PL49003B1 - - Google Patents
Download PDFInfo
- Publication number
- PL49003B1 PL49003B1 PL98521A PL9852162A PL49003B1 PL 49003 B1 PL49003 B1 PL 49003B1 PL 98521 A PL98521 A PL 98521A PL 9852162 A PL9852162 A PL 9852162A PL 49003 B1 PL49003 B1 PL 49003B1
- Authority
- PL
- Poland
- Prior art keywords
- alkyl
- alkenyl
- formula
- cooling
- solution
- Prior art date
Links
- 239000000243 solution Substances 0.000 claims description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 12
- 238000001816 cooling Methods 0.000 claims description 8
- -1 alkenyl dicyanoguanidine Chemical compound 0.000 claims description 6
- 230000001476 alcoholic effect Effects 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000000047 product Substances 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- SJXIVKQAVJISKW-UHFFFAOYSA-N chloro cyanate Chemical compound ClOC#N SJXIVKQAVJISKW-UHFFFAOYSA-N 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 239000002244 precipitate Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000005466 alkylenyl group Chemical group 0.000 claims 1
- 239000007864 aqueous solution Substances 0.000 claims 1
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 239000013078 crystal Substances 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 4
- JMANVNJQNLATNU-UHFFFAOYSA-N oxalonitrile Chemical compound N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- FVFVNNKYKYZTJU-UHFFFAOYSA-N 6-chloro-1,3,5-triazine-2,4-diamine Chemical compound NC1=NC(N)=NC(Cl)=N1 FVFVNNKYKYZTJU-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ROLHQCWTEFKSMZ-UHFFFAOYSA-N 2-n-butyl-6-chloro-1,3,5-triazine-2,4-diamine Chemical compound CCCCNC1=NC(N)=NC(Cl)=N1 ROLHQCWTEFKSMZ-UHFFFAOYSA-N 0.000 description 1
- CPJAMPPDPAMSNN-UHFFFAOYSA-N 6-chloro-2-n-methyl-1,3,5-triazine-2,4-diamine Chemical compound CNC1=NC(N)=NC(Cl)=N1 CPJAMPPDPAMSNN-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000002152 aqueous-organic solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- IVENSCMCQBJAKW-UHFFFAOYSA-N deisopropylatrazine Chemical compound CCNC1=NC(N)=NC(Cl)=N1 IVENSCMCQBJAKW-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL49003B1 true PL49003B1 (enExample) | 1964-12-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2955111A (en) | Synthesis of n-alkyl-piperidine and n-alkyl-pyrrolidine-alpha-carboxylic acid amides | |
| US2567651A (en) | J-dialkyl-g-amino-l | |
| SU433681A3 (ru) | Способ получения 1,2.4^триазин-5-онов | |
| DE69709252T2 (de) | Coumarin-Derivate, Verfahren zu deren Herstellung und deren Verwendung | |
| US2785176A (en) | Ethylene urea derivatives and process of production | |
| PL49003B1 (enExample) | ||
| PL94114B1 (enExample) | ||
| JPS59199681A (ja) | １，２，４−トリアゾ−ル−３−カルボン酸アミド類の製造法 | |
| US3328395A (en) | 6-halo-2-amino substituted-4-sulfanilamido-pyrimidine compounds | |
| US3759976A (en) | Nitrile compounds | |
| US2829157A (en) | Novel hydantoic acids and their alkyl esters | |
| US2945061A (en) | Process for the production of biguanide derivatives containing active chlorine | |
| US2806036A (en) | Process for preparation of | |
| US2407203A (en) | Alpha-amino-gamma-alkoxybutyric acids and method of preparing the same | |
| US4022830A (en) | Process for preparing polychlorobenzamide derivatives | |
| US2525927A (en) | 2-nitramino delta 2-1, 3 diazacycloalkenes | |
| PL97091B1 (pl) | Sposob wytwarzania nowych podstawionych n-/2-pirolidynyloalkilo/benzamidow | |
| US2740785A (en) | 4-hydroxy-5-alkyl-6-arylpyrimidine derivatives | |
| US2559546A (en) | 3-pyridoxy-alkanoic acid compounds | |
| US3655664A (en) | 2-aryl-4(3h)-quinazolinones | |
| US2534332A (en) | 2-oxoimidazolines and process for preparing the same | |
| SU471713A3 (ru) | Способ получени -/аминофенил/алифатических производных карбоновых кислот или их солей,или их -окисей | |
| US2377485A (en) | Process for the production of sulphonylguanidines | |
| US2548231A (en) | Preparation of acylcarbamyl-guanidines | |
| US2817682A (en) | Carboxy-amino compounds |