PL83085B1 - - Google Patents
Download PDFInfo
- Publication number
- PL83085B1 PL83085B1 PL1972152959A PL15295972A PL83085B1 PL 83085 B1 PL83085 B1 PL 83085B1 PL 1972152959 A PL1972152959 A PL 1972152959A PL 15295972 A PL15295972 A PL 15295972A PL 83085 B1 PL83085 B1 PL 83085B1
- Authority
- PL
- Poland
- Prior art keywords
- ester
- cephalosporin
- dimethylformamide
- complex
- cephalexin
- Prior art date
Links
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 193
- 229940106164 cephalexin Drugs 0.000 claims description 50
- -1 cephalosporin ester Chemical class 0.000 claims description 46
- 229930186147 Cephalosporin Natural products 0.000 claims description 43
- 229940124587 cephalosporin Drugs 0.000 claims description 43
- 238000000034 method Methods 0.000 claims description 43
- 150000001780 cephalosporins Chemical class 0.000 claims description 37
- 239000000203 mixture Substances 0.000 claims description 24
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 18
- 230000008569 process Effects 0.000 claims description 16
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 125000004185 ester group Chemical group 0.000 claims description 12
- 239000011701 zinc Substances 0.000 claims description 12
- 229910052725 zinc Inorganic materials 0.000 claims description 12
- 230000002378 acidificating effect Effects 0.000 claims description 10
- 150000003839 salts Chemical group 0.000 claims description 10
- 239000003638 chemical reducing agent Substances 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 230000009471 action Effects 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 230000001590 oxidative effect Effects 0.000 claims description 3
- ORLCYMQZIPSODD-UHFFFAOYSA-N 1-chloro-2-[chloro(2,2,2-trichloroethoxy)phosphoryl]oxybenzene Chemical compound ClC1=CC=CC=C1OP(Cl)(=O)OCC(Cl)(Cl)Cl ORLCYMQZIPSODD-UHFFFAOYSA-N 0.000 claims description 2
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 claims description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000000266 alpha-aminoacyl group Chemical group 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 229910052717 sulfur Chemical group 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 4
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 claims 1
- 150000007522 mineralic acids Chemical class 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- AVGYWQBCYZHHPN-CYJZLJNKSA-N cephalexin monohydrate Chemical compound O.C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 AVGYWQBCYZHHPN-CYJZLJNKSA-N 0.000 description 52
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 31
- 239000002253 acid Substances 0.000 description 29
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- 239000000243 solution Substances 0.000 description 23
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 229910052757 nitrogen Inorganic materials 0.000 description 21
- 150000001875 compounds Chemical class 0.000 description 19
- 150000002148 esters Chemical class 0.000 description 17
- 239000000047 product Substances 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 239000002585 base Substances 0.000 description 14
- 239000000543 intermediate Substances 0.000 description 11
- 239000003242 anti bacterial agent Substances 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 10
- 229940088710 antibiotic agent Drugs 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 230000003115 biocidal effect Effects 0.000 description 7
- 238000003776 cleavage reaction Methods 0.000 description 7
- 230000007017 scission Effects 0.000 description 7
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 6
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 6
- 239000000908 ammonium hydroxide Substances 0.000 description 6
- 239000012535 impurity Substances 0.000 description 6
- 238000001556 precipitation Methods 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- 230000010933 acylation Effects 0.000 description 5
