PL90786B1 - - Google Patents
Download PDFInfo
- Publication number
- PL90786B1 PL90786B1 PL1974168645A PL16864574A PL90786B1 PL 90786 B1 PL90786 B1 PL 90786B1 PL 1974168645 A PL1974168645 A PL 1974168645A PL 16864574 A PL16864574 A PL 16864574A PL 90786 B1 PL90786 B1 PL 90786B1
- Authority
- PL
- Poland
- Prior art keywords
- pattern
- formula
- green blue
- chg
- groups
- Prior art date
Links
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 40
- 150000001875 compounds Chemical class 0.000 claims description 39
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 16
- 125000005843 halogen group Chemical group 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 125000002252 acyl group Chemical group 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 8
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 5
- 238000003776 cleavage reaction Methods 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 3
- 238000006460 hydrolysis reaction Methods 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 230000007017 scission Effects 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 2
- 101000720704 Homo sapiens Neuronal migration protein doublecortin Proteins 0.000 claims 1
- 102100025929 Neuronal migration protein doublecortin Human genes 0.000 claims 1
- 229910006069 SO3H Inorganic materials 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- 125000000542 sulfonic acid group Chemical group 0.000 claims 1
- 239000000975 dye Substances 0.000 description 34
- -1 alkyl radical Chemical group 0.000 description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- 239000000203 mixture Substances 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 12
- 238000004043 dyeing Methods 0.000 description 11
- 150000003254 radicals Chemical class 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- 239000004677 Nylon Substances 0.000 description 9
- 229920001778 nylon Polymers 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- 239000004952 Polyamide Substances 0.000 description 8
- 229920002647 polyamide Polymers 0.000 description 8
- 125000003277 amino group Chemical group 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000004429 atom Chemical group 0.000 description 6
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 6
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 229920002302 Nylon 6,6 Polymers 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical group [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 4
- 229940045803 cuprous chloride Drugs 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 210000002268 wool Anatomy 0.000 description 4
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229920002292 Nylon 6 Polymers 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 238000010186 staining Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- WIMJTAGMOPIYOA-UHFFFAOYSA-N 1-bromo-4-(cyclohexylamino)anthracene-9,10-dione Chemical compound C1=2C(=O)C3=CC=CC=C3C(=O)C=2C(Br)=CC=C1NC1CCCCC1 WIMJTAGMOPIYOA-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- BWDBEAQIHAEVLV-UHFFFAOYSA-N 6-methylheptan-1-ol Chemical compound CC(C)CCCCCO BWDBEAQIHAEVLV-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical class [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000000956 alloy Substances 0.000 description 2
- 229910045601 alloy Inorganic materials 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 150000004056 anthraquinones Chemical class 0.000 description 2
- 239000012752 auxiliary agent Substances 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000003245 coal Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000000834 fixative Substances 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 235000011056 potassium acetate Nutrition 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- BTLXPCBPYBNQNR-UHFFFAOYSA-N 1-Hydroxyanthraquinone Natural products O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2O BTLXPCBPYBNQNR-UHFFFAOYSA-N 0.000 description 1
