PL66626B1 - - Google Patents
Download PDFInfo
- Publication number
- PL66626B1 PL66626B1 PL128855A PL12885568A PL66626B1 PL 66626 B1 PL66626 B1 PL 66626B1 PL 128855 A PL128855 A PL 128855A PL 12885568 A PL12885568 A PL 12885568A PL 66626 B1 PL66626 B1 PL 66626B1
- Authority
- PL
- Poland
- Prior art keywords
- nitro
- acridine
- dialkylaminoalkylamino
- peroxy acids
- temperature below
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 7
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 claims description 4
- 150000004965 peroxy acids Chemical class 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 239000007800 oxidant agent Substances 0.000 claims description 2
- 150000002978 peroxides Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims 1
- 230000004071 biological effect Effects 0.000 claims 1
- 230000003647 oxidation Effects 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 5
- 206010028980 Neoplasm Diseases 0.000 description 3
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 230000001093 anti-cancer Effects 0.000 description 2
- 230000000259 anti-tumor effect Effects 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 1
- 108020005199 Dehydrogenases Proteins 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- KVHISFJMQMSZHQ-UHFFFAOYSA-N acridin-10-ium;chloride;hydrochloride Chemical compound Cl.[Cl-].C1=CC=CC2=CC3=CC=CC=C3[NH+]=C21 KVHISFJMQMSZHQ-UHFFFAOYSA-N 0.000 description 1
- 150000001251 acridines Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1526771A CH517097A (de) | 1968-08-31 | 1969-08-12 | Verfahren zur Herstellung neuer, biologisch aktiver 1-Nitro-9-(dialkylaminoalkyl)-akridin-N10,Nw-dioxide |
| CH1526671A CH524606A (de) | 1968-08-31 | 1969-08-12 | Verfahren zur Herstellung neuer, biologisch aktiver 1-Nitro-9-(dialkylaminoalkylamino)-akridin-Nw-oxide |
| CH1220469A CH517096A (de) | 1968-08-31 | 1969-08-12 | Verfahren zur Herstellung neuer, biologisch aktiver 1-Nitro-9-(dialkyl-aminoalkylamino)-akridin-N10-oxide |
| DE1942185A DE1942185C3 (de) | 1968-08-31 | 1969-08-19 | N-Oxide von l-Nitro-9-(dialkylaminoalkylamino)-acridinen |
| GB1231567D GB1231567A (https=) | 1968-08-31 | 1969-08-20 | |
| FR696928866A FR2022144B1 (https=) | 1968-08-31 | 1969-08-22 | |
| SU691364473A SU700518A1 (ru) | 1968-08-31 | 1969-08-28 | Способ получени -окиси 1-нитро-9-(диалкиламиналкиламин)-акридина |
| SU1474954A SU366194A1 (ru) | 1968-08-31 | 1969-08-28 | ВСЕрОЮЗНАЯ |
| SU1474955A SU363701A1 (ru) | 1968-08-31 | 1969-08-28 | Способ получения nio, n<^'—двуокисей 1-нитро-9- -(диалкиламиналкиламин)-акридина |
| US854608A US3694448A (en) | 1968-08-31 | 1969-09-02 | 1-nitro-9-(dialkylaminoalkylamino)acridine n{11 oxides |
| US00201946A US3838130A (en) | 1968-08-31 | 1971-11-24 | N10-oxides of 1-nitro-9-(dialkylamino-alkylamino)acridine |
| US403624A US3897435A (en) | 1968-08-31 | 1973-10-04 | N-oxides of 1 -nitro-9-dialkylaminoalkylamino/acridine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL66626B1 true PL66626B1 (https=) | 1972-08-31 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2200220C (en) | Drug for tumor growth suppression | |
| Wang et al. | Synthesis and evaluation of artesunate–indoloquinoline hybrids as antimalarial drug candidates | |
| HU217779B (hu) | O6-Helyettesített guaninszármazékok, ezeket tartalmazó gyógyászati készítmények, valamint eljárás e vegyületek előállítására | |
| US3438968A (en) | Substituted ammonium basic addition salts of ribonucleic acid | |
| Daniels et al. | Chemistry and biology of manganese carbon-releasing molecules containing thiosemicarbazone ligands | |
| Hussain et al. | Photo-induced DNA cleavage activity and remarkable photocytotoxicity of lanthanide (III) complexes of a polypyridyl ligand | |
| Hufford et al. | Assignments of dissociation constants of primaquine by 13C‐NMR spectroscopy | |
| Borchardt | Catechol O-methyltransferase. 4. In vitro inhibition by 3-hydroxy-4-pyrones, 3-hydroxy-2-pyridones, and 3-hydroxy-4-pyridones | |
| Akladios et al. | The evaluation of metal co-ordinating bis-thiosemicarbazones as potential anti-malarial agents | |
| PL66626B1 (https=) | ||
| US5508289A (en) | Bis-acridone chemotherapeutic derivatives | |
| Wang et al. | Synthesis and biological evaluation of ruthenium complexes bearing the 1, 2, 4-triazole group as potential membrane-targeting antibacterial agents towards Staphylococcus aureus | |
| Henke | Superoxide dismutase mimics as future therapeutics | |
| US3694448A (en) | 1-nitro-9-(dialkylaminoalkylamino)acridine n{11 oxides | |
| KARMARKAR et al. | Preparation of Nitrotetrazolium Salts Containing Benzothiazole1 | |
| US3829417A (en) | Imidazole substituted rifamycins | |
| RU2843184C1 (ru) | Фармацевтическая композиция на основе n-оксида пиридина и ее применение для покрытия медицинских стентов | |
| JP2001518878A (ja) | ピリミジンからの四環式誘導体 | |
| Tahaa et al. | Synthesis and characterization of a symmetrically substituted cyclodiphosph (V) azane ligand and its transition metal complexes for antimicrobial and antitumor investigation. | |
| Obaid et al. | Recent Development In Oxine Complexes And Their Medical Application: A Review. | |
| US3897435A (en) | N-oxides of 1 -nitro-9-dialkylaminoalkylamino/acridine | |
| US11459313B2 (en) | Aziridinyl and amino dimeric naphthoquinone compounds and use for acute myeloid leukemia | |
| KR20010114122A (ko) | 신규 퀴놀린디온 유도체, 이의 제조방법 및 이를 포함하는약학적 조성물 | |
| EP3070078B1 (en) | Asymmetric bis-acridines with antitumor activity and use thereof | |
| EP1473298A4 (en) | SUPERMELECULAR CARBOPLATIN DERIVATIVES, THEIR PREPARATION AND PHARMACEUTICAL COMPOSITIONS CONTAINING THE SAME AS ACTIVE AGENTS, AND APPLICATIONS OF THE COMPOSITIONS |