PL63103B1 - - Google Patents
Download PDFInfo
- Publication number
- PL63103B1 PL63103B1 PL114975A PL11497566A PL63103B1 PL 63103 B1 PL63103 B1 PL 63103B1 PL 114975 A PL114975 A PL 114975A PL 11497566 A PL11497566 A PL 11497566A PL 63103 B1 PL63103 B1 PL 63103B1
- Authority
- PL
- Poland
- Prior art keywords
- methoxy
- quinazoline
- reactions
- carried out
- water
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- GMZDJXMSEMUZMK-UHFFFAOYSA-N 4-amino-2-methoxy-N-quinazolin-2-ylbenzenesulfonamide Chemical compound COC1=C(S(=O)(=O)NC2=NC3=CC=CC=C3C=N2)C=CC(=C1)N GMZDJXMSEMUZMK-UHFFFAOYSA-N 0.000 claims description 2
- VANNPISTIUFMLH-UHFFFAOYSA-N glutaric anhydride Chemical compound O=C1CCCC(=O)O1 VANNPISTIUFMLH-UHFFFAOYSA-N 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 229940079593 drug Drugs 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940124599 anti-inflammatory drug Drugs 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical group NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL63103B1 true PL63103B1 (cg-RX-API-DMAC7.html) | 1971-06-30 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0092968B1 (en) | Crystalline benzenesulfonate salts of sultamicillin | |
| IL44061A (en) | 4,5,6,7-tetrahydro-furo(or thieno)(3,2-c)pyridines their preparation and pharmaceutical compositions containing the | |
| US3639477A (en) | Novel propoxyguanidine compounds and means of producing the same | |
| CA1202317A (en) | Acetylsalicylic acid thioesters, a process for their preparation and pharmaceutical compositions containing them | |
| FI73970C (fi) | Foerfarande foer framstaellning av farmaceutiskt aktiva 2-amino-3-(halobensoyl)-metyl-fenylaettiksyra och estrar och salter daerav. | |
| US3139381A (en) | Process of effecting diuresis with nitro disulfamylaniline compounds | |
| PL63103B1 (cg-RX-API-DMAC7.html) | ||
| JP5695797B2 (ja) | 新規抗血小板化合物の付加塩 | |
| US3060206A (en) | 2, 4-disulfamyl-5-alkoxy-aniline | |
| CS195746B2 (en) | Process for preparing crystalline methanolate of natrium salt of cephamandole | |
| US3485834A (en) | Hypoglycemic sulfonamido-s-triazines | |
| US3426017A (en) | Sulfonylurea compounds | |
| US4131683A (en) | ω-(1,3-Dithiolan-2-imino) substituted acetic acids | |
| EP0151451B1 (en) | 4-phenylaminopyridine derivatives, process of the preparation thereof and pharmaceutical compositions containing them | |
| US3821415A (en) | Heterocyclic compounds in pharmaceutical compositions and methods | |
| US4440691A (en) | Indancarboxylic acid zinc salts | |
| US4882328A (en) | Thiazetidine derivatives | |
| US2803627A (en) | Therapeutic quinoline compounds | |
| US4098887A (en) | Pharmaceutical compositions and methods of producing antiarthritic activity with bis(pyridine)gold(1+) salts | |
| HU181728B (en) | Process for preparing 2-amino-3-/alkyl-thio-benzoyl/-phenyl-acetic acid derivatives | |
| KR100742134B1 (ko) | 결정성S-(+)-메틸-2-(2-클로로페닐)-2-(6,7-디히드로티에노[3,2-c]피리딘-5(4H)-일)아세테이트·캄실레이트를 포함하는약학적 조성물 | |
| JPH0128743B2 (cg-RX-API-DMAC7.html) | ||
| RU1383752C (ru) | 4-Хлор-5-нитро-6-метилтиено [2,3-D]пиримидин, обладающий противотуберкулезной активностью | |
| HU203839B (en) | Process for producing pharmaceutical composition containing acrylic acid derivatives | |
| US3428638A (en) | Certain 2-iminobarbituric acids |