- VFNUGTPKUWHTDI-UHFFFAOYSA-N 1-bromo-4-[(2-ethylcyclohexyl)amino]anthracene-9,10-dione Chemical compound CCC1CCCCC1NC1=CC=C(Br)C2=C1C(=O)C1=CC=CC=C1C2=O VFNUGTPKUWHTDI-UHFFFAOYSA-N 0.000 description 1
- XOTHSHKKHRSVOY-UHFFFAOYSA-N 1-bromo-4-[(2-methylcyclohexyl)amino]anthracene-9,10-dione Chemical compound CC1CCCCC1NC1=CC=C(Br)C2=C1C(=O)C1=CC=CC=C1C2=O XOTHSHKKHRSVOY-UHFFFAOYSA-N 0.000 description 1
- DPYBDRZRDKNRNW-UHFFFAOYSA-N 1-bromo-4-[(4-methylcyclohexyl)amino]anthracene-9,10-dione Chemical compound C1CC(C)CCC1NC1=CC=C(Br)C2=C1C(=O)C1=CC=CC=C1C2=O DPYBDRZRDKNRNW-UHFFFAOYSA-N 0.000 description 1
- FKKAGFLIPSSCHT-UHFFFAOYSA-N 1-dodecoxydodecane;sulfuric acid Chemical compound OS(O)(=O)=O.CCCCCCCCCCCCOCCCCCCCCCCCC FKKAGFLIPSSCHT-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- FVEYIFISRORTDD-ROUUACIJSA-N 2-(4-phenoxyphenoxy)-6-[(1S,4S)-5-prop-2-enoyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyridine-3-carboxamide Chemical compound C(C=C)(=O)N1[C@@H]2CN([C@H](C1)C2)C1=NC(=C(C(=O)N)C=C1)OC1=CC=C(C=C1)OC1=CC=CC=C1 FVEYIFISRORTDD-ROUUACIJSA-N 0.000 description 1
- DHPUIKWBNXTXOB-UHFFFAOYSA-N 2-bromo-1-methoxy-4-methylbenzene Chemical compound COC1=CC=C(C)C=C1Br DHPUIKWBNXTXOB-UHFFFAOYSA-N 0.000 description 1
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000969729 Apteryx rowi Species 0.000 description 1
- 241000193738 Bacillus anthracis Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 229910000906 Bronze Inorganic materials 0.000 description 1
- DGJWKLOHCHFWAF-UHFFFAOYSA-N C(C)(C)[Ni] Chemical compound C(C)(C)[Ni] DGJWKLOHCHFWAF-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical compound FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 101000650578 Salmonella phage P22 Regulatory protein C3 Proteins 0.000 description 1
- 101001040920 Triticum aestivum Alpha-amylase inhibitor 0.28 Proteins 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000001000 anthraquinone dye Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- NGPGDYLVALNKEG-UHFFFAOYSA-N azanium;azane;2,3,4-trihydroxy-4-oxobutanoate Chemical compound [NH4+].[NH4+].[O-]C(=O)C(O)C(O)C([O-])=O NGPGDYLVALNKEG-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 238000003287 bathing Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 235000008429 bread Nutrition 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000010974 bronze Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- KQDYOGHAGNJBRA-UHFFFAOYSA-N copper thorium Chemical compound [Cu].[Cu].[Th] KQDYOGHAGNJBRA-UHFFFAOYSA-N 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(I) oxide Inorganic materials [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 1
- KRFJLUBVMFXRPN-UHFFFAOYSA-N cuprous oxide Chemical compound [O-2].[Cu+].[Cu+] KRFJLUBVMFXRPN-UHFFFAOYSA-N 0.000 description 1
- 229940112669 cuprous oxide Drugs 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 238000005242 forging Methods 0.000 description 1
- 235000012490 fresh bread Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000009499 grossing Methods 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 238000005552 hardfacing Methods 0.000 description 1
- 125000001245 hexylamino group Chemical group [H]N([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- AKQOMDYHXJTRAX-UHFFFAOYSA-N n-(4-bromo-9,10-dioxoanthracen-1-yl)-n-cyclohexylacetamide Chemical compound C=1C=C(Br)C=2C(=O)C3=CC=CC=C3C(=O)C=2C=1N(C(=O)C)C1CCCCC1 AKQOMDYHXJTRAX-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000013535 sea water Substances 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 239000011265 semifinished product Substances 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000007447 staining method Methods 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- 230000009182 swimming Effects 0.000 description 1
