PL81357B1 - - Google Patents
Download PDFInfo
- Publication number
- PL81357B1 PL81357B1 PL14333470A PL14333470A PL81357B1 PL 81357 B1 PL81357 B1 PL 81357B1 PL 14333470 A PL14333470 A PL 14333470A PL 14333470 A PL14333470 A PL 14333470A PL 81357 B1 PL81357 B1 PL 81357B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- methyl
- tetrahydro
- compound
- indeno
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 43
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 41
- -1 methoxy, methylthio Chemical group 0.000 claims description 39
- 238000000034 method Methods 0.000 claims description 22
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 16
- 239000002904 solvent Substances 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 14
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 10
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 229960000583 acetic acid Drugs 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 239000012362 glacial acetic acid Substances 0.000 claims description 3
- FDWJXKVIOJHRNJ-UHFFFAOYSA-N 5-methyl-2,3,4,9b-tetrahydro-1h-indeno[1,2-c]pyridine Chemical compound C12=CC=CC=C2C(C)=C2C1CNCC2 FDWJXKVIOJHRNJ-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 238000006683 Mannich reaction Methods 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 2
- 150000003254 radicals Chemical class 0.000 claims 2
- HVVXCLMUSGOZNO-UHFFFAOYSA-N 4-bromobutan-2-one Chemical compound CC(=O)CCBr HVVXCLMUSGOZNO-UHFFFAOYSA-N 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 52
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 34
- 238000002844 melting Methods 0.000 description 31
- 230000008018 melting Effects 0.000 description 31
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- 239000000203 mixture Substances 0.000 description 26
- 239000000243 solution Substances 0.000 description 25
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- 238000000354 decomposition reaction Methods 0.000 description 20
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 18
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 16
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 11
- 238000003756 stirring Methods 0.000 description 10
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 9
- 235000019341 magnesium sulphate Nutrition 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 229910000027 potassium carbonate Inorganic materials 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 230000016571 aggressive behavior Effects 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 229930040373 Paraformaldehyde Natural products 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 238000002955 isolation Methods 0.000 description 4
- 229920002866 paraformaldehyde Polymers 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 230000003111 delayed effect Effects 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridine hydrochloride Substances [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 3
- UYBJPGNUFBESQK-UHFFFAOYSA-N 1-(4-methoxyphenyl)-3-(5-methyl-1,3,4,9b-tetrahydroindeno[1,2-c]pyridin-2-yl)propan-1-one Chemical compound COC1=CC=C(C=C1)C(CCN1CC2C(CC1)=C(C1=CC=CC=C12)C)=O UYBJPGNUFBESQK-UHFFFAOYSA-N 0.000 description 2
- ZGHFDIIVVIFNPS-UHFFFAOYSA-N 3-Methyl-3-buten-2-one Chemical compound CC(=C)C(C)=O ZGHFDIIVVIFNPS-UHFFFAOYSA-N 0.000 description 2
- SUOHHUITLLBKKX-UHFFFAOYSA-N 4,4-dimethyl-1-(5-methyl-1,3,4,9b-tetrahydroindeno[1,2-c]pyridin-2-yl)pentan-3-one Chemical compound CC=1C2=CC=CC=C2C2CN(CCC21)CCC(C(C)(C)C)=O SUOHHUITLLBKKX-UHFFFAOYSA-N 0.000 description 2
