PL81827B1 - - Google Patents
Download PDFInfo
- Publication number
- PL81827B1 PL81827B1 PL1972155270A PL15527072A PL81827B1 PL 81827 B1 PL81827 B1 PL 81827B1 PL 1972155270 A PL1972155270 A PL 1972155270A PL 15527072 A PL15527072 A PL 15527072A PL 81827 B1 PL81827 B1 PL 81827B1
- Authority
- PL
- Poland
- Prior art keywords
- pyridazine
- tetrahydro
- pyrido
- chloro
- melting point
- Prior art date
Links
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 208
- 150000001875 compounds Chemical class 0.000 description 147
- 238000002844 melting Methods 0.000 description 131
- 230000008018 melting Effects 0.000 description 131
- 238000001953 recrystallisation Methods 0.000 description 112
- 238000000354 decomposition reaction Methods 0.000 description 110
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 105
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 93
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 80
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 73
- -1 alkyl radical Chemical class 0.000 description 64
- 239000000047 product Substances 0.000 description 62
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 58
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 58
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 57
- 239000011541 reaction mixture Substances 0.000 description 56
- 239000000243 solution Substances 0.000 description 45
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 42
- 239000002253 acid Substances 0.000 description 40
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- 238000000034 method Methods 0.000 description 36
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 36
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 31
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 31
- 238000010992 reflux Methods 0.000 description 31
- 238000001816 cooling Methods 0.000 description 30
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 26
- 239000012043 crude product Substances 0.000 description 26
- 125000000217 alkyl group Chemical group 0.000 description 25
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 24
- 238000009835 boiling Methods 0.000 description 23
- 238000003756 stirring Methods 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 21
- 239000000203 mixture Substances 0.000 description 21
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 20
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 20
- 239000002585 base Substances 0.000 description 19
- WXTMDXOMEHJXQO-UHFFFAOYSA-N 2,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1O WXTMDXOMEHJXQO-UHFFFAOYSA-N 0.000 description 18
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 17
- 239000000725 suspension Substances 0.000 description 17
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 16
- 125000004432 carbon atom Chemical group C* 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 14
- 229910052794 bromium Inorganic materials 0.000 description 14
- 125000004494 ethyl ester group Chemical group 0.000 description 14
- 229910052801 chlorine Inorganic materials 0.000 description 13
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 13
- 239000012044 organic layer Substances 0.000 description 13
- 239000001530 fumaric acid Substances 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 11
- 239000000460 chlorine Substances 0.000 description 11
- 239000010410 layer Substances 0.000 description 11
- UDABHERMEKWUDP-BTJKTKAUSA-N (z)-but-2-enedioic acid;3-chloro-5,6,7,8-tetrahydropyrido[4,3-c]pyridazine Chemical compound OC(=O)\C=C/C(O)=O.C1NCCC2=C1C=C(Cl)N=N2 UDABHERMEKWUDP-BTJKTKAUSA-N 0.000 description 10
