PL46250B1 - - Google Patents
Download PDFInfo
- Publication number
- PL46250B1 PL46250B1 PL46250A PL4625061A PL46250B1 PL 46250 B1 PL46250 B1 PL 46250B1 PL 46250 A PL46250 A PL 46250A PL 4625061 A PL4625061 A PL 4625061A PL 46250 B1 PL46250 B1 PL 46250B1
- Authority
- PL
- Poland
- Prior art keywords
- nitrate
- calcium
- ammonium
- stefan
- superphosphate
- Prior art date
Links
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 claims description 7
- 239000003337 fertilizer Substances 0.000 claims description 7
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical compound [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 claims description 4
- 239000002426 superphosphate Substances 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- 229910002651 NO3 Inorganic materials 0.000 claims description 3
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910000882 Ca alloy Inorganic materials 0.000 claims 1
- NGLMYMJASOJOJY-UHFFFAOYSA-O azanium;calcium;nitrate Chemical compound [NH4+].[Ca].[O-][N+]([O-])=O NGLMYMJASOJOJY-UHFFFAOYSA-O 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL46250B1 true PL46250B1 (cg-RX-API-DMAC7.html) | 1962-10-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ194273A (en) | Non caking granular mineral fertilisers containing an ammonium salt and dicyandiamide | |
| PL46250B1 (cg-RX-API-DMAC7.html) | ||
| US3096170A (en) | Novel slurry fertilizer | |
| US3116108A (en) | Process for the granulation of ammonium nitrate | |
| GB1142288A (en) | Process for the mixing of solid compounds with a melt or a suspension in the production of npk-fertilizer prills | |
| GB976713A (en) | Improvements in or relating to stable urea-formaldehyde suspensions | |
| ATE71073T1 (de) | Komplexes npk-duengemittel mit verringerter neigung zum schwellen und zusammenbacken. | |
| GB1221791A (en) | Fertilizer compositions | |
| SU632675A1 (ru) | Способ уменьшени слеживаемости калийных удобрений | |
| GB886951A (en) | Phosphate fertilizer composition and the method of manufacture thereof | |
| GB1359884A (en) | Fertilizer | |
| US3299133A (en) | Process for the improvement of the storage properties of urea | |
| SU304824A1 (ru) | Б П Т В \ФШЩ SuOE?IOO j | |
| US3525602A (en) | Process for producing salt suspension fertilizers | |
| GB822969A (en) | Fertilizer compositions | |
| US2132155A (en) | Method of manufacturing a product containing calcium nitrate and ammonium nitrate | |
| SU1263689A1 (ru) | Состав дл модифицировани гранулированного хлористого кали | |
| SU582238A1 (ru) | Способ получени неслеживающихс калийных удобрений спродленным сроком действи | |
| SU431145A1 (ru) | Способ стабилизации гранул аммиачнойселитры | |
| GB791647A (en) | Improved process for producing mixed ammonium nitrate fertilizers | |
| SU912644A1 (ru) | Способ уменьшени слеживаемости хлористого кали | |
| SU1071616A1 (ru) | Способ получени удобрени с бором | |
| RU2002106256A (ru) | Торфяная питательная смесь | |
| GB828675A (en) | Process for making mixed fertilizers containing ammonium nitrate and calcium carbonate | |
| JO1243B1 (en) | A process for producing compound fertilizer in the form of granules |