PL82127B1 - - Google Patents
Download PDFInfo
- Publication number
- PL82127B1 PL82127B1 PL1971149746A PL14974671A PL82127B1 PL 82127 B1 PL82127 B1 PL 82127B1 PL 1971149746 A PL1971149746 A PL 1971149746A PL 14974671 A PL14974671 A PL 14974671A PL 82127 B1 PL82127 B1 PL 82127B1
- Authority
- PL
- Poland
- Prior art keywords
- urea
- tobacco
- cellulose
- weight
- measure according
- Prior art date
Links
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 95
- 239000004202 carbamide Substances 0.000 claims description 48
- 241000208125 Nicotiana Species 0.000 claims description 43
- 235000002637 Nicotiana tabacum Nutrition 0.000 claims description 42
- 239000000203 mixture Substances 0.000 claims description 28
- SNICXCGAKADSCV-JTQLQIEISA-N (-)-Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 claims description 14
- 229960002715 nicotine Drugs 0.000 claims description 12
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Natural products CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 claims description 12
- 230000000391 smoking effect Effects 0.000 claims description 12
- 238000002485 combustion reaction Methods 0.000 claims description 10
- 239000003607 modifier Substances 0.000 claims description 10
- 229920002678 cellulose Polymers 0.000 claims description 9
- 239000001913 cellulose Substances 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 229920002472 Starch Polymers 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 235000010987 pectin Nutrition 0.000 claims description 5
- 239000001814 pectin Substances 0.000 claims description 5
- 229920001277 pectin Polymers 0.000 claims description 5
- 235000019698 starch Nutrition 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 239000008107 starch Substances 0.000 claims description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 3
- STIAPHVBRDNOAJ-UHFFFAOYSA-N carbamimidoylazanium;carbonate Chemical compound NC(N)=N.NC(N)=N.OC(O)=O STIAPHVBRDNOAJ-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 3
- 230000003000 nontoxic effect Effects 0.000 claims description 3
- 239000010936 titanium Substances 0.000 claims description 3
- 229910052719 titanium Inorganic materials 0.000 claims description 3
- 229920002201 Oxidized cellulose Polymers 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000001413 amino acids Chemical class 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 238000001704 evaporation Methods 0.000 claims description 2
- 230000008020 evaporation Effects 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 150000002894 organic compounds Chemical class 0.000 claims description 2
- 229940107304 oxidized cellulose Drugs 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 239000011347 resin Substances 0.000 claims description 2
- 229920005989 resin Polymers 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 238000006467 substitution reaction Methods 0.000 claims description 2
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 claims 4
- 239000002253 acid Substances 0.000 claims 1
- 235000019504 cigarettes Nutrition 0.000 description 39
- 239000000779 smoke Substances 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 11
- 239000000126 substance Substances 0.000 description 8
- 239000000758 substrate Substances 0.000 description 8
- 239000000654 additive Substances 0.000 description 7
- 235000010980 cellulose Nutrition 0.000 description 7
- 230000007794 irritation Effects 0.000 description 7
- -1 alginic acid salts Chemical class 0.000 description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 4
- 239000005909 Kieselgur Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000001768 carboxy methyl cellulose Substances 0.000 description 4
- 239000010459 dolomite Substances 0.000 description 4
