PL81812B1 - - Google Patents
Download PDFInfo
- Publication number
- PL81812B1 PL81812B1 PL15043071A PL15043071A PL81812B1 PL 81812 B1 PL81812 B1 PL 81812B1 PL 15043071 A PL15043071 A PL 15043071A PL 15043071 A PL15043071 A PL 15043071A PL 81812 B1 PL81812 B1 PL 81812B1
- Authority
- PL
- Poland
- Prior art keywords
- nitrate
- explosives
- ammonium
- weight
- air
- Prior art date
Links
- 239000002360 explosive Substances 0.000 claims description 33
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 12
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 10
- 229910052760 oxygen Inorganic materials 0.000 claims description 10
- 239000001301 oxygen Substances 0.000 claims description 10
- 239000000463 material Substances 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 229910002651 NO3 Inorganic materials 0.000 claims description 7
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 7
- 239000003513 alkali Substances 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- 235000019270 ammonium chloride Nutrition 0.000 claims description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 4
- 108010010803 Gelatin Proteins 0.000 claims description 3
- 229920000159 gelatin Polymers 0.000 claims description 3
- 239000008273 gelatin Substances 0.000 claims description 3
- 235000019322 gelatine Nutrition 0.000 claims description 3
- 235000011852 gelatine desserts Nutrition 0.000 claims description 3
- 229910001484 inorganic perchlorate Inorganic materials 0.000 claims description 3
- 239000000843 powder Substances 0.000 claims description 3
- 230000001235 sensitizing effect Effects 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- VBIXEXWLHSRNKB-UHFFFAOYSA-N ammonium oxalate Chemical compound [NH4+].[NH4+].[O-]C(=O)C([O-])=O VBIXEXWLHSRNKB-UHFFFAOYSA-N 0.000 claims description 2
- 239000008187 granular material Substances 0.000 claims description 2
- 229910044991 metal oxide Inorganic materials 0.000 claims description 2
- 150000004706 metal oxides Chemical class 0.000 claims description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- 229910052700 potassium Inorganic materials 0.000 claims 1
- 239000011591 potassium Substances 0.000 claims 1
- 229910052708 sodium Inorganic materials 0.000 claims 1
- 239000011734 sodium Substances 0.000 claims 1
- 238000004880 explosion Methods 0.000 description 8
- -1 for example Chemical compound 0.000 description 7
- 235000013339 cereals Nutrition 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 235000013312 flour Nutrition 0.000 description 4
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 244000303965 Cyamopsis psoralioides Species 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical class O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- GLKRSFJCYTXIOF-UHFFFAOYSA-N 2-octadecylguanidine Chemical compound CCCCCCCCCCCCCCCCCCN=C(N)N GLKRSFJCYTXIOF-UHFFFAOYSA-N 0.000 description 1
- AXDJCCTWPBKUKL-UHFFFAOYSA-N 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydron;chloride Chemical compound Cl.C1=CC(=N)C(C)=CC1=C(C=1C=CC(N)=CC=1)C1=CC=C(N)C=C1 AXDJCCTWPBKUKL-UHFFFAOYSA-N 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 239000004604 Blowing Agent Substances 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- 244000007835 Cyamopsis tetragonoloba Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- REYJJPSVUYRZGE-UHFFFAOYSA-N Octadecylamine Chemical compound CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- LSHFIWNMHGCYRS-UHFFFAOYSA-N [O-][N+]([O-])=O.[O-][N+]([O-])=O.[OH4+2] Chemical compound [O-][N+]([O-])=O.[O-][N+]([O-])=O.[OH4+2] LSHFIWNMHGCYRS-UHFFFAOYSA-N 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- UQXKXGWGFRWILX-UHFFFAOYSA-N ethylene glycol dinitrate Chemical compound O=N(=O)OCCON(=O)=O UQXKXGWGFRWILX-UHFFFAOYSA-N 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000000691 measurement method Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- BRBAEHHXGZRCBK-UHFFFAOYSA-N pentrinitrol Chemical compound [O-][N+](=O)OCC(CO)(CO[N+]([O-])=O)CO[N+]([O-])=O BRBAEHHXGZRCBK-UHFFFAOYSA-N 0.000 description 1
- 229950006286 pentrinitrol Drugs 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Inorganic materials [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B23/00—Compositions characterised by non-explosive or non-thermic constituents
- C06B23/04—Compositions characterised by non-explosive or non-thermic constituents for cooling the explosion gases including antifouling and flash suppressing agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
- Curing Cements, Concrete, And Artificial Stone (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicinal Preparation (AREA)
