PL67969B1 - - Google Patents
Download PDFInfo
- Publication number
- PL67969B1 PL67969B1 PL125819A PL12581968A PL67969B1 PL 67969 B1 PL67969 B1 PL 67969B1 PL 125819 A PL125819 A PL 125819A PL 12581968 A PL12581968 A PL 12581968A PL 67969 B1 PL67969 B1 PL 67969B1
- Authority
- PL
- Poland
- Prior art keywords
- parts
- dodecylamine
- decylamine
- carbon atoms
- dichlorobenzylidene
- Prior art date
Links
- -1 nitro, amino, hydroxyl Chemical group 0.000 claims description 29
- 239000004480 active ingredient Substances 0.000 claims description 22
- 150000001875 compounds Chemical class 0.000 claims description 11
- 239000000969 carrier Substances 0.000 claims description 10
- 239000000417 fungicide Substances 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 230000000855 fungicidal effect Effects 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000004984 dialkylaminoalkoxy group Chemical group 0.000 claims 1
- 125000005031 thiocyano group Chemical group S(C#N)* 0.000 claims 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- 241000196324 Embryophyta Species 0.000 description 13
- 241000233866 Fungi Species 0.000 description 10
- 239000013543 active substance Substances 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 239000008187 granular material Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000000843 powder Substances 0.000 description 7
- 239000000377 silicon dioxide Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 5
- 235000019738 Limestone Nutrition 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 239000000378 calcium silicate Substances 0.000 description 5
- 229910052918 calcium silicate Inorganic materials 0.000 description 5
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 5
- 230000035784 germination Effects 0.000 description 5
- 239000006028 limestone Substances 0.000 description 5
- 239000006072 paste Substances 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 235000012222 talc Nutrition 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- 239000005995 Aluminium silicate Substances 0.000 description 4
- 235000012211 aluminium silicate Nutrition 0.000 description 4
- 229910052791 calcium Inorganic materials 0.000 description 4
- 239000011575 calcium Substances 0.000 description 4
- 235000013339 cereals Nutrition 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 238000010410 dusting Methods 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- MHZGKXUYDGKKIU-UHFFFAOYSA-N Decylamine Chemical compound CCCCCCCCCCN MHZGKXUYDGKKIU-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- CDFPXALLOJLBDX-UHFFFAOYSA-N 2,3-dibutylnaphthalene-1-sulfonic acid;sodium Chemical compound [Na].C1=CC=C2C(S(O)(=O)=O)=C(CCCC)C(CCCC)=CC2=C1 CDFPXALLOJLBDX-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000223194 Fusarium culmorum Species 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000002518 antifoaming agent Substances 0.000 description 2
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000004491 dispersible concentrate Substances 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 229940057995 liquid paraffin Drugs 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- CNAGQEQFRDQQPS-UHFFFAOYSA-N 1-(2-chloro-5-nitrophenyl)-n-dodecylmethanimine Chemical compound CCCCCCCCCCCCN=CC1=CC([N+]([O-])=O)=CC=C1Cl CNAGQEQFRDQQPS-UHFFFAOYSA-N 0.000 description 1
- VHHAWEPMGARVMC-UHFFFAOYSA-N 1-(4-chlorophenyl)-N-dodecylmethanimine Chemical compound ClC1=CC=C(C=NCCCCCCCCCCCC)C=C1 VHHAWEPMGARVMC-UHFFFAOYSA-N 0.000 description 1
- BPZQHNXAODJVIQ-UHFFFAOYSA-N 1-(4-methoxyphenyl)-N-tetradecylmethanimine Chemical compound COC1=CC=C(C=NCCCCCCCCCCCCCC)C=C1 BPZQHNXAODJVIQ-UHFFFAOYSA-N 0.000 description 1
- ZFTPPUOJLFIBEQ-UHFFFAOYSA-N 4-(decyliminomethyl)-2,6-di(propan-2-yl)phenol Chemical compound C(C)(C)C=1C=C(C=NCCCCCCCCCC)C=C(C1O)C(C)C ZFTPPUOJLFIBEQ-UHFFFAOYSA-N 0.000 description 1
- ILRDZCFSHTTXGG-UHFFFAOYSA-N 4-(dodecyliminomethyl)-n,n-dimethylaniline Chemical compound CCCCCCCCCCCCN=CC1=CC=C(N(C)C)C=C1 ILRDZCFSHTTXGG-UHFFFAOYSA-N 0.000 description 1