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 10
- 235000002639 sodium chloride Nutrition 0.000 description 10
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 125000003545 alkoxy group Chemical group 0.000 description 9
- 125000001309 chloro group Chemical group Cl* 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 238000000746 purification Methods 0.000 description 8
- RGWAZXHUULNXGT-UHFFFAOYSA-N pyrido[4,3-c]pyridazine Chemical compound N1=CC=C2C=NC=CC2=N1 RGWAZXHUULNXGT-UHFFFAOYSA-N 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 8
- SYSATALHMMDBPP-BTJKTKAUSA-N (z)-but-2-enedioic acid;pyridazine Chemical compound C1=CC=NN=C1.OC(=O)\C=C/C(O)=O SYSATALHMMDBPP-BTJKTKAUSA-N 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- RUUOPSRRIKJHNH-UHFFFAOYSA-N pyridazine-3-carboxylic acid Chemical compound OC(=O)C1=CC=CN=N1 RUUOPSRRIKJHNH-UHFFFAOYSA-N 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 125000003342 alkenyl group Chemical group 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 6
- 239000012362 glacial acetic acid Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 150000003609 titanium compounds Chemical class 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 5
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 5
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 5
- 229960005219 gentisic acid Drugs 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical group [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- SXVPOSFURRDKBO-UHFFFAOYSA-N Cyclododecanone Chemical compound O=C1CCCCCCCCCCC1 SXVPOSFURRDKBO-UHFFFAOYSA-N 0.000 description 4
- QHWYFSPKFQRXIN-UHFFFAOYSA-N N=1NC(C=C2C1C=CN=C2)=O Chemical compound N=1NC(C=C2C1C=CN=C2)=O QHWYFSPKFQRXIN-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- VJSCICINBIBEOF-UHFFFAOYSA-N ethyl 3-chloro-7,8-dihydro-5h-pyrido[4,3-c]pyridazine-6-carboxylate Chemical compound N1=C(Cl)C=C2CN(C(=O)OCC)CCC2=N1 VJSCICINBIBEOF-UHFFFAOYSA-N 0.000 description 4
- LLLVOBWNRQYTKR-UHFFFAOYSA-N ethyl pyridazine-3-carboxylate Chemical compound CCOC(=O)C1=CC=CN=N1 LLLVOBWNRQYTKR-UHFFFAOYSA-N 0.000 description 4
- 150000004702 methyl esters Chemical class 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 125000003884 phenylalkyl group Chemical group 0.000 description 4
- 239000003495 polar organic solvent Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- SYSATALHMMDBPP-WLHGVMLRSA-N (e)-but-2-enedioic acid;pyridazine Chemical compound C1=CC=NN=C1.OC(=O)\C=C\C(O)=O SYSATALHMMDBPP-WLHGVMLRSA-N 0.000 description 3
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical compound OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 3
- IIIDPTXDTHOYRK-UHFFFAOYSA-N 5,6,7,8-tetrahydropyrido[4,3-c]pyridazin-6-ium-3-olate Chemical compound C1NCCC2=NNC(=O)C=C21 IIIDPTXDTHOYRK-UHFFFAOYSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 206010020772 Hypertension Diseases 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 229940114119 gentisate Drugs 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229940086542 triethylamine Drugs 0.000 description 3
- KJGKYZLBBSMYQR-UHFFFAOYSA-N (3-chloro-7,8-dihydro-5h-pyrido[4,3-c]pyridazin-6-yl)-(4-phenylphenyl)methanone Chemical compound C1CC=2N=NC(Cl)=CC=2CN1C(=O)C(C=C1)=CC=C1C1=CC=CC=C1 KJGKYZLBBSMYQR-UHFFFAOYSA-N 0.000 description 2
- IPDGSIHXHOCKEW-UHFFFAOYSA-N 1,2,3,4-tetrahydropyrido[4,3-c]pyridazine Chemical compound N1=CC=C2NNCCC2=C1 IPDGSIHXHOCKEW-UHFFFAOYSA-N 0.000 description 2
- YDNUUXDMGBKSKE-UHFFFAOYSA-N 1-(3-chloro-7,8-dihydro-5h-pyrido[4,3-c]pyridazin-6-yl)butan-1-one Chemical compound N1=C(Cl)C=C2CN(C(=O)CCC)CCC2=N1 YDNUUXDMGBKSKE-UHFFFAOYSA-N 0.000 description 2
