PL61263B1 - - Google Patents
Download PDFInfo
- Publication number
- PL61263B1 PL61263B1 PL115018A PL11501866A PL61263B1 PL 61263 B1 PL61263 B1 PL 61263B1 PL 115018 A PL115018 A PL 115018A PL 11501866 A PL11501866 A PL 11501866A PL 61263 B1 PL61263 B1 PL 61263B1
- Authority
- PL
- Poland
- Prior art keywords
- hydrogen
- chlorine
- group
- solution
- methyl
- Prior art date
Links
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 239000000460 chlorine Chemical group 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 229910052801 chlorine Chemical group 0.000 claims description 8
- -1 methoxyl group Chemical group 0.000 claims description 8
- 238000005859 coupling reaction Methods 0.000 claims description 7
- 239000000835 fiber Substances 0.000 claims description 7
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 7
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical group [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 7
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 150000004982 aromatic amines Chemical class 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 206010048245 Yellow skin Diseases 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 150000003254 radicals Chemical group 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 2
- 239000000243 solution Substances 0.000 description 18
- 239000000975 dye Substances 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000012670 alkaline solution Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 235000002639 sodium chloride Nutrition 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 2
- PBGKNXWGYQPUJK-UHFFFAOYSA-N 4-chloro-2-nitroaniline Chemical compound NC1=CC=C(Cl)C=C1[N+]([O-])=O PBGKNXWGYQPUJK-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000010409 ironing Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000013535 sea water Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL61263B1 true PL61263B1 (2) | 1970-08-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2237885A (en) | Stable diazo compounds | |
| GB2149808A (en) | Basic and cationic triazinyl disazo dyes | |
| US1908571A (en) | Azo dyestuffs containing chromium and process of making same | |
| US3900460A (en) | Water-soluble disazo compounds containing a pyrazole component | |
| PL61263B1 (2) | ||
| CH639119A5 (de) | Azopigmente. | |
| US2276187A (en) | Acyl derivatives of azo dyestuffs, and process of preparing same | |
| US5698683A (en) | Mixed aluminium-heavy metal dyestuff complexes and a process for their preparation | |
| US3528961A (en) | Monoazo dyes from e-caprolactam | |
| DE2222099A1 (de) | Basische azofarbstoffe, ihre herstellung und verwendung | |
| US3822247A (en) | Quaternized 1-methyl-2-phenyl-3-indolylazo-guanazolyl-azo-1-methyl-2-phenyl-3-indoles | |
| US4077953A (en) | Tri-dentate metal complex azo pigments | |
| US1565229A (en) | Georg kalischer | |
| US3352846A (en) | Monoazo pyrimidine dyes | |
| US3257378A (en) | Indazolium azo dyestuffs | |
| US2795575A (en) | Azo dyes | |
| US1011770A (en) | Azo dye for wool. | |
| US1959507A (en) | Ortho-hydroxyazo-dyestuffs containing chromium and process of making same | |
| US1216760A (en) | Copper compounds of orthooxyazo dyestuffs and a process of making same. | |
| CH502413A (de) | Verfahren zur Herstellung von wasserlöslichen Azofarbstoffen | |
| US2829139A (en) | Metalliferous azo dyestuff | |
| CA1038376A (en) | Pigment complexes | |
| US3370910A (en) | Process for dyeing polypropylene materials and monoazo dyestuffs therefor | |
| JPH06329934A (ja) | 陽イオン性ジアゾシアニン染料 | |
| US2784178A (en) | Azo-dyestuffs |