- 229910000514 dolomite Inorganic materials 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 229910001868 water Inorganic materials 0.000 description 4
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 3
- 206010008674 Cholinergic syndrome Diseases 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 3
- 229920003090 carboxymethyl hydroxyethyl cellulose Polymers 0.000 description 3
- 239000002274 desiccant Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 235000019634 flavors Nutrition 0.000 description 3
- 150000002484 inorganic compounds Chemical class 0.000 description 3
- 229910010272 inorganic material Inorganic materials 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 229920000609 methyl cellulose Polymers 0.000 description 3
- 239000001923 methylcellulose Substances 0.000 description 3
- 235000010981 methylcellulose Nutrition 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 2
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 2
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 239000008186 active pharmaceutical agent Substances 0.000 description 2
- 235000004279 alanine Nutrition 0.000 description 2
- 235000003704 aspartic acid Nutrition 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 2
- 229920003064 carboxyethyl cellulose Polymers 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 229940105329 carboxymethylcellulose Drugs 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000001133 paullinia cupana hbk gum Substances 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 150000003141 primary amines Chemical group 0.000 description 2
- 235000010413 sodium alginate Nutrition 0.000 description 2
- 239000000661 sodium alginate Substances 0.000 description 2
- 229940005550 sodium alginate Drugs 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- FMMWHPNWAFZXNH-UHFFFAOYSA-N Benz[a]pyrene Chemical compound C1=C2C3=CC=CC=C3C=C(C=C3)C2=C2C3=CC=CC2=C1 FMMWHPNWAFZXNH-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- 229920013683 Celanese Polymers 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-L L-tartrate(2-) Chemical compound [O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O FEWJPZIEWOKRBE-JCYAYHJZSA-L 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- CPCNAMNNSLASDC-UHFFFAOYSA-N acetic acid;3-(1-methylpyrrolidin-2-yl)pyridine Chemical compound CC(O)=O.CN1CCCC1C1=CC=CN=C1 CPCNAMNNSLASDC-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 229920003123 carboxymethyl cellulose sodium Polymers 0.000 description 1
- 229940063834 carboxymethylcellulose sodium Drugs 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 235000019994 cava Nutrition 0.000 description 1
- 235000019506 cigar Nutrition 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- SHFGJEQAOUMGJM-UHFFFAOYSA-N dialuminum dipotassium disodium dioxosilane iron(3+) oxocalcium oxomagnesium oxygen(2-) Chemical compound [O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[Na+].[Na+].[Al+3].[Al+3].[K+].[K+].[Fe+3].[Fe+3].O=[Mg].O=[Ca].O=[Si]=O SHFGJEQAOUMGJM-UHFFFAOYSA-N 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229920000591 gum Polymers 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000014380 magnesium carbonate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 235000019629 palatability Nutrition 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000010451 perlite Substances 0.000 description 1
- 235000019362 perlite Nutrition 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004854 plant resin Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 235000019505 tobacco product Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A24—TOBACCO; CIGARS; CIGARETTES; SIMULATED SMOKING DEVICES; SMOKERS' REQUISITES
- A24B—MANUFACTURE OR PREPARATION OF TOBACCO FOR SMOKING OR CHEWING; TOBACCO; SNUFF