- JCMAVTLVSODPEH-UHFFFAOYSA-N 9-phenylnon-8-en-1-amine Chemical compound NCCCCCCCC=CC1=CC=CC=C1 JCMAVTLVSODPEH-UHFFFAOYSA-N 0.000 description 1
- 241000223602 Alternaria alternata Species 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 241001312183 Coniothyrium Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000235395 Mucor Species 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- OATYZUXEPOSZOX-UHFFFAOYSA-N OC1=C(C=NCCCCCCCC)C=C(C=C1Cl)Cl Chemical compound OC1=C(C=NCCCCCCCC)C=C(C=C1Cl)Cl OATYZUXEPOSZOX-UHFFFAOYSA-N 0.000 description 1
- 241000228143 Penicillium Species 0.000 description 1
- 241001674048 Phthiraptera Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000371621 Stemphylium Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241000722093 Tilletia caries Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000012296 anti-solvent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 239000001175 calcium sulphate Substances 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 239000007931 coated granule Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 235000012245 magnesium oxide Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- ZEJACTIBVANKAL-UHFFFAOYSA-N n,n-dimethyl-4-(octadecyliminomethyl)aniline Chemical compound CCCCCCCCCCCCCCCCCCN=CC1=CC=C(N(C)C)C=C1 ZEJACTIBVANKAL-UHFFFAOYSA-N 0.000 description 1
- WFHDABAZDRXINT-UHFFFAOYSA-N n-dodecyl-1-(4-methoxyphenyl)methanimine Chemical compound CCCCCCCCCCCCN=CC1=CC=C(OC)C=C1 WFHDABAZDRXINT-UHFFFAOYSA-N 0.000 description 1
- RRDJYGJOZRFVNY-UHFFFAOYSA-N n-dodecyl-1-phenylmethanimine Chemical compound CCCCCCCCCCCCN=CC1=CC=CC=C1 RRDJYGJOZRFVNY-UHFFFAOYSA-N 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000019814 powdered cellulose Nutrition 0.000 description 1
- 229920003124 powdered cellulose Polymers 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 125000004001 thioalkyl group Chemical group 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M thiocyanate group Chemical group [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL67969B1 true PL67969B1 (index.php) | 1972-12-30 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3063823A (en) | Method of killing weeds and influencing plant growth | |
| PL108983B1 (en) | Insecticidal agent | |
| PL159168B1 (pl) | Srodek grzybobójczy PL PL | |
| PL110263B1 (en) | Phytohormonal agent and a herbicide | |
| US4003735A (en) | Compositions and methods for reducing herbicidal injury | |
| US2424199A (en) | 1,3-epoxyarylofurazanes as parasiticidal preparations | |
| JPS6261583B2 (index.php) | ||
| US3697589A (en) | N-(4-carboxy-benzylidene)amines | |
| PL67969B1 (index.php) | ||
| KR920003209B1 (ko) | 살진균 조성물 | |
| US3972707A (en) | N-(phenylcarbamoyl)-4-methylpiperidine herbicides compositions and herbicidal method | |
| US2302384A (en) | Parasiticidal preparation | |
| GB781413A (en) | New ethers and thioethers and processes for their preparation | |
| EP0001328A1 (en) | Method and composition for combating weeds | |
| US2557520A (en) | Pesticidal compositions comprising an alkyl aryl sulfide | |
| US3751466A (en) | N-benzylidene alkylamines | |
| US3819609A (en) | Fungicidal-2-alkoxy-5-halogeno-benzene diazonium cyanides | |
| US2923658A (en) | Fungicidal compositions and methods employing p-chloro-omega-thiocyano acetyl benzene | |
| US4137332A (en) | 1-(Alkoxyphenyl)-5-(phenyl)biguanide compositions for use as agricultural fungicides | |
| JP2007063290A (ja) | 選択的除草性組成物 | |
| PL89203B1 (en) | 2-Chloro-N-(2'-methoxypropyl)- and 2-chloro-N-(2'-ethoxypropyl)-2'',6''-dimethyl-acetanilide as long term weed killers[US4412855A] | |
| US4185989A (en) | 3-Phenacyl phthaldide safening agents | |
| AT284544B (de) | Fungizides Mittel | |
| US3629252A (en) | 3-arylimino-4-chloro-5-amino-1 2-dithiols | |
| US3507963A (en) | Compositions and methods for controlling fungi with n-benzylidene alkylamines |