- 125000004098 2,6-dichlorobenzoyl group Chemical group O=C([*])C1=C(Cl)C([H])=C([H])C([H])=C1Cl 0.000 description 2
- 125000003541 2-chlorobenzoyl group Chemical group ClC1=C(C(=O)*)C=CC=C1 0.000 description 2
- 125000001216 2-naphthoyl group Chemical group C1=C(C=CC2=CC=CC=C12)C(=O)* 0.000 description 2
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 2
- NKGWEPKYDIYWOL-UHFFFAOYSA-N 3-chloro-5,6,7,8,9,10-hexahydrocycloocta[c]pyridazine Chemical compound C1CCCCCC2=C1C=C(Cl)N=N2 NKGWEPKYDIYWOL-UHFFFAOYSA-N 0.000 description 2
- ALJUPDQYZZRFSN-UHFFFAOYSA-N 3-chloro-5,6,7,8-tetrahydropyrido[4,3-c]pyridazine Chemical compound C1NCCC2=C1C=C(Cl)N=N2 ALJUPDQYZZRFSN-UHFFFAOYSA-N 0.000 description 2
- OOFHVZWITPXUMZ-UHFFFAOYSA-N 3-chloro-6,7,8,9-tetrahydro-5h-cyclohepta[c]pyridazine Chemical compound C1CCCCC2=C1C=C(Cl)N=N2 OOFHVZWITPXUMZ-UHFFFAOYSA-N 0.000 description 2
- 125000002672 4-bromobenzoyl group Chemical group BrC1=CC=C(C(=O)*)C=C1 0.000 description 2
- VGVHNLRUAMRIEW-UHFFFAOYSA-N 4-methylcyclohexan-1-one Chemical compound CC1CCC(=O)CC1 VGVHNLRUAMRIEW-UHFFFAOYSA-N 0.000 description 2
- UUZNRFYGEZBNEC-UHFFFAOYSA-N 5,6,7,8,9,10-hexahydro-2h-cycloocta[c]pyridazine-3-thione Chemical compound C1CCCCCC2=NNC(=S)C=C21 UUZNRFYGEZBNEC-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 150000004292 cyclic ethers Chemical class 0.000 description 2
- CGZZMOTZOONQIA-UHFFFAOYSA-N cycloheptanone Chemical compound O=C1CCCCCC1 CGZZMOTZOONQIA-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- QWFYBFFWLXGYBD-UHFFFAOYSA-N ethyl 3-hydrazinyl-7,8-dihydro-5h-pyrido[4,3-c]pyridazine-6-carboxylate Chemical compound N1=C(NN)C=C2CN(C(=O)OCC)CCC2=N1 QWFYBFFWLXGYBD-UHFFFAOYSA-N 0.000 description 2
- YQONNJPKBHDJJM-UHFFFAOYSA-N ethyl 3-methyl-4-oxopiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(=O)C(C)C1 YQONNJPKBHDJJM-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- HOEOMWYFJBSYSF-UHFFFAOYSA-N methyl 4-oxopiperidine-1-carboxylate Chemical compound COC(=O)N1CCC(=O)CC1 HOEOMWYFJBSYSF-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- OKRHSMWSLCHFCI-UHFFFAOYSA-N (3-benzylsulfanyl-7,8-dihydro-5h-pyrido[4,3-c]pyridazin-6-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)N(CC1=C2)CCC1=NN=C2SCC1=CC=CC=C1 OKRHSMWSLCHFCI-UHFFFAOYSA-N 0.000 description 1
- MWSZNJZZMGBOMH-UHFFFAOYSA-N (3-chloro-7,8-dihydro-5h-pyrido[4,3-c]pyridazin-6-yl)-(2,6-dichlorophenyl)methanone Chemical compound C1CC=2N=NC(Cl)=CC=2CN1C(=O)C1=C(Cl)C=CC=C1Cl MWSZNJZZMGBOMH-UHFFFAOYSA-N 0.000 description 1
- ZYGQKGNXOIBXMG-UHFFFAOYSA-N (3-chloro-7,8-dihydro-5h-pyrido[4,3-c]pyridazin-6-yl)-(2-fluorophenyl)methanone Chemical compound FC1=CC=CC=C1C(=O)N1CC2=CC(Cl)=NN=C2CC1 ZYGQKGNXOIBXMG-UHFFFAOYSA-N 0.000 description 1
- UGGIYYOTLHBVGQ-UHFFFAOYSA-N (3-chloro-7,8-dihydro-5h-pyrido[4,3-c]pyridazin-6-yl)-(3-chlorophenyl)methanone Chemical compound ClC1=CC=CC(C(=O)N2CC3=CC(Cl)=NN=C3CC2)=C1 UGGIYYOTLHBVGQ-UHFFFAOYSA-N 0.000 description 1
- OUOTURDMANTVEM-UHFFFAOYSA-N (3-chloro-7,8-dihydro-5h-pyrido[4,3-c]pyridazin-6-yl)-(4-ethoxyphenyl)methanone Chemical compound C1=CC(OCC)=CC=C1C(=O)N1CC2=CC(Cl)=NN=C2CC1 OUOTURDMANTVEM-UHFFFAOYSA-N 0.000 description 1
- BQXSACKHPWOYLT-UHFFFAOYSA-N (3-chloro-7,8-dihydro-5h-pyrido[4,3-c]pyridazin-6-yl)-phenylmethanone Chemical compound C1CC=2N=NC(Cl)=CC=2CN1C(=O)C1=CC=CC=C1 BQXSACKHPWOYLT-UHFFFAOYSA-N 0.000 description 1
- AEPJVUQCYGAVJL-UHFFFAOYSA-N (3-hydrazinyl-7,8-dihydro-5h-pyrido[4,3-c]pyridazin-6-yl)-(4-phenylphenyl)methanone Chemical compound C1CC=2N=NC(NN)=CC=2CN1C(=O)C(C=C1)=CC=C1C1=CC=CC=C1 AEPJVUQCYGAVJL-UHFFFAOYSA-N 0.000 description 1