- WBOBBFXICHVHHM-UHFFFAOYSA-N 4-(5-methyl-1,3,4,9b-tetrahydroindeno[1,2-c]pyridin-2-yl)butan-2-one Chemical compound C1=CC=C2C(CN(CCC(=O)C)CC3)C3=C(C)C2=C1 WBOBBFXICHVHHM-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RKGIYUMBCGWTBM-UHFFFAOYSA-N Cl.CC=1C2=CC=CC=C2C2CNCCC21 Chemical compound Cl.CC=1C2=CC=CC=C2C2CNCCC21 RKGIYUMBCGWTBM-UHFFFAOYSA-N 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 208000020016 psychiatric disease Diseases 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- BDCOKHXLVNSXLR-UHFFFAOYSA-N 1-(4-chlorophenyl)-2-(5-methyl-1,3,4,9b-tetrahydroindeno[1,2-c]pyridin-2-yl)ethanone Chemical compound ClC1=CC=C(C(CN2CC3C(CC2)=C(C2=CC=CC=C23)C)=O)C=C1 BDCOKHXLVNSXLR-UHFFFAOYSA-N 0.000 description 1
- ZDPAWHACYDRYIW-UHFFFAOYSA-N 1-(4-fluorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(F)C=C1 ZDPAWHACYDRYIW-UHFFFAOYSA-N 0.000 description 1
- MTCZLOYLYXSWHI-UHFFFAOYSA-N 1-(5-methyl-1,3,4,9b-tetrahydroindeno[1,2-c]pyridin-2-yl)pentan-3-one Chemical compound CC=1C2=CC=CC=C2C2CN(CCC21)CCC(CC)=O MTCZLOYLYXSWHI-UHFFFAOYSA-N 0.000 description 1
- DGYALEVANYNOIV-UHFFFAOYSA-N 1-(5-methyl-1,3,4,9b-tetrahydroindeno[1,2-c]pyridin-2-yl)propan-2-one hydrochloride Chemical compound Cl.C(C(=O)C)N1CC2C(CC1)=C(C1=CC=CC=C12)C DGYALEVANYNOIV-UHFFFAOYSA-N 0.000 description 1
- ZLJOWTOCICOVLU-UHFFFAOYSA-N 1-cyclopentyl-3-(5-methyl-1,3,4,9b-tetrahydroindeno[1,2-c]pyridin-2-yl)propan-1-one Chemical compound C1(CCCC1)C(CCN1CC2C(CC1)=C(C1=CC=CC=C12)C)=O ZLJOWTOCICOVLU-UHFFFAOYSA-N 0.000 description 1
- JNDQHYUJKITBRY-UHFFFAOYSA-N 2,5-dimethyl-1,3,4,9b-tetrahydroindeno[1,2-c]pyridine Chemical compound C1=CC=C2C(CN(C)CC3)C3=C(C)C2=C1 JNDQHYUJKITBRY-UHFFFAOYSA-N 0.000 description 1
- YAFLNMURVGKVIC-UHFFFAOYSA-N 2,5-dimethyl-2,3,4,9b-tetrahydro-1H-indeno[1,2-c]pyridin-2-ium chloride Chemical compound Cl.CN1CC2C(CC1)=C(C1=CC=CC=C12)C YAFLNMURVGKVIC-UHFFFAOYSA-N 0.000 description 1
- FWWOWPGPERBCNJ-UHFFFAOYSA-N 2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid Chemical compound OCCOC(=O)CC(O)C(O)=O FWWOWPGPERBCNJ-UHFFFAOYSA-N 0.000 description 1
- HDZOQKGVGIJWGO-UHFFFAOYSA-N 2H-indeno[1,2-c]pyridin-1-ol Chemical compound C=1(NC=CC=2C1C1=CC=CC=C1C2)O HDZOQKGVGIJWGO-UHFFFAOYSA-N 0.000 description 1
- SVCFFBMBIBMUQQ-UHFFFAOYSA-N 2h-indeno[1,2-c]pyridine Chemical class N1C=CC2=CC3=CC=CC=C3C2=C1 SVCFFBMBIBMUQQ-UHFFFAOYSA-N 0.000 description 1
- RWRFLPMEBZARHN-UHFFFAOYSA-N 3-(5-methyl-1,3,4,9b-tetrahydroindeno[1,2-c]pyridin-2-yl)-1-(3-methylphenyl)propan-1-one Chemical compound CC=1C2=CC=CC=C2C2CN(CCC21)CCC(C=2C=C(C=CC2)C)=O RWRFLPMEBZARHN-UHFFFAOYSA-N 0.000 description 1
- SODWOFXPVXKFRM-UHFFFAOYSA-N 3-chloropropylcyclopentane Chemical compound ClCCCC1CCCC1 SODWOFXPVXKFRM-UHFFFAOYSA-N 0.000 description 1
- ZGDPKOGLUPSFBT-UHFFFAOYSA-N 5-(5-methyl-1,3,4,9b-tetrahydroindeno[1,2-c]pyridin-2-yl)pentan-2-one Chemical compound C1=CC=C2C(CN(CCCC(=O)C)CC3)C3=C(C)C2=C1 ZGDPKOGLUPSFBT-UHFFFAOYSA-N 0.000 description 1
- CMXNFXBFNYHFAL-UHFFFAOYSA-N 5-methylhex-1-en-3-one Chemical compound CC(C)CC(=O)C=C CMXNFXBFNYHFAL-UHFFFAOYSA-N 0.000 description 1
- KQGVXJCUVALSKR-UHFFFAOYSA-N CN1CC2C(CC1)C(C1=CC=CC=C12)(O)C Chemical compound CN1CC2C(CC1)C(C1=CC=CC=C12)(O)C KQGVXJCUVALSKR-UHFFFAOYSA-N 0.000 description 1
- AWYKXVFGYKSHFI-UHFFFAOYSA-N COC1=CC=C(C(CN2CC3C(CC2)=C(C2=CC=CC=C23)C)=O)C=C1 Chemical compound COC1=CC=C(C(CN2CC3C(CC2)=C(C2=CC=CC=C23)C)=O)C=C1 AWYKXVFGYKSHFI-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- IUJDSEJGGMCXSG-UHFFFAOYSA-N Thiopental Chemical compound CCCC(C)C1(CC)C(=O)NC(=S)NC1=O IUJDSEJGGMCXSG-UHFFFAOYSA-N 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- VXXUUWYSBMZPEU-UHFFFAOYSA-N dimethyl(2-phenylethyl)azanium;hydroxide Chemical compound [OH-].C[NH+](C)CCC1=CC=CC=C1 VXXUUWYSBMZPEU-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-M fumarate(1-) Chemical compound OC(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-M 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 230000037023 motor activity Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 229940043200 pentothal Drugs 0.000 description 1