- 238000005917 acylation reaction Methods 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 230000031700 light absorption Effects 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- ZYEZCIAZWXFKCP-UHFFFAOYSA-N (2-amino-2-phenylacetyl) 2-amino-2-phenylacetate Chemical compound C=1C=CC=CC=1C(N)C(=O)OC(=O)C(N)C1=CC=CC=C1 ZYEZCIAZWXFKCP-UHFFFAOYSA-N 0.000 description 2
- NVIAYEIXYQCDAN-UHFFFAOYSA-N 7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)C(N)C12 NVIAYEIXYQCDAN-UHFFFAOYSA-N 0.000 description 2
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 229930182555 Penicillin Natural products 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229940047526 cephalexin monohydrate Drugs 0.000 description 2
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 2
- HOKIDJSKDBPKTQ-GLXFQSAKSA-N cephalosporin C Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CCC[C@@H](N)C(O)=O)[C@@H]12 HOKIDJSKDBPKTQ-GLXFQSAKSA-N 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 150000002081 enamines Chemical class 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- YGZIWEZFFBPCLN-UHFFFAOYSA-N n,3-bis(2-chloroethyl)-4-hydroperoxy-2-oxo-1,3,2$l^{5}-oxazaphosphinan-2-amine Chemical compound OOC1CCOP(=O)(NCCCl)N1CCCl YGZIWEZFFBPCLN-UHFFFAOYSA-N 0.000 description 2
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 229940049954 penicillin Drugs 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- FCZNNHHXCFARDY-WQRUCBPWSA-N (2s,5r,6r)-3,3-dimethyl-4,7-dioxo-6-[(2-phenylacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical class N([C@H]1[C@@H]2N(C1=O)[C@H](C(S2=O)(C)C)C(O)=O)C(=O)CC1=CC=CC=C1 FCZNNHHXCFARDY-WQRUCBPWSA-N 0.000 description 1
- QXTKWWMLNUQOLB-UHFFFAOYSA-N (4-nitrophenyl)methyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC1=CC=C([N+]([O-])=O)C=C1 QXTKWWMLNUQOLB-UHFFFAOYSA-N 0.000 description 1
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- QMYGFTJCQFEDST-UHFFFAOYSA-N 3-methoxybutyl acetate Chemical group COC(C)CCOC(C)=O QMYGFTJCQFEDST-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- GEHMBYLTCISYNY-UHFFFAOYSA-N Ammonium sulfamate Chemical compound [NH4+].NS([O-])(=O)=O GEHMBYLTCISYNY-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Natural products NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 238000002083 X-ray spectrum Methods 0.000 description 1
- XAKBSHICSHRJCL-UHFFFAOYSA-N [CH2]C(=O)C1=CC=CC=C1 Chemical group [CH2]C(=O)C1=CC=CC=C1 XAKBSHICSHRJCL-UHFFFAOYSA-N 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- FDIWRLNJDKKDHB-UHFFFAOYSA-N azanium;2-aminoacetate Chemical compound [NH4+].NCC([O-])=O FDIWRLNJDKKDHB-UHFFFAOYSA-N 0.000 description 1
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- YVPJCJLMRRTDMQ-UHFFFAOYSA-N ethyl diazoacetate Chemical compound CCOC(=O)C=[N+]=[N-] YVPJCJLMRRTDMQ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- OHHBFEVZJLBKEH-UHFFFAOYSA-N ethylenediamine dihydrochloride Chemical compound Cl.Cl.NCCN OHHBFEVZJLBKEH-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000006502 nitrobenzyl group Chemical group 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 150000005331 phenylglycines Chemical class 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000012088 reference solution Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/22—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with radicals containing only hydrogen and carbon atoms, attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US10821871A | 1971-01-20 | 1971-01-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL83085B1 true PL83085B1 (enExample) | 1975-12-31 |
Family
ID=22320939
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1972152959A PL83085B1 (enExample) | 1971-01-20 | 1972-01-18 |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US3781282A (enExample) |
| JP (1) | JPS5544076B1 (enExample) |
| AR (1) | AR194722A1 (enExample) |
| AT (1) | AT314731B (enExample) |
| BE (1) | BE777789A (enExample) |
| BG (1) | BG21611A3 (enExample) |
| CA (1) | CA1010848A (enExample) |
| CH (1) | CH547311A (enExample) |
| CS (1) | CS187354B2 (enExample) |
| DK (1) | DK142950C (enExample) |
| ES (1) | ES398963A1 (enExample) |
| FI (1) | FI60565C (enExample) |