- XVTAEVMXPFSSOC-WAYWQWQTSA-N (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)tetradec-9-en-1-one Chemical compound ClC1=CC2=C(N=N1)CCN(C2)C(CCCCCCC\C=C/CCCC)=O XVTAEVMXPFSSOC-WAYWQWQTSA-N 0.000 description 1
- MULLKLZWQQERCK-BUOKYLHBSA-J (e)-but-2-enedioate;titanium(4+) Chemical compound [Ti+4].[O-]C(=O)\C=C\C([O-])=O.[O-]C(=O)\C=C\C([O-])=O MULLKLZWQQERCK-BUOKYLHBSA-J 0.000 description 1
- TUNLYEHIVPWOHK-ARJAWSKDSA-N (z)-2-methylbut-2-enoyl chloride Chemical compound C\C=C(\C)C(Cl)=O TUNLYEHIVPWOHK-ARJAWSKDSA-N 0.000 description 1
- MMWRGWQTAMNAFC-UHFFFAOYSA-N 1,2-dihydropyridine Chemical compound C1NC=CC=C1 MMWRGWQTAMNAFC-UHFFFAOYSA-N 0.000 description 1
- BGDGMIWDPMJYPP-UHFFFAOYSA-N 1,3-dimethylpiperidin-4-one Chemical compound CC1CN(C)CCC1=O BGDGMIWDPMJYPP-UHFFFAOYSA-N 0.000 description 1
- WGOCJZVMXDGXOQ-UHFFFAOYSA-N 1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-phenylethanone Chemical compound C1CC=2N=NC(Cl)=CC=2CN1C(=O)CC1=CC=CC=C1 WGOCJZVMXDGXOQ-UHFFFAOYSA-N 0.000 description 1
- JSAOWOSTVBKZHK-UHFFFAOYSA-N 1-[3-[amino(methyl)amino]-7,8-dihydro-5h-pyrido[4,3-c]pyridazin-6-yl]pent-4-en-1-one Chemical compound C1N(C(=O)CCC=C)CCC2=C1C=C(N(N)C)N=N2 JSAOWOSTVBKZHK-UHFFFAOYSA-N 0.000 description 1
- GGYVTHJIUNGKFZ-UHFFFAOYSA-N 1-methylpiperidin-2-one Chemical compound CN1CCCCC1=O GGYVTHJIUNGKFZ-UHFFFAOYSA-N 0.000 description 1
- BFMCJGKHMJACTO-UHFFFAOYSA-N 1-pyridin-2-ylpent-4-en-1-one Chemical compound C=CCCC(=O)C1=CC=CC=N1 BFMCJGKHMJACTO-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- WFNKMVDATNLZBX-UHFFFAOYSA-N 2,3-dimethylbenzoyl chloride Chemical compound CC1=CC=CC(C(Cl)=O)=C1C WFNKMVDATNLZBX-UHFFFAOYSA-N 0.000 description 1
- JBLIDPPHFGWTKU-UHFFFAOYSA-N 2,6-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=C(Cl)C=CC=C1Cl JBLIDPPHFGWTKU-UHFFFAOYSA-N 0.000 description 1
- FKMIBYMTHOJWCY-UHFFFAOYSA-N 2-(2-methylphenyl)acetyl chloride Chemical compound CC1=CC=CC=C1CC(Cl)=O FKMIBYMTHOJWCY-UHFFFAOYSA-N 0.000 description 1
- MQKBMDLEBVTMMF-UHFFFAOYSA-N 2-(4-chlorophenyl)propanoyl chloride Chemical compound ClC(=O)C(C)C1=CC=C(Cl)C=C1 MQKBMDLEBVTMMF-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- RAAGZOYMEQDCTD-UHFFFAOYSA-N 2-fluorobenzoyl chloride Chemical compound FC1=CC=CC=C1C(Cl)=O RAAGZOYMEQDCTD-UHFFFAOYSA-N 0.000 description 1
- QGXMHCMPIAYMGT-UHFFFAOYSA-N 2-phenylbutanoyl chloride Chemical compound CCC(C(Cl)=O)C1=CC=CC=C1 QGXMHCMPIAYMGT-UHFFFAOYSA-N 0.000 description 1
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- PITHYUDHKJKJNQ-UHFFFAOYSA-N 2-propylpentanoyl chloride Chemical compound CCCC(C(Cl)=O)CCC PITHYUDHKJKJNQ-UHFFFAOYSA-N 0.000 description 1
- ZQOZLLNCVHPQMV-UHFFFAOYSA-N 2-tert-butylbenzoyl chloride Chemical compound CC(C)(C)C1=CC=CC=C1C(Cl)=O ZQOZLLNCVHPQMV-UHFFFAOYSA-N 0.000 description 1
- GPLQCPZSABFLTP-UHFFFAOYSA-N 3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazine-6-carboxylic acid Chemical compound N1=C(Cl)C=C2CN(C(=O)O)CCC2=N1 GPLQCPZSABFLTP-UHFFFAOYSA-N 0.000 description 1
- YDYFTPLRDUDLMP-UHFFFAOYSA-N 3-chloro-8-methyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazine-6-carboxylic acid Chemical compound ClC1=NN=C2C(C)CN(C(O)=O)CC2=C1 YDYFTPLRDUDLMP-UHFFFAOYSA-N 0.000 description 1
- WHIHIKVIWVIIER-UHFFFAOYSA-N 3-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Cl)=C1 WHIHIKVIWVIIER-UHFFFAOYSA-N 0.000 description 1
- DENKGPBHLYFNGK-UHFFFAOYSA-N 4-bromobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Br)C=C1 DENKGPBHLYFNGK-UHFFFAOYSA-N 0.000 description 1
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- UZFMOKQJFYMBGY-UHFFFAOYSA-N 4-hydroxy-TEMPO Chemical compound CC1(C)CC(O)CC(C)(C)N1[O] UZFMOKQJFYMBGY-UHFFFAOYSA-N 0.000 description 1