- 208000022821 personality disease Diseases 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- PJGSXYOJTGTZAV-UHFFFAOYSA-N pinacolone Chemical compound CC(=O)C(C)(C)C PJGSXYOJTGTZAV-UHFFFAOYSA-N 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- XTUSEBKMEQERQV-UHFFFAOYSA-N propan-2-ol;hydrate Chemical compound O.CC(C)O XTUSEBKMEQERQV-UHFFFAOYSA-N 0.000 description 1
- 239000004089 psychotropic agent Substances 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1431769A CH517745A (de) | 1969-09-23 | 1969-09-23 | Verfahren zur Herstellung neuer Indenopyridinderivate |
| CH607870 | 1970-04-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL81357B1 true PL81357B1 (de) | 1975-08-30 |
Family
ID=25698937
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL14333470A PL81357B1 (de) | 1969-09-23 | 1970-09-21 |
Country Status (2)
| Country | Link |
|---|---|
| AT (1) | AT314537B (de) |
| PL (1) | PL81357B1 (de) |
-
1970
- 1970-09-21 PL PL14333470A patent/PL81357B1/pl unknown
- 1970-09-22 AT AT855470A patent/AT314537B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AT314537B (de) | 1974-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0658559A1 (de) | Thienothiazinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als 5-dipoxygenase und Cyclooxygenaseinhibitoren | |
| PL124063B1 (en) | Process for preparing novel derivatives of 5h-2,3-benzodiazepine | |
| PL79435B1 (en) | Certain pyridyl-1 2 4-oxadiazole derivatives[us3647809a] | |
| US3993656A (en) | 1,8-Naphthyridine compounds | |
| CS264300B2 (cs) | Způsob výroby nových dihydrobenzcfuran- a -ehroman-karboxamidů | |
| CA1127165A (en) | Dibenzothiepin derivatives and a process for producing the same | |
| US3843663A (en) | 1,8-naphthyridine compounds | |
| AU596869B2 (en) | 2-(thio-linked)-pyridine-5-(4,5-dihydro-2-oxazolyl)-(thieno( 2,3-d)-imidazoles and -benzimidazoles), a process for their preparation, and their use | |
| PL106659B1 (pl) | Sposob wytwarzania nowych pochodnych pirazolo/1,5-c/chinazoliny | |
| US3408353A (en) | 1, 3, 4, 9b-tetrahydro-2h-indeno(1, 2-c)pyridine derivatives | |
| US4163785A (en) | Benzothiazepine compounds and compositions | |
| PL81357B1 (de) | ||
| CZ129693A3 (en) | Novel thienothiazine derivatives, process of their preparation and pharmaceutical preparations in which they are comprised | |
| HU179391B (en) | Process for producing thiasolo-square bracket-2,3-b-square bracket closed-quinasoline derivatives | |
| US3960847A (en) | 9-Substituted-4-oxopyrido(1,2-α)pyrimidine-3-carboxylic acids and derivatives thereof | |
| HU187572B (en) | Process for preparing 1,5-diphenyl-pyrazolin-3-one derivatives | |
| US3842087A (en) | 1,8-naphthyridine compounds | |
| US3962262A (en) | 1,8-naphthyridine compounds | |
| PL91000B1 (en) | Process for the manufacture of indole derivatives [gb1407658a] | |
| USRE28939E (en) | 3-Aminoindazole derivatives | |
| GB1561521A (en) | 3,4 - dihydro - 3 - oxo - 4-carbamoyl - 2h - thieno (2,3 - e) - 1 - 2-thiazine 1,1 - dioxide derivatives | |
| US4031103A (en) | 1,8-Naphthyridine compounds | |
| US3542777A (en) | Derivatives of 9-pyridylalkyl-1,2,8,9-tetraazaphenalenes | |
| CZ357190A3 (en) | Dihydropyrimidothiazine derivatives, process of their preparation and pharmaceutical compositions containing thereof | |
| EP0093515B1 (de) | Tricyclische Triazino-Verbindungen, ihre Verwendung als Arzneimittel und ihre Herstellung |