- 150000003512 tertiary amines Chemical group 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06P—DYEING OR PRINTING TEXTILES; DYEING LEATHER, FURS OR SOLID MACROMOLECULAR SUBSTANCES IN ANY FORM
- D06P3/00—Special processes of dyeing or printing textiles, or dyeing leather, furs, or solid macromolecular substances in any form, classified according to the material treated
- D06P3/02—Material containing basic nitrogen
- D06P3/04—Material containing basic nitrogen containing amide groups
- D06P3/24—Polyamides; Polyurethanes
- D06P3/241—Polyamides; Polyurethanes using acid dyes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B1/00—Dyes with anthracene nucleus not condensed with any other ring
- C09B1/16—Amino-anthraquinones
- C09B1/20—Preparation from starting materials already containing the anthracene nucleus
- C09B1/26—Dyes with amino groups substituted by hydrocarbon radicals
- C09B1/32—Dyes with amino groups substituted by hydrocarbon radicals substituted by aryl groups
- C09B1/34—Dyes with amino groups substituted by hydrocarbon radicals substituted by aryl groups sulfonated
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH180273A CH583277A5 (en:Method) | 1973-02-08 | 1973-02-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL90786B1 true PL90786B1 (en:Method) | 1977-01-31 |
Family
ID=4218934
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1974168645A PL90786B1 (en:Method) | 1973-02-08 | 1974-02-07 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4376077A (en:Method) |
| JP (1) | JPS5313219B2 (en:Method) |
| AR (1) | AR207323A1 (en:Method) |
| BE (1) | BE810812A (en:Method) |
| BR (1) | BR7400879D0 (en:Method) |
| CA (1) | CA1045134A (en:Method) |
| CH (1) | CH583277A5 (en:Method) |
| CS (1) | CS177161B2 (en:Method) |
| DD (1) | DD110891A5 (en:Method) |
| DE (1) | DE2405152C3 (en:Method) |
| ES (1) | ES422975A1 (en:Method) |
| FR (1) | FR2217321B1 (en:Method) |
| GB (1) | GB1454631A (en:Method) |
| IN (1) | IN142813B (en:Method) |
| NL (1) | NL7401494A (en:Method) |
| PL (1) | PL90786B1 (en:Method) |
| SU (1) | SU638270A3 (en:Method) |
| ZA (1) | ZA74856B (en:Method) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0270306B1 (en) * | 1986-12-01 | 1991-03-27 | Sumitomo Chemical Company, Limited | Anthrapyridone compounds, their production process and their use |
| US5059061A (en) * | 1990-06-14 | 1991-10-22 | Minnesota Mining And Manufacturing Company | Truck mounted pavement marking applicator |
| GB0817175D0 (en) * | 2008-09-19 | 2008-10-29 | Liquavista Bv | Improvements in relation to electrowetting elements |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB449012A (en) * | 1934-11-14 | 1936-06-15 | Ici Ltd | New anthraquinone dyestuffs |
| GB929060A (en) * | 1961-07-24 | 1963-06-19 | Mine Safety Appliances Co | Cable cutting tool |
| BE653163A (en:Method) * | 1963-09-24 | |||
| CH437202A (de) * | 1964-12-04 | 1967-11-30 | Sandoz Ag | Verfahren zum Färben von Textilmaterial aus synthetischen Polyamiden mit Anthrachinonfarbstoffen |
| NL130102C (en:Method) * | 1964-12-21 | 1970-06-15 | ||
| US3491126A (en) | 1964-12-21 | 1970-01-20 | Geigy Ag J R | Sulfonated 1-alkylamino-4-tolylaminoanthraquinones |
| CH489565A (de) * | 1968-04-08 | 1970-04-30 | Sandoz Ag | Verfahren zur Herstellung von Anthrachinonverbindungen |
| DE1932647C3 (de) * | 1969-06-27 | 1975-06-05 | Bayer Ag, 5090 Leverkusen | Sulfonsäuregruppenhaltige Anthrachinonfarbstoffe, ihre Herstellung und Verwendung |
| US3980677A (en) * | 1969-06-27 | 1976-09-14 | Bayer Aktiengesellschaft | Anthraquinone dyestuffs containing sulphonic acid groups |
