PL91702B1 - - Google Patents
Download PDFInfo
- Publication number
- PL91702B1 PL91702B1 PL16903074A PL16903074A PL91702B1 PL 91702 B1 PL91702 B1 PL 91702B1 PL 16903074 A PL16903074 A PL 16903074A PL 16903074 A PL16903074 A PL 16903074A PL 91702 B1 PL91702 B1 PL 91702B1
- Authority
- PL
- Poland
- Prior art keywords
- carbon atoms
- alkyl radical
- formula
- straight
- branched alkyl
- Prior art date
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- 238000002360 preparation method Methods 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 239000011230 binding agent Substances 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000004001 thioalkyl group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 2
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 claims 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 230000001055 chewing effect Effects 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 31
- 239000000203 mixture Substances 0.000 description 25
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 18
- -1 alkyl radical Chemical class 0.000 description 17
- 239000013078 crystal Substances 0.000 description 13
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 229910000027 potassium carbonate Inorganic materials 0.000 description 9
- 239000003480 eluent Substances 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 4
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- VVAVOWMMXLKTHN-UHFFFAOYSA-N 2-hydroxypyrido[1,2-a]pyrimidin-4-one Chemical compound C1=CC=CC2=NC(O)=CC(=O)N21 VVAVOWMMXLKTHN-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- 238000005119 centrifugation Methods 0.000 description 3
- QXRILJZYLNQLPW-UHFFFAOYSA-N chloro-ethoxy-hydroxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(O)(Cl)=S QXRILJZYLNQLPW-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- 241000244206 Nematoda Species 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 230000000895 acaricidal effect Effects 0.000 description 2
- 239000000642 acaricide Substances 0.000 description 2
- KMJJJTCKNZYTEY-UHFFFAOYSA-N chloro-diethoxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(Cl)(=S)OCC KMJJJTCKNZYTEY-UHFFFAOYSA-N 0.000 description 2
- ITVPBBDAZKBMRP-UHFFFAOYSA-N chloro-dioxido-oxo-$l^{5}-phosphane;hydron Chemical compound OP(O)(Cl)=O ITVPBBDAZKBMRP-UHFFFAOYSA-N 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- VOLGAXAGEUPBDM-UHFFFAOYSA-N $l^{1}-oxidanylethane Chemical compound CC[O] VOLGAXAGEUPBDM-UHFFFAOYSA-N 0.000 description 1
- SEPPVOUBHWNCAW-FNORWQNLSA-N (E)-4-oxonon-2-enal Chemical compound CCCCCC(=O)\C=C\C=O SEPPVOUBHWNCAW-FNORWQNLSA-N 0.000 description 1
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 1
- 150000005006 2-aminopyrimidines Chemical class 0.000 description 1
- JUKHDZFQIBQQIV-UHFFFAOYSA-N 3-chloro-1h-pyrimidine-2,4-dione Chemical compound ClN1C(=O)C=CNC1=O JUKHDZFQIBQQIV-UHFFFAOYSA-N 0.000 description 1
- LLBZPESJRQGYMB-UHFFFAOYSA-N 4-one Natural products O1C(C(=O)CC)CC(C)C11C2(C)CCC(C3(C)C(C(C)(CO)C(OC4C(C(O)C(O)C(COC5C(C(O)C(O)CO5)OC5C(C(OC6C(C(O)C(O)C(CO)O6)O)C(O)C(CO)O5)OC5C(C(O)C(O)C(C)O5)O)O4)O)CC3)CC3)=C3C2(C)CC1 LLBZPESJRQGYMB-UHFFFAOYSA-N 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- 241001425390 Aphis fabae Species 0.000 description 1
- 241000255579 Ceratitis capitata Species 0.000 description 1
- 241000255601 Drosophila melanogaster Species 0.000 description 1
- 241000258937 Hemiptera Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- 241000254179 Sitophilus granarius Species 0.000 description 1
- 241000985245 Spodoptera litura Species 0.000 description 1
- 241000254086 Tribolium <beetle> Species 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000003927 aminopyridines Chemical class 0.000 description 1
