PL51124B1 - - Google Patents
Download PDFInfo
- Publication number
- PL51124B1 PL51124B1 PL104001A PL10400164A PL51124B1 PL 51124 B1 PL51124 B1 PL 51124B1 PL 104001 A PL104001 A PL 104001A PL 10400164 A PL10400164 A PL 10400164A PL 51124 B1 PL51124 B1 PL 51124B1
- Authority
- PL
- Poland
- Prior art keywords
- environment
- isopropylaminoantipyrine
- zinc
- hydrogen
- free
- Prior art date
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 14
- 229950000385 ramifenazone Drugs 0.000 claims description 13
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 10
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 8
- 239000011701 zinc Substances 0.000 claims description 8
- 229910052725 zinc Inorganic materials 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 7
- 229910000497 Amalgam Inorganic materials 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 6
- 235000005074 zinc chloride Nutrition 0.000 claims description 5
- 239000011592 zinc chloride Substances 0.000 claims description 5
- UZSCVCWALGRUTR-UHFFFAOYSA-N 4-amino-1,5-dimethyl-2-phenylpyrazol-3-one;hydron;chloride Chemical compound Cl.CN1C(C)=C(N)C(=O)N1C1=CC=CC=C1 UZSCVCWALGRUTR-UHFFFAOYSA-N 0.000 claims description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 2
- 229910021529 ammonia Inorganic materials 0.000 claims description 2
- 238000002425 crystallisation Methods 0.000 claims description 2
- 230000008025 crystallization Effects 0.000 claims description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 2
- 229910000043 hydrogen iodide Inorganic materials 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 150000003457 sulfones Chemical group 0.000 claims description 2
- 150000003751 zinc Chemical class 0.000 claims description 2
- 238000000605 extraction Methods 0.000 claims 1
- 229910000039 hydrogen halide Inorganic materials 0.000 claims 1
- 239000012433 hydrogen halide Substances 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- RLFWWDJHLFCNIJ-UHFFFAOYSA-N 4-aminoantipyrine Chemical compound CN1C(C)=C(N)C(=O)N1C1=CC=CC=C1 RLFWWDJHLFCNIJ-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 239000000203 mixture Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- IEODZSWSXNQPQL-UHFFFAOYSA-N 1,5-dimethyl-4-nitroso-2-phenylpyrazol-3-one Chemical compound CN1C(C)=C(N=O)C(=O)N1C1=CC=CC=C1 IEODZSWSXNQPQL-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- RMMXTBMQSGEXHJ-UHFFFAOYSA-N Aminophenazone Chemical compound O=C1C(N(C)C)=C(C)N(C)N1C1=CC=CC=C1 RMMXTBMQSGEXHJ-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XOZLRRYPUKAKMU-UHFFFAOYSA-N 1,5-dimethyl-2-phenyl-4-(propan-2-ylamino)-3-pyrazolone Chemical compound O=C1C(NC(C)C)=C(C)N(C)N1C1=CC=CC=C1 XOZLRRYPUKAKMU-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19651620104 DE1620104A1 (de) | 1964-03-12 | 1965-03-12 | Verfahren zur Darstellung von 1-Phenyl-2,3-dimethyl-4-isopropylamino-5-pyrazolon sowie dessen Halogenwasserstoffsaeure-Verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL51124B1 true PL51124B1 (esLanguage) | 1966-02-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS60209577A (ja) | ベンゾチオフェン誘導体 | |
| Raap et al. | Tetrazolylacetic acids | |
| SU507233A3 (ru) | Способ получени производных изоиндолина или их солей | |
| PL51124B1 (esLanguage) | ||
| US3946012A (en) | 6-L-dihydroxyethyl-2,4,7-trioxo-8-D-ribityl pteridine and process for producing the same | |
| US2772280A (en) | Synthesis of 4-amino-3-isoxazolidone and its derivatives | |
| US3947448A (en) | Salts of novel p-dihydroxybenezene disulfonic acids | |
| US4038390A (en) | Salts of p-dihydroxybenzene disulfonic acids for combatting hemorrhages and fragility of the capillaries | |
| US2793212A (en) | Substituted benzamidopiperidinopropanes | |
| US3149153A (en) | 3'-substituted-3, 5-diiodothyronine and salts thereof | |
| US3084171A (en) | 5-nitro-2-furylamidine and alkyl 5-nitro-2-furylimidate | |
| US2325053A (en) | Mcmss | |
| Sundholm et al. | The Reaction of 2, 3-Dichloro-1, 4-naphthoquinone with Salts of Alkyl Substituted and Unsubstituted Dithiocarbamic Acids | |
| DAVIS Jr | Studies with Quinolines. II. The Acid-Catalyzed Hydrolysis of Reissert Compounds | |
| RICHTER | 5-Amino-6-nitroacenaphthene | |
| CN114634422B (zh) | 一种二硝托胺的制备方法 | |
| US3109022A (en) | Nu-aryl anthranilic acids | |
| US2970152A (en) | Anilinobenzoquinone derivatives | |
| US2559546A (en) | 3-pyridoxy-alkanoic acid compounds | |
| US4643996A (en) | 5-phenyl-2-furoic acid hydrazides | |
| RICHTER et al. | Acenaphthene Chemistry. V. 1 1, 2-Diketopyracene2 | |
| Frankel et al. | Preparation of aliphatic secondary nitramines | |
| US2697095A (en) | Penicillin salts of glycine-diphenylamides | |
| US2780625A (en) | Piperazine derivatives and method of preparing the same | |
| Hammick et al. | 190. A new synthesis of 1-amino-4-methylthioxanthone and of miracil D |