMAKLBXBVEO-UHFFFAOYSA-N 0.000 description 1
- YXASHNSJWVCWQQ-UHFFFAOYSA-N bromomethyl propanoate Chemical compound CCC(=O)OCBr YXASHNSJWVCWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- BOXZXICVMMSYPE-UHFFFAOYSA-N chloromethyl benzoate Chemical compound ClCOC(=O)C1=CC=CC=C1 BOXZXICVMMSYPE-UHFFFAOYSA-N 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 230000001351 cycling effect Effects 0.000 description 1
- RAABOESOVLLHRU-UHFFFAOYSA-N diazene Chemical compound N=N RAABOESOVLLHRU-UHFFFAOYSA-N 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- PEHSSTUGJUBZBI-UHFFFAOYSA-N indan-5-ol Chemical compound OC1=CC=C2CCCC2=C1 PEHSSTUGJUBZBI-UHFFFAOYSA-N 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- FYFFGSSZFBZTAH-UHFFFAOYSA-N methylaminomethanetriol Chemical compound CNC(O)(O)O FYFFGSSZFBZTAH-UHFFFAOYSA-N 0.000 description 1
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 1
- FBLUSPHFKYPTKI-UHFFFAOYSA-N n-[3-(2-chlorophenyl)prop-2-enoyl]-n-methylcarbamoyl chloride Chemical compound ClC(=O)N(C)C(=O)C=CC1=CC=CC=C1Cl FBLUSPHFKYPTKI-UHFFFAOYSA-N 0.000 description 1
- XHLLMVSEBKZODD-UHFFFAOYSA-N n-acetyl-n-methylcarbamoyl chloride Chemical compound CC(=O)N(C)C(Cl)=O XHLLMVSEBKZODD-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- TWVKGZMOFYALFE-UHFFFAOYSA-N n-methyl-n-propanoylcarbamoyl chloride Chemical compound CCC(=O)N(C)C(Cl)=O TWVKGZMOFYALFE-UHFFFAOYSA-N 0.000 description 1
- NCCHARWOCKOHIH-UHFFFAOYSA-N n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1 NCCHARWOCKOHIH-UHFFFAOYSA-N 0.000 description 1
- GRRYSIXDUIAUGY-UHFFFAOYSA-N n-methylcarbamoyl chloride Chemical compound CNC(Cl)=O GRRYSIXDUIAUGY-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- PQDJYEQOELDLCP-UHFFFAOYSA-N trimethylsilane Chemical class C[SiH](C)C PQDJYEQOELDLCP-UHFFFAOYSA-N 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US456517A US3925368A (en) | 1974-04-01 | 1974-04-01 | Acylureido substituted cephalosporins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL94934B1 true PL94934B1 (enExample) | 1977-09-30 |
Family
ID=23813079
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1975179229A PL94934B1 (enExample) | 1974-04-01 | 1975-03-29 |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3925368A (enExample) |
| JP (1) | JPS50130785A (enExample) |
| AR (1) | AR210854A1 (enExample) |
| AT (1) | ATA247775A (enExample) |
| AU (1) | AU7963575A (enExample) |
| BE (1) | BE827298A (enExample) |
| BG (1) | BG26537A3 (enExample) |
| CS (1) | CS187318B2 (enExample) |
| DD (1) | DD118651A5 (enExample) |
| DE (1) | DE2514020A1 (enExample) |
| DK (1) | DK129975A (enExample) |
| ES (1) | ES436199A1 (enExample) |
| FR (1) | FR2265392A1 (enExample) |
| GB (1) | GB1505885A (enExample) |
| HU (1) | HU169527B (enExample) |
| IL (1) | IL46954A0 (enExample) |
| NL (1) | NL7503885A (enExample) |
| PL (1) | PL94934B1 (enExample) |
| SE (1) | SE7503708L (enExample) |
| SU (1) | SU541438A3 (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4115566A (en) * | 1972-03-29 | 1978-09-19 | Ciba-Geigy Corporation | 7α Ureido cephem-4-carboxylic acid derivatives |
