PL50990B1 - - Google Patents
Download PDFInfo
- Publication number
- PL50990B1 PL50990B1 PL102516A PL10251663A PL50990B1 PL 50990 B1 PL50990 B1 PL 50990B1 PL 102516 A PL102516 A PL 102516A PL 10251663 A PL10251663 A PL 10251663A PL 50990 B1 PL50990 B1 PL 50990B1
- Authority
- PL
- Poland
- Prior art keywords
- salts
- sodium
- caking
- weight
- potassium nitrate
- Prior art date
Links
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 claims description 16
- 235000010333 potassium nitrate Nutrition 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 235000010344 sodium nitrate Nutrition 0.000 claims description 10
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Inorganic materials [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 claims description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 7
- -1 amine salts Chemical class 0.000 claims description 7
- 239000004323 potassium nitrate Substances 0.000 claims description 7
- 239000004317 sodium nitrate Substances 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 2
- 239000007864 aqueous solution Substances 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 238000001035 drying Methods 0.000 claims 1
- 238000000034 method Methods 0.000 claims 1
- 150000002823 nitrates Chemical class 0.000 claims 1
- 239000012266 salt solution Substances 0.000 claims 1
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000003749 cleanliness Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- TWFQJFPTTMIETC-UHFFFAOYSA-N dodecan-1-amine;hydron;chloride Chemical compound [Cl-].CCCCCCCCCCCC[NH3+] TWFQJFPTTMIETC-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL50990B1 true PL50990B1 (Direct) | 1966-02-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2917428A (en) | Bactericidal composition comprising tetra alkyl quaternary ammonium halide and hydrogen peroxide | |
| US2474412A (en) | Soapless-germicidally active detergent | |
| PL50990B1 (Direct) | ||
| CZ20013536A3 (cs) | Nespékavá směs solí | |
| GB1328509A (en) | Inhibition of corrosion | |
| US2734002A (en) | Resin-coated potassium salts and method | |
| GB1357740A (en) | Aerosol spray laundry conpositions | |
| JPS58208133A (ja) | 安定化シアナミド水溶液 | |
| US3497314A (en) | Recovery of potassium from sea water | |
| US1482479A (en) | Manufacture of a nonhygroscopic fertilizer | |
| KR102546603B1 (ko) | 밀폐된 용기에 보관중인 질산암모늄 입자의 케이킹 방지 특성 개선 | |
| US3081325A (en) | Trialkyllead thioglycolamides | |
| US3330775A (en) | Solubilization process | |
| Ross et al. | Preparation of ammonium nitrate for fertilizer use | |
| PL184263B1 (pl) | Sposób wytwarzania soli 2,2-ditlenku 3-izopropylo-2,1,3-benzotiadiazynonu-4 | |
| US2219287A (en) | Insecticide and process of making the same | |
| JPS605558B2 (ja) | カリ塩の固結防止剤 | |
| US2176894A (en) | Mothproofing | |
| US3709674A (en) | Method and composition for suppressing the nitrification of ammonium nitrogen in soil | |
| US2780653A (en) | Stabilization of mustard | |
| US1968737A (en) | Process for the separation of magnesium chloride from calcium chloride | |
| GB1220747A (en) | Ampicillin | |
| US2081401A (en) | Preparation of fertilizer | |
| GB1086483A (en) | Phosphates | |
| NO140149B (no) | Leddvarmelegeme i kunststoff. |