| FR (1) | FR2122987A5 (enExample) |
| GB (1) | GB1336802A (enExample) |
| HU (1) | HU167270B (enExample) |
| IE (1) | IE35964B1 (enExample) |
| IL (1) | IL38565A (enExample) |
| LU (1) | LU64635A1 (enExample) |
| NL (1) | NL172746C (enExample) |
| NO (1) | NO143158C (enExample) |
| PH (1) | PH9590A (enExample) |
| PL (1) | PL83085B1 (enExample) |
| SE (1) | SE380269B (enExample) |
| SU (1) | SU592360A3 (enExample) |
| YU (1) | YU39454B (enExample) |
| ZA (1) | ZA7250B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS52106891A (en) * | 1976-03-03 | 1977-09-07 | Shionogi & Co Ltd | Removal of carboxyl protecting group |
| GB1532682A (en) * | 1976-04-27 | 1978-11-22 | Bristol Myers Co | Process for the preparation of cephadroxil |
| US4091214A (en) * | 1977-02-25 | 1978-05-23 | Eli Lilly And Company | De-esterification process for cephalosporins |
| US4160863A (en) * | 1977-04-07 | 1979-07-10 | Bristol-Myers Company | Process for the preparation of the crystalline monohydrate of 7-[D-α-aα-(p-hydroxyphenyl)acetamido]-3-methyl-3-cephem-4-carboxylic acid |
| AR223653A1 (es) * | 1977-09-27 | 1981-09-15 | Toyama Chemical Co Ltd | Procedimiento de preparacion del acido 7-(d(-)-alpha-(4-etil-2,3-dioxo-1-piperazinocarboxamido)-alpha-(4-hidroxifenil)acetamido)-3-(5-(1-metil-1,2,3,4-tetrazolil)tiometil)-delta3-cefem-4-carboxilico y su producto de adicion con n,n-dimetilacetamida |
| AT363594B (de) * | 1978-02-01 | 1981-08-10 | Biochemie Gmbh | Verfahren zur herstellung eines neuen formamidkomplexes von 7-beta-(d-2-amino-2-phenylacetamido)-3-methylceph-3-emcarbonsaeure |
| DE3138409A1 (de) * | 1981-09-26 | 1983-04-21 | Robert Bosch Gmbh, 7000 Stuttgart | "kraftstoffeinspritzpumpe fuer brennkraftmaschinen" |
| FR2555989B1 (fr) * | 1983-12-06 | 1987-02-20 | Bristol Myers Sa | Monohydrate de chlorocephadroxyle |
| JPS60114271U (ja) * | 1984-01-12 | 1985-08-02 | 株式会社ボッシュオートモーティブ システム | 流体ポンプ |
| US4775751A (en) * | 1985-06-03 | 1988-10-04 | Eli Lilly & Company | Process for cephalexin hydrochloride alcoholates |
| US4977257A (en) * | 1988-11-14 | 1990-12-11 | Eli Lilly And Company | DMF solvates of a β-lactam antibiotic |
| WO1991000865A1 (en) * | 1989-07-10 | 1991-01-24 | Gema S.A. | A novel stable form of cephradine, process for its production and intermediates used therein |
| US5278157A (en) * | 1989-07-10 | 1994-01-11 | Gema, S.A. | Stable cephradine hydrate |
| IN181697B (enExample) * | 1994-04-22 | 1998-09-05 | Ranbaxy Lab Ltd | |
| DE69601051T2 (de) * | 1995-05-30 | 1999-06-10 | Ranbaxy Laboratories, Ltd., New Delhi | Verfahren zur Spaltung von p-Nitrobenzylester in Cephalosporin |
| FR2814679B1 (fr) * | 2000-09-29 | 2003-04-11 | Cll Pharma | Compositions pharmaceutiques dispersibles a base de cephalosporines, leur procede de preparation et leur utilisation |
| CN102351884B (zh) * | 2006-05-19 | 2015-06-17 | 中化帝斯曼制药有限公司荷兰公司 | 一种用于结晶头孢羟氨苄的方法 |
-
1971
- 1971-01-20 US US00108218A patent/US3781282A/en not_active Expired - Lifetime
-
1972
- 1972-01-04 ZA ZA720050A patent/ZA7250B/xx unknown
- 1972-01-06 BE BE777789A patent/BE777789A/xx not_active IP Right Cessation
- 1972-01-07 SE SE7200477A patent/SE380269B/xx unknown
- 1972-01-10 IE IE30/72A patent/IE35964B1/xx unknown
- 1972-01-16 IL IL38565A patent/IL38565A/xx unknown
- 1972-01-17 CH CH62272A patent/CH547311A/fr not_active IP Right Cessation
- 1972-01-17 CA CA132,546A patent/CA1010848A/en not_active Expired
- 1972-01-18 YU YU118/72A patent/YU39454B/xx unknown
- 1972-01-18 ES ES398963A patent/ES398963A1/es not_active Expired
- 1972-01-18 PL PL1972152959A patent/PL83085B1/pl unknown
- 1972-01-18 NL NLAANVRAGE7200712,A patent/NL172746C/xx not_active IP Right Cessation
- 1972-01-18 PH PH13210*UA patent/PH9590A/en unknown
- 1972-01-19 NO NO110/72A patent/NO143158C/no unknown
- 1972-01-19 GB GB265772A patent/GB1336802A/en not_active Expired
- 1972-01-19 SU SU721738574A patent/SU592360A3/ru active
- 1972-01-19 HU HUEI403A patent/HU167270B/hu unknown
- 1972-01-19 AT AT43072A patent/AT314731B/de not_active IP Right Cessation