- Air Bags (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702045020 DE2045020C3 (de) | 1970-09-11 | 1970-09-11 | Wettersprengstoffe mit erhöhter Energie |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL81812B1 true PL81812B1 (OSRAM) | 1975-08-30 |
Family
ID=5782198
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL15043071A PL81812B1 (OSRAM) | 1970-09-11 | 1971-09-09 |
Country Status (7)
| Country | Link |
|---|---|
| BE (1) | BE772471R (OSRAM) |
| CS (1) | CS160602B2 (OSRAM) |
| DE (1) | DE2045020C3 (OSRAM) |
| FR (1) | FR2107484A5 (OSRAM) |
| GB (1) | GB1321187A (OSRAM) |
| HU (1) | HU166081B (OSRAM) |
| PL (1) | PL81812B1 (OSRAM) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2263761C3 (de) * | 1972-12-28 | 1980-07-03 | Dynamit Nobel Ag, 5210 Troisdorf | Verwendung von Metallcarbonaten zur Gewährung der Schlagwettersicherheit von Sprengstoffen |
| ES2047408B1 (es) * | 1991-06-20 | 1994-09-01 | Espanola Explosivos | Preparacion de una composicion explosiva de seguridad tipo hidrogel. |
| DE4204442C1 (en) * | 1992-02-14 | 1993-08-19 | Wasagchemie Sythen Gmbh, 4358 Haltern, De | Explosive esp. permissible explosive - contg. fine high explosive powder and additive for safety in fire-damp, which is more powerful than nitroglycerin and esp. economical in coal mining |
| DE19539210A1 (de) * | 1995-10-21 | 1997-04-24 | Dynamit Nobel Ag | Löschkette zum Bekämpfen von Bränden |
| DE19546335A1 (de) * | 1995-12-12 | 1997-06-19 | Dynamit Nobel Ag | Wetteremulsionssprengstoffe |
| RU2318789C1 (ru) * | 2006-10-16 | 2008-03-10 | Общество с ограниченной ответственностью "ИФОХИМ" | Модификатор взрывчатых веществ |
| AU2011285992B2 (en) * | 2010-08-03 | 2016-02-11 | The Lubrizol Corporation | Ammonium nitrate fuel oil mixtures |
| CN102115352B (zh) * | 2010-12-28 | 2015-05-13 | 陕西省汉阴华能新材料研究有限公司 | 一种硝酸铵改性剂 |
| CN106905087B (zh) * | 2017-04-11 | 2019-03-08 | 浏阳市颐和隆烟花集团有限公司 | 一种烟花爆竹开包用钝感复合材料 |
| US12416619B2 (en) * | 2019-10-24 | 2025-09-16 | The European Union, Represented By The European Commission | Simulant composition of an explosive compound |
-
1970
- 1970-09-11 DE DE19702045020 patent/DE2045020C3/de not_active Expired
-
1971
- 1971-09-03 CS CS633071A patent/CS160602B2/cs unknown
- 1971-09-09 FR FR7132606A patent/FR2107484A5/fr not_active Expired
- 1971-09-09 PL PL15043071A patent/PL81812B1/pl unknown
- 1971-09-10 BE BE772471A patent/BE772471R/xx not_active IP Right Cessation
- 1971-09-10 GB GB4242271A patent/GB1321187A/en not_active Expired
- 1971-09-11 HU HUDI000213 patent/HU166081B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2045020C3 (de) | 1980-04-30 |
| BE772471R (fr) | 1972-01-17 |
| DE2045020A1 (de) | 1972-05-10 |
| HU166081B (OSRAM) | 1975-01-28 |
| CS160602B2 (OSRAM) | 1975-03-28 |
| DE2045020B2 (de) | 1979-08-16 |
| FR2107484A5 (OSRAM) | 1972-05-05 |
| GB1321187A (en) | 1973-06-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL81812B1 (OSRAM) | ||
| US3640784A (en) | Blasting agents containing guar gum | |
| RU2086524C1 (ru) | Взрывчатый состав и способ его изготовления | |
| US3331717A (en) | Inorganic oxidizer blasting slurry containing smokeless powder and aluminum | |
| US3496040A (en) | Aqueous ammonium nitrate slurry explosive compositions containing hexamethylenetetramine | |
| RU2122990C1 (ru) | Пороховой взрывчатый состав | |
| US3160535A (en) | Free flowing granular explosive composition of controlled particle size | |
| JPH06144982A (ja) | 火工用遅発組成物 | |
| US2613146A (en) | Unsheathed safety explosive composition | |
| US3839107A (en) | Calcium nitrate explosive composition | |
| FI64570C (fi) | Pulverformig detonationskaenslig spraengaemnesblandning | |
| US5151138A (en) | Blasting composition and method | |
| US3457126A (en) | Aqueous explosive composition containing a porous water insoluble synthetic organic polymeric cellular material | |
| RU2243200C2 (ru) | Водосодержащий взрывчатый состав | |
| US3096223A (en) | Slurry blasting explosives containing inorganic prechlorate or chlorate | |
| US4424087A (en) | Method for desensitizing particle formed solid explosive substances | |
| US3124495A (en) | Explosive compositions | |
| KR19990013823A (ko) | 마이크로벌룬이 있는 주조 폭약조성물 | |
| US3378417A (en) | Explosive composition containing inorganic nitrate salt of particular size distribution | |
| US3357873A (en) | Explosive composition comprising a nitric acid ester of a polyvalent alcohol and theternary salt mixture of ammonium chloride, an alkali nitrate, and an alkaline earth carbonate | |
| PL93162B1 (OSRAM) | ||
| JP2000178093A (ja) | 油中水滴型エマルション爆薬組成物 | |
| CA1101675A (en) | Explosive blasting compositions | |
| US3090713A (en) | Composition of matter in the nature of an explosive | |
| RU2237645C1 (ru) | Взрывчатый состав |