| CH526678A (de) * | 1969-12-16 | 1972-04-28 | Ciba Geigy Ag | Verfahren zum Färben von stickstoffhaltigem Textilmaterial |
| FR2237933B1 (en:Method) * | 1973-07-17 | 1976-11-12 | Ugine Kuhlmann |
-
1973
- 1973-02-08 CH CH180273A patent/CH583277A5/xx not_active IP Right Cessation
-
1974
- 1974-01-01 AR AR252208A patent/AR207323A1/es active
- 1974-02-04 NL NL7401494A patent/NL7401494A/xx unknown
- 1974-02-04 DE DE2405152A patent/DE2405152C3/de not_active Expired
- 1974-02-05 GB GB517674A patent/GB1454631A/en not_active Expired
- 1974-02-06 JP JP1530474A patent/JPS5313219B2/ja not_active Expired
- 1974-02-06 ES ES422975A patent/ES422975A1/es not_active Expired
- 1974-02-06 DD DD176421A patent/DD110891A5/xx unknown
- 1974-02-06 CS CS828A patent/CS177161B2/cs unknown
- 1974-02-07 FR FR7404124A patent/FR2217321B1/fr not_active Expired
- 1974-02-07 CA CA191,946A patent/CA1045134A/en not_active Expired
- 1974-02-07 PL PL1974168645A patent/PL90786B1/pl unknown
- 1974-02-07 BR BR879/74A patent/BR7400879D0/pt unknown
- 1974-02-08 ZA ZA00740856A patent/ZA74856B/xx unknown
- 1974-02-08 BE BE140729A patent/BE810812A/xx unknown
-
1975
- 1975-02-03 IN IN204/CAL/1975A patent/IN142813B/en unknown
- 1975-04-28 SU SU752129160A patent/SU638270A3/ru active
-
1978
- 1978-11-06 US US05/958,182 patent/US4376077A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| SU638270A3 (ru) | 1978-12-15 |
| AR207323A1 (es) | 1976-09-30 |
| FR2217321A1 (en:Method) | 1974-09-06 |
| ES422975A1 (es) | 1976-12-01 |
| BE810812A (fr) | 1974-08-08 |
| DE2405152B2 (de) | 1978-04-13 |
| DE2405152A1 (de) | 1974-08-15 |
| JPS49111934A (en:Method) | 1974-10-24 |
| JPS5313219B2 (en:Method) | 1978-05-09 |
| AU6539474A (en) | 1975-08-14 |
| DD110891A5 (en:Method) | 1975-01-12 |
| FR2217321B1 (en:Method) | 1977-09-23 |
| CA1045134A (en) | 1978-12-26 |
| IN142813B (en:Method) | 1977-08-27 |
| NL7401494A (en:Method) | 1974-08-12 |
| ZA74856B (en) | 1975-09-24 |
| CS177161B2 (en:Method) | 1977-07-29 |
| US4376077A (en) | 1983-03-08 |
| DE2405152C3 (de) | 1978-12-14 |
| CH583277A5 (en:Method) | 1976-12-31 |
| BR7400879D0 (pt) | 1974-09-10 |
| GB1454631A (en) | 1976-11-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL72556B1 (en:Method) | ||
| JPH03131663A (ja) | 染料混合物及び三色染色方法におけるそれらの使用 | |
| JPH10504330A (ja) | 反応性モノアゾ染料 | |
| PL90786B1 (en:Method) | ||
| PL76587B1 (en:Method) | ||
| EP0302115B1 (en) | Water-soluble formazan dyes and method of dyeing with same | |
| EP0073267B1 (en) | Copper phthalocyanine blue reactive dyes, process for their production, and their use for dyeing cellulosic fibers | |
| US4410331A (en) | Condensation products containing sulphonic acid groups: additives for dyeing synthetic polyamide | |
| EP0637615B1 (en) | Red reactive dyes, their compositions and dyeing method employing them | |
| CA2137763A1 (en) | Reactive dyes, process for their preparation and the use thereof | |
| JPH0345108B2 (en:Method) | ||
| JPS6344866B2 (en:Method) | ||
| JP3968134B2 (ja) | バット染料混合物及びその製造方法 | |
| US2049648A (en) | Anthraquinone dyestuffs | |
| US6086640A (en) | Formazan compounds and method of dyeing therewith | |
| JPH0249069A (ja) | 繊維反応性フオルマザン染料とその製造法及び使用法 | |
| US4728464A (en) | 1-amino-4-(3'-phenylsulphonyl-aminophenylamino) anthraquinone-2-sulphonic acids useful as anionic dyestuffs | |
| KR100245194B1 (ko) | 안트라퀴논 분산염료, 그의 제조방법 및 그에 관한 염색방법 | |
| KR860000594B1 (ko) | 반응성 흑색 염료 조성물 | |
| JPS6361977B2 (en:Method) | ||
| PL93357B1 (en:Method) | ||
| NL8200676A (nl) | Anionogene disazoverbindingen en werkwijzen voor het bereiden en toepassen van deze verbindingen. | |
| US6090165A (en) | Dye mixtures and their use | |
| HK1003228A1 (en) | Reactive dyes, process for their preparation and their use | |
| KR880002249B1 (ko) | 구리프탈로시아닌 청색 반응성 염료의 제조방법 |