PL53651B1 - - Google Patents
Download PDFInfo
- Publication number
- PL53651B1 PL53651B1 PL107542A PL10754265A PL53651B1 PL 53651 B1 PL53651 B1 PL 53651B1 PL 107542 A PL107542 A PL 107542A PL 10754265 A PL10754265 A PL 10754265A PL 53651 B1 PL53651 B1 PL 53651B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- piperazine
- tetracycline
- dimethyltetracycline
- chlortetracycline
- Prior art date
Links
- 239000004098 Tetracycline Substances 0.000 claims description 8
- 229960002180 tetracycline Drugs 0.000 claims description 8
- 235000019364 tetracycline Nutrition 0.000 claims description 8
- 229930101283 tetracycline Natural products 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 150000003522 tetracyclines Chemical class 0.000 claims description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- 239000004099 Chlortetracycline Substances 0.000 claims description 5
- CYDMQBQPVICBEU-UHFFFAOYSA-N chlorotetracycline Natural products C1=CC(Cl)=C2C(O)(C)C3CC4C(N(C)C)C(O)=C(C(N)=O)C(=O)C4(O)C(O)=C3C(=O)C2=C1O CYDMQBQPVICBEU-UHFFFAOYSA-N 0.000 claims description 5
- 229960004475 chlortetracycline Drugs 0.000 claims description 5
- CYDMQBQPVICBEU-XRNKAMNCSA-N chlortetracycline Chemical compound C1=CC(Cl)=C2[C@](O)(C)[C@H]3C[C@H]4[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O CYDMQBQPVICBEU-XRNKAMNCSA-N 0.000 claims description 5
- 235000019365 chlortetracycline Nutrition 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 150000004885 piperazines Chemical class 0.000 claims description 4
- 125000000565 sulfonamide group Chemical group 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 150000003949 imides Chemical class 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 230000003115 biocidal effect Effects 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 9
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 229960005141 piperazine Drugs 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229940066771 systemic antihistamines piperazine derivative Drugs 0.000 description 2
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical group CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 2
- FEFMTWYKZOVFMX-UHFFFAOYSA-N 4-methyl-N-[[4-[[(4-methylphenyl)sulfonylamino]methyl]piperazin-1-yl]methyl]benzenesulfonamide Chemical compound CC1=CC=C(C=C1)S(=O)(=O)NCN1CCN(CC1)CNS(=O)(=O)C1=CC=C(C)C=C1 FEFMTWYKZOVFMX-UHFFFAOYSA-N 0.000 description 1
- 239000012296 anti-solvent Substances 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- XMEVHPAGJVLHIG-FMZCEJRJSA-N chembl454950 Chemical compound [Cl-].C1=CC=C2[C@](O)(C)[C@H]3C[C@H]4[C@H]([NH+](C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O XMEVHPAGJVLHIG-FMZCEJRJSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229960003506 piperazine hexahydrate Drugs 0.000 description 1
- AVRVZRUEXIEGMP-UHFFFAOYSA-N piperazine;hexahydrate Chemical compound O.O.O.O.O.O.C1CNCCN1 AVRVZRUEXIEGMP-UHFFFAOYSA-N 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229960004989 tetracycline hydrochloride Drugs 0.000 description 1
- -1 tetracycline piperazine derivatives Chemical class 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL53651B1 true PL53651B1 (enExample) | 1967-06-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Birtwell | 356. 2-Cyanoamino-4: 6-dimethylpyrimidine and complexes formed by pyrimidines with urea and related compounds | |
| PL53651B1 (enExample) | ||
| US2302749A (en) | Dithiocarbamates | |
| US2278499A (en) | Amine salts | |
| EP0179408B1 (de) | Neue Amidoalkylmelamine und Aminoalkylmelamine und Verfahren zu ihrer Herstellung | |
| US2245539A (en) | Sulphanilamide phosphoric acid derivative and process for the manufacture thereof | |
| US3474135A (en) | N-(omega-aminoalkylene)-aminoalkyl sulfonic acids | |
| SU486507A3 (ru) | Способ получени бензолсульфонилмочевины | |
| US2265212A (en) | Thioformamide compounds | |
| US2524802A (en) | Hydroxybenzenesulfonamidopyridazines and preparation of same | |
| US2538557A (en) | Sulfanilamidopyrimidine-formaldehyde condensation products | |
| US2225618A (en) | Amine salts of nitro-phenols | |
| US2740785A (en) | 4-hydroxy-5-alkyl-6-arylpyrimidine derivatives | |
| Baker et al. | 615. Characterisation of primary aliphatic amines by reaction with o-acetoacetylphenol and by paper chromatography | |
| US3088947A (en) | Benzoylcarbinol-aminoacetates | |
| USRE23701E (en) | Substituted piperazines and method | |
| GB1037774A (en) | Process for the production of quinacridine diones | |
| DE1695117B2 (de) | Verfahren zur herstellung von chloramino-s-triazinen | |
| US2833781A (en) | Isothiourea-alkylsulfonates | |
| US2481715A (en) | Theophylline-ethylenediamine compound and method of preparing same | |
| US2892866A (en) | Improvement in the method for the manufacture of nitrobenzene-sulfonate | |
| US3406171A (en) | N-tertiaryamino-n'-[alkyl, allyl or tertiary amino] dithiocarbamoyl monosulphides | |
| AT254200B (de) | Verfahren zur Herstellung von disubstituierten Piperazinverbindungen | |
| US2510981A (en) | Cyanomelamesfes and the preparation | |
| AT235839B (de) | Verfahren zur Herstellung von Chinazolon-(4)-Derivaten |