PL90348B1 - - Google Patents
Download PDFInfo
- Publication number
- PL90348B1 PL90348B1 PL15759772A PL15759772A PL90348B1 PL 90348 B1 PL90348 B1 PL 90348B1 PL 15759772 A PL15759772 A PL 15759772A PL 15759772 A PL15759772 A PL 15759772A PL 90348 B1 PL90348 B1 PL 90348B1
- Authority
- PL
- Poland
- Prior art keywords
- benzylpenicillin
- protected
- ampicillin
- action
- hydrochloride
- Prior art date
Links
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 claims description 37
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 claims description 23
- 235000019371 penicillin G benzathine Nutrition 0.000 claims description 19
- 229940056360 penicillin g Drugs 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 18
- 229960003311 ampicillin trihydrate Drugs 0.000 claims description 12
- 229960000723 ampicillin Drugs 0.000 claims description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- IYNDLOXRXUOGIU-LQDWTQKMSA-M benzylpenicillin potassium Chemical compound [K+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)CC1=CC=CC=C1 IYNDLOXRXUOGIU-LQDWTQKMSA-M 0.000 claims description 8
- GVVFCAFBYHYGEE-UHFFFAOYSA-N 2-amino-2-phenylacetyl chloride;hydron;chloride Chemical compound Cl.ClC(=O)C(N)C1=CC=CC=C1 GVVFCAFBYHYGEE-UHFFFAOYSA-N 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 6
- -1 dicarboxylic Chemical group 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 2
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 2
- BYLOHCRAPOSXLY-UHFFFAOYSA-N dichloro(diethyl)silane Chemical compound CC[Si](Cl)(Cl)CC BYLOHCRAPOSXLY-UHFFFAOYSA-N 0.000 claims 2
- ZPARXAPXKAKNQO-UHFFFAOYSA-N 2-(2-phenylethylamino)acetic acid;hydrochloride Chemical compound Cl.OC(=O)CNCCC1=CC=CC=C1 ZPARXAPXKAKNQO-UHFFFAOYSA-N 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- 238000005917 acylation reaction Methods 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 230000010933 acylation Effects 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 239000012153 distilled water Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229930182555 Penicillin Natural products 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000002960 penicillins Chemical class 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- HFVMEOPYDLEHBR-UHFFFAOYSA-N (2-fluorophenyl)-phenylmethanol Chemical compound C=1C=CC=C(F)C=1C(O)C1=CC=CC=C1 HFVMEOPYDLEHBR-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical group OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- NPKSPKHJBVJUKB-UHFFFAOYSA-N N-phenylglycine Chemical compound OC(=O)CNC1=CC=CC=C1 NPKSPKHJBVJUKB-UHFFFAOYSA-N 0.000 description 1
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- BTMVHUNTONAYDX-UHFFFAOYSA-N butyl propionate Chemical group CCCCOC(=O)CC BTMVHUNTONAYDX-UHFFFAOYSA-N 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- JSYGRUBHOCKMGQ-UHFFFAOYSA-N dichloramine Chemical compound ClNCl JSYGRUBHOCKMGQ-UHFFFAOYSA-N 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical group OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| YU103272A YU34297B (en) | 1972-04-17 | 1972-04-17 | Process for obtaining ampicillin |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL90348B1 true PL90348B1 (en:Method) | 1977-01-31 |
Family
ID=25552491
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL15759772A PL90348B1 (en:Method) | 1972-04-17 | 1972-09-05 |
Country Status (8)
| Country | Link |
|---|---|
| CH (1) | CH574963A5 (en:Method) |
| CS (1) | CS182232B2 (en:Method) |
| DE (1) | DE2255846A1 (en:Method) |
| FR (1) | FR2180632B1 (en:Method) |
| GB (1) | GB1410236A (en:Method) |
| HU (1) | HU171899B (en:Method) |
| PL (1) | PL90348B1 (en:Method) |
| YU (1) | YU34297B (en:Method) |
-
1972
- 1972-04-17 YU YU103272A patent/YU34297B/xx unknown
- 1972-09-05 PL PL15759772A patent/PL90348B1/pl unknown
- 1972-10-11 GB GB4691272A patent/GB1410236A/en not_active Expired
- 1972-10-12 FR FR7236224A patent/FR2180632B1/fr not_active Expired
- 1972-11-15 DE DE19722255846 patent/DE2255846A1/de active Pending
-
1973
- 1973-04-05 CS CS243573A patent/CS182232B2/cs unknown
- 1973-04-17 HU HU73GA00001132A patent/HU171899B/hu unknown
- 1973-04-17 CH CH547773A patent/CH574963A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CS182232B2 (en) | 1978-04-28 |
| YU103272A (en) | 1978-10-31 |
| YU34297B (en) | 1979-04-30 |
| DE2255846A1 (de) | 1973-10-31 |
| CH574963A5 (en:Method) | 1976-04-30 |
| GB1410236A (en) | 1975-10-15 |
| FR2180632B1 (en:Method) | 1976-08-20 |
| HU171899B (hu) | 1978-04-28 |
| FR2180632A1 (en:Method) | 1973-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3392173A (en) | Novel acyl derivatives of desacetyl-vincaleukoblastine and processes for their preparation | |
| US3966743A (en) | Ortho fused cycloalkano-4-quinolone-3-carboxylic acid derivatives | |
| JPS6150985A (ja) | 新規なカンプトテシン誘導体 | |
| US3976641A (en) | Cephalosporin intermediates and process therefor | |
| US3658802A (en) | Cephalosporine derivatives and process | |
| US4193918A (en) | Process for the preparation of hydroxy-alpha-amino-benzyl penicillin | |
| PL90348B1 (en:Method) | ||
| US4299955A (en) | Process for preparing derivatives of 7-amino-desacetoxy cephalosporanic acid | |
| US3579506A (en) | Alpha-aminoisothiazolylacetic acids and their penicillin and cephalosporin derivatives | |
| HU192609B (en) | Process for dehalogenating 6,6-dibromo-penicillanic-acid-1,1-dioxide | |
| US2926167A (en) | Process of esterifying ib-hydroxy | |
| IL38023A (en) | Isoindoline derivatives and process for their preparation | |
| US4591596A (en) | Treating pain, inflammation and/or platelet aggregation | |
| US2557762A (en) | Long chain tertiary alkyl aminepenicillin salts and preparation thereof | |
| US4075214A (en) | Preparation of leurosidine and novel leurosidine 4'-ethers and esters | |
| US3567733A (en) | Process for the preparation of intermediates for the synthesis of steroids | |
| Pfister | Convenient synthesis of N-noratropine | |
| US3385847A (en) | Derivatives of 6-aminopenicillanic acid and a process for their preparation | |
| US3926972A (en) | 7-Hydrazono and hydrazino cephalosporins | |
| CA1072544A (en) | Process for preparing penicillins | |
| US3236841A (en) | 7-acylaminocephalosporanic acids | |
| US3962226A (en) | 3-nitrooxycepham compounds and process for preparing desacetoxycephalosporins therefrom | |
| US4360694A (en) | Process for preparing 1,2-diacyl-sn-glycerols | |
| HK65181A (en) | Process for preparing oxazoles | |
| CH625805A5 (en:Method) |