- A24B15/00—Chemical features or treatment of tobacco; Tobacco substitutes, e.g. in liquid form
- A24B15/10—Chemical features of tobacco products or tobacco substitutes
- A24B15/12—Chemical features of tobacco products or tobacco substitutes of reconstituted tobacco
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/08—Esters of oxyacids of phosphorus
- C07F9/09—Esters of phosphoric acids
- C07F9/091—Esters of phosphoric acids with hydroxyalkyl compounds with further substituents on alkyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Manufacture Of Tobacco Products (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US5970470A | 1970-07-30 | 1970-07-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL82127B1 true PL82127B1 (da) | 1975-10-31 |
Family
ID=22024705
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971149746A PL82127B1 (da) | 1970-07-30 | 1971-07-29 |
Country Status (27)
| Country | Link |
|---|---|
| JP (1) | JPS552275B1 (da) |
| AU (1) | AU459752B2 (da) |
| BE (1) | BE770719A (da) |
| BR (1) | BR7104900D0 (da) |
| CA (1) | CA950787A (da) |
| CH (1) | CH551161A (da) |
| CS (1) | CS154696B2 (da) |
| DE (1) | DE2137866C2 (da) |
| EG (1) | EG10156A (da) |
| ES (1) | ES393746A1 (da) |
| FI (1) | FI50926C (da) |
| FR (1) | FR2099380A5 (da) |
| GB (1) | GB1355865A (da) |
| HU (1) | HU164876B (da) |
| IE (1) | IE36674B1 (da) |
| IL (1) | IL37411A (da) |
| IT (1) | IT1059657B (da) |
| LU (1) | LU63635A1 (da) |
| MT (1) | MTP700B (da) |
| NL (1) | NL7110555A (da) |
| NO (1) | NO130622C (da) |
| OA (1) | OA03780A (da) |
| PL (1) | PL82127B1 (da) |
| SE (2) | SE395823B (da) |
| SU (1) | SU849980A4 (da) |
| ZA (1) | ZA714990B (da) |
| ZM (1) | ZM10171A1 (da) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4319591A (en) * | 1972-02-09 | 1982-03-16 | Celanese Corporation | Smoking compositions |
| GB1445124A (en) * | 1973-07-09 | 1976-08-04 | Ici Ltd | Smoking mixtures |
| DE3150582C2 (de) * | 1981-12-21 | 1983-11-03 | H.F. & Ph.F. Reemtsma Gmbh & Co, 2000 Hamburg | Rauchbares Produkt, insbesondere Zigarette |
| JPH01283032A (ja) * | 1988-05-07 | 1989-11-14 | Sanken Electric Co Ltd | 無停電直流電源装置 |
| RU2380992C1 (ru) * | 2008-08-29 | 2010-02-10 | Тагир Эюб Оглы Агаев | Способ приготовления курительной композиции |
| RU2380991C1 (ru) * | 2008-08-29 | 2010-02-10 | Тагир Эюб Оглы Агаев | Курительная композиция |
| MX2018004859A (es) * | 2015-11-05 | 2018-08-01 | Philip Morris Products Sa | Material de tabaco homogeneizado con lipido fundible. |
| KR102619157B1 (ko) * | 2016-01-21 | 2023-12-28 | 도쿄엘렉트론가부시키가이샤 | 약액 공급 장치 및 도포 현상 시스템 |
| ES2999299T3 (en) | 2016-12-30 | 2025-02-25 | Philip Morris Products Sa | Method of making a nicotine containing sheet |
| RU2762115C2 (ru) * | 2016-12-30 | 2021-12-15 | Филип Моррис Продактс С.А. | Генерирующий аэрозоль стержень и генерирующее аэрозоль изделие (варианты) |
| CN114916701A (zh) * | 2016-12-30 | 2022-08-19 | 菲利普莫里斯生产公司 | 含尼古丁和粘合剂的片材 |
| KR102613159B1 (ko) * | 2016-12-30 | 2023-12-14 | 필립모리스 프로덕츠 에스.에이. | 니코틴 및 셀룰로오스 함유 시트 |
| CN108936793B (zh) * | 2018-06-15 | 2021-08-06 | 张莘蔓 | 一种降低卷烟co和焦油释放量的方法 |
| CN108968140B (zh) * | 2018-06-15 | 2021-07-30 | 张莘蔓 | 一种卷烟烟叶添加剂及其制备方法 |
| KR20220092568A (ko) * | 2019-12-17 | 2022-07-01 | 필립모리스 프로덕츠 에스.에이. | 질소 함유 친핵성 화합물을 갖는 에어로졸 형성 기재 |
-
1971
- 1971-07-26 ZA ZA714990A patent/ZA714990B/xx unknown
- 1971-07-27 FI FI712125A patent/FI50926C/fi active
- 1971-07-28 EG EG334/71A patent/EG10156A/xx active
- 1971-07-28 MT MT700A patent/MTP700B/xx unknown
- 1971-07-29 PL PL1971149746A patent/PL82127B1/pl unknown
- 1971-07-29 AU AU31808/71A patent/AU459752B2/en not_active Expired
- 1971-07-29 HU HU71CE847A patent/HU164876B/hu unknown
- 1971-07-29 IT IT51994/71A patent/IT1059657B/it active
- 1971-07-29 DE DE2137866A patent/DE2137866C2/de not_active Expired