- 150000005005 aminopyrimidines Chemical class 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- AMZONRRFUQKTSZ-UHFFFAOYSA-N benzene;2-propan-2-yloxypropane Chemical compound C1=CC=CC=C1.CC(C)OC(C)C AMZONRRFUQKTSZ-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- XFBJRFNXPUCPKU-UHFFFAOYSA-N chloro-dimethoxy-sulfanylidene-$l^{5}-phosphane Chemical compound COP(Cl)(=S)OC XFBJRFNXPUCPKU-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- LXHCUFNVRJLDLN-UHFFFAOYSA-N ethoxysulfanyloxyethane Chemical compound CCOSOCC LXHCUFNVRJLDLN-UHFFFAOYSA-N 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- QOLACWFHYSUXPZ-UHFFFAOYSA-N n-[chloro(ethoxy)phosphinothioyl]methanamine Chemical compound CCOP(Cl)(=S)NC QOLACWFHYSUXPZ-UHFFFAOYSA-N 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL16903074A PL91702B1 (instruction) | 1974-02-22 | 1974-02-22 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL16903074A PL91702B1 (instruction) | 1974-02-22 | 1974-02-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL91702B1 true PL91702B1 (instruction) | 1977-03-31 |
Family
ID=19966203
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL16903074A PL91702B1 (instruction) | 1974-02-22 | 1974-02-22 |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL91702B1 (instruction) |
-
1974
- 1974-02-22 PL PL16903074A patent/PL91702B1/pl unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2195262C (en) | Phosphonate nucleotide compounds | |
| RU2040527C1 (ru) | Производные дипиридо-диазепина и их гидраты, обладающие биологической активностью | |
| HK1051373A1 (en) | Nucleotide analog composition and synthesis method | |
| EP1723156B1 (en) | Process for the preparation of pyridine derivatives | |
| Alley et al. | Synthesis and characterisation of ferrocenyl-phosphonic and-arsonic acids | |
| US3153663A (en) | Phosphoric (phosphonic, phosphinic) or thiophosphoric (-phosphonic, -phosphinic) acidesters and processes for their production | |
| Jóźwiak et al. | Synthesis of phosphorylated isoindolinone derivatives | |
| US3857838A (en) | Organophosphate ester derivatives of heterocyclic compounds and process | |
| PL91702B1 (instruction) | ||
| AU628158B2 (en) | Geminal bisphosphonic acids and derivatives as anti-arthritic agents | |
| JP3156026B2 (ja) | ホスホン酸ジエステル誘導体 | |
| US2938902A (en) | Novel pyridazinones and methods of preparing same | |
| JP4795023B2 (ja) | ビタミンd化合物及びそれらの合成中間体の合成方法 | |
| Schull et al. | Synthesis of symmetrical triarylphosphines from aryl fluorides and red phosphorus: scope and limitations | |
| Abdou et al. | Fused phosphono substituted O-, and N-heterocycles via condensative cyclisation reactions of α-phosphonyl carbanions with 4-thiazolidinones | |
| DE2131734B2 (de) | Eckige Klammer auf Oxazoloeckige Klammer auf 4,5-b eckige Klammer zu -pyridin-2(3H)-onyl- oder thionyl-(3>alkyl-(l'> oder (2'-halogen-alkyl>-(V)- phosphate oder phosphonate, Verfahren zu ihrer Herstellung und diese enthaltende Mittel | |
| JPS6115890A (ja) | リン酸誘導体の製造方法 | |
| Petkova et al. | Synthesis of heterocyclic methylenebisphosphonates by 1, 3-dipolar cycloaddition of ethyl diazoacetate to 1, 2-benzoxaphosphorin-3-phosphonates | |
| US3496178A (en) | 2 - (o,o - dialkyl-phosphoryl)-6-carbalkoxy or carbalkenoxy-pyrazolo pyrimidines | |
| US3808218A (en) | 3h-oxazolo(4,5-b)pyridine-2-one,esters with 3-(-o-)or(-s-)-o,o'-diloweralkyl phosphates or thiophosphates | |
| EP0023841A2 (en) | 5 Pyrimidinol phosphorus esters, and methods for their manufacture, compositions containing those esters and their use as pesticides | |
| EP0081945B1 (en) | Substituted pyrimidinyl organophosphorus compounds, compositions thereof and methods of controlling pests | |
| US3929809A (en) | Oxazolo-{8 4,5-b{9 -pyridine-2-ones and -2-thiones as intermediates | |
| US3299188A (en) | Phosphoric, phosphonic, phosphinic or thionophosphoric, -phosphonic, -phosphinic acid esters | |
| US20060106233A1 (en) | Process for the preparation of disubstituted acetylenes bearing heteroaromatic and heterobicyclic groups |