| GB1479711A (en) * | 1973-06-12 | 1977-07-13 | Beecham Group Ltd | Acylureido cephalosporins |
| US4088815A (en) * | 1974-09-20 | 1978-05-09 | E. R. Squibb & Sons, Inc. | 3-Heterothio-7-ureido cephalosporins |
| US4024135A (en) * | 1976-03-05 | 1977-05-17 | E. R. Squibb & Sons, Inc. | (Carbamoyl)pyridino derivatives of ureidocephalosporins |
| US4028354A (en) * | 1976-03-08 | 1977-06-07 | E. R. Squibb & Sons, Inc. | Alkenyl and alkinylureido cephalosporins |
| US4063019A (en) | 1976-03-30 | 1977-12-13 | E. R. Squibb & Sons, Inc. | [[[(2,4-Dioxo-1-imidazolidinyl)amino]carbonyl]amino]-acetylcephalosporin derivatives |
| US4097670A (en) * | 1976-04-05 | 1978-06-27 | E. R. Squibb & Sons, Inc. | Carboxyalkylureido cephalosporins |
| US4092475A (en) * | 1976-04-09 | 1978-05-30 | E. R. Squibb & Sons, Inc. | Trifluoroalkylureido 3-heterocyclic thio methyl cephalosporins |
| US4049651A (en) * | 1976-04-19 | 1977-09-20 | E. R. Squibb & Sons, Inc. | Alkoxy and alkylthioalkylureido cephalosporins |
| US4066689A (en) * | 1976-05-20 | 1978-01-03 | Union Carbide Corporation | Ketoalkanesulfenylcarbamoyl and ketoalkanethiosulfenylcarbamoyl halides |
| FR2358410A1 (fr) * | 1976-07-14 | 1978-02-10 | Beecham Group Ltd | Cephanosporines utilisables comme medicaments |
| DK225179A (da) * | 1978-06-22 | 1979-12-23 | Chugai Pharmaceutical Co Ltd | Fremgangsmaade til fremstilling af cephalosporinderivater |
| US4463050A (en) * | 1982-09-30 | 1984-07-31 | Texaco Inc. | Polyurethane catalyst system additive which permits the use of relatively "cold" molds |
| GB9814366D0 (en) | 1998-07-02 | 1998-09-02 | Reckitt & Colmann Prod Ltd | Malodour treatment |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3687949A (en) * | 1969-01-21 | 1972-08-29 | Bristol Myers Co | Synthetic cephalosporins |
| US3641021A (en) * | 1969-04-18 | 1972-02-08 | Lilly Co Eli | 3 7-(ring-substituted) cephalosporin compounds |
| US3766175A (en) * | 1971-05-11 | 1973-10-16 | R & L Molecular Research Ltd | Certain 7 - (o-aminomethylphenylacetamido) - 3-((heterocyclylthio)methyl)ceph-3-em-4-carboxylic acids |
| US3741962A (en) * | 1971-05-21 | 1973-06-26 | Squibb & Sons Inc | Alpha-thioureidocephalosporanic acid compounds |
| BE792112A (fr) * | 1971-12-06 | 1973-05-30 | Smith Kline French Lab | 7-ureidocephalosporines |
-
1974
- 1974-04-01 US US456517A patent/US3925368A/en not_active Expired - Lifetime
-
1975
- 1975-03-19 JP JP50034271A patent/JPS50130785A/ja active Pending
- 1975-03-26 DK DK129975A patent/DK129975A/da unknown
- 1975-03-27 AU AU79635/75A patent/AU7963575A/en not_active Expired
- 1975-03-28 HU HUEI000605 patent/HU169527B/hu unknown
- 1975-03-28 FR FR7510045A patent/FR2265392A1/fr not_active Withdrawn
- 1975-03-28 IL IL46954A patent/IL46954A0/xx unknown
- 1975-03-28 BE BE1006556A patent/BE827298A/xx unknown
- 1975-03-29 PL PL1975179229A patent/PL94934B1/pl unknown
- 1975-03-29 BG BG029485A patent/BG26537A3/xx unknown
- 1975-03-29 DE DE19752514020 patent/DE2514020A1/de active Pending