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 1
- JPVUWCPKMYXOKW-UHFFFAOYSA-N 4-phenylbenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C1=CC=CC=C1 JPVUWCPKMYXOKW-UHFFFAOYSA-N 0.000 description 1
- RILXZOSGVPPRMX-UHFFFAOYSA-N 5,6,7,8,9,10,11,12,13,14-decahydro-2h-cyclododeca[c]pyridazin-3-one Chemical compound C1CCCCCCCCCC2=C1C=C(O)N=N2 RILXZOSGVPPRMX-UHFFFAOYSA-N 0.000 description 1
- WPKKYTFIJLZVPP-UHFFFAOYSA-N 5,6,7,8-tetrahydropyrido[4,3-c]pyridazine Chemical compound N1=CC=C2CNCCC2=N1 WPKKYTFIJLZVPP-UHFFFAOYSA-N 0.000 description 1
- MHSKQJPAYRHWAO-UHFFFAOYSA-N 8-methyl-5,6,7,8-tetrahydro-2H-pyrido[4,3-c]pyridazin-3-one Chemical compound CC1CNCC=2C1=NNC(C=2)=O MHSKQJPAYRHWAO-UHFFFAOYSA-N 0.000 description 1
- FLXJVRWYRNQEGL-UHFFFAOYSA-N COC1=CC=CC(OC)=C1OC.Cl Chemical compound COC1=CC=CC(OC)=C1OC.Cl FLXJVRWYRNQEGL-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 101100137598 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) PRM6 gene Proteins 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 238000000944 Soxhlet extraction Methods 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- KFNXZHFCLIHMRI-UHFFFAOYSA-N [3-[amino(methyl)amino]-7,8-dihydro-5h-pyrido[4,3-c]pyridazin-6-yl]-phenylmethanone Chemical compound C1CC=2N=NC(N(N)C)=CC=2CN1C(=O)C1=CC=CC=C1 KFNXZHFCLIHMRI-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- QXNITQGRWCXTEE-UHFFFAOYSA-N benzyl pyridazine-3-carboxylate Chemical compound C=1C=CN=NC=1C(=O)OCC1=CC=CC=C1 QXNITQGRWCXTEE-UHFFFAOYSA-N 0.000 description 1
- 210000004763 bicuspid Anatomy 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000004531 blood pressure lowering effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 210000003109 clavicle Anatomy 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- JFWMYCVMQSLLOO-UHFFFAOYSA-N cyclobutanecarbonyl chloride Chemical compound ClC(=O)C1CCC1 JFWMYCVMQSLLOO-UHFFFAOYSA-N 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001240 enamine group Chemical group 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- AGYHLNMYQCGFHV-UHFFFAOYSA-N ethyl 3-(2-butylidenehydrazinyl)-7,8-dihydro-5h-pyrido[4,3-c]pyridazine-6-carboxylate Chemical compound C1N(C(=O)OCC)CCC2=C1C=C(NN=CCCC)N=N2 AGYHLNMYQCGFHV-UHFFFAOYSA-N 0.000 description 1
- JEQFPYLTOMTXFJ-UHFFFAOYSA-N ethyl 3-[amino(methyl)amino]-7,8-dihydro-5h-pyrido[4,3-c]pyridazine-6-carboxylate Chemical compound N1=C(N(C)N)C=C2CN(C(=O)OCC)CCC2=N1 JEQFPYLTOMTXFJ-UHFFFAOYSA-N 0.000 description 1
- NOSPJADXAAYCAR-UHFFFAOYSA-N ethyl 3-sulfanyl-5,6,7,8-tetrahydro-2h-pyrido[4,3-c]pyridazine-3-carboxylate Chemical compound C1CNCC2=CC(C(=O)OCC)(S)NN=C21 NOSPJADXAAYCAR-UHFFFAOYSA-N 0.000 description 1
- UQMBQHJJTYPOOS-UHFFFAOYSA-N ethyl 3-sulfanylidene-2,5,7,8-tetrahydropyrido[4,3-c]pyridazine-6-carboxylate Chemical compound N1=C(S)C=C2CN(C(=O)OCC)CCC2=N1 UQMBQHJJTYPOOS-UHFFFAOYSA-N 0.000 description 1
- LUBGFMZTGFXIIN-UHFFFAOYSA-N ethyl 4-oxopiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(=O)CC1 LUBGFMZTGFXIIN-UHFFFAOYSA-N 0.000 description 1
- BOBUJEPCIKNLDK-UHFFFAOYSA-N ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2h-pyridine-1-carboxylate Chemical compound C1N(C(=O)OCC)CCC(N2CCCC2)=C1 BOBUJEPCIKNLDK-UHFFFAOYSA-N 0.000 description 1
- NYMNHILNJVJICH-UHFFFAOYSA-N ethyl 8-methyl-3-oxo-2,4,4a,5,7,8-hexahydropyrido[4,3-c]pyridazine-6-carboxylate Chemical compound N1C(=O)CC2CN(C(=O)OCC)CC(C)C2=N1 NYMNHILNJVJICH-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000003517 fume Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000009940 knitting Methods 0.000 description 1