- 1972-01-19 DK DK26772A patent/DK142950C/da not_active IP Right Cessation
- 1972-01-20 LU LU64635D patent/LU64635A1/xx unknown
- 1972-01-20 CS CS72388A patent/CS187354B2/cs unknown
- 1972-01-20 AR AR240159A patent/AR194722A1/es active
- 1972-01-20 BG BG019530A patent/BG21611A3/xx unknown
- 1972-01-20 FR FR7201897A patent/FR2122987A5/fr not_active Expired
- 1972-01-20 FI FI145/72A patent/FI60565C/fi active
- 1972-01-20 JP JP802272A patent/JPS5544076B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| PH9590A (en) | 1976-01-19 |
| FR2122987A5 (enExample) | 1972-09-01 |
| IL38565A0 (en) | 1972-03-28 |
| ZA7250B (en) | 1973-08-29 |
| FI60565B (fi) | 1981-10-30 |
| DE2202227B2 (de) | 1976-05-26 |
| CA1010848A (en) | 1977-05-24 |
| DE2202227A1 (de) | 1972-11-30 |
| IL38565A (en) | 1975-02-10 |
| GB1336802A (en) | 1973-11-14 |
| DK142950C (da) | 1981-10-05 |
| ES398963A1 (es) | 1974-10-16 |
| CS187354B2 (en) | 1979-01-31 |
| DK142950B (da) | 1981-03-02 |
| AR194722A1 (es) | 1973-08-14 |
| NO143158B (no) | 1980-09-15 |
| NL7200712A (enExample) | 1972-07-24 |
| YU39454B (en) | 1984-12-31 |
| YU11872A (en) | 1982-02-28 |
| FI60565C (fi) | 1982-02-10 |
| NO143158C (no) | 1980-12-29 |
| CH547311A (fr) | 1974-03-29 |
| AT314731B (de) | 1974-04-25 |
| NL172746B (nl) | 1983-05-16 |
| SU592360A3 (ru) | 1978-02-05 |
| US3781282A (en) | 1973-12-25 |
| BG21611A3 (bg) | 1976-07-20 |
| IE35964B1 (en) | 1976-07-07 |
| IE35964L (en) | 1972-07-20 |
| NL172746C (nl) | 1983-10-17 |
| SE380269B (sv) | 1975-11-03 |
| BE777789A (fr) | 1972-07-06 |
| HU167270B (enExample) | 1975-09-27 |
| JPS5544076B1 (enExample) | 1980-11-10 |
| LU64635A1 (enExample) | 1972-08-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL83085B1 (enExample) | ||
| CA1111413A (en) | PROCESS FOR THE PREPARATION OF A [D-.alpha.-AMIDO-(P- HYDROXYPHENYL)-ACETAMIDO] GROUP CONTAINING PENICILLANIC ACID AND CEPHALOSPORANIC ACID DERIVATIVES | |
| US4252951A (en) | Isolation of syn-7-(2-amino-4-thiazolyl)-(methoxyimino)acetamido-3-acetoxymethyl-3-cephem-4-carboxylic acid | |
| US20020028931A1 (en) | Ceftiofur, its intermediate and a process for the preparation of the same | |
| PL80099B1 (enExample) | ||
| JPH02311483A (ja) | セフトリアキソンの製造方法 | |
| US5412094A (en) | Bicyclic beta-lactam/paraben complexes | |
| US5441874A (en) | Method for the acylation of the 7-amino group of the cephalosporanic ring | |
| US3549628A (en) | Side chain cleavage in desacetoxycephalosporin esters | |
| US3843639A (en) | Production of cephalexin via methoxymethyl ester | |
| US3507860A (en) | Process for the purification of crude 7-aminocephalosporanic acid and acid addition salts of 7 - amino - cephalosporanic acid employed therein | |
| IE48101B1 (en) | Process for the acylation of 7-aminocephem derivatives | |
| KR870001271B1 (ko) | 탈에스테르화 방법에 의한 유기 카복실산의 제조방법 | |
| EP1671974B1 (en) | Penicillin crystal and process for producing the same | |
| NZ200067A (en) | Penicillin intermediates for producing readily hydrolysable esters which degrade in vivo into beta-lactams and beta-lactamase inhibitors | |
| US4336376A (en) | Process for the preparation of 7-(D(-)-alpha-amino-p-hydroxyphenylacetamido)desacetoxycephalosporanic acid | |
| EP0222022A1 (en) | Process for producing beta-lactam derivatives | |
| KR20010037039A (ko) | 7-아미노-3-메톡시메틸-3-세펨-4-카복실산의 제조방법 | |
| US3769280A (en) | Process for acylation of cephalosporin esters | |
| US3840532A (en) | Process for cleaving cephalosporin compounds | |
| US3634416A (en) | Purification of 7alpha-aminoarylacetamido delta**3-4-carboxy-cephalosporins | |
| IL36990A (en) | 6-Amino- or acylamidofenicylic acids converted to position-6 and their production | |
| US3188311A (en) | Process for the preparation of 7-amino-cephalosporanic acids | |
| US4304909A (en) | Process for producing 7-(D(-)-α-(4-ethyl-2,3-dioxo-1-piperazinecarboxamido)-α-(4-hydroxyphenyl)acetamido)-3-(5-(1-methyl-1,2,3,4-tetrazolyl)thiomethyl)-.DELTA.3 -cephem-4-carboxylic acid and a pharmaceutically acceptable salt thereof | |
| US3507862A (en) | Cleavage of cephalosporin c |