PL89021B1 - Fungicidal carboxylic acid nitriles[US3886283A] - Google Patents
Fungicidal carboxylic acid nitriles[US3886283A] Download PDFInfo
- Publication number
- PL89021B1 PL89021B1 PL1972155654A PL15565472A PL89021B1 PL 89021 B1 PL89021 B1 PL 89021B1 PL 1972155654 A PL1972155654 A PL 1972155654A PL 15565472 A PL15565472 A PL 15565472A PL 89021 B1 PL89021 B1 PL 89021B1
- Authority
- PL
- Poland
- Prior art keywords
- alpha
- measure according
- acid nitrile
- dimethoxyphenyl
- active ingredients
- Prior art date
Links
- -1 carboxylic acid nitriles Chemical class 0.000 title claims 6
- 230000000855 fungicidal effect Effects 0.000 title abstract 2
- 239000004480 active ingredient Substances 0.000 claims abstract 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract 6
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract 5
- 125000003545 alkoxy group Chemical group 0.000 claims abstract 4
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract 4
- 239000001257 hydrogen Substances 0.000 claims abstract 4
- 125000000217 alkyl group Chemical group 0.000 claims abstract 2
- 150000001875 compounds Chemical class 0.000 claims abstract 2
- 239000003085 diluting agent Substances 0.000 claims abstract 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract 2
- 239000002253 acid Substances 0.000 claims 3
- 150000002825 nitriles Chemical class 0.000 claims 3
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 claims 1
- 102220492497 ATP-dependent RNA helicase DDX54_W20R_mutation Human genes 0.000 claims 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 239000000575 pesticide Substances 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 230000002363 herbicidal effect Effects 0.000 abstract 1
- 230000000749 insecticidal effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/32—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing at least one six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI1120A HU164015B (OSRAM) | 1971-05-31 | 1971-05-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL89021B1 true PL89021B1 (en) | 1976-10-30 |
Family
ID=10994406
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1972155654A PL89021B1 (en) | 1971-05-31 | 1972-05-29 | Fungicidal carboxylic acid nitriles[US3886283A] |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3886283A (OSRAM) |
| AT (1) | AT318300B (OSRAM) |
| AU (1) | AU4270772A (OSRAM) |
| BE (1) | BE784160A (OSRAM) |
| BR (1) | BR7203531D0 (OSRAM) |
| CA (1) | CA994239A (OSRAM) |
| CS (1) | CS196508B1 (OSRAM) |
| DD (1) | DD105381A1 (OSRAM) |
| DE (1) | DE2223957A1 (OSRAM) |
| ES (1) | ES403303A1 (OSRAM) |
| FR (1) | FR2143678B1 (OSRAM) |
| GB (1) | GB1386992A (OSRAM) |
| HU (1) | HU164015B (OSRAM) |
| IL (1) | IL39505A (OSRAM) |
| PL (1) | PL89021B1 (OSRAM) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5163145A (en) * | 1974-11-26 | 1976-06-01 | Sumitomo Chemical Co | 33 mechiru 22 * 44 harogenofueniru * buchironitoriruno seizoho |
| US4056509A (en) * | 1975-07-09 | 1977-11-01 | Shell Oil Company | Preparation of benzyl cyanides |
| US4182625A (en) * | 1977-07-05 | 1980-01-08 | Stauffer Chemical Company | 3-Halo-5-(lower alkoxy) phenoxy alkyl amides |
| US4383848A (en) * | 1978-05-05 | 1983-05-17 | American Cyanamid Company | Polysubstituted butanoic acids, esters and derivatives thereof utilizing the same as herbicides |
| US4224052A (en) * | 1978-05-05 | 1980-09-23 | American Cyanamid Company | Polysubstituted butanoic acids, esters and derivatives thereof utilizing the same as herbicides |
| US4430114A (en) | 1979-07-25 | 1984-02-07 | American Cyanamid Company | 2,6-Dinitroaniline herbicides, and use thereof |
| DE3047106A1 (de) * | 1980-12-13 | 1982-07-29 | Henkel Kgaa | Topische kosmetische zubereitungen zur behandlung von stark fettendem haar und seborrhoeischer haut |
| US4400204A (en) * | 1981-03-16 | 1983-08-23 | Stauffer Chemical Company | Substituted benzyloxy chloroethoxy ethane herbicide antidotes |
| US4489007A (en) * | 1981-03-16 | 1984-12-18 | Stauffer Chemical Company | Substituted benzyloxy chloroethoxy ethane herbicide antidotes |
| US4511394A (en) * | 1981-03-16 | 1985-04-16 | Stauffer Chemical Co. | Substituted benzyloxy chloroethoxy ethane herbicide antidotes |
| JPS57185252A (en) * | 1981-05-07 | 1982-11-15 | Nippon Tokushu Kagaku Kogyo Kk | Production of phenylacetonitrile derivative |
| US4806673A (en) * | 1986-12-10 | 1989-02-21 | The Dow Chemical Company | Preparation of cyanoalkylphenols from bisphenols |
| US4916251A (en) * | 1987-01-02 | 1990-04-10 | The Dow Chemical Company | Cyanoisoalkylation of hydroxy substituted aryl compounds using ketones |