- SIABDLGPVODQRN-UHFFFAOYSA-N lancin Natural products COC1CC(OC2C(C)OC(CC2OC)OC3CCC4(C)C5C(O)C(O)C6(C)C(CCC6(O)C5(O)CC=C4C3)C(C)O)OC(C)C1O SIABDLGPVODQRN-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- OHZZTXYKLXZFSZ-UHFFFAOYSA-I manganese(3+) 5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(1-methylpyridin-4-ylidene)porphyrin-22-ide pentachloride Chemical compound [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Mn+3].C1=CN(C)C=CC1=C1C(C=C2)=NC2=C(C=2C=C[N+](C)=CC=2)C([N-]2)=CC=C2C(C=2C=C[N+](C)=CC=2)=C(C=C2)N=C2C(C=2C=C[N+](C)=CC=2)=C2N=C1C=C2 OHZZTXYKLXZFSZ-UHFFFAOYSA-I 0.000 description 1
- FCMAEEWDOKAVHX-UHFFFAOYSA-N methyl 3-chloro-7,8-dihydro-5h-pyrido[4,3-c]pyridazine-6-carboxylate Chemical compound N1=C(Cl)C=C2CN(C(=O)OC)CCC2=N1 FCMAEEWDOKAVHX-UHFFFAOYSA-N 0.000 description 1
- AECDBUSGGXPLIT-UHFFFAOYSA-N methyl 4-pyrrolidin-1-yl-3,6-dihydro-2h-pyridine-1-carboxylate Chemical compound C1N(C(=O)OC)CCC(N2CCCC2)=C1 AECDBUSGGXPLIT-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- MQWCXKGKQLNYQG-UHFFFAOYSA-N methyl cyclohexan-4-ol Natural products CC1CCC(O)CC1 MQWCXKGKQLNYQG-UHFFFAOYSA-N 0.000 description 1
- ITMAHDJHOXDZEL-UHFFFAOYSA-N methyl pyridazine-3-carboxylate Chemical compound COC(=O)C1=CC=CN=N1 ITMAHDJHOXDZEL-UHFFFAOYSA-N 0.000 description 1
- JJXWKXZOHOUFCX-UHFFFAOYSA-N methylhydrazine;hydrate Chemical compound O.CNN JJXWKXZOHOUFCX-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- XNLBCXGRQWUJLU-UHFFFAOYSA-N naphthalene-2-carbonyl chloride Chemical compound C1=CC=CC2=CC(C(=O)Cl)=CC=C21 XNLBCXGRQWUJLU-UHFFFAOYSA-N 0.000 description 1
- 125000005441 o-toluyl group Chemical group [H]C1=C([H])C(C(*)=O)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- SXZRICDQKOATLA-UHFFFAOYSA-N phenyl 3-chloro-7,8-dihydro-5h-pyrido[4,3-c]pyridazine-6-carboxylate Chemical compound C1CC=2N=NC(Cl)=CC=2CN1C(=O)OC1=CC=CC=C1 SXZRICDQKOATLA-UHFFFAOYSA-N 0.000 description 1
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 1
- DMXRLIIYJBKMPW-UHFFFAOYSA-N phenyl-(3-sulfanylidene-2,5,7,8-tetrahydropyrido[4,3-c]pyridazin-6-yl)methanone Chemical compound C1CC=2N=NC(S)=CC=2CN1C(=O)C1=CC=CC=C1 DMXRLIIYJBKMPW-UHFFFAOYSA-N 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- CAEWJEXPFKNBQL-UHFFFAOYSA-N prop-2-enyl carbonochloridate Chemical compound ClC(=O)OCC=C CAEWJEXPFKNBQL-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- YRUFRSUZZACWCW-UHFFFAOYSA-N pyridazine-3-carbaldehyde Chemical compound O=CC1=CC=CN=N1 YRUFRSUZZACWCW-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000009751 slip forming Methods 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- LPWCRLGKYWVLHQ-UHFFFAOYSA-N tetradecanoyl chloride Chemical compound CCCCCCCCCCCCCC(Cl)=O LPWCRLGKYWVLHQ-UHFFFAOYSA-N 0.000 description 1
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical class SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/06—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with radicals, containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D211/74—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D211/74—Oxygen atoms
- C07D211/76—Oxygen atoms attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/02—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements
- C07D295/027—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements containing only one hetero ring
- C07D295/033—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements containing only one hetero ring with the ring nitrogen atoms directly attached to carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH695271A CH547808A (de) | 1971-05-11 | 1971-05-11 | Verfahren zur herstellung neuer cycloalkan(c)pyridazine. |
