PL60742B1 - - Google Patents
Download PDFInfo
- Publication number
- PL60742B1 PL60742B1 PL117752A PL11775266A PL60742B1 PL 60742 B1 PL60742 B1 PL 60742B1 PL 117752 A PL117752 A PL 117752A PL 11775266 A PL11775266 A PL 11775266A PL 60742 B1 PL60742 B1 PL 60742B1
- Authority
- PL
- Poland
- Prior art keywords
- amine
- parts
- so3m
- cyanuric chloride
- symbol
- Prior art date
Links
- 239000002253 acid Substances 0.000 claims description 19
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 claims description 14
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 239000011707 mineral Substances 0.000 claims description 8
- 150000001412 amines Chemical class 0.000 claims description 7
- 230000003287 optical effect Effects 0.000 claims description 7
- 238000009833 condensation Methods 0.000 claims description 6
- 230000005494 condensation Effects 0.000 claims description 6
- 238000005282 brightening Methods 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 239000007900 aqueous suspension Substances 0.000 claims description 2
- 150000004982 aromatic amines Chemical class 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 230000003472 neutralizing effect Effects 0.000 claims description 2
- -1 aliphatic primary Chemical group 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 150000003335 secondary amines Chemical group 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 239000000243 solution Substances 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 235000010755 mineral Nutrition 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 4
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 235000002639 sodium chloride Nutrition 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XJQRCFRVWZHIPN-UHFFFAOYSA-N 3-amino-4-chlorobenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1Cl XJQRCFRVWZHIPN-UHFFFAOYSA-N 0.000 description 1
- VALLWWIZOBWSFP-UHFFFAOYSA-N 5-amino-2-[2-(4-amino-2-sulfophenyl)ethenyl]benzenesulfonic acid;sodium Chemical compound [Na].OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=C(N)C=C1S(O)(=O)=O VALLWWIZOBWSFP-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000001000 anthraquinone dye Substances 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- QYUDDCLXBAJUNA-UHFFFAOYSA-L disodium;2-aminobenzene-1,4-disulfonate Chemical compound [Na+].[Na+].NC1=CC(S([O-])(=O)=O)=CC=C1S([O-])(=O)=O QYUDDCLXBAJUNA-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000001012 protector Effects 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000005619 secondary aliphatic amines Chemical group 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL60742B1 true PL60742B1 (cg-RX-API-DMAC10.html) | 1970-06-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2503611C2 (de) | Sulfogruppen enthaltende Reaktivfarbstoffe | |
| DE2342197C2 (de) | Reaktivfarbstoffe | |
| JPH0220662B2 (cg-RX-API-DMAC10.html) | ||
| US2394306A (en) | Process of producing nitrogenous condensation products | |
| PL60742B1 (cg-RX-API-DMAC10.html) | ||
| US2865908A (en) | Stilbene azo dyes | |
| US3740341A (en) | Manufacture of bis (alkoxyaminotriazinylamino)-stilbene - 2,2' - disulphonic acids | |
| AU622827B2 (en) | N,n'-bis-1,3,5-triazin-6-ylpiperazines, and process for their preparation | |
| US2690455A (en) | Ethylene bis-arylbiguanides and process of preparing same | |
| CA1321999C (en) | Mixtures of sulphur-containing triazine compounds and process for producing same | |
| US2723288A (en) | Fluorescent agents | |
| US2703801A (en) | Fluorescent agents | |
| US2813864A (en) | Chs-coona- | |
| DE2852672A1 (de) | Reaktiv-farbstoffe | |
| CA1215368A (en) | White modification of a bis-triazinyl amino stilbene optical brightener and a process for making the same | |
| US2390091A (en) | Substituted 1,3,5-triazinyl-(6)-aminophenyl-arsenic compounds | |
| JP4412635B2 (ja) | アミノ基置換1,3,5−トリアジン類の製造方法 | |
| US3398143A (en) | Process for the preparation of 4, 4'-bis-(4-amino-6-arylamino-s-triazin-2-ylamino)-2,2'-stilbenedisulfonic acid | |
| US2774761A (en) | Preparation of sulfuric acid half esters of leuco vat dyes | |
| US1536731A (en) | Sulphurized dyes | |
| PL104499B1 (pl) | Sposob wytwarzania barwnikow azowych do wlokien celulozowych | |
| US1840553A (en) | New basic and acid dyes of the rhodamine type | |
| US1822968A (en) | Vat dyestuffs of the benzanthrone series | |
| US1662415A (en) | Dyestuffs and process of making same | |
| US4302582A (en) | Process for the preparation of a condensation product from phenothiazine and p-nitrosophenol |