| US7622504B2 (en) * | 2006-12-20 | 2009-11-24 | MCS Laboratories, Inc. | Esters of 2-phenylalkanenitriles and antifungal compositions containing them |
| JP2020203835A (ja) * | 2017-08-25 | 2020-12-24 | アグロカネショウ株式会社 | フェニルアセトニトリル誘導体を用いた植物の細菌性病害の防除方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2695319A (en) * | 1954-11-23 | Process of producing verairyl | ||
| US2740806A (en) * | 1953-01-29 | 1956-04-03 | Searle & Co | Nuclearly hydroxylated derivatives of alpha, beta-diphenylalkanonitriles |
| US2897229A (en) * | 1954-02-09 | 1959-07-28 | Kali Chemie Ag | Phenyl acetonitrile compounds and a process of making same |
| US3441617A (en) * | 1966-03-15 | 1969-04-29 | Lummus Co | Oxidation of aromatic compounds |
-
1971
- 1971-05-31 HU HUCI1120A patent/HU164015B/hu unknown
-
1972
- 1972-05-17 DE DE19722223957 patent/DE2223957A1/de active Pending
- 1972-05-23 IL IL39505A patent/IL39505A/en unknown
- 1972-05-24 US US256268A patent/US3886283A/en not_active Expired - Lifetime
- 1972-05-24 AT AT447472A patent/AT318300B/de not_active IP Right Cessation
- 1972-05-25 AU AU42707/72A patent/AU4270772A/en not_active Expired
- 1972-05-29 PL PL1972155654A patent/PL89021B1/pl unknown
- 1972-05-29 DD DD163260A patent/DD105381A1/xx unknown
- 1972-05-29 FR FR7219104A patent/FR2143678B1/fr not_active Expired
- 1972-05-30 CS CS723717A patent/CS196508B1/cs unknown
- 1972-05-30 ES ES403303A patent/ES403303A1/es not_active Expired
- 1972-05-30 BE BE784160A patent/BE784160A/xx not_active IP Right Cessation
- 1972-05-31 BR BR3531/72A patent/BR7203531D0/pt unknown
- 1972-05-31 CA CA143,542A patent/CA994239A/en not_active Expired
- 1972-05-31 GB GB2554272A patent/GB1386992A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2223957A1 (de) | 1972-12-14 |
| IL39505A (en) | 1976-01-30 |
| US3886283A (en) | 1975-05-27 |
| BE784160A (fr) | 1972-09-18 |
| AU4270772A (en) | 1973-11-29 |
| HU164015B (OSRAM) | 1973-12-28 |
| GB1386992A (en) | 1975-03-12 |
| CS196508B1 (en) | 1980-03-31 |
| FR2143678B1 (OSRAM) | 1975-03-28 |
| CA994239A (en) | 1976-08-03 |
| BR7203531D0 (pt) | 1973-05-31 |
| FR2143678A1 (OSRAM) | 1973-02-09 |
| DD105381A1 (OSRAM) | 1974-04-20 |
| AT318300B (de) | 1974-10-10 |
| IL39505A0 (en) | 1972-09-28 |
| ES403303A1 (es) | 1975-05-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL89021B1 (en) | Fungicidal carboxylic acid nitriles[US3886283A] | |
| KR830001926A (ko) | 신규한 퀴나조린 유도체 및 그의 부가염의 제조방법 | |
| MY108540A (en) | Isoxazole derivatives, compositions containing them and their use as herbicides | |
| HUT61656A (en) | Herbicide composition containing 5-aryl-izoxazol derivatives as active components and process for producing the active components | |
| GB1178857A (en) | Cyclopropane Carboxylic Acid Esters, processes for producing them, and Insecticidal Compositions incorporating them | |
| ES8105985A1 (es) | Procedimiento para preparar derivados de quinoxalina | |
| IL66591A (en) | Benzoyl,furoyl and/or thenoyl amide derivatives,their preparation and herbicidal or fungicidal compositions comprising them | |
| ES552702A1 (es) | Procedimiento para la preparacion de nuevas (hetero)-aril-propilaminas | |
| KR900007322A (ko) | 살균 화합물, 이들의 제조방법 및 사용, 및 이들을 함유하는 조성물 | |
| BR8201737A (pt) | Processo para a preparacao de 2'-amino-2'-feniletil-ih-1,2,4-triazol,processo para a preparacao de materiais de partida,composicao microbicida,processo de preparacao de uma composicao e processo de combate a microorganismo | |
| GB1358669A (en) | Imidazolidines processes for their preparation and their use for repelling birds | |
| GB1309358A (en) | Thionothiolphosphoric acid ester amides a process for their preparation and their use as nematocides insecticides and acaricides | |
| GB1483617A (en) | Pesticidal thiophosphoric acid esteramides | |
| ES482110A1 (es) | Procedimiento para la preparacion de esteres de acido 0-(pi-ridiloxi-fenil)-lactico. | |
| GB1475357A (OSRAM) | ||
| GB1340889A (en) | Pesticidal phosphorus-containing barbiturates | |
| US4372776A (en) | Compounds for the loosening of fruit and/or leaves on plants | |
| KR870007139A (ko) | 알파-(2-알콕시페닐)-알파-알킬-1h-1,2,4-트리아졸-1-프로판 니트릴 및 그의 유도체 | |
| IL40934A (en) | Phenylformamidines and herbicidal compositions containing them | |
| GB1385436A (en) | Herbicide | |
| GB1420584A (en) | 3-diethylamino-2,2-dimethyl-propyl-5-substituted phenyl-2- furoates their preparation and compositions cojntainging them | |
| ATE24264T1 (de) | Homogene waessrige formulierungen. | |
| GB1469741A (en) | 2-chloroalkyl-2-3,5-disubstituted phenyl-oxiranes | |
| ES8106508A1 (es) | Procedimiento para la preparacion de derivados de acidos al-canocarboxilicos | |
| GB1380516A (en) | Thiophosphoric acid ester amides a process for their preparation and their use as insecticides and acaricides |