| CH695171A CH547807A (de) | 1971-05-11 | 1971-05-11 | Verfahren zur herstellung neuer cycloalkan(c)pyridazine. |
| CH767971A CH547813A (de) | 1971-05-26 | 1971-05-26 | Verfahren zur herstellung neuer pyrido (4,3-c)pyridazine. |
| CH768371A CH547814A (de) | 1971-05-26 | 1971-05-26 | Verfahren zur herstellung neuer pyrido (4,3-c)pyridazine. |
| CH784971A CH553201A (de) | 1971-05-26 | 1971-05-28 | Verfahren zur herstellung neuer pyrido (4,3-c)pyridazinderivate. |
| CH784871A CH551433A (de) | 1971-05-26 | 1971-05-28 | Verfahren zur herstellung neuer 3-hydrazino-5,6,7,8-tetrahydropyrido (4,3-c)pyridazin-derivate. |
| CH1512071A CH555350A (de) | 1971-05-26 | 1971-10-15 | Verfahren zur herstellung neuer 3-hydrazinopyrido(4,3c)-pyridazine. |
| CH1512171A CH555841A (de) | 1971-05-26 | 1971-10-15 | Verfahren zur herstellung neuer 3-hydrazinopyrido-(4,3c)pyridazine. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL81827B1 true PL81827B1 (env) | 1975-10-31 |
Family
ID=27570368
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1972155270A PL81827B1 (env) | 1971-05-11 | 1972-05-09 |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US3838125A (env) |
| JP (1) | JPS5750791B1 (env) |
| AU (1) | AU472726B2 (env) |
| BE (1) | BE783219A (env) |
| CA (1) | CA943542A (env) |
| DD (1) | DD97418A5 (env) |
| DK (1) | DK139625B (env) |
| FI (1) | FI55343C (env) |
| GB (2) | GB1392474A (env) |
| HU (1) | HU168682B (env) |
| IE (1) | IE36710B1 (env) |
| IL (1) | IL39392A (env) |
| NL (1) | NL176565C (env) |
| NO (1) | NO136251C (env) |
| PL (1) | PL81827B1 (env) |
| SE (1) | SE400557B (env) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE400557B (sv) * | 1971-05-11 | 1978-04-03 | Sandoz Ag | Forfarande for framstellning av nya kondenserade pyridaziner |
| FI224574A7 (env) * | 1973-08-02 | 1975-02-03 | Sandoz Ag | |
| SE418800B (sv) * | 1975-11-13 | 1981-06-29 | Sandoz Ag | Forfarande for framstellning av nya antihypertensiva preparat |
| US4277472A (en) * | 1978-11-10 | 1981-07-07 | Byk Gulden Lomberg Chemische Fabrik Gmbh | 3,6-Disubstituted-5,7-(lower alkano)-5,6,7,8-tetrahydropyrido(4,3-C)pyridazines; their intermediates, preparation, antihypertensive use and compositions |
| US4473574A (en) * | 1982-02-01 | 1984-09-25 | Sandoz Ltd. | Prophylaxis of arterial disease |
| US6176240B1 (en) | 1995-06-07 | 2001-01-23 | Conceptus, Inc. | Contraceptive transcervical fallopian tube occlusion devices and their delivery |
| US6705323B1 (en) | 1995-06-07 | 2004-03-16 | Conceptus, Inc. | Contraceptive transcervical fallopian tube occlusion devices and methods |
| TW432073B (en) * | 1995-12-28 | 2001-05-01 | Pfizer | Pyrazolopyridine compounds |
| US6825196B2 (en) * | 2002-03-05 | 2004-11-30 | Barbeau Pharma, Inc. | Stable pharmaceutical compositions |
| US6821974B2 (en) * | 2002-03-05 | 2004-11-23 | Barbeau Pharma, Inc | Stable pharmaceutical compositions |
| CN102911173A (zh) * | 2012-11-08 | 2013-02-06 | 苏州施亚生物科技有限公司 | 5,6,7,8-四氢-2H-吡啶并[4,3-c]哒嗪-3-酮的合成方法 |
| CN106905315B (zh) * | 2017-03-02 | 2019-09-27 | 北京工业大学 | 四氢吡啶并[3,4-d]嘧啶类化合物及其制备方法和应用 |
| KR102452296B1 (ko) | 2018-07-10 | 2022-10-06 | 고쿠리츠켄큐카이하츠호진 상교기쥬츠 소고켄큐쇼 | 적층 구조체 및 그 제조 방법 그리고 반도체 디바이스 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE400557B (sv) * | 1971-05-11 | 1978-04-03 | Sandoz Ag | Forfarande for framstellning av nya kondenserade pyridaziner |
-
1972
- 1972-05-02 SE SE7205731A patent/SE400557B/xx unknown
- 1972-05-02 DK DK217572AA patent/DK139625B/da not_active IP Right Cessation
- 1972-05-02 FI FI1245/72A patent/FI55343C/fi active
- 1972-05-02 NO NO1533/72A patent/NO136251C/no unknown
