PL58087B1 - - Google Patents
Download PDFInfo
- Publication number
- PL58087B1 PL58087B1 PL112522A PL11252266A PL58087B1 PL 58087 B1 PL58087 B1 PL 58087B1 PL 112522 A PL112522 A PL 112522A PL 11252266 A PL11252266 A PL 11252266A PL 58087 B1 PL58087 B1 PL 58087B1
- Authority
- PL
- Poland
- Prior art keywords
- nitrothiazolyl
- keto
- tetrahydroimidazole
- nitro
- formula
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 8
- 238000010992 reflux Methods 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 230000007062 hydrolysis Effects 0.000 claims 1
- 238000006460 hydrolysis reaction Methods 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 238000006396 nitration reaction Methods 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- -1 5-nitrothiazolyl Chemical group 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WZELXJBMMZFDDU-UHFFFAOYSA-N Imidazol-2-one Chemical group O=C1N=CC=N1 WZELXJBMMZFDDU-UHFFFAOYSA-N 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical class C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 230000000590 parasiticidal effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL58087B1 true PL58087B1 (enExample) | 1969-06-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO143531B (no) | Fremgangsmaate for fremstilling av acylerte benzoksazolinon-derivater | |
| US3873573A (en) | Phthalide compounds | |
| DE1176660B (de) | Verfahren zur Herstellung von triaryl-substituierten Imidazolinonen-4(5) | |
| PL58087B1 (enExample) | ||
| US2186773A (en) | 2(p-nicotinylaminobenzenesulfon-amide) pyridine and its salts, and process of preparing them | |
| US2370015A (en) | Derivatives of tertiary amino aliphatic acids | |
| US1698894A (en) | Process of preparing isatins | |
| US2025116A (en) | Arylamide and method for its production | |
| US2585910A (en) | Process for preparing diquaternary salts of pyrimidylamino quinolines | |
| US2496364A (en) | 3 - sulfanilamido-benzotriazines-1,2,4 and method for their preparation | |
| US2748120A (en) | 2-amino-6-aryl-5, 6-dihydro-4-hydroxy-pyrimidines | |
| US2088667A (en) | Amino-aroylamino-benzoic acid and process of making it | |
| US1906581A (en) | Anthraquinone derivatives and a process of preparing the same | |
| US2086704A (en) | Compounds of the azabenzanthrone series | |
| US2740785A (en) | 4-hydroxy-5-alkyl-6-arylpyrimidine derivatives | |
| US1997305A (en) | Derivatives of acenaphthene and process of making same | |
| US2439302A (en) | Preparation of benzotetronic acid | |
| US2123710A (en) | Purification of 3, 3'-dichlorobenzidine mineral acid salts | |
| AT162912B (de) | Verfahren zur Herstellung neuer Hydrazinverbindungen und ihrer Derivate | |
| JPS6310942B2 (enExample) | ||
| US2358366A (en) | Heterocyclic substituted aryl sulphonamido compounds and methods of obtaining the same | |
| US1970908A (en) | Substituted 0-benzoyl-benzoic acid | |
| US2735852A (en) | N nxch | |
| US1043682A (en) | Colored condensation products and process of making same. | |
| US2061627A (en) | Manufacture of nitronaphthylamines |