PL52621B1 - - Google Patents
Download PDFInfo
- Publication number
- PL52621B1 PL52621B1 PL105516A PL10551664A PL52621B1 PL 52621 B1 PL52621 B1 PL 52621B1 PL 105516 A PL105516 A PL 105516A PL 10551664 A PL10551664 A PL 10551664A PL 52621 B1 PL52621 B1 PL 52621B1
- Authority
- PL
- Poland
- Prior art keywords
- zinebe
- sulfur
- weight
- elemental sulfur
- zinc
- Prior art date
Links
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 36
- 239000011593 sulfur Substances 0.000 claims description 16
- 229910052717 sulfur Inorganic materials 0.000 claims description 16
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- 239000011575 calcium Substances 0.000 claims description 13
- 229910052791 calcium Inorganic materials 0.000 claims description 12
- 230000000855 fungicidal effect Effects 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 239000000417 fungicide Substances 0.000 claims description 7
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 6
- 229910052725 zinc Inorganic materials 0.000 claims description 6
- 239000011701 zinc Substances 0.000 claims description 6
- 159000000009 barium salts Chemical class 0.000 claims description 5
- 238000002474 experimental method Methods 0.000 claims description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 3
- TXSULMYZLWFIAT-UHFFFAOYSA-N carbamodithioic acid;ethene Chemical class C=C.NC(S)=S TXSULMYZLWFIAT-UHFFFAOYSA-N 0.000 claims description 3
- 239000004615 ingredient Substances 0.000 claims description 3
- 239000011777 magnesium Substances 0.000 claims description 3
- 229910052749 magnesium Inorganic materials 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 230000003179 granulation Effects 0.000 claims description 2
- 238000005469 granulation Methods 0.000 claims description 2
- 239000002253 acid Substances 0.000 description 8
- 241000196324 Embryophyta Species 0.000 description 5
- 229910052788 barium Inorganic materials 0.000 description 5
- AGVJBLHVMNHENQ-UHFFFAOYSA-N Calcium sulfide Chemical compound [S-2].[Ca+2] AGVJBLHVMNHENQ-UHFFFAOYSA-N 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- AARJUIWTWZTQBC-UHFFFAOYSA-L dithiocarboxyazanide ethene manganese(2+) Chemical compound C=C.SC(=S)N[Mn]NC(S)=S AARJUIWTWZTQBC-UHFFFAOYSA-L 0.000 description 3
- 241000233866 Fungi Species 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- -1 Manganese ethylene dithiocarbamate Ethylene dithiocarbamate Manganese ethylene dithiocarbamate Chemical compound 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- YPIRBHXLQNSUAB-UHFFFAOYSA-L [Zn+2].C=C.NC([S-])=S.NC([S-])=S Chemical compound [Zn+2].C=C.NC([S-])=S.NC([S-])=S YPIRBHXLQNSUAB-UHFFFAOYSA-L 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 239000002420 orchard Substances 0.000 description 2
- 150000004763 sulfides Chemical class 0.000 description 2
- 150000003751 zinc Chemical class 0.000 description 2
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 240000007087 Apium graveolens Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 244000141359 Malus pumila Species 0.000 description 1
- 241000208134 Nicotiana rustica Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241001597359 Septoria apiicola Species 0.000 description 1
- NINIDFKCEFEMDL-AKLPVKDBSA-N Sulfur-35 Chemical compound [35S] NINIDFKCEFEMDL-AKLPVKDBSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 235000021016 apples Nutrition 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical class [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- CJDPJFRMHVXWPT-UHFFFAOYSA-N barium sulfide Chemical compound [S-2].[Ba+2] CJDPJFRMHVXWPT-UHFFFAOYSA-N 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- 238000005188 flotation Methods 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- SJLOMQIUPFZJAN-UHFFFAOYSA-N oxorhodium Chemical class [Rh]=O SJLOMQIUPFZJAN-UHFFFAOYSA-N 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229910003450 rhodium oxide Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 229940052367 sulfur,colloidal Drugs 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL52621B1 true PL52621B1 (OSRAM) | 1966-12-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69005855T2 (de) | Biozide Zusammensetzungen und Behandlungen. | |
| DE2456627C2 (de) | Fungizide Mittel auf der Basis von Phosphonsäureestern | |
| US4806445A (en) | Fungicidal compositions based on alkyl phosphites | |
| EP0280348B1 (en) | Fungicidal compositions | |
| DE2453401A1 (de) | Fungizide zusammensetzungen auf der basis phosphoriger saeure oder ihrer salze | |
| DE60021176T2 (de) | Phosphonat und thiosulfat enthaltendes düngemittel | |
| US3873700A (en) | Fungicidal compositions and method for protecting plants by the use thereof | |
| US5169646A (en) | Fungicidal compositions based on alkyl phosphites | |
| US3034949A (en) | Fungicidal composition comprising chlorophenol mercury sulfate and tetramethlthiuram isulfide | |
| PL52621B1 (OSRAM) | ||
| US2844506A (en) | Fungicidal compositions | |
| US2967101A (en) | Defoliant compositions | |
| DE2617743C2 (de) | Fungicide Mittel auf der Basis von Hypophosphiten und ihre Verwendung als Pflanzenschutzmittel | |
| US2774706A (en) | Fungicidal composition comprising shydrocarbyl isothiourea salts and method of applying the same | |
| US2594135A (en) | Inducing growth of dormant woody plants | |
| DE1025203B (de) | Bekaempfung von Pflanzenparasiten | |
| PL146597B1 (en) | Pesticide of acaricidal,insecticidal and fungicidal properties | |
| DE3606294A1 (de) | Mittel und verfahren zur bekaempfung von erregern von pilzkrankheiten bei kulturpflanzen | |
| US3065124A (en) | Bisdithiocarbamate hypochlorite reaction products for agricultural use | |
| US3784366A (en) | Method for promoting formation of fruit abscising layer | |
| US3520673A (en) | Plant desiccating and defoliating compositions | |
| RU2804372C2 (ru) | Устойчивое экологически безвредное удобрение, предназначенное для борьбы с физиологическими нарушениями плодов и с вредителями | |
| DE956639C (de) | Fungicides Gemisch | |
| US4503042A (en) | Acaricide compositions | |
| US3295948A (en) | Desiccation of plants with acetylenedicarboxylic acid compounds |