- 1972-05-05 GB GB2106072A patent/GB1392474A/en not_active Expired
- 1972-05-05 GB GB4572274A patent/GB1392475A/en not_active Expired
- 1972-05-08 US US00251035A patent/US3838125A/en not_active Expired - Lifetime
- 1972-05-09 IL IL39392A patent/IL39392A/en unknown
- 1972-05-09 BE BE783219A patent/BE783219A/xx not_active IP Right Cessation
- 1972-05-09 PL PL1972155270A patent/PL81827B1/pl unknown
- 1972-05-09 IE IE617/72A patent/IE36710B1/xx unknown
- 1972-05-09 DD DD162838A patent/DD97418A5/xx unknown
- 1972-05-09 HU HUSA2354A patent/HU168682B/hu unknown
- 1972-05-10 JP JP47046266A patent/JPS5750791B1/ja active Pending
- 1972-05-10 AU AU42135/72A patent/AU472726B2/en not_active Expired
- 1972-05-10 CA CA141,760A patent/CA943542A/en not_active Expired
- 1972-05-12 NL NLAANVRAGE7206477,A patent/NL176565C/xx not_active IP Right Cessation
-
1979
- 1979-04-13 US US06/029,892 patent/US4478837A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DK139625B (da) | 1979-03-19 |
| US3838125A (en) | 1974-09-24 |
| GB1392474A (en) | 1975-04-30 |
| AU472726B2 (en) | 1976-06-03 |
| DD97418A5 (env) | 1973-05-05 |
| NL176565C (nl) | 1985-05-01 |
| AU4213572A (en) | 1973-11-15 |
| NL176565B (nl) | 1984-12-03 |
| GB1392475A (en) | 1975-04-30 |
| IE36710B1 (en) | 1977-02-02 |
| FI55343C (fi) | 1979-07-10 |
| HU168682B (env) | 1976-06-28 |
| IE36710L (en) | 1972-11-11 |
| NL7206477A (env) | 1972-11-14 |
| US4478837A (en) | 1984-10-23 |
| NO136251C (no) | 1977-08-10 |
| IL39392A0 (en) | 1972-07-26 |
| DK139625C (env) | 1979-09-03 |
| JPS5750791B1 (env) | 1982-10-28 |
| BE783219A (fr) | 1972-11-09 |
| IL39392A (en) | 1977-10-31 |
| SE400557B (sv) | 1978-04-03 |
| FI55343B (fi) | 1979-03-30 |
| CA943542A (en) | 1974-03-12 |
| NO136251B (env) | 1977-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU678434B2 (en) | Imidazopyridines and their use in treating gastrointestinal diseases | |
| EP0086422B1 (en) | Pharmacologically active pyrazolo(4,3-c)pyridines | |
| US4133885A (en) | Substituted naphthyridinones | |
| PL81827B1 (env) | ||
| NO156385B (no) | Anordning for laasing av dreibare maskinelementer. | |
| DE69713255T2 (de) | Pharmazeutische Pyridin-Derivate, ihre Herstellungsverfahren und Zwischenprodukte dafür | |
| US3993656A (en) | 1,8-Naphthyridine compounds | |
| CZ284896A3 (en) | Novel hydroxypyridinones, process of their preparation and pharmaceutical composition in which such hydroxypyridinones are comprised | |
| US4219649A (en) | Pyrido[1,2-a]pyrimidine derivatives | |
| PL89008B1 (env) | ||
| PL85030B1 (env) | ||
| PL109346B1 (en) | Method of producing new derivatives of recemic eventually optically active condensed pyrimidines | |
| US3951980A (en) | 3-Substituted-8-methyl-3,8-diazabicyclo[3.2.1]octanes | |
| GB1600969A (en) | Heterocyclic compounds | |
| US4420615A (en) | Substituted pyridopyrimidines as gastric secretion inhibitors | |
| PL80193B1 (env) | ||
| US4447361A (en) | Aryl substituted pyrido[1,4]benzodiazepines | |
| EP0041359A1 (en) | Process for the preparation of heterocyclylalkyl guanidines; intermediates and their preparation | |
| EP0066628B1 (en) | Pyridine derivatives | |
| PL69663B1 (env) | ||
| NO164596B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazokinolinderivater. | |
| NO165248B (no) | Kammervegg for anvendelse i en konverter for behandling av stoepejernsmelter. | |
| PL119517B1 (en) | Process for preparing novel,condensed pyrimidine derivatives with nodal nitrogen atompirimidina s central'nym atomom azota | |
| PL88941B1 (en) | Indolylacetic acid derivatives[us3812112a] | |
| US5001131A (en) | Pyridine derivatives |