- 1971-07-29 SE SE7109768A patent/SE395823B/xx unknown
- 1971-07-29 IL IL37411A patent/IL37411A/xx unknown
- 1971-07-29 ZM ZM101/71A patent/ZM10171A1/xx unknown
- 1971-07-29 LU LU63635D patent/LU63635A1/xx unknown
- 1971-07-29 ES ES393746A patent/ES393746A1/es not_active Expired
- 1971-07-29 FR FR7127917A patent/FR2099380A5/fr not_active Expired
- 1971-07-29 NO NO712871A patent/NO130622C/no unknown
- 1971-07-30 BE BE770719A patent/BE770719A/xx unknown
- 1971-07-30 CS CS560871A patent/CS154696B2/cs unknown
- 1971-07-30 CA CA119,585,A patent/CA950787A/en not_active Expired
- 1971-07-30 JP JP5682971A patent/JPS552275B1/ja active Pending
- 1971-07-30 SU SU711686602A patent/SU849980A4/ru active
- 1971-07-30 NL NL7110555A patent/NL7110555A/xx not_active Application Discontinuation
- 1971-07-30 IE IE973/71A patent/IE36674B1/xx unknown
- 1971-07-30 BR BR4900/71A patent/BR7104900D0/pt unknown
- 1971-07-30 CH CH1126971A patent/CH551161A/xx not_active IP Right Cessation
- 1971-07-30 GB GB3586071A patent/GB1355865A/en not_active Expired
- 1971-08-20 OA OA54336A patent/OA03780A/xx unknown
-
1974
- 1974-08-28 SE SE7410908A patent/SE411831B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE36674B1 (en) | 1977-02-02 |
| SE411831B (sv) | 1980-02-11 |
| BR7104900D0 (pt) | 1973-05-24 |
| AU459752B2 (en) | 1975-04-10 |
| CH551161A (de) | 1974-07-15 |
| NO130622B (da) | 1974-10-07 |
| JPS552275B1 (da) | 1980-01-19 |
| FR2099380A5 (da) | 1972-03-10 |
| HU164876B (da) | 1974-05-28 |
| IT1059657B (it) | 1982-06-21 |
| DE2137866A1 (de) | 1972-02-03 |
| GB1355865A (en) | 1974-06-05 |
| EG10156A (en) | 1978-09-30 |
| IL37411A (en) | 1974-12-31 |
| NL7110555A (da) | 1972-02-01 |
| AU3180871A (en) | 1973-02-01 |
| BE770719A (fr) | 1971-12-01 |
| ZM10171A1 (en) | 1972-04-21 |
| ZA714990B (en) | 1973-03-28 |
| IL37411A0 (en) | 1971-10-20 |
| IE36674L (en) | 1972-01-30 |
| SE395823B (sv) | 1977-08-29 |
| OA03780A (fr) | 1971-12-24 |
| MTP700B (en) | 1972-01-17 |
| NO130622C (da) | 1975-01-15 |
| SE7410908L (da) | 1974-08-28 |
| FI50926B (da) | 1976-05-31 |
| FI50926C (fi) | 1976-09-10 |
| ES393746A1 (es) | 1974-07-16 |
| LU63635A1 (da) | 1971-11-26 |
| CA950787A (en) | 1974-07-09 |
| DE2137866C2 (de) | 1982-06-09 |
| SU849980A4 (ru) | 1981-07-23 |
| CS154696B2 (da) | 1974-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3943942A (en) | Smoking mixtures | |
| US3931824A (en) | Smoking materials | |
| US4008723A (en) | Smoking mixture | |
| US3885574A (en) | Smoking mixture | |
| US4197861A (en) | Smoking material | |
| PL82127B1 (da) | ||
| RU2248738C2 (ru) | Обертка курительного изделия с улучшенным наполнителем | |
| RU1829919C (ru) | Сигарета | |
| US3878850A (en) | Smoking mixture | |
| US4233993A (en) | Smoking material | |
| TWI308484B (en) | Improvements relating to smoking articles and smokable filler materials therefor | |
| RU1812956C (ru) | Сигарета | |
| PL198869B1 (pl) | Materiał do palenia, pozbawiony włókien materiał do palenia i artykuł do palenia | |
| BG63420B1 (bg) | Тютюневи изделия с филтър или подобни на тютюневиизделия продукти с филтър с антиокислително действуващи естествени вещества и метод за получаванетоим | |
| US4055191A (en) | Tobacco composition | |
| US4319591A (en) | Smoking compositions | |
| SU516333A3 (ru) | Способ изготовлени курительного продукта | |
| Yamamoto et al. | Effect of exogenous potassium on the reduction in tar, nicotine and carbon monoxide deliveries in the mainstream smoke of cigarettes | |
| US4117850A (en) | Smoking mixtures | |
| PL83126B1 (en) | Tobacco substitute smoking material[us3818915a] | |
| JPWO2010084792A1 (ja) | シガレット | |
| JP2014138604A (ja) | タバコ充填材およびシガレット | |
| PL83132B1 (en) | Smoking mixture[US3965911A] | |
| US4142535A (en) | Smoking product | |
| US3812864A (en) | Tobacco replacement material |