- 1975-03-31 SU SU2118338A patent/SU541438A3/ru active
- 1975-04-01 AT AT247775A patent/ATA247775A/de not_active IP Right Cessation
- 1975-04-01 ES ES436199A patent/ES436199A1/es not_active Expired
- 1975-04-01 DD DD185118A patent/DD118651A5/xx unknown
- 1975-04-01 SE SE7503708A patent/SE7503708L/xx unknown
- 1975-04-01 GB GB13382/75A patent/GB1505885A/en not_active Expired
- 1975-04-01 NL NL7503885A patent/NL7503885A/xx not_active Application Discontinuation
- 1975-04-01 CS CS752207A patent/CS187318B2/cs unknown
- 1975-04-10 AR AR258201A patent/AR210854A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| NL7503885A (nl) | 1975-10-03 |
| BE827298A (fr) | 1975-09-29 |
| GB1505885A (en) | 1978-03-30 |
| HU169527B (enExample) | 1976-12-28 |
| FR2265392A1 (enExample) | 1975-10-24 |
| BG26537A3 (bg) | 1979-04-12 |
| SU541438A3 (ru) | 1976-12-30 |
| ES436199A1 (es) | 1977-04-16 |
| AU7963575A (en) | 1976-09-30 |
| DE2514020A1 (de) | 1975-10-02 |
| SE7503708L (enExample) | 1975-10-02 |
| AR210854A1 (es) | 1977-09-30 |
| DK129975A (enExample) | 1975-10-02 |
| JPS50130785A (enExample) | 1975-10-16 |
| CS187318B2 (en) | 1979-01-31 |
| US3925368A (en) | 1975-12-09 |
| ATA247775A (de) | 1976-09-15 |
| IL46954A0 (en) | 1975-05-22 |
| DD118651A5 (enExample) | 1976-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4168309A (en) | Cephalosporins having a 7-(carboxy substituted α-etherified oximinoarylacetamido) group | |
| PL94934B1 (enExample) | ||
| FI63035B (fi) | Foerfarande foer framstaellning av 7-alfa-aminoacyl-3-klorcefalosporinderivat | |
| US3917588A (en) | {60 -Aminoacyl cephalosporin ethers | |
| JPS6133836B2 (enExample) | ||
| HU185985B (en) | Process for producing new esters of cepheme-carboxylic acid | |
| US4018921A (en) | Substituted phenylglycylcephalosporins | |
| US4061630A (en) | 7-Substituted-ureido-3-carbamoyloxymethyl cephalosporin antibiotics | |
| PL90346B1 (enExample) | ||
| JPS5934197B2 (ja) | 抗バクテリア剤中間体の合成法 | |
| US3946003A (en) | Hydroxy substituted phenylglycylamido-3-heterocyclic thiomethyl cephalosporins | |
| US4560683A (en) | Cephalosporin antibiotics | |
| US4179502A (en) | 7[2-Hydroxyiminoacetamido]cephalosporins | |
| CA1131617A (en) | Cephalosporin derivatives | |
| US4224442A (en) | 7-Ureido acetamido substituted cephalosporin antibiotics | |
| JPS5932472B2 (ja) | 2−アルキル−7−アシルアミノ−2(または3)−セフエム−4−カルボン酸類の製造法 | |
| SK133099A3 (en) | Antibacterial substituted 7-acylamino-3-(methylhydrazono) methyl-cephalosporins and intermediates | |
| GB2137998A (en) | Benzothienyl cephalosporin antibiotics | |
| IE53116B1 (en) | Cephem derivatives and a process for their preparation | |
| US4497811A (en) | 1-Oxadethiacephalosporin compound and antibacterial agent containing the _same | |
| US4761409A (en) | Cephem derivatives | |
| KR830000343B1 (ko) | 세팔로스포린 유도체의 제법 | |
| EP0098615B1 (en) | 1-oxadethiacephalosporin compound and antibacterial agent containing the same | |
| KR790000945B1 (ko) | 우레이도 치환 세팔로스포린 유도체의 제조방법 | |
| KR790001651B1 (ko) | 세팔로스포린계열 항생제의 제조방법 |